diff --git a/.gitignore b/.gitignore index 52ba16c..9e2ca2d 100644 --- a/.gitignore +++ b/.gitignore @@ -1,2 +1,164 @@ -bin -config.yml \ No newline at end of file +#### joe made this: http://goel.io/joe + +#####=== Node ===##### + +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* + +# Runtime data +pids +*.pid +*.seed +*.pid.lock + +# Directory for instrumented libs generated by jscoverage/JSCover +lib-cov + +# Coverage directory used by tools like istanbul +coverage + +# nyc test coverage +.nyc_output + +# Grunt intermediate storage (https://gruntjs.com/creating-plugins#storing-task-files) +.grunt + +# Bower dependency directory (https://bower.io/) +bower_components + +# node-waf configuration +.lock-wscript + +# Compiled binary addons (https://nodejs.org/api/addons.html) +build/Release + +# Dependency directories +node_modules/ +jspm_packages/ + +# TypeScript v1 declaration files +typings/ + +# Optional npm cache directory +.npm + +# Optional eslint cache +.eslintcache + +# Optional REPL history +.node_repl_history + +# Output of 'npm pack' +*.tgz + +# Yarn Integrity file +.yarn-integrity + +# dotenv environment variables file +.env + +# parcel-bundler cache (https://parceljs.org/) +.cache + +# next.js build output +.next + +# nuxt.js build output +.nuxt + +# vuepress build output +.vuepress/dist + +# Serverless directories +.serverless + +#####=== Go ===##### + +# Binaries for programs and plugins +*.exe +*.exe~ +*.dll +*.so +*.dylib + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +#####=== macOS ===##### +# General +.DS_Store +.AppleDouble +.LSOverride + +# Icon must end with two \r +Icon + + +# Thumbnails +._* + +# Files that might appear in the root of a volume +.DocumentRevisions-V100 +.fseventsd +.Spotlight-V100 +.TemporaryItems +.Trashes +.VolumeIcon.icns +.com.apple.timemachine.donotpresent + +# Directories potentially created on remote AFP share +.AppleDB +.AppleDesktop +Network Trash Folder +Temporary Items +.apdisk + +#####=== Windows ===##### +# Windows thumbnail cache files +Thumbs.db +ehthumbs.db +ehthumbs_vista.db + +# Dump file +*.stackdump + +# Folder config file +[Dd]esktop.ini + +# Recycle Bin used on file shares +$RECYCLE.BIN/ + +# Windows Installer files +*.cab +*.msi +*.msix +*.msm +*.msp + +# Windows shortcuts +*.lnk + +#####=== Linux ===##### +*~ + +# temporary files which can be created if a process still has a handle open of a deleted file +.fuse_hidden* + +# KDE directory preferences +.directory + +# Linux trash folder which might appear on any partition or disk +.Trash-* + +# .nfs files are created when an open file is removed but is still being accessed +.nfs* + +#####=== Custom ===##### +config.yml diff --git a/frontend/.dockerignore b/frontend/.dockerignore new file mode 100644 index 0000000..2fac00f --- /dev/null +++ b/frontend/.dockerignore @@ -0,0 +1,6 @@ +.git +node_modules +packages/*/node_modules +packages/*/dist +plugins/*/node_modules +plugins/*/dist diff --git a/frontend/.editorconfig b/frontend/.editorconfig new file mode 100644 index 0000000..c69a5cb --- /dev/null +++ b/frontend/.editorconfig @@ -0,0 +1,31 @@ +# EditorConfig is awesome: https://EditorConfig.org + +# top-most EditorConfig file +root = true + +# Unix-style newlines with a newline ending every file +[*] +end_of_line = lf +insert_final_newline = true +charset = utf-8 +indent_style = space + +[*.html] +indent_style = space +indent_size = 2 + +[*.{ts,json,js,tsx,jsx}] +indent_style = space +indent_size = 2 + +[*.md] +indent_size = 2 +indent_style = space + +[Dockerfile] +indent_style = space +indent_size = 2 + +[*.{yml,yaml}] +indent_size = 2 +indent_style = space diff --git a/frontend/.eslintignore b/frontend/.eslintignore new file mode 100644 index 0000000..dcf1135 --- /dev/null +++ b/frontend/.eslintignore @@ -0,0 +1,7 @@ +**/node_modules/** +**/dist/** +**/storybook-static/** +**/coverage/** +**/build/** +**/.git/** +**/public/** diff --git a/frontend/.eslintrc.js b/frontend/.eslintrc.js new file mode 100644 index 0000000..3681612 --- /dev/null +++ b/frontend/.eslintrc.js @@ -0,0 +1,4 @@ +module.exports = { + root: true, + extends: ['@spotify/eslint-config-oss'], +}; diff --git a/frontend/.gitignore b/frontend/.gitignore new file mode 100644 index 0000000..f5794ba --- /dev/null +++ b/frontend/.gitignore @@ -0,0 +1,118 @@ +.idea/ +.DS_Store +.vscode/ +.vsls.json + +# @spotify/web-script build output +cjs/ +esm/ +types/ +build/ + +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* +lerna-debug.log* + +# Diagnostic reports (https://nodejs.org/api/report.html) +report.[0-9]*.[0-9]*.[0-9]*.[0-9]*.json + +# Runtime data +pids +*.pid +*.seed +*.pid.lock + +# Directory for instrumented libs generated by jscoverage/JSCover +lib-cov + +# Coverage directory used by tools like istanbul +coverage +*.lcov + +# nyc test coverage +.nyc_output + +# Grunt intermediate storage (https://gruntjs.com/creating-plugins#storing-task-files) +.grunt + +# Bower dependency directory (https://bower.io/) +bower_components + +# node-waf configuration +.lock-wscript + +# Compiled binary addons (https://nodejs.org/api/addons.html) +build/Release + +# Dependency directories +node_modules/ +jspm_packages/ + +# TypeScript v1 declaration files +typings/ + +# TypeScript cache +*.tsbuildinfo + +# Optional npm cache directory +.npm + +# Optional eslint cache +.eslintcache + +# Microbundle cache +.rpt2_cache/ +.rts2_cache_cjs/ +.rts2_cache_es/ +.rts2_cache_umd/ + +# Optional REPL history +.node_repl_history + +# Output of 'npm pack' +*.tgz + +# Yarn Integrity file +.yarn-integrity + +# dotenv environment variables file +.env +.env.test + +# parcel-bundler cache (https://parceljs.org/) +.cache + +# Next.js build output +.next + +# Nuxt.js build / generate output +.nuxt +dist + +# Gatsby files +.cache/ +# Comment in the public line in if your project uses Gatsby and not Next.js +# https://nextjs.org/blog/next-9-1#public-directory-support +# public + +# vuepress build output +.vuepress/dist + +# Serverless directories +.serverless/ + +# FuseBox cache +.fusebox/ + +# DynamoDB Local files +.dynamodb/ + +# TernJS port file +.tern-port + +# Stores VSCode versions used for testing VSCode extensions +.vscode-test diff --git a/frontend/.npmrc b/frontend/.npmrc new file mode 100644 index 0000000..c3c6634 --- /dev/null +++ b/frontend/.npmrc @@ -0,0 +1,2 @@ +registry=https://registry.npmjs.org/ +engine-strict=true diff --git a/frontend/.yarn/releases/yarn-1.22.1.js b/frontend/.yarn/releases/yarn-1.22.1.js new file mode 100755 index 0000000..995e38e --- /dev/null +++ b/frontend/.yarn/releases/yarn-1.22.1.js @@ -0,0 +1,200078 @@ +#!/usr/bin/env node +module.exports = /******/ (function(modules) { + // webpackBootstrap + /******/ // The module cache + /******/ var installedModules = {}; // The require function + /******/ + /******/ /******/ function __webpack_require__(moduleId) { + /******/ + /******/ // Check if module is in cache + /******/ if (installedModules[moduleId]) { + /******/ return installedModules[moduleId].exports; + /******/ + } // Create a new module (and put it into the cache) + /******/ /******/ var module = (installedModules[moduleId] = { + /******/ i: moduleId, + /******/ l: false, + /******/ exports: {}, + /******/ + }); // Execute the module function + /******/ + /******/ /******/ modules[moduleId].call( + module.exports, + module, + module.exports, + __webpack_require__, + ); // Flag the module as loaded + /******/ + /******/ /******/ module.l = true; // Return the exports of the module + /******/ + /******/ /******/ return module.exports; + /******/ + } // expose the modules object (__webpack_modules__) + /******/ + /******/ + /******/ /******/ __webpack_require__.m = modules; // expose the module cache + /******/ + /******/ /******/ __webpack_require__.c = installedModules; // identity function for calling harmony imports with the correct context + /******/ + /******/ /******/ __webpack_require__.i = function(value) { + return value; + }; // define getter function for harmony exports + /******/ + /******/ /******/ __webpack_require__.d = function(exports, name, getter) { + /******/ if (!__webpack_require__.o(exports, name)) { + /******/ Object.defineProperty(exports, name, { + /******/ configurable: false, + /******/ enumerable: true, + /******/ get: getter, + /******/ + }); + /******/ + } + /******/ + }; // getDefaultExport function for compatibility with non-harmony modules + /******/ + /******/ /******/ __webpack_require__.n = function(module) { + /******/ var getter = + module && module.__esModule + ? /******/ function getDefault() { + return module['default']; + } + : /******/ function getModuleExports() { + return module; + }; + /******/ __webpack_require__.d(getter, 'a', getter); + /******/ return getter; + /******/ + }; // Object.prototype.hasOwnProperty.call + /******/ + /******/ /******/ __webpack_require__.o = function(object, property) { + return Object.prototype.hasOwnProperty.call(object, property); + }; // __webpack_public_path__ + /******/ + /******/ /******/ __webpack_require__.p = ''; // Load entry module and return exports + /******/ + /******/ /******/ return __webpack_require__((__webpack_require__.s = 549)); + /******/ +})( + /************************************************************************/ + /******/ [ + /* 0 */ + /***/ function(module, exports) { + module.exports = require('path'); + + /***/ + }, + /* 1 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (immutable) */ __webpack_exports__['a'] = __extends; + /* unused harmony export __assign */ + /* unused harmony export __rest */ + /* unused harmony export __decorate */ + /* unused harmony export __param */ + /* unused harmony export __metadata */ + /* unused harmony export __awaiter */ + /* unused harmony export __generator */ + /* unused harmony export __exportStar */ + /* unused harmony export __values */ + /* unused harmony export __read */ + /* unused harmony export __spread */ + /* unused harmony export __await */ + /* unused harmony export __asyncGenerator */ + /* unused harmony export __asyncDelegator */ + /* unused harmony export __asyncValues */ + /* unused harmony export __makeTemplateObject */ + /* unused harmony export __importStar */ + /* unused harmony export __importDefault */ + /*! ***************************************************************************** +Copyright (c) Microsoft Corporation. All rights reserved. +Licensed under the Apache License, Version 2.0 (the "License"); you may not use +this file except in compliance with the License. You may obtain a copy of the +License at http://www.apache.org/licenses/LICENSE-2.0 + +THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED +WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE, +MERCHANTABLITY OR NON-INFRINGEMENT. + +See the Apache Version 2.0 License for specific language governing permissions +and limitations under the License. +***************************************************************************** */ + /* global Reflect, Promise */ + + var extendStatics = function(d, b) { + extendStatics = + Object.setPrototypeOf || + ({ __proto__: [] } instanceof Array && + function(d, b) { + d.__proto__ = b; + }) || + function(d, b) { + for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; + }; + return extendStatics(d, b); + }; + + function __extends(d, b) { + extendStatics(d, b); + function __() { + this.constructor = d; + } + d.prototype = + b === null + ? Object.create(b) + : ((__.prototype = b.prototype), new __()); + } + + var __assign = function() { + __assign = + Object.assign || + function __assign(t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) + if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + } + return t; + }; + return __assign.apply(this, arguments); + }; + + function __rest(s, e) { + var t = {}; + for (var p in s) + if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === 'function') + for ( + var i = 0, p = Object.getOwnPropertySymbols(s); + i < p.length; + i++ + ) + if (e.indexOf(p[i]) < 0) t[p[i]] = s[p[i]]; + return t; + } + + function __decorate(decorators, target, key, desc) { + var c = arguments.length, + r = + c < 3 + ? target + : desc === null + ? (desc = Object.getOwnPropertyDescriptor(target, key)) + : desc, + d; + if ( + typeof Reflect === 'object' && + typeof Reflect.decorate === 'function' + ) + r = Reflect.decorate(decorators, target, key, desc); + else + for (var i = decorators.length - 1; i >= 0; i--) + if ((d = decorators[i])) + r = + (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || + r; + return c > 3 && r && Object.defineProperty(target, key, r), r; + } + + function __param(paramIndex, decorator) { + return function(target, key) { + decorator(target, key, paramIndex); + }; + } + + function __metadata(metadataKey, metadataValue) { + if ( + typeof Reflect === 'object' && + typeof Reflect.metadata === 'function' + ) + return Reflect.metadata(metadataKey, metadataValue); + } + + function __awaiter(thisArg, _arguments, P, generator) { + return new (P || (P = Promise))(function(resolve, reject) { + function fulfilled(value) { + try { + step(generator.next(value)); + } catch (e) { + reject(e); + } + } + function rejected(value) { + try { + step(generator['throw'](value)); + } catch (e) { + reject(e); + } + } + function step(result) { + result.done + ? resolve(result.value) + : new P(function(resolve) { + resolve(result.value); + }).then(fulfilled, rejected); + } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); + } + + function __generator(thisArg, body) { + var _ = { + label: 0, + sent: function() { + if (t[0] & 1) throw t[1]; + return t[1]; + }, + trys: [], + ops: [], + }, + f, + y, + t, + g; + return ( + (g = { next: verb(0), throw: verb(1), return: verb(2) }), + typeof Symbol === 'function' && + (g[Symbol.iterator] = function() { + return this; + }), + g + ); + function verb(n) { + return function(v) { + return step([n, v]); + }; + } + function step(op) { + if (f) throw new TypeError('Generator is already executing.'); + while (_) + try { + if ( + ((f = 1), + y && + (t = + op[0] & 2 + ? y['return'] + : op[0] + ? y['throw'] || ((t = y['return']) && t.call(y), 0) + : y.next) && + !(t = t.call(y, op[1])).done) + ) + return t; + if (((y = 0), t)) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: + case 1: + t = op; + break; + case 4: + _.label++; + return { value: op[1], done: false }; + case 5: + _.label++; + y = op[1]; + op = [0]; + continue; + case 7: + op = _.ops.pop(); + _.trys.pop(); + continue; + default: + if ( + !((t = _.trys), (t = t.length > 0 && t[t.length - 1])) && + (op[0] === 6 || op[0] === 2) + ) { + _ = 0; + continue; + } + if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { + _.label = op[1]; + break; + } + if (op[0] === 6 && _.label < t[1]) { + _.label = t[1]; + t = op; + break; + } + if (t && _.label < t[2]) { + _.label = t[2]; + _.ops.push(op); + break; + } + if (t[2]) _.ops.pop(); + _.trys.pop(); + continue; + } + op = body.call(thisArg, _); + } catch (e) { + op = [6, e]; + y = 0; + } finally { + f = t = 0; + } + if (op[0] & 5) throw op[1]; + return { value: op[0] ? op[1] : void 0, done: true }; + } + } + + function __exportStar(m, exports) { + for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; + } + + function __values(o) { + var m = typeof Symbol === 'function' && o[Symbol.iterator], + i = 0; + if (m) return m.call(o); + return { + next: function() { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; + }, + }; + } + + function __read(o, n) { + var m = typeof Symbol === 'function' && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), + r, + ar = [], + e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) + ar.push(r.value); + } catch (error) { + e = { error: error }; + } finally { + try { + if (r && !r.done && (m = i['return'])) m.call(i); + } finally { + if (e) throw e.error; + } + } + return ar; + } + + function __spread() { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; + } + + function __await(v) { + return this instanceof __await ? ((this.v = v), this) : new __await(v); + } + + function __asyncGenerator(thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) + throw new TypeError('Symbol.asyncIterator is not defined.'); + var g = generator.apply(thisArg, _arguments || []), + i, + q = []; + return ( + (i = {}), + verb('next'), + verb('throw'), + verb('return'), + (i[Symbol.asyncIterator] = function() { + return this; + }), + i + ); + function verb(n) { + if (g[n]) + i[n] = function(v) { + return new Promise(function(a, b) { + q.push([n, v, a, b]) > 1 || resume(n, v); + }); + }; + } + function resume(n, v) { + try { + step(g[n](v)); + } catch (e) { + settle(q[0][3], e); + } + } + function step(r) { + r.value instanceof __await + ? Promise.resolve(r.value.v).then(fulfill, reject) + : settle(q[0][2], r); + } + function fulfill(value) { + resume('next', value); + } + function reject(value) { + resume('throw', value); + } + function settle(f, v) { + if ((f(v), q.shift(), q.length)) resume(q[0][0], q[0][1]); + } + } + + function __asyncDelegator(o) { + var i, p; + return ( + (i = {}), + verb('next'), + verb('throw', function(e) { + throw e; + }), + verb('return'), + (i[Symbol.iterator] = function() { + return this; + }), + i + ); + function verb(n, f) { + i[n] = o[n] + ? function(v) { + return (p = !p) + ? { value: __await(o[n](v)), done: n === 'return' } + : f + ? f(v) + : v; + } + : f; + } + } + + function __asyncValues(o) { + if (!Symbol.asyncIterator) + throw new TypeError('Symbol.asyncIterator is not defined.'); + var m = o[Symbol.asyncIterator], + i; + return m + ? m.call(o) + : ((o = + typeof __values === 'function' + ? __values(o) + : o[Symbol.iterator]()), + (i = {}), + verb('next'), + verb('throw'), + verb('return'), + (i[Symbol.asyncIterator] = function() { + return this; + }), + i); + function verb(n) { + i[n] = + o[n] && + function(v) { + return new Promise(function(resolve, reject) { + (v = o[n](v)), settle(resolve, reject, v.done, v.value); + }); + }; + } + function settle(resolve, reject, d, v) { + Promise.resolve(v).then(function(v) { + resolve({ value: v, done: d }); + }, reject); + } + } + + function __makeTemplateObject(cooked, raw) { + if (Object.defineProperty) { + Object.defineProperty(cooked, 'raw', { value: raw }); + } else { + cooked.raw = raw; + } + return cooked; + } + + function __importStar(mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) + for (var k in mod) + if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result.default = mod; + return result; + } + + function __importDefault(mod) { + return mod && mod.__esModule ? mod : { default: mod }; + } + + /***/ + }, + /* 2 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + exports.__esModule = true; + + var _promise = __webpack_require__(227); + + var _promise2 = _interopRequireDefault(_promise); + + function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { default: obj }; + } + + exports.default = function(fn) { + return function() { + var gen = fn.apply(this, arguments); + return new _promise2.default(function(resolve, reject) { + function step(key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; + } + + if (info.done) { + resolve(value); + } else { + return _promise2.default.resolve(value).then( + function(value) { + step('next', value); + }, + function(err) { + step('throw', err); + }, + ); + } + } + + return step('next'); + }); + }; + }; + + /***/ + }, + /* 3 */ + /***/ function(module, exports) { + module.exports = require('util'); + + /***/ + }, + /* 4 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined; + + var _asyncToGenerator2; + + function _load_asyncToGenerator() { + return (_asyncToGenerator2 = _interopRequireDefault( + __webpack_require__(2), + )); + } + + let buildActionsForCopy = (() => { + var _ref = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + queue, + events, + possibleExtraneous, + reporter, + ) { + // + let build = (() => { + var _ref5 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + data, + ) { + const src = data.src, + dest = data.dest, + type = data.type; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + + // TODO https://github.com/yarnpkg/yarn/issues/3751 + // related to bundled dependencies handling + if (files.has(dest.toLowerCase())) { + reporter.verbose( + `The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`, + ); + } else { + files.add(dest.toLowerCase()); + } + + if (type === 'symlink') { + yield mkdirp((_path || _load_path()).default.dirname(dest)); + onFresh(); + actions.symlink.push({ + dest, + linkname: src, + }); + onDone(); + return; + } + + if ( + events.ignoreBasenames.indexOf( + (_path || _load_path()).default.basename(src), + ) >= 0 + ) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + let destStat; + try { + // try accessing the destination + destStat = yield lstat(dest); + } catch (e) { + // proceed if destination doesn't exist, otherwise error + if (e.code !== 'ENOENT') { + throw e; + } + } + + // if destination exists + if (destStat) { + const bothSymlinks = + srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = + srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + + /* if (srcStat.mode !== destStat.mode) { + try { + await access(dest, srcStat.mode); + } catch (err) {} + } */ + + if (bothFiles && artifactFiles.has(dest)) { + // this file gets changed during build, likely by a custom install script. Don't bother checking it. + onDone(); + reporter.verbose( + reporter.lang('verboseFileSkipArtifact', src), + ); + return; + } + + if ( + bothFiles && + srcStat.size === destStat.size && + (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)( + srcStat.mtime, + destStat.mtime, + ) + ) { + // we can safely assume this is the same file + onDone(); + reporter.verbose( + reporter.lang( + 'verboseFileSkip', + src, + dest, + srcStat.size, + +srcStat.mtime, + ), + ); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose( + reporter.lang( + 'verboseFileSkipSymlink', + src, + dest, + srcReallink, + ), + ); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for ( + var _iterator4 = destFiles, + _isArray4 = Array.isArray(_iterator4), + _i4 = 0, + _iterator4 = _isArray4 + ? _iterator4 + : _iterator4[Symbol.iterator](); + ; + + ) { + var _ref6; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref6 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref6 = _i4.value; + } + + const file = _ref6; + + if (srcFiles.indexOf(file) < 0) { + const loc = (_path || _load_path()).default.join( + dest, + file, + ); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for ( + var _iterator5 = yield readdir(loc), + _isArray5 = Array.isArray(_iterator5), + _i5 = 0, + _iterator5 = _isArray5 + ? _iterator5 + : _iterator5[Symbol.iterator](); + ; + + ) { + var _ref7; + + if (_isArray5) { + if (_i5 >= _iterator5.length) break; + _ref7 = _iterator5[_i5++]; + } else { + _i5 = _iterator5.next(); + if (_i5.done) break; + _ref7 = _i5.value; + } + + const file = _ref7; + + possibleExtraneous.add( + (_path || _load_path()).default.join(loc, file), + ); + } + } + } + } + } + } + + if (destStat && destStat.isSymbolicLink()) { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); + destStat = null; + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.symlink.push({ + dest, + linkname, + }); + onDone(); + } else if (srcStat.isDirectory()) { + if (!destStat) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + } + + const destParts = dest.split( + (_path || _load_path()).default.sep, + ); + while (destParts.length) { + files.add( + destParts + .join((_path || _load_path()).default.sep) + .toLowerCase(), + ); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for ( + var _iterator6 = srcFiles, + _isArray6 = Array.isArray(_iterator6), + _i6 = 0, + _iterator6 = _isArray6 + ? _iterator6 + : _iterator6[Symbol.iterator](); + ; + + ) { + var _ref8; + + if (_isArray6) { + if (_i6 >= _iterator6.length) break; + _ref8 = _iterator6[_i6++]; + } else { + _i6 = _iterator6.next(); + if (_i6.done) break; + _ref8 = _i6.value; + } + + const file = _ref8; + + queue.push({ + dest: (_path || _load_path()).default.join(dest, file), + onFresh, + onDone: (function(_onDone) { + function onDone() { + return _onDone.apply(this, arguments); + } + + onDone.toString = function() { + return _onDone.toString(); + }; + + return onDone; + })(function() { + if (--remaining === 0) { + onDone(); + } + }), + src: (_path || _load_path()).default.join(src, file), + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.file.push({ + src, + dest, + atime: srcStat.atime, + mtime: srcStat.mtime, + mode: srcStat.mode, + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x5) { + return _ref5.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for ( + var _iterator = queue, + _isArray = Array.isArray(_iterator), + _i = 0, + _iterator = _isArray ? _iterator : _iterator[Symbol.iterator](); + ; + + ) { + var _ref2; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref2 = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref2 = _i.value; + } + + const item = _ref2; + + const onDone = item.onDone; + item.onDone = function() { + events.onProgress(item.dest); + if (onDone) { + onDone(); + } + }; + } + events.onStart(queue.length); + + // start building actions + const actions = { + file: [], + symlink: [], + link: [], + }; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraneous + for ( + var _iterator2 = artifactFiles, + _isArray2 = Array.isArray(_iterator2), + _i2 = 0, + _iterator2 = _isArray2 + ? _iterator2 + : _iterator2[Symbol.iterator](); + ; + + ) { + var _ref3; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref3 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref3 = _i2.value; + } + + const file = _ref3; + + if (possibleExtraneous.has(file)) { + reporter.verbose( + reporter.lang('verboseFilePhantomExtraneous', file), + ); + possibleExtraneous.delete(file); + } + } + + for ( + var _iterator3 = possibleExtraneous, + _isArray3 = Array.isArray(_iterator3), + _i3 = 0, + _iterator3 = _isArray3 + ? _iterator3 + : _iterator3[Symbol.iterator](); + ; + + ) { + var _ref4; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref4 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref4 = _i3.value; + } + + const loc = _ref4; + + if (files.has(loc.toLowerCase())) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForCopy(_x, _x2, _x3, _x4) { + return _ref.apply(this, arguments); + }; + })(); + + let buildActionsForHardlink = (() => { + var _ref9 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + queue, + events, + possibleExtraneous, + reporter, + ) { + // + let build = (() => { + var _ref13 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + data, + ) { + const src = data.src, + dest = data.dest; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + if (files.has(dest.toLowerCase())) { + // Fixes issue https://github.com/yarnpkg/yarn/issues/2734 + // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1, + // package-linker passes that modules A1 and B1 need to be hardlinked, + // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case + // an exception. + onDone(); + return; + } + files.add(dest.toLowerCase()); + + if ( + events.ignoreBasenames.indexOf( + (_path || _load_path()).default.basename(src), + ) >= 0 + ) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + const destExists = yield exists(dest); + if (destExists) { + const destStat = yield lstat(dest); + + const bothSymlinks = + srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = + srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + if (srcStat.mode !== destStat.mode) { + try { + yield access(dest, srcStat.mode); + } catch (err) { + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + reporter.verbose(err); + } + } + + if (bothFiles && artifactFiles.has(dest)) { + // this file gets changed during build, likely by a custom install script. Don't bother checking it. + onDone(); + reporter.verbose( + reporter.lang('verboseFileSkipArtifact', src), + ); + return; + } + + // correct hardlink + if ( + bothFiles && + srcStat.ino !== null && + srcStat.ino === destStat.ino + ) { + onDone(); + reporter.verbose( + reporter.lang('verboseFileSkip', src, dest, srcStat.ino), + ); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose( + reporter.lang( + 'verboseFileSkipSymlink', + src, + dest, + srcReallink, + ), + ); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for ( + var _iterator10 = destFiles, + _isArray10 = Array.isArray(_iterator10), + _i10 = 0, + _iterator10 = _isArray10 + ? _iterator10 + : _iterator10[Symbol.iterator](); + ; + + ) { + var _ref14; + + if (_isArray10) { + if (_i10 >= _iterator10.length) break; + _ref14 = _iterator10[_i10++]; + } else { + _i10 = _iterator10.next(); + if (_i10.done) break; + _ref14 = _i10.value; + } + + const file = _ref14; + + if (srcFiles.indexOf(file) < 0) { + const loc = (_path || _load_path()).default.join( + dest, + file, + ); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for ( + var _iterator11 = yield readdir(loc), + _isArray11 = Array.isArray(_iterator11), + _i11 = 0, + _iterator11 = _isArray11 + ? _iterator11 + : _iterator11[Symbol.iterator](); + ; + + ) { + var _ref15; + + if (_isArray11) { + if (_i11 >= _iterator11.length) break; + _ref15 = _iterator11[_i11++]; + } else { + _i11 = _iterator11.next(); + if (_i11.done) break; + _ref15 = _i11.value; + } + + const file = _ref15; + + possibleExtraneous.add( + (_path || _load_path()).default.join(loc, file), + ); + } + } + } + } + } + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.symlink.push({ + dest, + linkname, + }); + onDone(); + } else if (srcStat.isDirectory()) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + + const destParts = dest.split( + (_path || _load_path()).default.sep, + ); + while (destParts.length) { + files.add( + destParts + .join((_path || _load_path()).default.sep) + .toLowerCase(), + ); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for ( + var _iterator12 = srcFiles, + _isArray12 = Array.isArray(_iterator12), + _i12 = 0, + _iterator12 = _isArray12 + ? _iterator12 + : _iterator12[Symbol.iterator](); + ; + + ) { + var _ref16; + + if (_isArray12) { + if (_i12 >= _iterator12.length) break; + _ref16 = _iterator12[_i12++]; + } else { + _i12 = _iterator12.next(); + if (_i12.done) break; + _ref16 = _i12.value; + } + + const file = _ref16; + + queue.push({ + onFresh, + src: (_path || _load_path()).default.join(src, file), + dest: (_path || _load_path()).default.join(dest, file), + onDone: (function(_onDone2) { + function onDone() { + return _onDone2.apply(this, arguments); + } + + onDone.toString = function() { + return _onDone2.toString(); + }; + + return onDone; + })(function() { + if (--remaining === 0) { + onDone(); + } + }), + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.link.push({ + src, + dest, + removeDest: destExists, + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x10) { + return _ref13.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for ( + var _iterator7 = queue, + _isArray7 = Array.isArray(_iterator7), + _i7 = 0, + _iterator7 = _isArray7 + ? _iterator7 + : _iterator7[Symbol.iterator](); + ; + + ) { + var _ref10; + + if (_isArray7) { + if (_i7 >= _iterator7.length) break; + _ref10 = _iterator7[_i7++]; + } else { + _i7 = _iterator7.next(); + if (_i7.done) break; + _ref10 = _i7.value; + } + + const item = _ref10; + + const onDone = item.onDone || noop; + item.onDone = function() { + events.onProgress(item.dest); + onDone(); + }; + } + events.onStart(queue.length); + + // start building actions + const actions = { + file: [], + symlink: [], + link: [], + }; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraneous + for ( + var _iterator8 = artifactFiles, + _isArray8 = Array.isArray(_iterator8), + _i8 = 0, + _iterator8 = _isArray8 + ? _iterator8 + : _iterator8[Symbol.iterator](); + ; + + ) { + var _ref11; + + if (_isArray8) { + if (_i8 >= _iterator8.length) break; + _ref11 = _iterator8[_i8++]; + } else { + _i8 = _iterator8.next(); + if (_i8.done) break; + _ref11 = _i8.value; + } + + const file = _ref11; + + if (possibleExtraneous.has(file)) { + reporter.verbose( + reporter.lang('verboseFilePhantomExtraneous', file), + ); + possibleExtraneous.delete(file); + } + } + + for ( + var _iterator9 = possibleExtraneous, + _isArray9 = Array.isArray(_iterator9), + _i9 = 0, + _iterator9 = _isArray9 + ? _iterator9 + : _iterator9[Symbol.iterator](); + ; + + ) { + var _ref12; + + if (_isArray9) { + if (_i9 >= _iterator9.length) break; + _ref12 = _iterator9[_i9++]; + } else { + _i9 = _iterator9.next(); + if (_i9.done) break; + _ref12 = _i9.value; + } + + const loc = _ref12; + + if (files.has(loc.toLowerCase())) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { + return _ref9.apply(this, arguments); + }; + })(); + + let copyBulk = (exports.copyBulk = (() => { + var _ref17 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + queue, + reporter, + _events, + ) { + const events = { + onStart: (_events && _events.onStart) || noop, + onProgress: (_events && _events.onProgress) || noop, + possibleExtraneous: _events + ? _events.possibleExtraneous + : new Set(), + ignoreBasenames: (_events && _events.ignoreBasenames) || [], + artifactFiles: (_events && _events.artifactFiles) || [], + }; + + const actions = yield buildActionsForCopy( + queue, + events, + events.possibleExtraneous, + reporter, + ); + events.onStart( + actions.file.length + actions.symlink.length + actions.link.length, + ); + + const fileActions = actions.file; + + const currentlyWriting = new Map(); + + yield (_promise || _load_promise()).queue( + fileActions, + (() => { + var _ref18 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*(data) { + let writePromise; + while ((writePromise = currentlyWriting.get(data.dest))) { + yield writePromise; + } + + reporter.verbose( + reporter.lang('verboseFileCopy', data.src, data.dest), + ); + const copier = (0, + (_fsNormalized || _load_fsNormalized()).copyFile)( + data, + function() { + return currentlyWriting.delete(data.dest); + }, + ); + currentlyWriting.set(data.dest, copier); + events.onProgress(data.dest); + return copier; + }, + ); + + return function(_x14) { + return _ref18.apply(this, arguments); + }; + })(), + CONCURRENT_QUEUE_ITEMS, + ); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.symlink; + yield (_promise || _load_promise()).queue(symlinkActions, function( + data, + ) { + const linkname = (_path || _load_path()).default.resolve( + (_path || _load_path()).default.dirname(data.dest), + data.linkname, + ); + reporter.verbose( + reporter.lang('verboseFileSymlink', data.dest, linkname), + ); + return symlink(linkname, data.dest); + }); + }); + + return function copyBulk(_x11, _x12, _x13) { + return _ref17.apply(this, arguments); + }; + })()); + + let hardlinkBulk = (exports.hardlinkBulk = (() => { + var _ref19 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + queue, + reporter, + _events, + ) { + const events = { + onStart: (_events && _events.onStart) || noop, + onProgress: (_events && _events.onProgress) || noop, + possibleExtraneous: _events + ? _events.possibleExtraneous + : new Set(), + artifactFiles: (_events && _events.artifactFiles) || [], + ignoreBasenames: [], + }; + + const actions = yield buildActionsForHardlink( + queue, + events, + events.possibleExtraneous, + reporter, + ); + events.onStart( + actions.file.length + actions.symlink.length + actions.link.length, + ); + + const fileActions = actions.link; + + yield (_promise || _load_promise()).queue( + fileActions, + (() => { + var _ref20 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*(data) { + reporter.verbose( + reporter.lang('verboseFileLink', data.src, data.dest), + ); + if (data.removeDest) { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)( + data.dest, + ); + } + yield link(data.src, data.dest); + }, + ); + + return function(_x18) { + return _ref20.apply(this, arguments); + }; + })(), + CONCURRENT_QUEUE_ITEMS, + ); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.symlink; + yield (_promise || _load_promise()).queue(symlinkActions, function( + data, + ) { + const linkname = (_path || _load_path()).default.resolve( + (_path || _load_path()).default.dirname(data.dest), + data.linkname, + ); + reporter.verbose( + reporter.lang('verboseFileSymlink', data.dest, linkname), + ); + return symlink(linkname, data.dest); + }); + }); + + return function hardlinkBulk(_x15, _x16, _x17) { + return _ref19.apply(this, arguments); + }; + })()); + + let readFileAny = (exports.readFileAny = (() => { + var _ref21 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + files, + ) { + for ( + var _iterator13 = files, + _isArray13 = Array.isArray(_iterator13), + _i13 = 0, + _iterator13 = _isArray13 + ? _iterator13 + : _iterator13[Symbol.iterator](); + ; + + ) { + var _ref22; + + if (_isArray13) { + if (_i13 >= _iterator13.length) break; + _ref22 = _iterator13[_i13++]; + } else { + _i13 = _iterator13.next(); + if (_i13.done) break; + _ref22 = _i13.value; + } + + const file = _ref22; + + if (yield exists(file)) { + return readFile(file); + } + } + return null; + }); + + return function readFileAny(_x19) { + return _ref21.apply(this, arguments); + }; + })()); + + let readJson = (exports.readJson = (() => { + var _ref23 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + loc, + ) { + return (yield readJsonAndFile(loc)).object; + }); + + return function readJson(_x20) { + return _ref23.apply(this, arguments); + }; + })()); + + let readJsonAndFile = (exports.readJsonAndFile = (() => { + var _ref24 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + loc, + ) { + const file = yield readFile(loc); + try { + return { + object: (0, (_map || _load_map()).default)( + JSON.parse(stripBOM(file)), + ), + content: file, + }; + } catch (err) { + err.message = `${loc}: ${err.message}`; + throw err; + } + }); + + return function readJsonAndFile(_x21) { + return _ref24.apply(this, arguments); + }; + })()); + + let find = (exports.find = (() => { + var _ref25 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + filename, + dir, + ) { + const parts = dir.split((_path || _load_path()).default.sep); + + while (parts.length) { + const loc = parts + .concat(filename) + .join((_path || _load_path()).default.sep); + + if (yield exists(loc)) { + return loc; + } else { + parts.pop(); + } + } + + return false; + }); + + return function find(_x22, _x23) { + return _ref25.apply(this, arguments); + }; + })()); + + let symlink = (exports.symlink = (() => { + var _ref26 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + src, + dest, + ) { + if (process.platform !== 'win32') { + // use relative paths otherwise which will be retained if the directory is moved + src = (_path || _load_path()).default.relative( + (_path || _load_path()).default.dirname(dest), + src, + ); + // When path.relative returns an empty string for the current directory, we should instead use + // '.', which is a valid fs.symlink target. + src = src || '.'; + } + + try { + const stats = yield lstat(dest); + if (stats.isSymbolicLink()) { + const resolved = dest; + if (resolved === src) { + return; + } + } + } catch (err) { + if (err.code !== 'ENOENT') { + throw err; + } + } + + // We use rimraf for unlink which never throws an ENOENT on missing target + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); + + if (process.platform === 'win32') { + // use directory junctions if possible on win32, this requires absolute paths + yield fsSymlink(src, dest, 'junction'); + } else { + yield fsSymlink(src, dest); + } + }); + + return function symlink(_x24, _x25) { + return _ref26.apply(this, arguments); + }; + })()); + + let walk = (exports.walk = (() => { + var _ref27 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + dir, + relativeDir, + ignoreBasenames = new Set(), + ) { + let files = []; + + let filenames = yield readdir(dir); + if (ignoreBasenames.size) { + filenames = filenames.filter(function(name) { + return !ignoreBasenames.has(name); + }); + } + + for ( + var _iterator14 = filenames, + _isArray14 = Array.isArray(_iterator14), + _i14 = 0, + _iterator14 = _isArray14 + ? _iterator14 + : _iterator14[Symbol.iterator](); + ; + + ) { + var _ref28; + + if (_isArray14) { + if (_i14 >= _iterator14.length) break; + _ref28 = _iterator14[_i14++]; + } else { + _i14 = _iterator14.next(); + if (_i14.done) break; + _ref28 = _i14.value; + } + + const name = _ref28; + + const relative = relativeDir + ? (_path || _load_path()).default.join(relativeDir, name) + : name; + const loc = (_path || _load_path()).default.join(dir, name); + const stat = yield lstat(loc); + + files.push({ + relative, + basename: name, + absolute: loc, + mtime: +stat.mtime, + }); + + if (stat.isDirectory()) { + files = files.concat(yield walk(loc, relative, ignoreBasenames)); + } + } + + return files; + }); + + return function walk(_x26, _x27) { + return _ref27.apply(this, arguments); + }; + })()); + + let getFileSizeOnDisk = (exports.getFileSizeOnDisk = (() => { + var _ref29 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + loc, + ) { + const stat = yield lstat(loc); + const size = stat.size, + blockSize = stat.blksize; + + return Math.ceil(size / blockSize) * blockSize; + }); + + return function getFileSizeOnDisk(_x28) { + return _ref29.apply(this, arguments); + }; + })()); + + let getEolFromFile = (() => { + var _ref30 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + path, + ) { + if (!(yield exists(path))) { + return undefined; + } + + const buffer = yield readFileBuffer(path); + + for (let i = 0; i < buffer.length; ++i) { + if (buffer[i] === cr) { + return '\r\n'; + } + if (buffer[i] === lf) { + return '\n'; + } + } + return undefined; + }); + + return function getEolFromFile(_x29) { + return _ref30.apply(this, arguments); + }; + })(); + + let writeFilePreservingEol = (exports.writeFilePreservingEol = (() => { + var _ref31 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + path, + data, + ) { + const eol = + (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL; + if (eol !== '\n') { + data = data.replace(/\n/g, eol); + } + yield writeFile(path, data); + }); + + return function writeFilePreservingEol(_x30, _x31) { + return _ref31.apply(this, arguments); + }; + })()); + + let hardlinksWork = (exports.hardlinksWork = (() => { + var _ref32 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + dir, + ) { + const filename = 'test-file' + Math.random(); + const file = (_path || _load_path()).default.join(dir, filename); + const fileLink = (_path || _load_path()).default.join( + dir, + filename + '-link', + ); + try { + yield writeFile(file, 'test'); + yield link(file, fileLink); + } catch (err) { + return false; + } finally { + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file); + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink); + } + return true; + }); + + return function hardlinksWork(_x32) { + return _ref32.apply(this, arguments); + }; + })()); + + // not a strict polyfill for Node's fs.mkdtemp + + let makeTempDir = (exports.makeTempDir = (() => { + var _ref33 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + prefix, + ) { + const dir = (_path || _load_path()).default.join( + (_os || _load_os()).default.tmpdir(), + `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`, + ); + yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir); + yield mkdirp(dir); + return dir; + }); + + return function makeTempDir(_x33) { + return _ref33.apply(this, arguments); + }; + })()); + + let readFirstAvailableStream = (exports.readFirstAvailableStream = (() => { + var _ref34 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + paths, + ) { + for ( + var _iterator15 = paths, + _isArray15 = Array.isArray(_iterator15), + _i15 = 0, + _iterator15 = _isArray15 + ? _iterator15 + : _iterator15[Symbol.iterator](); + ; + + ) { + var _ref35; + + if (_isArray15) { + if (_i15 >= _iterator15.length) break; + _ref35 = _iterator15[_i15++]; + } else { + _i15 = _iterator15.next(); + if (_i15.done) break; + _ref35 = _i15.value; + } + + const path = _ref35; + + try { + const fd = yield open(path, 'r'); + return (_fs || _load_fs()).default.createReadStream(path, { fd }); + } catch (err) { + // Try the next one + } + } + return null; + }); + + return function readFirstAvailableStream(_x34) { + return _ref34.apply(this, arguments); + }; + })()); + + let getFirstSuitableFolder = (exports.getFirstSuitableFolder = (() => { + var _ref36 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + paths, + mode = constants.W_OK | constants.X_OK, + ) { + const result = { + skipped: [], + folder: null, + }; + + for ( + var _iterator16 = paths, + _isArray16 = Array.isArray(_iterator16), + _i16 = 0, + _iterator16 = _isArray16 + ? _iterator16 + : _iterator16[Symbol.iterator](); + ; + + ) { + var _ref37; + + if (_isArray16) { + if (_i16 >= _iterator16.length) break; + _ref37 = _iterator16[_i16++]; + } else { + _i16 = _iterator16.next(); + if (_i16.done) break; + _ref37 = _i16.value; + } + + const folder = _ref37; + + try { + yield mkdirp(folder); + yield access(folder, mode); + + result.folder = folder; + + return result; + } catch (error) { + result.skipped.push({ + error, + folder, + }); + } + } + return result; + }); + + return function getFirstSuitableFolder(_x35) { + return _ref36.apply(this, arguments); + }; + })()); + + exports.copy = copy; + exports.readFile = readFile; + exports.readFileRaw = readFileRaw; + exports.normalizeOS = normalizeOS; + + var _fs; + + function _load_fs() { + return (_fs = _interopRequireDefault(__webpack_require__(5))); + } + + var _glob; + + function _load_glob() { + return (_glob = _interopRequireDefault(__webpack_require__(99))); + } + + var _os; + + function _load_os() { + return (_os = _interopRequireDefault(__webpack_require__(46))); + } + + var _path; + + function _load_path() { + return (_path = _interopRequireDefault(__webpack_require__(0))); + } + + var _blockingQueue; + + function _load_blockingQueue() { + return (_blockingQueue = _interopRequireDefault( + __webpack_require__(110), + )); + } + + var _promise; + + function _load_promise() { + return (_promise = _interopRequireWildcard(__webpack_require__(50))); + } + + var _promise2; + + function _load_promise2() { + return (_promise2 = __webpack_require__(50)); + } + + var _map; + + function _load_map() { + return (_map = _interopRequireDefault(__webpack_require__(29))); + } + + var _fsNormalized; + + function _load_fsNormalized() { + return (_fsNormalized = __webpack_require__(218)); + } + + function _interopRequireWildcard(obj) { + if (obj && obj.__esModule) { + return obj; + } else { + var newObj = {}; + if (obj != null) { + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) + newObj[key] = obj[key]; + } + } + newObj.default = obj; + return newObj; + } + } + + function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { default: obj }; + } + + const constants = (exports.constants = + typeof (_fs || _load_fs()).default.constants !== 'undefined' + ? (_fs || _load_fs()).default.constants + : { + R_OK: (_fs || _load_fs()).default.R_OK, + W_OK: (_fs || _load_fs()).default.W_OK, + X_OK: (_fs || _load_fs()).default.X_OK, + }); + + const lockQueue = (exports.lockQueue = new ( + _blockingQueue || _load_blockingQueue() + ).default('fs lock')); + + const readFileBuffer = (exports.readFileBuffer = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.readFile, + )); + const open = (exports.open = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.open, + )); + const writeFile = (exports.writeFile = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.writeFile, + )); + const readlink = (exports.readlink = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.readlink, + )); + const realpath = (exports.realpath = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.realpath, + )); + const readdir = (exports.readdir = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.readdir, + )); + const rename = (exports.rename = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.rename, + )); + const access = (exports.access = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.access, + )); + const stat = (exports.stat = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.stat, + )); + const mkdirp = (exports.mkdirp = (0, + (_promise2 || _load_promise2()).promisify)(__webpack_require__(145))); + const exists = (exports.exists = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.exists, + true, + )); + const lstat = (exports.lstat = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.lstat, + )); + const chmod = (exports.chmod = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.chmod, + )); + const link = (exports.link = (0, + (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.link, + )); + const glob = (exports.glob = (0, + (_promise2 || _load_promise2()).promisify)( + (_glob || _load_glob()).default, + )); + exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink; + + // fs.copyFile uses the native file copying instructions on the system, performing much better + // than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the + // concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD. + + const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile + ? 128 + : 4; + + const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)( + (_fs || _load_fs()).default.symlink, + ); + const invariant = __webpack_require__(9); + const stripBOM = __webpack_require__(160); + + const noop = () => {}; + + function copy(src, dest, reporter) { + return copyBulk([{ src, dest }], reporter); + } + + function _readFile(loc, encoding) { + return new Promise((resolve, reject) => { + (_fs || _load_fs()).default.readFile(loc, encoding, function( + err, + content, + ) { + if (err) { + reject(err); + } else { + resolve(content); + } + }); + }); + } + + function readFile(loc) { + return _readFile(loc, 'utf8').then(normalizeOS); + } + + function readFileRaw(loc) { + return _readFile(loc, 'binary'); + } + + function normalizeOS(body) { + return body.replace(/\r\n/g, '\n'); + } + + const cr = '\r'.charCodeAt(0); + const lf = '\n'.charCodeAt(0); + + /***/ + }, + /* 5 */ + /***/ function(module, exports) { + module.exports = require('fs'); + + /***/ + }, + /* 6 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + class MessageError extends Error { + constructor(msg, code) { + super(msg); + this.code = code; + } + } + + exports.MessageError = MessageError; + class ProcessSpawnError extends MessageError { + constructor(msg, code, process) { + super(msg, code); + this.process = process; + } + } + + exports.ProcessSpawnError = ProcessSpawnError; + class SecurityError extends MessageError {} + + exports.SecurityError = SecurityError; + class ProcessTermError extends MessageError {} + + exports.ProcessTermError = ProcessTermError; + class ResponseError extends Error { + constructor(msg, responseCode) { + super(msg); + this.responseCode = responseCode; + } + } + + exports.ResponseError = ResponseError; + class OneTimePasswordError extends Error {} + exports.OneTimePasswordError = OneTimePasswordError; + + /***/ + }, + /* 7 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'a', + function() { + return Subscriber; + }, + ); + /* unused harmony export SafeSubscriber */ + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__( + 1, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__( + 154, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__( + 420, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__( + 25, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__( + 321, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__( + 185, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__( + 323, + ); + /** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */ + + var Subscriber = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + Subscriber, + _super, + ); + function Subscriber(destinationOrNext, error, complete) { + var _this = _super.call(this) || this; + _this.syncErrorValue = null; + _this.syncErrorThrown = false; + _this.syncErrorThrowable = false; + _this.isStopped = false; + _this._parentSubscription = null; + switch (arguments.length) { + case 0: + _this.destination = + __WEBPACK_IMPORTED_MODULE_2__Observer__['a' /* empty */]; + break; + case 1: + if (!destinationOrNext) { + _this.destination = + __WEBPACK_IMPORTED_MODULE_2__Observer__['a' /* empty */]; + break; + } + if (typeof destinationOrNext === 'object') { + if (destinationOrNext instanceof Subscriber) { + _this.syncErrorThrowable = + destinationOrNext.syncErrorThrowable; + _this.destination = destinationOrNext; + destinationOrNext.add(_this); + } else { + _this.syncErrorThrowable = true; + _this.destination = new SafeSubscriber( + _this, + destinationOrNext, + ); + } + break; + } + default: + _this.syncErrorThrowable = true; + _this.destination = new SafeSubscriber( + _this, + destinationOrNext, + error, + complete, + ); + break; + } + return _this; + } + Subscriber.prototype[ + __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__[ + 'a' /* rxSubscriber */ + ] + ] = function() { + return this; + }; + Subscriber.create = function(next, error, complete) { + var subscriber = new Subscriber(next, error, complete); + subscriber.syncErrorThrowable = false; + return subscriber; + }; + Subscriber.prototype.next = function(value) { + if (!this.isStopped) { + this._next(value); + } + }; + Subscriber.prototype.error = function(err) { + if (!this.isStopped) { + this.isStopped = true; + this._error(err); + } + }; + Subscriber.prototype.complete = function() { + if (!this.isStopped) { + this.isStopped = true; + this._complete(); + } + }; + Subscriber.prototype.unsubscribe = function() { + if (this.closed) { + return; + } + this.isStopped = true; + _super.prototype.unsubscribe.call(this); + }; + Subscriber.prototype._next = function(value) { + this.destination.next(value); + }; + Subscriber.prototype._error = function(err) { + this.destination.error(err); + this.unsubscribe(); + }; + Subscriber.prototype._complete = function() { + this.destination.complete(); + this.unsubscribe(); + }; + Subscriber.prototype._unsubscribeAndRecycle = function() { + var _a = this, + _parent = _a._parent, + _parents = _a._parents; + this._parent = null; + this._parents = null; + this.unsubscribe(); + this.closed = false; + this.isStopped = false; + this._parent = _parent; + this._parents = _parents; + this._parentSubscription = null; + return this; + }; + return Subscriber; + })(__WEBPACK_IMPORTED_MODULE_3__Subscription__['a' /* Subscription */]); + + var SafeSubscriber = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + SafeSubscriber, + _super, + ); + function SafeSubscriber( + _parentSubscriber, + observerOrNext, + error, + complete, + ) { + var _this = _super.call(this) || this; + _this._parentSubscriber = _parentSubscriber; + var next; + var context = _this; + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_1__util_isFunction__[ + 'a' /* isFunction */ + ], + )(observerOrNext) + ) { + next = observerOrNext; + } else if (observerOrNext) { + next = observerOrNext.next; + error = observerOrNext.error; + complete = observerOrNext.complete; + if ( + observerOrNext !== + __WEBPACK_IMPORTED_MODULE_2__Observer__['a' /* empty */] + ) { + context = Object.create(observerOrNext); + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_1__util_isFunction__[ + 'a' /* isFunction */ + ], + )(context.unsubscribe) + ) { + _this.add(context.unsubscribe.bind(context)); + } + context.unsubscribe = _this.unsubscribe.bind(_this); + } + } + _this._context = context; + _this._next = next; + _this._error = error; + _this._complete = complete; + return _this; + } + SafeSubscriber.prototype.next = function(value) { + if (!this.isStopped && this._next) { + var _parentSubscriber = this._parentSubscriber; + if ( + !__WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling || + !_parentSubscriber.syncErrorThrowable + ) { + this.__tryOrUnsub(this._next, value); + } else if ( + this.__tryOrSetError(_parentSubscriber, this._next, value) + ) { + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.error = function(err) { + if (!this.isStopped) { + var _parentSubscriber = this._parentSubscriber; + var useDeprecatedSynchronousErrorHandling = + __WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling; + if (this._error) { + if ( + !useDeprecatedSynchronousErrorHandling || + !_parentSubscriber.syncErrorThrowable + ) { + this.__tryOrUnsub(this._error, err); + this.unsubscribe(); + } else { + this.__tryOrSetError(_parentSubscriber, this._error, err); + this.unsubscribe(); + } + } else if (!_parentSubscriber.syncErrorThrowable) { + this.unsubscribe(); + if (useDeprecatedSynchronousErrorHandling) { + throw err; + } + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__[ + 'a' /* hostReportError */ + ], + )(err); + } else { + if (useDeprecatedSynchronousErrorHandling) { + _parentSubscriber.syncErrorValue = err; + _parentSubscriber.syncErrorThrown = true; + } else { + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__[ + 'a' /* hostReportError */ + ], + )(err); + } + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.complete = function() { + var _this = this; + if (!this.isStopped) { + var _parentSubscriber = this._parentSubscriber; + if (this._complete) { + var wrappedComplete = function() { + return _this._complete.call(_this._context); + }; + if ( + !__WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling || + !_parentSubscriber.syncErrorThrowable + ) { + this.__tryOrUnsub(wrappedComplete); + this.unsubscribe(); + } else { + this.__tryOrSetError(_parentSubscriber, wrappedComplete); + this.unsubscribe(); + } + } else { + this.unsubscribe(); + } + } + }; + SafeSubscriber.prototype.__tryOrUnsub = function(fn, value) { + try { + fn.call(this._context, value); + } catch (err) { + this.unsubscribe(); + if ( + __WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling + ) { + throw err; + } else { + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__[ + 'a' /* hostReportError */ + ], + )(err); + } + } + }; + SafeSubscriber.prototype.__tryOrSetError = function(parent, fn, value) { + if ( + !__WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling + ) { + throw new Error('bad call'); + } + try { + fn.call(this._context, value); + } catch (err) { + if ( + __WEBPACK_IMPORTED_MODULE_5__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling + ) { + parent.syncErrorValue = err; + parent.syncErrorThrown = true; + return true; + } else { + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__[ + 'a' /* hostReportError */ + ], + )(err); + return true; + } + } + return false; + }; + SafeSubscriber.prototype._unsubscribe = function() { + var _parentSubscriber = this._parentSubscriber; + this._context = null; + this._parentSubscriber = null; + _parentSubscriber.unsubscribe(); + }; + return SafeSubscriber; + })(Subscriber); + + //# sourceMappingURL=Subscriber.js.map + + /***/ + }, + /* 8 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.getPathKey = getPathKey; + const os = __webpack_require__(46); + const path = __webpack_require__(0); + const userHome = __webpack_require__(67).default; + + var _require = __webpack_require__(225); + + const getCacheDir = _require.getCacheDir, + getConfigDir = _require.getConfigDir, + getDataDir = _require.getDataDir; + + const isWebpackBundle = __webpack_require__(278); + + const DEPENDENCY_TYPES = (exports.DEPENDENCY_TYPES = [ + 'devDependencies', + 'dependencies', + 'optionalDependencies', + 'peerDependencies', + ]); + const OWNED_DEPENDENCY_TYPES = (exports.OWNED_DEPENDENCY_TYPES = [ + 'devDependencies', + 'dependencies', + 'optionalDependencies', + ]); + + const RESOLUTIONS = (exports.RESOLUTIONS = 'resolutions'); + const MANIFEST_FIELDS = (exports.MANIFEST_FIELDS = [ + RESOLUTIONS, + ...DEPENDENCY_TYPES, + ]); + + const SUPPORTED_NODE_VERSIONS = (exports.SUPPORTED_NODE_VERSIONS = + '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0'); + + const YARN_REGISTRY = (exports.YARN_REGISTRY = + 'https://registry.yarnpkg.com'); + const NPM_REGISTRY_RE = (exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g); + + const YARN_DOCS = (exports.YARN_DOCS = + 'https://yarnpkg.com/en/docs/cli/'); + const YARN_INSTALLER_SH = (exports.YARN_INSTALLER_SH = + 'https://yarnpkg.com/install.sh'); + const YARN_INSTALLER_MSI = (exports.YARN_INSTALLER_MSI = + 'https://yarnpkg.com/latest.msi'); + + const SELF_UPDATE_VERSION_URL = (exports.SELF_UPDATE_VERSION_URL = + 'https://yarnpkg.com/latest-version'); + + // cache version, bump whenever we make backwards incompatible changes + const CACHE_VERSION = (exports.CACHE_VERSION = 6); + + // lockfile version, bump whenever we make backwards incompatible changes + const LOCKFILE_VERSION = (exports.LOCKFILE_VERSION = 1); + + // max amount of network requests to perform concurrently + const NETWORK_CONCURRENCY = (exports.NETWORK_CONCURRENCY = 8); + + // HTTP timeout used when downloading packages + const NETWORK_TIMEOUT = (exports.NETWORK_TIMEOUT = 30 * 1000); // in milliseconds + + // max amount of child processes to execute concurrently + const CHILD_CONCURRENCY = (exports.CHILD_CONCURRENCY = 5); + + const REQUIRED_PACKAGE_KEYS = (exports.REQUIRED_PACKAGE_KEYS = [ + 'name', + 'version', + '_uid', + ]); + + function getPreferredCacheDirectories() { + const preferredCacheDirectories = [getCacheDir()]; + + if (process.getuid) { + // $FlowFixMe: process.getuid exists, dammit + preferredCacheDirectories.push( + path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`), + ); + } + + preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`)); + + return preferredCacheDirectories; + } + + const PREFERRED_MODULE_CACHE_DIRECTORIES = (exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories()); + const CONFIG_DIRECTORY = (exports.CONFIG_DIRECTORY = getConfigDir()); + const DATA_DIRECTORY = (exports.DATA_DIRECTORY = getDataDir()); + const LINK_REGISTRY_DIRECTORY = (exports.LINK_REGISTRY_DIRECTORY = path.join( + DATA_DIRECTORY, + 'link', + )); + const GLOBAL_MODULE_DIRECTORY = (exports.GLOBAL_MODULE_DIRECTORY = path.join( + DATA_DIRECTORY, + 'global', + )); + + const NODE_BIN_PATH = (exports.NODE_BIN_PATH = process.execPath); + const YARN_BIN_PATH = (exports.YARN_BIN_PATH = getYarnBinPath()); + + // Webpack needs to be configured with node.__dirname/__filename = false + function getYarnBinPath() { + if (isWebpackBundle) { + return __filename; + } else { + return path.join(__dirname, '..', 'bin', 'yarn.js'); + } + } + + const NODE_MODULES_FOLDER = (exports.NODE_MODULES_FOLDER = + 'node_modules'); + const NODE_PACKAGE_JSON = (exports.NODE_PACKAGE_JSON = 'package.json'); + + const PNP_FILENAME = (exports.PNP_FILENAME = '.pnp.js'); + + const POSIX_GLOBAL_PREFIX = (exports.POSIX_GLOBAL_PREFIX = `${process.env + .DESTDIR || ''}/usr/local`); + const FALLBACK_GLOBAL_PREFIX = (exports.FALLBACK_GLOBAL_PREFIX = path.join( + userHome, + '.yarn', + )); + + const META_FOLDER = (exports.META_FOLDER = '.yarn-meta'); + const INTEGRITY_FILENAME = (exports.INTEGRITY_FILENAME = + '.yarn-integrity'); + const LOCKFILE_FILENAME = (exports.LOCKFILE_FILENAME = 'yarn.lock'); + const METADATA_FILENAME = (exports.METADATA_FILENAME = + '.yarn-metadata.json'); + const TARBALL_FILENAME = (exports.TARBALL_FILENAME = '.yarn-tarball.tgz'); + const CLEAN_FILENAME = (exports.CLEAN_FILENAME = '.yarnclean'); + + const NPM_LOCK_FILENAME = (exports.NPM_LOCK_FILENAME = + 'package-lock.json'); + const NPM_SHRINKWRAP_FILENAME = (exports.NPM_SHRINKWRAP_FILENAME = + 'npm-shrinkwrap.json'); + + const DEFAULT_INDENT = (exports.DEFAULT_INDENT = ' '); + const SINGLE_INSTANCE_PORT = (exports.SINGLE_INSTANCE_PORT = 31997); + const SINGLE_INSTANCE_FILENAME = (exports.SINGLE_INSTANCE_FILENAME = + '.yarn-single-instance'); + + const ENV_PATH_KEY = (exports.ENV_PATH_KEY = getPathKey( + process.platform, + process.env, + )); + + function getPathKey(platform, env) { + let pathKey = 'PATH'; + + // windows calls its path "Path" usually, but this is not guaranteed. + if (platform === 'win32') { + pathKey = 'Path'; + + for (const key in env) { + if (key.toLowerCase() === 'path') { + pathKey = key; + } + } + } + + return pathKey; + } + + const VERSION_COLOR_SCHEME = (exports.VERSION_COLOR_SCHEME = { + major: 'red', + premajor: 'red', + minor: 'yellow', + preminor: 'yellow', + patch: 'green', + prepatch: 'green', + prerelease: 'red', + unchanged: 'white', + unknown: 'red', + }); + + /***/ + }, + /* 9 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + /** + * Copyright (c) 2013-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ + + /** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + + var NODE_ENV = process.env.NODE_ENV; + + var invariant = function(condition, format, a, b, c, d, e, f) { + if (NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error( + 'Minified exception occurred; use the non-minified dev environment ' + + 'for the full error message and additional helpful warnings.', + ); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error( + format.replace(/%s/g, function() { + return args[argIndex++]; + }), + ); + error.name = 'Invariant Violation'; + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } + }; + + module.exports = invariant; + + /***/ + }, + /* 10 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + var YAMLException = __webpack_require__(54); + + var TYPE_CONSTRUCTOR_OPTIONS = [ + 'kind', + 'resolve', + 'construct', + 'instanceOf', + 'predicate', + 'represent', + 'defaultStyle', + 'styleAliases', + ]; + + var YAML_NODE_KINDS = ['scalar', 'sequence', 'mapping']; + + function compileStyleAliases(map) { + var result = {}; + + if (map !== null) { + Object.keys(map).forEach(function(style) { + map[style].forEach(function(alias) { + result[String(alias)] = style; + }); + }); + } + + return result; + } + + function Type(tag, options) { + options = options || {}; + + Object.keys(options).forEach(function(name) { + if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { + throw new YAMLException( + 'Unknown option "' + + name + + '" is met in definition of "' + + tag + + '" YAML type.', + ); + } + }); + + // TODO: Add tag format check. + this.tag = tag; + this.kind = options['kind'] || null; + this.resolve = + options['resolve'] || + function() { + return true; + }; + this.construct = + options['construct'] || + function(data) { + return data; + }; + this.instanceOf = options['instanceOf'] || null; + this.predicate = options['predicate'] || null; + this.represent = options['represent'] || null; + this.defaultStyle = options['defaultStyle'] || null; + this.styleAliases = compileStyleAliases( + options['styleAliases'] || null, + ); + + if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { + throw new YAMLException( + 'Unknown kind "' + + this.kind + + '" is specified for "' + + tag + + '" YAML type.', + ); + } + } + + module.exports = Type; + + /***/ + }, + /* 11 */ + /***/ function(module, exports) { + module.exports = require('crypto'); + + /***/ + }, + /* 12 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'a', + function() { + return Observable; + }, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__( + 322, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__( + 932, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__( + 117, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__( + 324, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__( + 185, + ); + /** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */ + + var Observable = /*@__PURE__*/ (function() { + function Observable(subscribe) { + this._isScalar = false; + if (subscribe) { + this._subscribe = subscribe; + } + } + Observable.prototype.lift = function(operator) { + var observable = new Observable(); + observable.source = this; + observable.operator = operator; + return observable; + }; + Observable.prototype.subscribe = function( + observerOrNext, + error, + complete, + ) { + var operator = this.operator; + var sink = __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__[ + 'a' /* toSubscriber */ + ], + )(observerOrNext, error, complete); + if (operator) { + operator.call(sink, this.source); + } else { + sink.add( + this.source || + (__WEBPACK_IMPORTED_MODULE_4__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling && + !sink.syncErrorThrowable) + ? this._subscribe(sink) + : this._trySubscribe(sink), + ); + } + if ( + __WEBPACK_IMPORTED_MODULE_4__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling + ) { + if (sink.syncErrorThrowable) { + sink.syncErrorThrowable = false; + if (sink.syncErrorThrown) { + throw sink.syncErrorValue; + } + } + } + return sink; + }; + Observable.prototype._trySubscribe = function(sink) { + try { + return this._subscribe(sink); + } catch (err) { + if ( + __WEBPACK_IMPORTED_MODULE_4__config__['a' /* config */] + .useDeprecatedSynchronousErrorHandling + ) { + sink.syncErrorThrown = true; + sink.syncErrorValue = err; + } + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_0__util_canReportError__[ + 'a' /* canReportError */ + ], + )(sink) + ) { + sink.error(err); + } else { + console.warn(err); + } + } + }; + Observable.prototype.forEach = function(next, promiseCtor) { + var _this = this; + promiseCtor = getPromiseCtor(promiseCtor); + return new promiseCtor(function(resolve, reject) { + var subscription; + subscription = _this.subscribe( + function(value) { + try { + next(value); + } catch (err) { + reject(err); + if (subscription) { + subscription.unsubscribe(); + } + } + }, + reject, + resolve, + ); + }); + }; + Observable.prototype._subscribe = function(subscriber) { + var source = this.source; + return source && source.subscribe(subscriber); + }; + Observable.prototype[ + __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__[ + 'a' /* observable */ + ] + ] = function() { + return this; + }; + Observable.prototype.pipe = function() { + var operations = []; + for (var _i = 0; _i < arguments.length; _i++) { + operations[_i] = arguments[_i]; + } + if (operations.length === 0) { + return this; + } + return __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_3__util_pipe__['b' /* pipeFromArray */], + )(operations)(this); + }; + Observable.prototype.toPromise = function(promiseCtor) { + var _this = this; + promiseCtor = getPromiseCtor(promiseCtor); + return new promiseCtor(function(resolve, reject) { + var value; + _this.subscribe( + function(x) { + return (value = x); + }, + function(err) { + return reject(err); + }, + function() { + return resolve(value); + }, + ); + }); + }; + Observable.create = function(subscribe) { + return new Observable(subscribe); + }; + return Observable; + })(); + + function getPromiseCtor(promiseCtor) { + if (!promiseCtor) { + promiseCtor = + __WEBPACK_IMPORTED_MODULE_4__config__['a' /* config */].Promise || + Promise; + } + if (!promiseCtor) { + throw new Error('no Promise impl found'); + } + return promiseCtor; + } + //# sourceMappingURL=Observable.js.map + + /***/ + }, + /* 13 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'a', + function() { + return OuterSubscriber; + }, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__( + 1, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__( + 7, + ); + /** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */ + + var OuterSubscriber = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + OuterSubscriber, + _super, + ); + function OuterSubscriber() { + return (_super !== null && _super.apply(this, arguments)) || this; + } + OuterSubscriber.prototype.notifyNext = function( + outerValue, + innerValue, + outerIndex, + innerIndex, + innerSub, + ) { + this.destination.next(innerValue); + }; + OuterSubscriber.prototype.notifyError = function(error, innerSub) { + this.destination.error(error); + }; + OuterSubscriber.prototype.notifyComplete = function(innerSub) { + this.destination.complete(); + }; + return OuterSubscriber; + })(__WEBPACK_IMPORTED_MODULE_1__Subscriber__['a' /* Subscriber */]); + + //# sourceMappingURL=OuterSubscriber.js.map + + /***/ + }, + /* 14 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (immutable) */ __webpack_exports__[ + 'a' + ] = subscribeToResult; + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__( + 84, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__( + 446, + ); + /** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */ + + function subscribeToResult( + outerSubscriber, + result, + outerValue, + outerIndex, + destination, + ) { + if (destination === void 0) { + destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__[ + 'a' /* InnerSubscriber */ + ](outerSubscriber, outerValue, outerIndex); + } + if (destination.closed) { + return; + } + return __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_1__subscribeTo__['a' /* subscribeTo */], + )(result)(destination); + } + //# sourceMappingURL=subscribeToResult.js.map + + /***/ + }, + /* 15 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + /* eslint-disable node/no-deprecated-api */ + + var buffer = __webpack_require__(64); + var Buffer = buffer.Buffer; + + var safer = {}; + + var key; + + for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue; + if (key === 'SlowBuffer' || key === 'Buffer') continue; + safer[key] = buffer[key]; + } + + var Safer = (safer.Buffer = {}); + for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue; + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue; + Safer[key] = Buffer[key]; + } + + safer.Buffer.prototype = Buffer.prototype; + + if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function(value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError( + 'The "value" argument must not be of type number. Received type ' + + typeof value, + ); + } + if (value && typeof value.length === 'undefined') { + throw new TypeError( + 'The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + + typeof value, + ); + } + return Buffer(value, encodingOrOffset, length); + }; + } + + if (!Safer.alloc) { + Safer.alloc = function(size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError( + 'The "size" argument must be of type number. Received type ' + + typeof size, + ); + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError( + 'The value "' + size + '" is invalid for option "size"', + ); + } + var buf = Buffer(size); + if (!fill || fill.length === 0) { + buf.fill(0); + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding); + } else { + buf.fill(fill); + } + return buf; + }; + } + + if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength; + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } + } + + if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength, + }; + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength; + } + } + + module.exports = safer; + + /***/ + }, + /* 16 */ + /***/ function(module, exports, __webpack_require__) { + // Copyright (c) 2012, Mark Cavage. All rights reserved. + // Copyright 2015 Joyent, Inc. + + var assert = __webpack_require__(28); + var Stream = __webpack_require__(23).Stream; + var util = __webpack_require__(3); + + ///--- Globals + + /* JSSTYLED */ + var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + ///--- Internal + + function _capitalize(str) { + return str.charAt(0).toUpperCase() + str.slice(1); + } + + function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: actual === undefined ? typeof arg : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller, + }); + } + + function _getClass(arg) { + return Object.prototype.toString.call(arg).slice(8, -1); + } + + function noop() { + // Why even bother with asserts? + } + + ///--- Exports + + var types = { + bool: { + check: function(arg) { + return typeof arg === 'boolean'; + }, + }, + func: { + check: function(arg) { + return typeof arg === 'function'; + }, + }, + string: { + check: function(arg) { + return typeof arg === 'string'; + }, + }, + object: { + check: function(arg) { + return typeof arg === 'object' && arg !== null; + }, + }, + number: { + check: function(arg) { + return typeof arg === 'number' && !isNaN(arg); + }, + }, + finite: { + check: function(arg) { + return typeof arg === 'number' && !isNaN(arg) && isFinite(arg); + }, + }, + buffer: { + check: function(arg) { + return Buffer.isBuffer(arg); + }, + operator: 'Buffer.isBuffer', + }, + array: { + check: function(arg) { + return Array.isArray(arg); + }, + operator: 'Array.isArray', + }, + stream: { + check: function(arg) { + return arg instanceof Stream; + }, + operator: 'instanceof', + actual: _getClass, + }, + date: { + check: function(arg) { + return arg instanceof Date; + }, + operator: 'instanceof', + actual: _getClass, + }, + regexp: { + check: function(arg) { + return arg instanceof RegExp; + }, + operator: 'instanceof', + actual: _getClass, + }, + uuid: { + check: function(arg) { + return typeof arg === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID', + }, + }; + + function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function(arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function(k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function(arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function(k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function(arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function(k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function(arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function(k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function(arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function(k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; + } + + module.exports = _setExports(process.env.NODE_NDEBUG); + + /***/ + }, + /* 17 */ + /***/ function(module, exports) { + // https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 + var global = (module.exports = + typeof window != 'undefined' && window.Math == Math + ? window + : typeof self != 'undefined' && self.Math == Math + ? self + : // eslint-disable-next-line no-new-func + Function('return this')()); + if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef + + /***/ + }, + /* 18 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.sortAlpha = sortAlpha; + exports.sortOptionsByFlags = sortOptionsByFlags; + exports.entries = entries; + exports.removePrefix = removePrefix; + exports.removeSuffix = removeSuffix; + exports.addSuffix = addSuffix; + exports.hyphenate = hyphenate; + exports.camelCase = camelCase; + exports.compareSortedArrays = compareSortedArrays; + exports.sleep = sleep; + const _camelCase = __webpack_require__(230); + + function sortAlpha(a, b) { + // sort alphabetically in a deterministic way + const shortLen = Math.min(a.length, b.length); + for (let i = 0; i < shortLen; i++) { + const aChar = a.charCodeAt(i); + const bChar = b.charCodeAt(i); + if (aChar !== bChar) { + return aChar - bChar; + } + } + return a.length - b.length; + } + + function sortOptionsByFlags(a, b) { + const aOpt = a.flags.replace(/-/g, ''); + const bOpt = b.flags.replace(/-/g, ''); + return sortAlpha(aOpt, bOpt); + } + + function entries(obj) { + const entries = []; + if (obj) { + for (const key in obj) { + entries.push([key, obj[key]]); + } + } + return entries; + } + + function removePrefix(pattern, prefix) { + if (pattern.startsWith(prefix)) { + pattern = pattern.slice(prefix.length); + } + + return pattern; + } + + function removeSuffix(pattern, suffix) { + if (pattern.endsWith(suffix)) { + return pattern.slice(0, -suffix.length); + } + + return pattern; + } + + function addSuffix(pattern, suffix) { + if (!pattern.endsWith(suffix)) { + return pattern + suffix; + } + + return pattern; + } + + function hyphenate(str) { + return str.replace(/[A-Z]/g, match => { + return '-' + match.charAt(0).toLowerCase(); + }); + } + + function camelCase(str) { + if (/[A-Z]/.test(str)) { + return null; + } else { + return _camelCase(str); + } + } + + function compareSortedArrays(array1, array2) { + if (array1.length !== array2.length) { + return false; + } + for (let i = 0, len = array1.length; i < len; i++) { + if (array1[i] !== array2[i]) { + return false; + } + } + return true; + } + + function sleep(ms) { + return new Promise(resolve => { + setTimeout(resolve, ms); + }); + } + + /***/ + }, + /* 19 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.stringify = exports.parse = undefined; + + var _asyncToGenerator2; + + function _load_asyncToGenerator() { + return (_asyncToGenerator2 = _interopRequireDefault( + __webpack_require__(2), + )); + } + + var _parse; + + function _load_parse() { + return (_parse = __webpack_require__(105)); + } + + Object.defineProperty(exports, 'parse', { + enumerable: true, + get: function get() { + return _interopRequireDefault(_parse || _load_parse()).default; + }, + }); + + var _stringify; + + function _load_stringify() { + return (_stringify = __webpack_require__(199)); + } + + Object.defineProperty(exports, 'stringify', { + enumerable: true, + get: function get() { + return _interopRequireDefault(_stringify || _load_stringify()) + .default; + }, + }); + exports.implodeEntry = implodeEntry; + exports.explodeEntry = explodeEntry; + + var _misc; + + function _load_misc() { + return (_misc = __webpack_require__(18)); + } + + var _normalizePattern; + + function _load_normalizePattern() { + return (_normalizePattern = __webpack_require__(37)); + } + + var _parse2; + + function _load_parse2() { + return (_parse2 = _interopRequireDefault(__webpack_require__(105))); + } + + var _constants; + + function _load_constants() { + return (_constants = __webpack_require__(8)); + } + + var _fs; + + function _load_fs() { + return (_fs = _interopRequireWildcard(__webpack_require__(4))); + } + + function _interopRequireWildcard(obj) { + if (obj && obj.__esModule) { + return obj; + } else { + var newObj = {}; + if (obj != null) { + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) + newObj[key] = obj[key]; + } + } + newObj.default = obj; + return newObj; + } + } + + function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { default: obj }; + } + + const invariant = __webpack_require__(9); + + const path = __webpack_require__(0); + const ssri = __webpack_require__(65); + + function getName(pattern) { + return (0, + (_normalizePattern || _load_normalizePattern()).normalizePattern)( + pattern, + ).name; + } + + function blankObjectUndefined(obj) { + return obj && Object.keys(obj).length ? obj : undefined; + } + + function keyForRemote(remote) { + return ( + remote.resolved || + (remote.reference && remote.hash + ? `${remote.reference}#${remote.hash}` + : null) + ); + } + + function serializeIntegrity(integrity) { + // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output + // See https://git.io/vx2Hy + return integrity + .toString() + .split(' ') + .sort() + .join(' '); + } + + function implodeEntry(pattern, obj) { + const inferredName = getName(pattern); + const integrity = obj.integrity + ? serializeIntegrity(obj.integrity) + : ''; + const imploded = { + name: inferredName === obj.name ? undefined : obj.name, + version: obj.version, + uid: obj.uid === obj.version ? undefined : obj.uid, + resolved: obj.resolved, + registry: obj.registry === 'npm' ? undefined : obj.registry, + dependencies: blankObjectUndefined(obj.dependencies), + optionalDependencies: blankObjectUndefined(obj.optionalDependencies), + permissions: blankObjectUndefined(obj.permissions), + prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants), + }; + if (integrity) { + imploded.integrity = integrity; + } + return imploded; + } + + function explodeEntry(pattern, obj) { + obj.optionalDependencies = obj.optionalDependencies || {}; + obj.dependencies = obj.dependencies || {}; + obj.uid = obj.uid || obj.version; + obj.permissions = obj.permissions || {}; + obj.registry = obj.registry || 'npm'; + obj.name = obj.name || getName(pattern); + const integrity = obj.integrity; + if (integrity && integrity.isIntegrity) { + obj.integrity = ssri.parse(integrity); + } + return obj; + } + + class Lockfile { + constructor({ cache, source, parseResultType } = {}) { + this.source = source || ''; + this.cache = cache; + this.parseResultType = parseResultType; + } + + // source string if the `cache` was parsed + + // if true, we're parsing an old yarn file and need to update integrity fields + hasEntriesExistWithoutIntegrity() { + if (!this.cache) { + return false; + } + + for (const key in this.cache) { + // $FlowFixMe - `this.cache` is clearly defined at this point + if ( + !/^.*@(file:|http)/.test(key) && + this.cache[key] && + !this.cache[key].integrity + ) { + return true; + } + } + + return false; + } + + static fromDirectory(dir, reporter) { + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + // read the manifest in this directory + const lockfileLoc = path.join( + dir, + (_constants || _load_constants()).LOCKFILE_FILENAME, + ); + + let lockfile; + let rawLockfile = ''; + let parseResult; + + if (yield (_fs || _load_fs()).exists(lockfileLoc)) { + rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); + parseResult = (0, (_parse2 || _load_parse2()).default)( + rawLockfile, + lockfileLoc, + ); + + if (reporter) { + if (parseResult.type === 'merge') { + reporter.info(reporter.lang('lockfileMerged')); + } else if (parseResult.type === 'conflict') { + reporter.warn(reporter.lang('lockfileConflict')); + } + } + + lockfile = parseResult.object; + } else if (reporter) { + reporter.info(reporter.lang('noLockfileFound')); + } + + if (lockfile && lockfile.__metadata) { + const lockfilev2 = lockfile; + lockfile = {}; + } + + return new Lockfile({ + cache: lockfile, + source: rawLockfile, + parseResultType: parseResult && parseResult.type, + }); + }, + )(); + } + + getLocked(pattern) { + const cache = this.cache; + if (!cache) { + return undefined; + } + + const shrunk = pattern in cache && cache[pattern]; + + if (typeof shrunk === 'string') { + return this.getLocked(shrunk); + } else if (shrunk) { + explodeEntry(pattern, shrunk); + return shrunk; + } + + return undefined; + } + + removePattern(pattern) { + const cache = this.cache; + if (!cache) { + return; + } + delete cache[pattern]; + } + + getLockfile(patterns) { + const lockfile = {}; + const seen = new Map(); + + // order by name so that lockfile manifest is assigned to the first dependency with this manifest + // the others that have the same remoteKey will just refer to the first + // ordering allows for consistency in lockfile when it is serialized + const sortedPatternsKeys = Object.keys(patterns).sort( + (_misc || _load_misc()).sortAlpha, + ); + + for ( + var _iterator = sortedPatternsKeys, + _isArray = Array.isArray(_iterator), + _i = 0, + _iterator = _isArray ? _iterator : _iterator[Symbol.iterator](); + ; + + ) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const pattern = _ref; + + const pkg = patterns[pattern]; + const remote = pkg._remote, + ref = pkg._reference; + + invariant(ref, 'Package is missing a reference'); + invariant(remote, 'Package is missing a remote'); + + const remoteKey = keyForRemote(remote); + const seenPattern = remoteKey && seen.get(remoteKey); + if (seenPattern) { + // no point in duplicating it + lockfile[pattern] = seenPattern; + + // if we're relying on our name being inferred and two of the patterns have + // different inferred names then we need to set it + if (!seenPattern.name && getName(pattern) !== pkg.name) { + seenPattern.name = pkg.name; + } + continue; + } + const obj = implodeEntry(pattern, { + name: pkg.name, + version: pkg.version, + uid: pkg._uid, + resolved: remote.resolved, + integrity: remote.integrity, + registry: remote.registry, + dependencies: pkg.dependencies, + peerDependencies: pkg.peerDependencies, + optionalDependencies: pkg.optionalDependencies, + permissions: ref.permissions, + prebuiltVariants: pkg.prebuiltVariants, + }); + + lockfile[pattern] = obj; + + if (remoteKey) { + seen.set(remoteKey, obj); + } + } + + return lockfile; + } + } + exports.default = Lockfile; + + /***/ + }, + /* 20 */ + /***/ function(module, exports, __webpack_require__) { + var store = __webpack_require__(133)('wks'); + var uid = __webpack_require__(137); + var Symbol = __webpack_require__(17).Symbol; + var USE_SYMBOL = typeof Symbol == 'function'; + + var $exports = (module.exports = function(name) { + return ( + store[name] || + (store[name] = + (USE_SYMBOL && Symbol[name]) || + (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)) + ); + }); + + $exports.store = store; + + /***/ + }, + /* 21 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + exports.__esModule = true; + + var _assign = __webpack_require__(591); + + var _assign2 = _interopRequireDefault(_assign); + + function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { default: obj }; + } + + exports.default = + _assign2.default || + function(target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }; + + /***/ + }, + /* 22 */ + /***/ function(module, exports) { + exports = module.exports = SemVer; + + // The debug function is excluded entirely from the minified version. + /* nomin */ var debug; + /* nomin */ if ( + typeof process === 'object' && + /* nomin */ process.env && + /* nomin */ process.env.NODE_DEBUG && + /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG) + ) + /* nomin */ debug = function() { + /* nomin */ var args = Array.prototype.slice.call(arguments, 0); + /* nomin */ args.unshift('SEMVER'); + /* nomin */ console.log.apply(console, args); + /* nomin */ + }; + /* nomin */ + /* nomin */ else debug = function() {}; + + // Note: this is the semver.org version of the spec that it implements + // Not necessarily the package version of this code. + exports.SEMVER_SPEC_VERSION = '2.0.0'; + + var MAX_LENGTH = 256; + var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; + + // Max safe segment length for coercion. + var MAX_SAFE_COMPONENT_LENGTH = 16; + + // The actual regexps go on exports.re + var re = (exports.re = []); + var src = (exports.src = []); + var R = 0; + + // The following Regular Expressions can be used for tokenizing, + // validating, and parsing SemVer version strings. + + // ## Numeric Identifier + // A single `0`, or a non-zero digit followed by zero or more digits. + + var NUMERICIDENTIFIER = R++; + src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; + var NUMERICIDENTIFIERLOOSE = R++; + src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; + + // ## Non-numeric Identifier + // Zero or more digits, followed by a letter or hyphen, and then zero or + // more letters, digits, or hyphens. + + var NONNUMERICIDENTIFIER = R++; + src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; + + // ## Main Version + // Three dot-separated numeric identifiers. + + var MAINVERSION = R++; + src[MAINVERSION] = + '(' + + src[NUMERICIDENTIFIER] + + ')\\.' + + '(' + + src[NUMERICIDENTIFIER] + + ')\\.' + + '(' + + src[NUMERICIDENTIFIER] + + ')'; + + var MAINVERSIONLOOSE = R++; + src[MAINVERSIONLOOSE] = + '(' + + src[NUMERICIDENTIFIERLOOSE] + + ')\\.' + + '(' + + src[NUMERICIDENTIFIERLOOSE] + + ')\\.' + + '(' + + src[NUMERICIDENTIFIERLOOSE] + + ')'; + + // ## Pre-release Version Identifier + // A numeric identifier, or a non-numeric identifier. + + var PRERELEASEIDENTIFIER = R++; + src[PRERELEASEIDENTIFIER] = + '(?:' + src[NUMERICIDENTIFIER] + '|' + src[NONNUMERICIDENTIFIER] + ')'; + + var PRERELEASEIDENTIFIERLOOSE = R++; + src[PRERELEASEIDENTIFIERLOOSE] = + '(?:' + + src[NUMERICIDENTIFIERLOOSE] + + '|' + + src[NONNUMERICIDENTIFIER] + + ')'; + + // ## Pre-release Version + // Hyphen, followed by one or more dot-separated pre-release version + // identifiers. + + var PRERELEASE = R++; + src[PRERELEASE] = + '(?:-(' + + src[PRERELEASEIDENTIFIER] + + '(?:\\.' + + src[PRERELEASEIDENTIFIER] + + ')*))'; + + var PRERELEASELOOSE = R++; + src[PRERELEASELOOSE] = + '(?:-?(' + + src[PRERELEASEIDENTIFIERLOOSE] + + '(?:\\.' + + src[PRERELEASEIDENTIFIERLOOSE] + + ')*))'; + + // ## Build Metadata Identifier + // Any combination of digits, letters, or hyphens. + + var BUILDIDENTIFIER = R++; + src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; + + // ## Build Metadata + // Plus sign, followed by one or more period-separated build metadata + // identifiers. + + var BUILD = R++; + src[BUILD] = + '(?:\\+(' + + src[BUILDIDENTIFIER] + + '(?:\\.' + + src[BUILDIDENTIFIER] + + ')*))'; + + // ## Full Version String + // A main version, followed optionally by a pre-release version and + // build metadata. + + // Note that the only major, minor, patch, and pre-release sections of + // the version string are capturing groups. The build metadata is not a + // capturing group, because it should not ever be used in version + // comparison. + + var FULL = R++; + var FULLPLAIN = + 'v?' + src[MAINVERSION] + src[PRERELEASE] + '?' + src[BUILD] + '?'; + + src[FULL] = '^' + FULLPLAIN + '$'; + + // like full, but allows v1.2.3 and =1.2.3, which people do sometimes. + // also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty + // common in the npm registry. + var LOOSEPLAIN = + '[v=\\s]*' + + src[MAINVERSIONLOOSE] + + src[PRERELEASELOOSE] + + '?' + + src[BUILD] + + '?'; + + var LOOSE = R++; + src[LOOSE] = '^' + LOOSEPLAIN + '$'; + + var GTLT = R++; + src[GTLT] = '((?:<|>)?=?)'; + + // Something like "2.*" or "1.2.x". + // Note that "x.x" is a valid xRange identifer, meaning "any version" + // Only the first item is strictly required. + var XRANGEIDENTIFIERLOOSE = R++; + src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; + var XRANGEIDENTIFIER = R++; + src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; + + var XRANGEPLAIN = R++; + src[XRANGEPLAIN] = + '[v=\\s]*(' + + src[XRANGEIDENTIFIER] + + ')' + + '(?:\\.(' + + src[XRANGEIDENTIFIER] + + ')' + + '(?:\\.(' + + src[XRANGEIDENTIFIER] + + ')' + + '(?:' + + src[PRERELEASE] + + ')?' + + src[BUILD] + + '?' + + ')?)?'; + + var XRANGEPLAINLOOSE = R++; + src[XRANGEPLAINLOOSE] = + '[v=\\s]*(' + + src[XRANGEIDENTIFIERLOOSE] + + ')' + + '(?:\\.(' + + src[XRANGEIDENTIFIERLOOSE] + + ')' + + '(?:\\.(' + + src[XRANGEIDENTIFIERLOOSE] + + ')' + + '(?:' + + src[PRERELEASELOOSE] + + ')?' + + src[BUILD] + + '?' + + ')?)?'; + + var XRANGE = R++; + src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; + var XRANGELOOSE = R++; + src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; + + // Coercion. + // Extract anything that could conceivably be a part of a valid semver + var COERCE = R++; + src[COERCE] = + '(?:^|[^\\d])' + + '(\\d{1,' + + MAX_SAFE_COMPONENT_LENGTH + + '})' + + '(?:\\.(\\d{1,' + + MAX_SAFE_COMPONENT_LENGTH + + '}))?' + + '(?:\\.(\\d{1,' + + MAX_SAFE_COMPONENT_LENGTH + + '}))?' + + '(?:$|[^\\d])'; + + // Tilde ranges. + // Meaning is "reasonably at or greater than" + var LONETILDE = R++; + src[LONETILDE] = '(?:~>?)'; + + var TILDETRIM = R++; + src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; + re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); + var tildeTrimReplace = '$1~'; + + var TILDE = R++; + src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; + var TILDELOOSE = R++; + src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; + + // Caret ranges. + // Meaning is "at least and backwards compatible with" + var LONECARET = R++; + src[LONECARET] = '(?:\\^)'; + + var CARETTRIM = R++; + src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; + re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); + var caretTrimReplace = '$1^'; + + var CARET = R++; + src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; + var CARETLOOSE = R++; + src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; + + // A simple gt/lt/eq thing, or just "" to indicate "any version" + var COMPARATORLOOSE = R++; + src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; + var COMPARATOR = R++; + src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; + + // An expression to strip any whitespace between the gtlt and the thing + // it modifies, so that `> 1.2.3` ==> `>1.2.3` + var COMPARATORTRIM = R++; + src[COMPARATORTRIM] = + '(\\s*)' + + src[GTLT] + + '\\s*(' + + LOOSEPLAIN + + '|' + + src[XRANGEPLAIN] + + ')'; + + // this one has to use the /g flag + re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); + var comparatorTrimReplace = '$1$2$3'; + + // Something like `1.2.3 - 1.2.4` + // Note that these all use the loose form, because they'll be + // checked against either the strict or loose comparator form + // later. + var HYPHENRANGE = R++; + src[HYPHENRANGE] = + '^\\s*(' + + src[XRANGEPLAIN] + + ')' + + '\\s+-\\s+' + + '(' + + src[XRANGEPLAIN] + + ')' + + '\\s*$'; + + var HYPHENRANGELOOSE = R++; + src[HYPHENRANGELOOSE] = + '^\\s*(' + + src[XRANGEPLAINLOOSE] + + ')' + + '\\s+-\\s+' + + '(' + + src[XRANGEPLAINLOOSE] + + ')' + + '\\s*$'; + + // Star ranges basically just allow anything at all. + var STAR = R++; + src[STAR] = '(<|>)?=?\\s*\\*'; + + // Compile to actual regexp objects. + // All are flag-free, unless they were created above with a flag. + for (var i = 0; i < R; i++) { + debug(i, src[i]); + if (!re[i]) re[i] = new RegExp(src[i]); + } + + exports.parse = parse; + function parse(version, loose) { + if (version instanceof SemVer) return version; + + if (typeof version !== 'string') return null; + + if (version.length > MAX_LENGTH) return null; + + var r = loose ? re[LOOSE] : re[FULL]; + if (!r.test(version)) return null; + + try { + return new SemVer(version, loose); + } catch (er) { + return null; + } + } + + exports.valid = valid; + function valid(version, loose) { + var v = parse(version, loose); + return v ? v.version : null; + } + + exports.clean = clean; + function clean(version, loose) { + var s = parse(version.trim().replace(/^[=v]+/, ''), loose); + return s ? s.version : null; + } + + exports.SemVer = SemVer; + + function SemVer(version, loose) { + if (version instanceof SemVer) { + if (version.loose === loose) return version; + else version = version.version; + } else if (typeof version !== 'string') { + throw new TypeError('Invalid Version: ' + version); + } + + if (version.length > MAX_LENGTH) + throw new TypeError( + 'version is longer than ' + MAX_LENGTH + ' characters', + ); + + if (!(this instanceof SemVer)) return new SemVer(version, loose); + + debug('SemVer', version, loose); + this.loose = loose; + var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); + + if (!m) throw new TypeError('Invalid Version: ' + version); + + this.raw = version; + + // these are actually numbers + this.major = +m[1]; + this.minor = +m[2]; + this.patch = +m[3]; + + if (this.major > MAX_SAFE_INTEGER || this.major < 0) + throw new TypeError('Invalid major version'); + + if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) + throw new TypeError('Invalid minor version'); + + if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) + throw new TypeError('Invalid patch version'); + + // numberify any prerelease numeric ids + if (!m[4]) this.prerelease = []; + else + this.prerelease = m[4].split('.').map(function(id) { + if (/^[0-9]+$/.test(id)) { + var num = +id; + if (num >= 0 && num < MAX_SAFE_INTEGER) return num; + } + return id; + }); + + this.build = m[5] ? m[5].split('.') : []; + this.format(); + } + + SemVer.prototype.format = function() { + this.version = this.major + '.' + this.minor + '.' + this.patch; + if (this.prerelease.length) + this.version += '-' + this.prerelease.join('.'); + return this.version; + }; + + SemVer.prototype.toString = function() { + return this.version; + }; + + SemVer.prototype.compare = function(other) { + debug('SemVer.compare', this.version, this.loose, other); + if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); + + return this.compareMain(other) || this.comparePre(other); + }; + + SemVer.prototype.compareMain = function(other) { + if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); + + return ( + compareIdentifiers(this.major, other.major) || + compareIdentifiers(this.minor, other.minor) || + compareIdentifiers(this.patch, other.patch) + ); + }; + + SemVer.prototype.comparePre = function(other) { + if (!(other instanceof SemVer)) other = new SemVer(other, this.loose); + + // NOT having a prerelease is > having one + if (this.prerelease.length && !other.prerelease.length) return -1; + else if (!this.prerelease.length && other.prerelease.length) return 1; + else if (!this.prerelease.length && !other.prerelease.length) return 0; + + var i = 0; + do { + var a = this.prerelease[i]; + var b = other.prerelease[i]; + debug('prerelease compare', i, a, b); + if (a === undefined && b === undefined) return 0; + else if (b === undefined) return 1; + else if (a === undefined) return -1; + else if (a === b) continue; + else return compareIdentifiers(a, b); + } while (++i); + }; + + // preminor will bump the version up to the next minor release, and immediately + // down to pre-release. premajor and prepatch work the same way. + SemVer.prototype.inc = function(release, identifier) { + switch (release) { + case 'premajor': + this.prerelease.length = 0; + this.patch = 0; + this.minor = 0; + this.major++; + this.inc('pre', identifier); + break; + case 'preminor': + this.prerelease.length = 0; + this.patch = 0; + this.minor++; + this.inc('pre', identifier); + break; + case 'prepatch': + // If this is already a prerelease, it will bump to the next version + // drop any prereleases that might already exist, since they are not + // relevant at this point. + this.prerelease.length = 0; + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + // If the input is a non-prerelease version, this acts the same as + // prepatch. + case 'prerelease': + if (this.prerelease.length === 0) this.inc('patch', identifier); + this.inc('pre', identifier); + break; + + case 'major': + // If this is a pre-major version, bump up to the same major version. + // Otherwise increment major. + // 1.0.0-5 bumps to 1.0.0 + // 1.1.0 bumps to 2.0.0 + if ( + this.minor !== 0 || + this.patch !== 0 || + this.prerelease.length === 0 + ) + this.major++; + this.minor = 0; + this.patch = 0; + this.prerelease = []; + break; + case 'minor': + // If this is a pre-minor version, bump up to the same minor version. + // Otherwise increment minor. + // 1.2.0-5 bumps to 1.2.0 + // 1.2.1 bumps to 1.3.0 + if (this.patch !== 0 || this.prerelease.length === 0) this.minor++; + this.patch = 0; + this.prerelease = []; + break; + case 'patch': + // If this is not a pre-release version, it will increment the patch. + // If it is a pre-release it will bump up to the same patch version. + // 1.2.0-5 patches to 1.2.0 + // 1.2.0 patches to 1.2.1 + if (this.prerelease.length === 0) this.patch++; + this.prerelease = []; + break; + // This probably shouldn't be used publicly. + // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. + case 'pre': + if (this.prerelease.length === 0) this.prerelease = [0]; + else { + var i = this.prerelease.length; + while (--i >= 0) { + if (typeof this.prerelease[i] === 'number') { + this.prerelease[i]++; + i = -2; + } + } + if (i === -1) + // didn't increment anything + this.prerelease.push(0); + } + if (identifier) { + // 1.2.0-beta.1 bumps to 1.2.0-beta.2, + // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 + if (this.prerelease[0] === identifier) { + if (isNaN(this.prerelease[1])) + this.prerelease = [identifier, 0]; + } else this.prerelease = [identifier, 0]; + } + break; + + default: + throw new Error('invalid increment argument: ' + release); + } + this.format(); + this.raw = this.version; + return this; + }; + + exports.inc = inc; + function inc(version, release, loose, identifier) { + if (typeof loose === 'string') { + identifier = loose; + loose = undefined; + } + + try { + return new SemVer(version, loose).inc(release, identifier).version; + } catch (er) { + return null; + } + } + + exports.diff = diff; + function diff(version1, version2) { + if (eq(version1, version2)) { + return null; + } else { + var v1 = parse(version1); + var v2 = parse(version2); + if (v1.prerelease.length || v2.prerelease.length) { + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return 'pre' + key; + } + } + } + return 'prerelease'; + } + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return key; + } + } + } + } + } + + exports.compareIdentifiers = compareIdentifiers; + + var numeric = /^[0-9]+$/; + function compareIdentifiers(a, b) { + var anum = numeric.test(a); + var bnum = numeric.test(b); + + if (anum && bnum) { + a = +a; + b = +b; + } + + return anum && !bnum + ? -1 + : bnum && !anum + ? 1 + : a < b + ? -1 + : a > b + ? 1 + : 0; + } + + exports.rcompareIdentifiers = rcompareIdentifiers; + function rcompareIdentifiers(a, b) { + return compareIdentifiers(b, a); + } + + exports.major = major; + function major(a, loose) { + return new SemVer(a, loose).major; + } + + exports.minor = minor; + function minor(a, loose) { + return new SemVer(a, loose).minor; + } + + exports.patch = patch; + function patch(a, loose) { + return new SemVer(a, loose).patch; + } + + exports.compare = compare; + function compare(a, b, loose) { + return new SemVer(a, loose).compare(new SemVer(b, loose)); + } + + exports.compareLoose = compareLoose; + function compareLoose(a, b) { + return compare(a, b, true); + } + + exports.rcompare = rcompare; + function rcompare(a, b, loose) { + return compare(b, a, loose); + } + + exports.sort = sort; + function sort(list, loose) { + return list.sort(function(a, b) { + return exports.compare(a, b, loose); + }); + } + + exports.rsort = rsort; + function rsort(list, loose) { + return list.sort(function(a, b) { + return exports.rcompare(a, b, loose); + }); + } + + exports.gt = gt; + function gt(a, b, loose) { + return compare(a, b, loose) > 0; + } + + exports.lt = lt; + function lt(a, b, loose) { + return compare(a, b, loose) < 0; + } + + exports.eq = eq; + function eq(a, b, loose) { + return compare(a, b, loose) === 0; + } + + exports.neq = neq; + function neq(a, b, loose) { + return compare(a, b, loose) !== 0; + } + + exports.gte = gte; + function gte(a, b, loose) { + return compare(a, b, loose) >= 0; + } + + exports.lte = lte; + function lte(a, b, loose) { + return compare(a, b, loose) <= 0; + } + + exports.cmp = cmp; + function cmp(a, op, b, loose) { + var ret; + switch (op) { + case '===': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a === b; + break; + case '!==': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a !== b; + break; + case '': + case '=': + case '==': + ret = eq(a, b, loose); + break; + case '!=': + ret = neq(a, b, loose); + break; + case '>': + ret = gt(a, b, loose); + break; + case '>=': + ret = gte(a, b, loose); + break; + case '<': + ret = lt(a, b, loose); + break; + case '<=': + ret = lte(a, b, loose); + break; + default: + throw new TypeError('Invalid operator: ' + op); + } + return ret; + } + + exports.Comparator = Comparator; + function Comparator(comp, loose) { + if (comp instanceof Comparator) { + if (comp.loose === loose) return comp; + else comp = comp.value; + } + + if (!(this instanceof Comparator)) return new Comparator(comp, loose); + + debug('comparator', comp, loose); + this.loose = loose; + this.parse(comp); + + if (this.semver === ANY) this.value = ''; + else this.value = this.operator + this.semver.version; + + debug('comp', this); + } + + var ANY = {}; + Comparator.prototype.parse = function(comp) { + var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var m = comp.match(r); + + if (!m) throw new TypeError('Invalid comparator: ' + comp); + + this.operator = m[1]; + if (this.operator === '=') this.operator = ''; + + // if it literally is just '>' or '' then allow anything. + if (!m[2]) this.semver = ANY; + else this.semver = new SemVer(m[2], this.loose); + }; + + Comparator.prototype.toString = function() { + return this.value; + }; + + Comparator.prototype.test = function(version) { + debug('Comparator.test', version, this.loose); + + if (this.semver === ANY) return true; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + return cmp(version, this.operator, this.semver, this.loose); + }; + + Comparator.prototype.intersects = function(comp, loose) { + if (!(comp instanceof Comparator)) { + throw new TypeError('a Comparator is required'); + } + + var rangeTmp; + + if (this.operator === '') { + rangeTmp = new Range(comp.value, loose); + return satisfies(this.value, rangeTmp, loose); + } else if (comp.operator === '') { + rangeTmp = new Range(this.value, loose); + return satisfies(comp.semver, rangeTmp, loose); + } + + var sameDirectionIncreasing = + (this.operator === '>=' || this.operator === '>') && + (comp.operator === '>=' || comp.operator === '>'); + var sameDirectionDecreasing = + (this.operator === '<=' || this.operator === '<') && + (comp.operator === '<=' || comp.operator === '<'); + var sameSemVer = this.semver.version === comp.semver.version; + var differentDirectionsInclusive = + (this.operator === '>=' || this.operator === '<=') && + (comp.operator === '>=' || comp.operator === '<='); + var oppositeDirectionsLessThan = + cmp(this.semver, '<', comp.semver, loose) && + (this.operator === '>=' || this.operator === '>') && + (comp.operator === '<=' || comp.operator === '<'); + var oppositeDirectionsGreaterThan = + cmp(this.semver, '>', comp.semver, loose) && + (this.operator === '<=' || this.operator === '<') && + (comp.operator === '>=' || comp.operator === '>'); + + return ( + sameDirectionIncreasing || + sameDirectionDecreasing || + (sameSemVer && differentDirectionsInclusive) || + oppositeDirectionsLessThan || + oppositeDirectionsGreaterThan + ); + }; + + exports.Range = Range; + function Range(range, loose) { + if (range instanceof Range) { + if (range.loose === loose) { + return range; + } else { + return new Range(range.raw, loose); + } + } + + if (range instanceof Comparator) { + return new Range(range.value, loose); + } + + if (!(this instanceof Range)) return new Range(range, loose); + + this.loose = loose; + + // First, split based on boolean or || + this.raw = range; + this.set = range + .split(/\s*\|\|\s*/) + .map(function(range) { + return this.parseRange(range.trim()); + }, this) + .filter(function(c) { + // throw out any that are not relevant for whatever reason + return c.length; + }); + + if (!this.set.length) { + throw new TypeError('Invalid SemVer Range: ' + range); + } + + this.format(); + } + + Range.prototype.format = function() { + this.range = this.set + .map(function(comps) { + return comps.join(' ').trim(); + }) + .join('||') + .trim(); + return this.range; + }; + + Range.prototype.toString = function() { + return this.range; + }; + + Range.prototype.parseRange = function(range) { + var loose = this.loose; + range = range.trim(); + debug('range', range, loose); + // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` + var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; + range = range.replace(hr, hyphenReplace); + debug('hyphen replace', range); + // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` + range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); + debug('comparator trim', range, re[COMPARATORTRIM]); + + // `~ 1.2.3` => `~1.2.3` + range = range.replace(re[TILDETRIM], tildeTrimReplace); + + // `^ 1.2.3` => `^1.2.3` + range = range.replace(re[CARETTRIM], caretTrimReplace); + + // normalize spaces + range = range.split(/\s+/).join(' '); + + // At this point, the range is completely trimmed and + // ready to be split into comparators. + + var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var set = range + .split(' ') + .map(function(comp) { + return parseComparator(comp, loose); + }) + .join(' ') + .split(/\s+/); + if (this.loose) { + // in loose mode, throw out any that are not valid comparators + set = set.filter(function(comp) { + return !!comp.match(compRe); + }); + } + set = set.map(function(comp) { + return new Comparator(comp, loose); + }); + + return set; + }; + + Range.prototype.intersects = function(range, loose) { + if (!(range instanceof Range)) { + throw new TypeError('a Range is required'); + } + + return this.set.some(function(thisComparators) { + return thisComparators.every(function(thisComparator) { + return range.set.some(function(rangeComparators) { + return rangeComparators.every(function(rangeComparator) { + return thisComparator.intersects(rangeComparator, loose); + }); + }); + }); + }); + }; + + // Mostly just for testing and legacy API reasons + exports.toComparators = toComparators; + function toComparators(range, loose) { + return new Range(range, loose).set.map(function(comp) { + return comp + .map(function(c) { + return c.value; + }) + .join(' ') + .trim() + .split(' '); + }); + } + + // comprised of xranges, tildes, stars, and gtlt's at this point. + // already replaced the hyphen ranges + // turn into a set of JUST comparators. + function parseComparator(comp, loose) { + debug('comp', comp); + comp = replaceCarets(comp, loose); + debug('caret', comp); + comp = replaceTildes(comp, loose); + debug('tildes', comp); + comp = replaceXRanges(comp, loose); + debug('xrange', comp); + comp = replaceStars(comp, loose); + debug('stars', comp); + return comp; + } + + function isX(id) { + return !id || id.toLowerCase() === 'x' || id === '*'; + } + + // ~, ~> --> * (any, kinda silly) + // ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 + // ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 + // ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 + // ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 + // ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 + function replaceTildes(comp, loose) { + return comp + .trim() + .split(/\s+/) + .map(function(comp) { + return replaceTilde(comp, loose); + }) + .join(' '); + } + + function replaceTilde(comp, loose) { + var r = loose ? re[TILDELOOSE] : re[TILDE]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('tilde', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) ret = ''; + else if (isX(m)) ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) + // ~1.2 == >=1.2.0 <1.3.0 + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else if (pr) { + debug('replaceTilde pr', pr); + if (pr.charAt(0) !== '-') pr = '-' + pr; + ret = + '>=' + + M + + '.' + + m + + '.' + + p + + pr + + ' <' + + M + + '.' + + (+m + 1) + + '.0'; + } + // ~1.2.3 == >=1.2.3 <1.3.0 + else + ret = + '>=' + M + '.' + m + '.' + p + ' <' + M + '.' + (+m + 1) + '.0'; + + debug('tilde return', ret); + return ret; + }); + } + + // ^ --> * (any, kinda silly) + // ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 + // ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 + // ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 + // ^1.2.3 --> >=1.2.3 <2.0.0 + // ^1.2.0 --> >=1.2.0 <2.0.0 + function replaceCarets(comp, loose) { + return comp + .trim() + .split(/\s+/) + .map(function(comp) { + return replaceCaret(comp, loose); + }) + .join(' '); + } + + function replaceCaret(comp, loose) { + debug('caret', comp, loose); + var r = loose ? re[CARETLOOSE] : re[CARET]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('caret', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) ret = ''; + else if (isX(m)) ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) { + if (M === '0') + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; + } else if (pr) { + debug('replaceCaret pr', pr); + if (pr.charAt(0) !== '-') pr = '-' + pr; + if (M === '0') { + if (m === '0') + ret = + '>=' + + M + + '.' + + m + + '.' + + p + + pr + + ' <' + + M + + '.' + + m + + '.' + + (+p + 1); + else + ret = + '>=' + + M + + '.' + + m + + '.' + + p + + pr + + ' <' + + M + + '.' + + (+m + 1) + + '.0'; + } else + ret = + '>=' + M + '.' + m + '.' + p + pr + ' <' + (+M + 1) + '.0.0'; + } else { + debug('no pr'); + if (M === '0') { + if (m === '0') + ret = + '>=' + + M + + '.' + + m + + '.' + + p + + ' <' + + M + + '.' + + m + + '.' + + (+p + 1); + else + ret = + '>=' + + M + + '.' + + m + + '.' + + p + + ' <' + + M + + '.' + + (+m + 1) + + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + ' <' + (+M + 1) + '.0.0'; + } + + debug('caret return', ret); + return ret; + }); + } + + function replaceXRanges(comp, loose) { + debug('replaceXRanges', comp, loose); + return comp + .split(/\s+/) + .map(function(comp) { + return replaceXRange(comp, loose); + }) + .join(' '); + } + + function replaceXRange(comp, loose) { + comp = comp.trim(); + var r = loose ? re[XRANGELOOSE] : re[XRANGE]; + return comp.replace(r, function(ret, gtlt, M, m, p, pr) { + debug('xRange', comp, ret, gtlt, M, m, p, pr); + var xM = isX(M); + var xm = xM || isX(m); + var xp = xm || isX(p); + var anyX = xp; + + if (gtlt === '=' && anyX) gtlt = ''; + + if (xM) { + if (gtlt === '>' || gtlt === '<') { + // nothing is allowed + ret = '<0.0.0'; + } else { + // nothing is forbidden + ret = '*'; + } + } else if (gtlt && anyX) { + // replace X with 0 + if (xm) m = 0; + if (xp) p = 0; + + if (gtlt === '>') { + // >1 => >=2.0.0 + // >1.2 => >=1.3.0 + // >1.2.3 => >= 1.2.4 + gtlt = '>='; + if (xm) { + M = +M + 1; + m = 0; + p = 0; + } else if (xp) { + m = +m + 1; + p = 0; + } + } else if (gtlt === '<=') { + // <=0.7.x is actually <0.8.0, since any 0.7.x should + // pass. Similarly, <=7.x is actually <8.0.0, etc. + gtlt = '<'; + if (xm) M = +M + 1; + else m = +m + 1; + } + + ret = gtlt + M + '.' + m + '.' + p; + } else if (xm) { + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + } else if (xp) { + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + } + + debug('xRange return', ret); + + return ret; + }); + } + + // Because * is AND-ed with everything else in the comparator, + // and '' means "any version", just remove the *s entirely. + function replaceStars(comp, loose) { + debug('replaceStars', comp, loose); + // Looseness is ignored here. star is always as loose as it gets! + return comp.trim().replace(re[STAR], ''); + } + + // This function is passed to string.replace(re[HYPHENRANGE]) + // M, m, patch, prerelease, build + // 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 + // 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do + // 1.2 - 3.4 => >=1.2.0 <3.5.0 + function hyphenReplace( + $0, + from, + fM, + fm, + fp, + fpr, + fb, + to, + tM, + tm, + tp, + tpr, + tb, + ) { + if (isX(fM)) from = ''; + else if (isX(fm)) from = '>=' + fM + '.0.0'; + else if (isX(fp)) from = '>=' + fM + '.' + fm + '.0'; + else from = '>=' + from; + + if (isX(tM)) to = ''; + else if (isX(tm)) to = '<' + (+tM + 1) + '.0.0'; + else if (isX(tp)) to = '<' + tM + '.' + (+tm + 1) + '.0'; + else if (tpr) to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; + else to = '<=' + to; + + return (from + ' ' + to).trim(); + } + + // if ANY of the sets match ALL of its comparators, then pass + Range.prototype.test = function(version) { + if (!version) return false; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + for (var i = 0; i < this.set.length; i++) { + if (testSet(this.set[i], version)) return true; + } + return false; + }; + + function testSet(set, version) { + for (var i = 0; i < set.length; i++) { + if (!set[i].test(version)) return false; + } + + if (version.prerelease.length) { + // Find the set of versions that are allowed to have prereleases + // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 + // That should allow `1.2.3-pr.2` to pass. + // However, `1.2.4-alpha.notready` should NOT be allowed, + // even though it's within the range set by the comparators. + for (var i = 0; i < set.length; i++) { + debug(set[i].semver); + if (set[i].semver === ANY) continue; + + if (set[i].semver.prerelease.length > 0) { + var allowed = set[i].semver; + if ( + allowed.major === version.major && + allowed.minor === version.minor && + allowed.patch === version.patch + ) + return true; + } + } + + // Version has a -pre, but it's not one of the ones we like. + return false; + } + + return true; + } + + exports.satisfies = satisfies; + function satisfies(version, range, loose) { + try { + range = new Range(range, loose); + } catch (er) { + return false; + } + return range.test(version); + } + + exports.maxSatisfying = maxSatisfying; + function maxSatisfying(versions, range, loose) { + var max = null; + var maxSV = null; + try { + var rangeObj = new Range(range, loose); + } catch (er) { + return null; + } + versions.forEach(function(v) { + if (rangeObj.test(v)) { + // satisfies(v, range, loose) + if (!max || maxSV.compare(v) === -1) { + // compare(max, v, true) + max = v; + maxSV = new SemVer(max, loose); + } + } + }); + return max; + } + + exports.minSatisfying = minSatisfying; + function minSatisfying(versions, range, loose) { + var min = null; + var minSV = null; + try { + var rangeObj = new Range(range, loose); + } catch (er) { + return null; + } + versions.forEach(function(v) { + if (rangeObj.test(v)) { + // satisfies(v, range, loose) + if (!min || minSV.compare(v) === 1) { + // compare(min, v, true) + min = v; + minSV = new SemVer(min, loose); + } + } + }); + return min; + } + + exports.validRange = validRange; + function validRange(range, loose) { + try { + // Return '*' instead of '' so that truthiness works. + // This will throw if it's invalid anyway + return new Range(range, loose).range || '*'; + } catch (er) { + return null; + } + } + + // Determine if version is less than all the versions possible in the range + exports.ltr = ltr; + function ltr(version, range, loose) { + return outside(version, range, '<', loose); + } + + // Determine if version is greater than all the versions possible in the range. + exports.gtr = gtr; + function gtr(version, range, loose) { + return outside(version, range, '>', loose); + } + + exports.outside = outside; + function outside(version, range, hilo, loose) { + version = new SemVer(version, loose); + range = new Range(range, loose); + + var gtfn, ltefn, ltfn, comp, ecomp; + switch (hilo) { + case '>': + gtfn = gt; + ltefn = lte; + ltfn = lt; + comp = '>'; + ecomp = '>='; + break; + case '<': + gtfn = lt; + ltefn = gte; + ltfn = gt; + comp = '<'; + ecomp = '<='; + break; + default: + throw new TypeError('Must provide a hilo val of "<" or ">"'); + } + + // If it satisifes the range it is not outside + if (satisfies(version, range, loose)) { + return false; + } + + // From now on, variable terms are as if we're in "gtr" mode. + // but note that everything is flipped for the "ltr" function. + + for (var i = 0; i < range.set.length; ++i) { + var comparators = range.set[i]; + + var high = null; + var low = null; + + comparators.forEach(function(comparator) { + if (comparator.semver === ANY) { + comparator = new Comparator('>=0.0.0'); + } + high = high || comparator; + low = low || comparator; + if (gtfn(comparator.semver, high.semver, loose)) { + high = comparator; + } else if (ltfn(comparator.semver, low.semver, loose)) { + low = comparator; + } + }); + + // If the edge version comparator has a operator then our version + // isn't outside it + if (high.operator === comp || high.operator === ecomp) { + return false; + } + + // If the lowest version comparator has an operator and our version + // is less than it then it isn't higher than the range + if ( + (!low.operator || low.operator === comp) && + ltefn(version, low.semver) + ) { + return false; + } else if (low.operator === ecomp && ltfn(version, low.semver)) { + return false; + } + } + return true; + } + + exports.prerelease = prerelease; + function prerelease(version, loose) { + var parsed = parse(version, loose); + return parsed && parsed.prerelease.length ? parsed.prerelease : null; + } + + exports.intersects = intersects; + function intersects(r1, r2, loose) { + r1 = new Range(r1, loose); + r2 = new Range(r2, loose); + return r1.intersects(r2); + } + + exports.coerce = coerce; + function coerce(version) { + if (version instanceof SemVer) return version; + + if (typeof version !== 'string') return null; + + var match = version.match(re[COERCE]); + + if (match == null) return null; + + return parse( + (match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0'), + ); + } + + /***/ + }, + /* 23 */ + /***/ function(module, exports) { + module.exports = require('stream'); + + /***/ + }, + /* 24 */ + /***/ function(module, exports) { + module.exports = require('url'); + + /***/ + }, + /* 25 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'a', + function() { + return Subscription; + }, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__( + 41, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__( + 444, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__( + 154, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__( + 56, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__( + 48, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__( + 441, + ); + /** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */ + + var Subscription = /*@__PURE__*/ (function() { + function Subscription(unsubscribe) { + this.closed = false; + this._parent = null; + this._parents = null; + this._subscriptions = null; + if (unsubscribe) { + this._unsubscribe = unsubscribe; + } + } + Subscription.prototype.unsubscribe = function() { + var hasErrors = false; + var errors; + if (this.closed) { + return; + } + var _a = this, + _parent = _a._parent, + _parents = _a._parents, + _unsubscribe = _a._unsubscribe, + _subscriptions = _a._subscriptions; + this.closed = true; + this._parent = null; + this._parents = null; + this._subscriptions = null; + var index = -1; + var len = _parents ? _parents.length : 0; + while (_parent) { + _parent.remove(this); + _parent = (++index < len && _parents[index]) || null; + } + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_2__util_isFunction__[ + 'a' /* isFunction */ + ], + )(_unsubscribe) + ) { + var trial = __webpack_require__ + .i( + __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__[ + 'a' /* tryCatch */ + ], + )(_unsubscribe) + .call(this); + if ( + trial === + __WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ] + ) { + hasErrors = true; + errors = + errors || + (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ].e instanceof + __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__[ + 'a' /* UnsubscriptionError */ + ] + ? flattenUnsubscriptionErrors( + __WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ].e.errors, + ) + : [ + __WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ].e, + ]); + } + } + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_0__util_isArray__['a' /* isArray */], + )(_subscriptions) + ) { + index = -1; + len = _subscriptions.length; + while (++index < len) { + var sub = _subscriptions[index]; + if ( + __webpack_require__.i( + __WEBPACK_IMPORTED_MODULE_1__util_isObject__[ + 'a' /* isObject */ + ], + )(sub) + ) { + var trial = __webpack_require__ + .i( + __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__[ + 'a' /* tryCatch */ + ], + )(sub.unsubscribe) + .call(sub); + if ( + trial === + __WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ] + ) { + hasErrors = true; + errors = errors || []; + var err = + __WEBPACK_IMPORTED_MODULE_4__util_errorObject__[ + 'a' /* errorObject */ + ].e; + if ( + err instanceof + __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__[ + 'a' /* UnsubscriptionError */ + ] + ) { + errors = errors.concat( + flattenUnsubscriptionErrors(err.errors), + ); + } else { + errors.push(err); + } + } + } + } + } + if (hasErrors) { + throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__[ + 'a' /* UnsubscriptionError */ + ](errors); + } + }; + Subscription.prototype.add = function(teardown) { + if (!teardown || teardown === Subscription.EMPTY) { + return Subscription.EMPTY; + } + if (teardown === this) { + return this; + } + var subscription = teardown; + switch (typeof teardown) { + case 'function': + subscription = new Subscription(teardown); + case 'object': + if ( + subscription.closed || + typeof subscription.unsubscribe !== 'function' + ) { + return subscription; + } else if (this.closed) { + subscription.unsubscribe(); + return subscription; + } else if (typeof subscription._addParent !== 'function') { + var tmp = subscription; + subscription = new Subscription(); + subscription._subscriptions = [tmp]; + } + break; + default: + throw new Error( + 'unrecognized teardown ' + teardown + ' added to Subscription.', + ); + } + var subscriptions = this._subscriptions || (this._subscriptions = []); + subscriptions.push(subscription); + subscription._addParent(this); + return subscription; + }; + Subscription.prototype.remove = function(subscription) { + var subscriptions = this._subscriptions; + if (subscriptions) { + var subscriptionIndex = subscriptions.indexOf(subscription); + if (subscriptionIndex !== -1) { + subscriptions.splice(subscriptionIndex, 1); + } + } + }; + Subscription.prototype._addParent = function(parent) { + var _a = this, + _parent = _a._parent, + _parents = _a._parents; + if (!_parent || _parent === parent) { + this._parent = parent; + } else if (!_parents) { + this._parents = [parent]; + } else if (_parents.indexOf(parent) === -1) { + _parents.push(parent); + } + }; + Subscription.EMPTY = (function(empty) { + empty.closed = true; + return empty; + })(new Subscription()); + return Subscription; + })(); + + function flattenUnsubscriptionErrors(errors) { + return errors.reduce(function(errs, err) { + return errs.concat( + err instanceof + __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__[ + 'a' /* UnsubscriptionError */ + ] + ? err.errors + : err, + ); + }, []); + } + //# sourceMappingURL=Subscription.js.map + + /***/ + }, + /* 26 */ + /***/ function(module, exports, __webpack_require__) { + // Copyright 2015 Joyent, Inc. + + module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + calculateED25519Public: calculateED25519Public, + calculateX25519Public: calculateX25519Public, + mpNormalize: mpNormalize, + mpDenormalize: mpDenormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo, + publicFromPrivateECDSA: publicFromPrivateECDSA, + zeroPadToLength: zeroPadToLength, + writeBitString: writeBitString, + readBitString: readBitString, + }; + + var assert = __webpack_require__(16); + var Buffer = __webpack_require__(15).Buffer; + var PrivateKey = __webpack_require__(33); + var Key = __webpack_require__(27); + var crypto = __webpack_require__(11); + var algs = __webpack_require__(32); + var asn1 = __webpack_require__(66); + + var ec, jsbn; + var nacl; + + var MAX_CLASS_DEPTH = 3; + + function isCompatible(obj, klass, needVer) { + if (obj === null || typeof obj !== 'object') return false; + if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; + if ( + obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0] + ) + return true; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) return false; + } + if (proto.constructor.name !== klass.name) return false; + var ver = proto._sshpkApiVersion; + if (ver === undefined) ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) return false; + return true; + } + + function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) needVer = klass.prototype._sshpkApiVersion; + if ( + obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0] + ) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok( + proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance', + ); + } + assert.strictEqual( + proto.constructor.name, + klass.name, + name + ' must be a ' + klass.name + ' instance', + ); + var ver = proto._sshpkApiVersion; + if (ver === undefined) ver = klass._oldVersionDetect(obj); + assert.ok( + ver[0] == needVer[0] && ver[1] >= needVer[1], + name + + ' must be compatible with ' + + klass.name + + ' klass ' + + 'version ' + + needVer[0] + + '.' + + needVer[1], + ); + } + + var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 }, + }; + var PKCS5_SALT_LEN = 8; + + function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); + + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); + + salt = salt.slice(0, PKCS5_SALT_LEN); + + var D, D_prev, bufs; + var material = Buffer.alloc(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto + .createHash('md5') + .update(D) + .digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } + + return { + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv), + }; + } + + /* Count leading zero bits on a buffer */ + function countZeros(buf) { + var o = 0, + obit = 8; + while (o < buf.length) { + var mask = 1 << obit; + if ((buf[o] & mask) === mask) break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return o * 8 + (8 - obit) - 1; + } + + function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) ++matches; + else if (buf[i] === chr.charCodeAt(0)) matches = 1; + else matches = 0; + + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) parts.push(buf.slice(lastPart, buf.length)); + + return parts; + } + + function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) return buf; + return buf.slice(1); + } else if (buf[0] === 0x04) { + if (!addZero) return buf; + } else { + while (buf[0] === 0x00) buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw new Error( + 'Compressed elliptic curve points ' + 'are not supported', + ); + if (buf[0] !== 0x04) + throw new Error('Not a valid elliptic curve point'); + if (!addZero) return buf; + } + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return b; + } + + function readBitString(der, tag) { + if (tag === undefined) tag = asn1.Ber.BitString; + var buf = der.readString(tag, true); + assert.strictEqual( + buf[0], + 0x00, + 'bit strings with unused bits are ' + + 'not supported (0x' + + buf[0].toString(16) + + ')', + ); + return buf.slice(1); + } + + function writeBitString(der, buf, tag) { + if (tag === undefined) tag = asn1.Ber.BitString; + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + der.writeBuffer(b, tag); + } + + function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return buf; + } + + function mpDenormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00) buf = buf.slice(1); + return buf; + } + + function zeroPadToLength(buf, len) { + assert.buffer(buf); + assert.number(len); + while (buf.length > len) { + assert.equal(buf[0], 0x00); + buf = buf.slice(1); + } + while (buf.length < len) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return buf; + } + + function bigintToMpBuf(bigint) { + var buf = Buffer.from(bigint.toByteArray()); + buf = mpNormalize(buf); + return buf; + } + + function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(81).BigInteger; + } catch (e) { + throw new Error( + 'To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.', + ); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return ybuf; + } + + function calculateED25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) nacl = __webpack_require__(76); + + var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); + return Buffer.from(kp.publicKey); + } + + function calculateX25519Public(k) { + assert.buffer(k); + + if (nacl === undefined) nacl = __webpack_require__(76); + + var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); + return Buffer.from(kp.publicKey); + } + + function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(81).BigInteger; + } catch (e) { + throw new Error( + 'To write a PEM private key from ' + + 'this source, the node jsbn lib is required.', + ); + } + + var d = new bigInt(key.part.d.data); + var buf; + + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); + + buf = bigintToMpBuf(dmodp); + key.part.dmodp = { name: 'dmodp', data: buf }; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); + + buf = bigintToMpBuf(dmodq); + key.part.dmodq = { name: 'dmodq', data: buf }; + key.parts.push(key.part.dmodq); + } + } + + function publicFromPrivateECDSA(curveName, priv) { + assert.string(curveName, 'curveName'); + assert.buffer(priv); + if (ec === undefined) ec = __webpack_require__(139); + if (jsbn === undefined) jsbn = __webpack_require__(81).BigInteger; + var params = algs.curves[curveName]; + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); + + var d = new jsbn(mpNormalize(priv)); + var pub = G.multiply(d); + pub = Buffer.from(curve.encodePointHex(pub), 'hex'); + + var parts = []; + parts.push({ name: 'curve', data: Buffer.from(curveName) }); + parts.push({ name: 'Q', data: pub }); + + var key = new Key({ type: 'ecdsa', curve: curve, parts: parts }); + return key; + } + + function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw new Error('Unsupported openssl cipher "' + cipher + '"'); + } + return inf; + } + + /***/ + }, + /* 27 */ + /***/ function(module, exports, __webpack_require__) { + // Copyright 2017 Joyent, Inc. + + module.exports = Key; + + var assert = __webpack_require__(16); + var algs = __webpack_require__(32); + var crypto = __webpack_require__(11); + var Fingerprint = __webpack_require__(156); + var Signature = __webpack_require__(75); + var DiffieHellman = __webpack_require__(325).DiffieHellman; + var errs = __webpack_require__(74); + var utils = __webpack_require__(26); + var PrivateKey = __webpack_require__(33); + var edCompat; + + try { + edCompat = __webpack_require__(454); + } catch (e) { + /* Just continue through, and bail out if we try to use it. */ + } + + var InvalidAlgorithmError = errs.InvalidAlgorithmError; + var KeyParseError = errs.KeyParseError; + + var formats = {}; + formats['auto'] = __webpack_require__(455); + formats['pem'] = __webpack_require__(86); + formats['pkcs1'] = __webpack_require__(327); + formats['pkcs8'] = __webpack_require__(157); + formats['rfc4253'] = __webpack_require__(103); + formats['ssh'] = __webpack_require__(456); + formats['ssh-private'] = __webpack_require__(192); + formats['openssh'] = formats['ssh-private']; + formats['dnssec'] = __webpack_require__(326); + + function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); + + var algInfo = algs.info[opts.type]; + if (typeof algInfo !== 'object') + throw new InvalidAlgorithmError(opts.type); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; + + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; + + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519' || this.type === 'curve25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; + } + + Key.formats = formats; + + Key.prototype.toBuffer = function(format, options) { + if (format === undefined) format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return this._rfc4253Cache; + } + + return formats[format].write(this, options); + }; + + Key.prototype.toString = function(format, options) { + return this.toBuffer(format, options).toString(); + }; + + Key.prototype.hash = function(algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw new InvalidAlgorithmError(algo); + + if (this._hashCache[algo]) return this._hashCache[algo]; + var hash = crypto + .createHash(algo) + .update(this.toBuffer('rfc4253')) + .digest(); + this._hashCache[algo] = hash; + return hash; + }; + + Key.prototype.fingerprint = function(algo) { + if (algo === undefined) algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo, + }; + return new Fingerprint(opts); + }; + + Key.prototype.defaultHashAlgorithm = function() { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) hashAlgo = 'sha256'; + if (this.type === 'ed25519') hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) hashAlgo = 'sha256'; + else if (this.size <= 384) hashAlgo = 'sha384'; + else hashAlgo = 'sha512'; + } + return hashAlgo; + }; + + Key.prototype.createVerify = function(hashAlgo) { + if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return new edCompat.Verifier(this, hashAlgo); + if (this.type === 'curve25519') + throw new Error( + 'Curve25519 keys are not suitable for ' + 'signing or verification', + ); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if ( + v === undefined || + (err instanceof Error && err.message.match(/Unknown message digest/)) + ) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function(signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) return false; + if (signature.hashAlgorithm && signature.hashAlgorithm !== hashAlgo) + return false; + if ( + signature.curve && + self.type === 'ecdsa' && + signature.curve !== curve + ) + return false; + return oldVerify(key, signature.toBuffer('asn1')); + } else if ( + typeof signature === 'string' || + Buffer.isBuffer(signature) + ) { + return oldVerify(key, signature, fmt); + + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw new Error( + 'signature was created by too old ' + + 'a version of sshpk and cannot be verified', + ); + } else { + throw new TypeError( + 'signature must be a string, ' + 'Buffer, or Signature object', + ); + } + }; + return v; + }; + + Key.prototype.createDiffieHellman = function() { + if (this.type === 'rsa') + throw new Error('RSA keys do not support Diffie-Hellman'); + + return new DiffieHellman(this); + }; + Key.prototype.createDH = Key.prototype.createDiffieHellman; + + Key.parse = function(data, format, options) { + if (typeof data !== 'string') assert.buffer(data, 'data'); + if (format === undefined) format = 'auto'; + assert.string(format, 'format'); + if (typeof options === 'string') options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) k = k.toPublic(); + if (!k.comment) k.comment = options.filename; + return k; + } catch (e) { + if (e.name === 'KeyEncryptedError') throw e; + throw new KeyParseError(options.filename, format, e); + } + }; + + Key.isKey = function(obj, ver) { + return utils.isCompatible(obj, Key, ver); + }; + + /* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + * [1,6] -- changed ed25519 part names + */ + Key.prototype._sshpkApiVersion = [1, 6]; + + Key._oldVersionDetect = function(obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) return [1, 4]; + if (obj.defaultHashAlgorithm) return [1, 3]; + if (obj.formats['auto']) return [1, 2]; + if (obj.formats['pkcs1']) return [1, 1]; + return [1, 0]; + }; + + /***/ + }, + /* 28 */ + /***/ function(module, exports) { + module.exports = require('assert'); + + /***/ + }, + /* 29 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.default = nullify; + function nullify(obj = {}) { + if (Array.isArray(obj)) { + for ( + var _iterator = obj, + _isArray = Array.isArray(_iterator), + _i = 0, + _iterator = _isArray ? _iterator : _iterator[Symbol.iterator](); + ; + + ) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const item = _ref; + + nullify(item); + } + } else if ( + (obj !== null && typeof obj === 'object') || + typeof obj === 'function' + ) { + Object.setPrototypeOf(obj, null); + + // for..in can only be applied to 'object', not 'function' + if (typeof obj === 'object') { + for (const key in obj) { + nullify(obj[key]); + } + } + } + + return obj; + } + + /***/ + }, + /* 30 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + const escapeStringRegexp = __webpack_require__(388); + const ansiStyles = __webpack_require__(506); + const stdoutColor = __webpack_require__(598).stdout; + + const template = __webpack_require__(599); + + const isSimpleWindowsTerm = + process.platform === 'win32' && + !(process.env.TERM || '').toLowerCase().startsWith('xterm'); + + // `supportsColor.level` → `ansiStyles.color[name]` mapping + const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m']; + + // `color-convert` models to exclude from the Chalk API due to conflicts and such + const skipModels = new Set(['gray']); + + const styles = Object.create(null); + + function applyOptions(obj, options) { + options = options || {}; + + // Detect level if not set manually + const scLevel = stdoutColor ? stdoutColor.level : 0; + obj.level = options.level === undefined ? scLevel : options.level; + obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0; + } + + function Chalk(options) { + // We check for this.template here since calling `chalk.constructor()` + // by itself will have a `this` of a previously constructed chalk object + if (!this || !(this instanceof Chalk) || this.template) { + const chalk = {}; + applyOptions(chalk, options); + + chalk.template = function() { + const args = [].slice.call(arguments); + return chalkTag.apply(null, [chalk.template].concat(args)); + }; + + Object.setPrototypeOf(chalk, Chalk.prototype); + Object.setPrototypeOf(chalk.template, chalk); + + chalk.template.constructor = Chalk; + + return chalk.template; + } + + applyOptions(this, options); + } + + // Use bright blue on Windows as the normal blue color is illegible + if (isSimpleWindowsTerm) { + ansiStyles.blue.open = '\u001B[94m'; + } + + for (const key of Object.keys(ansiStyles)) { + ansiStyles[key].closeRe = new RegExp( + escapeStringRegexp(ansiStyles[key].close), + 'g', + ); + + styles[key] = { + get() { + const codes = ansiStyles[key]; + return build.call( + this, + this._styles ? this._styles.concat(codes) : [codes], + this._empty, + key, + ); + }, + }; + } + + styles.visible = { + get() { + return build.call(this, this._styles || [], true, 'visible'); + }, + }; + + ansiStyles.color.closeRe = new RegExp( + escapeStringRegexp(ansiStyles.color.close), + 'g', + ); + for (const model of Object.keys(ansiStyles.color.ansi)) { + if (skipModels.has(model)) { + continue; + } + + styles[model] = { + get() { + const level = this.level; + return function() { + const open = ansiStyles.color[levelMapping[level]][model].apply( + null, + arguments, + ); + const codes = { + open, + close: ansiStyles.color.close, + closeRe: ansiStyles.color.closeRe, + }; + return build.call( + this, + this._styles ? this._styles.concat(codes) : [codes], + this._empty, + model, + ); + }; + }, + }; + } + + ansiStyles.bgColor.closeRe = new RegExp( + escapeStringRegexp(ansiStyles.bgColor.close), + 'g', + ); + for (const model of Object.keys(ansiStyles.bgColor.ansi)) { + if (skipModels.has(model)) { + continue; + } + + const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1); + styles[bgModel] = { + get() { + const level = this.level; + return function() { + const open = ansiStyles.bgColor[levelMapping[level]][model].apply( + null, + arguments, + ); + const codes = { + open, + close: ansiStyles.bgColor.close, + closeRe: ansiStyles.bgColor.closeRe, + }; + return build.call( + this, + this._styles ? this._styles.concat(codes) : [codes], + this._empty, + model, + ); + }; + }, + }; + } + + const proto = Object.defineProperties(() => {}, styles); + + function build(_styles, _empty, key) { + const builder = function() { + return applyStyle.apply(builder, arguments); + }; + + builder._styles = _styles; + builder._empty = _empty; + + const self = this; + + Object.defineProperty(builder, 'level', { + enumerable: true, + get() { + return self.level; + }, + set(level) { + self.level = level; + }, + }); + + Object.defineProperty(builder, 'enabled', { + enumerable: true, + get() { + return self.enabled; + }, + set(enabled) { + self.enabled = enabled; + }, + }); + + // See below for fix regarding invisible grey/dim combination on Windows + builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey'; + + // `__proto__` is used because we must return a function, but there is + // no way to create a function with a different prototype + builder.__proto__ = proto; // eslint-disable-line no-proto + + return builder; + } + + function applyStyle() { + // Support varags, but simply cast to string in case there's only one arg + const args = arguments; + const argsLen = args.length; + let str = String(arguments[0]); + + if (argsLen === 0) { + return ''; + } + + if (argsLen > 1) { + // Don't slice `arguments`, it prevents V8 optimizations + for (let a = 1; a < argsLen; a++) { + str += ' ' + args[a]; + } + } + + if (!this.enabled || this.level <= 0 || !str) { + return this._empty ? '' : str; + } + + // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, + // see https://github.com/chalk/chalk/issues/58 + // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. + const originalDim = ansiStyles.dim.open; + if (isSimpleWindowsTerm && this.hasGrey) { + ansiStyles.dim.open = ''; + } + + for (const code of this._styles.slice().reverse()) { + // Replace any instances already present with a re-opening code + // otherwise only the part of the string until said closing code + // will be colored, and the rest will simply be 'plain'. + str = code.open + str.replace(code.closeRe, code.open) + code.close; + + // Close the styling before a linebreak and reopen + // after next line to fix a bleed issue on macOS + // https://github.com/chalk/chalk/pull/92 + str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`); + } + + // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue + ansiStyles.dim.open = originalDim; + + return str; + } + + function chalkTag(chalk, strings) { + if (!Array.isArray(strings)) { + // If chalk() was called by itself or with a string, + // return the string itself as a string. + return [].slice.call(arguments, 1).join(' '); + } + + const args = [].slice.call(arguments, 2); + const parts = [strings.raw[0]]; + + for (let i = 1; i < strings.length; i++) { + parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&')); + parts.push(String(strings.raw[i])); + } + + return template(chalk, parts.join('')); + } + + Object.defineProperties(Chalk.prototype, styles); + + module.exports = Chalk(); // eslint-disable-line new-cap + module.exports.supportsColor = stdoutColor; + module.exports.default = module.exports; // For TypeScript + + /***/ + }, + /* 31 */ + /***/ function(module, exports) { + var core = (module.exports = { version: '2.5.7' }); + if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef + + /***/ + }, + /* 32 */ + /***/ function(module, exports, __webpack_require__) { + // Copyright 2015 Joyent, Inc. + + var Buffer = __webpack_require__(15).Buffer; + + var algInfo = { + dsa: { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p', + }, + rsa: { + parts: ['e', 'n'], + sizePart: 'n', + }, + ecdsa: { + parts: ['curve', 'Q'], + sizePart: 'Q', + }, + ed25519: { + parts: ['A'], + sizePart: 'A', + }, + }; + algInfo['curve25519'] = algInfo['ed25519']; + + var algPrivInfo = { + dsa: { + parts: ['p', 'q', 'g', 'y', 'x'], + }, + rsa: { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'], + }, + ecdsa: { + parts: ['curve', 'Q', 'd'], + }, + ed25519: { + parts: ['A', 'k'], + }, + }; + algPrivInfo['curve25519'] = algPrivInfo['ed25519']; + + var hashAlgs = { + md5: true, + sha1: true, + sha256: true, + sha384: true, + sha512: true, + }; + + /* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ + var curves = { + nistp256: { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: Buffer.from( + ( + '00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff' + ).replace(/ /g, ''), + 'hex', + ), + a: Buffer.from( + ( + '00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC' + ).replace(/ /g, ''), + 'hex', + ), + b: Buffer.from( + ( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b' + ).replace(/ /g, ''), + 'hex', + ), + s: Buffer.from( + ('00' + 'c49d3608 86e70493 6a6678e1 139d26b7' + '819f7e90').replace( + / /g, + '', + ), + 'hex', + ), + n: Buffer.from( + ( + '00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551' + ).replace(/ /g, ''), + 'hex', + ), + G: Buffer.from( + ( + '04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5' + ).replace(/ /g, ''), + 'hex', + ), + }, + nistp384: { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: Buffer.from( + ( + '00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff' + ).replace(/ /g, ''), + 'hex', + ), + a: Buffer.from( + ( + '00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC' + ).replace(/ /g, ''), + 'hex', + ), + b: Buffer.from( + ( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef' + ).replace(/ /g, ''), + 'hex', + ), + s: Buffer.from( + ('00' + 'a335926a a319a27a 1d00896a 6773a482' + '7acdac73').replace( + / /g, + '', + ), + 'hex', + ), + n: Buffer.from( + ( + '00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973' + ).replace(/ /g, ''), + 'hex', + ), + G: Buffer.from( + ( + '04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f' + ).replace(/ /g, ''), + 'hex', + ), + }, + nistp521: { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: Buffer.from( + ( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff' + ).replace(/ /g, ''), + 'hex', + ), + a: Buffer.from( + ( + '01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC' + ).replace(/ /g, ''), + 'hex', + ), + b: Buffer.from( + ( + '51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00' + ).replace(/ /g, ''), + 'hex', + ), + s: Buffer.from( + ('00' + 'd09e8800 291cb853 96cc6717 393284aa' + 'a0da64ba').replace( + / /g, + '', + ), + 'hex', + ), + n: Buffer.from( + ( + '01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409' + ).replace(/ /g, ''), + 'hex', + ), + G: Buffer.from( + ( + '04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650' + ).replace(/ /g, ''), + 'hex', + ), + }, + }; + + module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves, + }; + + /***/ + }, + /* 33 */ + /***/ function(module, exports, __webpack_require__) { + // Copyright 2017 Joyent, Inc. + + module.exports = PrivateKey; + + var assert = __webpack_require__(16); + var Buffer = __webpack_require__(15).Buffer; + var algs = __webpack_require__(32); + var crypto = __webpack_require__(11); + var Fingerprint = __webpack_require__(156); + var Signature = __webpack_require__(75); + var errs = __webpack_require__(74); + var util = __webpack_require__(3); + var utils = __webpack_require__(26); + var dhe = __webpack_require__(325); + var generateECDSA = dhe.generateECDSA; + var generateED25519 = dhe.generateED25519; + var edCompat; + var nacl; + + try { + edCompat = __webpack_require__(454); + } catch (e) { + /* Just continue through, and bail out if we try to use it. */ + } + + var Key = __webpack_require__(27); + + var InvalidAlgorithmError = errs.InvalidAlgorithmError; + var KeyParseError = errs.KeyParseError; + var KeyEncryptedError = errs.KeyEncryptedError; + + var formats = {}; + formats['auto'] = __webpack_require__(455); + formats['pem'] = __webpack_require__(86); + formats['pkcs1'] = __webpack_require__(327); + formats['pkcs8'] = __webpack_require__(157); + formats['rfc4253'] = __webpack_require__(103); + formats['ssh-private'] = __webpack_require__(192); + formats['openssh'] = formats['ssh-private']; + formats['ssh'] = formats['ssh-private']; + formats['dnssec'] = __webpack_require__(326); + + function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); + + this._pubCache = undefined; + } + util.inherits(PrivateKey, Key); + + PrivateKey.formats = formats; + + PrivateKey.prototype.toBuffer = function(format, options) { + if (format === undefined) format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return formats[format].write(this, options); + }; + + PrivateKey.prototype.hash = function(algo) { + return this.toPublic().hash(algo); + }; + + PrivateKey.prototype.toPublic = function() { + if (this._pubCache) return this._pubCache; + + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } + + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts, + }); + if (this.comment) this._pubCache.comment = this.comment; + return this._pubCache; + }; + + PrivateKey.prototype.derive = function(newType) { + assert.string(newType, 'type'); + var priv, pub, pair; + + if (this.type === 'ed25519' && newType === 'curve25519') { + if (nacl === undefined) nacl = __webpack_require__(76); + + priv = this.part.k.data; + if (priv[0] === 0x00) priv = priv.slice(1); + + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) }, + ], + }); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (nacl === undefined) nacl = __webpack_require__(76); + + priv = this.part.k.data; + if (priv[0] === 0x00) priv = priv.slice(1); + + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) }, + ], + }); + } + throw new Error( + 'Key derivation not supported from ' + this.type + ' to ' + newType, + ); + }; + + PrivateKey.prototype.createVerify = function(hashAlgo) { + return this.toPublic().createVerify(hashAlgo); + }; + + PrivateKey.prototype.createSign = function(hashAlgo) { + if (hashAlgo === undefined) hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return new edCompat.Signer(this, hashAlgo); + if (this.type === 'curve25519') + throw new Error( + 'Curve25519 keys are not suitable for ' + 'signing or verification', + ); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if ( + v === undefined || + (err instanceof Error && err.message.match(/Unknown message digest/)) + ) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function() { + var sig = oldSign(key); + if (typeof sig === 'string') sig = Buffer.from(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return sig; + }; + return v; + }; + + PrivateKey.parse = function(data, format, options) { + if (typeof data !== 'string') assert.buffer(data, 'data'); + if (format === undefined) format = 'auto'; + assert.string(format, 'format'); + if (typeof options === 'string') options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) k.comment = options.filename; + return k; + } catch (e) { + if (e.name === 'KeyEncryptedError') throw e; + throw new KeyParseError(options.filename, format, e); + } + }; + + PrivateKey.isPrivateKey = function(obj, ver) { + return utils.isCompatible(obj, PrivateKey, ver); + }; + + PrivateKey.generate = function(type, options) { + if (options === undefined) options = {}; + assert.object(options, 'options'); + + switch (type) { + case 'ecdsa': + if (options.curve === undefined) options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return generateECDSA(options.curve); + case 'ed25519': + return generateED25519(); + default: + throw new Error( + 'Key generation not supported with key ' + 'type "' + type + '"', + ); + } + }; + + /* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + * [1,5] -- changed ed25519 part names and format + */ + PrivateKey.prototype._sshpkApiVersion = [1, 5]; + + PrivateKey._oldVersionDetect = function(obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) return [1, 3]; + if (obj.defaultHashAlgorithm) return [1, 2]; + if (obj.formats['auto']) return [1, 1]; + return [1, 0]; + }; + + /***/ + }, + /* 34 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined; + + var _extends2; + + function _load_extends() { + return (_extends2 = _interopRequireDefault(__webpack_require__(21))); + } + + var _asyncToGenerator2; + + function _load_asyncToGenerator() { + return (_asyncToGenerator2 = _interopRequireDefault( + __webpack_require__(2), + )); + } + + let install = (exports.install = (() => { + var _ref29 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + config, + reporter, + flags, + lockfile, + ) { + yield wrapLifecycle( + config, + flags, + (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const install = new Install(flags, config, reporter, lockfile); + yield install.init(); + }, + ), + ); + }); + + return function install(_x7, _x8, _x9, _x10) { + return _ref29.apply(this, arguments); + }; + })()); + + let run = (exports.run = (() => { + var _ref31 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + config, + reporter, + flags, + args, + ) { + let lockfile; + let error = 'installCommandRenamed'; + if (flags.lockfile === false) { + lockfile = new (_lockfile || _load_lockfile()).default(); + } else { + lockfile = yield ( + _lockfile || _load_lockfile() + ).default.fromDirectory(config.lockfileFolder, reporter); + } + + if (args.length) { + const exampleArgs = args.slice(); + + if (flags.saveDev) { + exampleArgs.push('--dev'); + } + if (flags.savePeer) { + exampleArgs.push('--peer'); + } + if (flags.saveOptional) { + exampleArgs.push('--optional'); + } + if (flags.saveExact) { + exampleArgs.push('--exact'); + } + if (flags.saveTilde) { + exampleArgs.push('--tilde'); + } + let command = 'add'; + if (flags.global) { + error = 'globalFlagRemoved'; + command = 'global add'; + } + throw new (_errors || _load_errors()).MessageError( + reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`), + ); + } + + yield install(config, reporter, flags, lockfile); + }); + + return function run(_x11, _x12, _x13, _x14) { + return _ref31.apply(this, arguments); + }; + })()); + + let wrapLifecycle = (exports.wrapLifecycle = (() => { + var _ref32 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function*( + config, + flags, + factory, + ) { + yield config.executeLifecycleScript('preinstall'); + + yield factory(); + + // npm behaviour, seems kinda funky but yay compatibility + yield config.executeLifecycleScript('install'); + yield config.executeLifecycleScript('postinstall'); + + if (!config.production) { + if (!config.disablePrepublish) { + yield config.executeLifecycleScript('prepublish'); + } + yield config.executeLifecycleScript('prepare'); + } + }); + + return function wrapLifecycle(_x15, _x16, _x17) { + return _ref32.apply(this, arguments); + }; + })()); + + exports.hasWrapper = hasWrapper; + exports.setFlags = setFlags; + + var _objectPath; + + function _load_objectPath() { + return (_objectPath = _interopRequireDefault(__webpack_require__(304))); + } + + var _hooks; + + function _load_hooks() { + return (_hooks = __webpack_require__(374)); + } + + var _index; + + function _load_index() { + return (_index = _interopRequireDefault(__webpack_require__(220))); + } + + var _errors; + + function _load_errors() { + return (_errors = __webpack_require__(6)); + } + + var _integrityChecker; + + function _load_integrityChecker() { + return (_integrityChecker = _interopRequireDefault( + __webpack_require__(208), + )); + } + + var _lockfile; + + function _load_lockfile() { + return (_lockfile = _interopRequireDefault(__webpack_require__(19))); + } + + var _lockfile2; + + function _load_lockfile2() { + return (_lockfile2 = __webpack_require__(19)); + } + + var _packageFetcher; + + function _load_packageFetcher() { + return (_packageFetcher = _interopRequireWildcard( + __webpack_require__(210), + )); + } + + var _packageInstallScripts; + + function _load_packageInstallScripts() { + return (_packageInstallScripts = _interopRequireDefault( + __webpack_require__(557), + )); + } + + var _packageCompatibility; + + function _load_packageCompatibility() { + return (_packageCompatibility = _interopRequireWildcard( + __webpack_require__(209), + )); + } + + var _packageResolver; + + function _load_packageResolver() { + return (_packageResolver = _interopRequireDefault( + __webpack_require__(366), + )); + } + + var _packageLinker; + + function _load_packageLinker() { + return (_packageLinker = _interopRequireDefault( + __webpack_require__(211), + )); + } + + var _index2; + + function _load_index2() { + return (_index2 = __webpack_require__(57)); + } + + var _index3; + + function _load_index3() { + return (_index3 = __webpack_require__(78)); + } + + var _autoclean; + + function _load_autoclean() { + return (_autoclean = __webpack_require__(354)); + } + + var _constants; + + function _load_constants() { + return (_constants = _interopRequireWildcard(__webpack_require__(8))); + } + + var _normalizePattern; + + function _load_normalizePattern() { + return (_normalizePattern = __webpack_require__(37)); + } + + var _fs; + + function _load_fs() { + return (_fs = _interopRequireWildcard(__webpack_require__(4))); + } + + var _map; + + function _load_map() { + return (_map = _interopRequireDefault(__webpack_require__(29))); + } + + var _yarnVersion; + + function _load_yarnVersion() { + return (_yarnVersion = __webpack_require__(120)); + } + + var _generatePnpMap; + + function _load_generatePnpMap() { + return (_generatePnpMap = __webpack_require__(579)); + } + + var _workspaceLayout; + + function _load_workspaceLayout() { + return (_workspaceLayout = _interopRequireDefault( + __webpack_require__(90), + )); + } + + var _resolutionMap; + + function _load_resolutionMap() { + return (_resolutionMap = _interopRequireDefault( + __webpack_require__(214), + )); + } + + var _guessName; + + function _load_guessName() { + return (_guessName = _interopRequireDefault(__webpack_require__(169))); + } + + var _audit; + + function _load_audit() { + return (_audit = _interopRequireDefault(__webpack_require__(353))); + } + + function _interopRequireWildcard(obj) { + if (obj && obj.__esModule) { + return obj; + } else { + var newObj = {}; + if (obj != null) { + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) + newObj[key] = obj[key]; + } + } + newObj.default = obj; + return newObj; + } + } + + function _interopRequireDefault(obj) { + return obj && obj.__esModule ? obj : { default: obj }; + } + + const deepEqual = __webpack_require__(631); + + const emoji = __webpack_require__(302); + const invariant = __webpack_require__(9); + const path = __webpack_require__(0); + const semver = __webpack_require__(22); + const uuid = __webpack_require__(119); + const ssri = __webpack_require__(65); + + const ONE_DAY = 1000 * 60 * 60 * 24; + + /** + * Try and detect the installation method for Yarn and provide a command to update it with. + */ + + function getUpdateCommand(installationMethod) { + if (installationMethod === 'tar') { + return `curl --compressed -o- -L ${ + (_constants || _load_constants()).YARN_INSTALLER_SH + } | bash`; + } + + if (installationMethod === 'homebrew') { + return 'brew upgrade yarn'; + } + + if (installationMethod === 'deb') { + return 'sudo apt-get update && sudo apt-get install yarn'; + } + + if (installationMethod === 'rpm') { + return 'sudo yum install yarn'; + } + + if (installationMethod === 'npm') { + return 'npm install --global yarn'; + } + + if (installationMethod === 'chocolatey') { + return 'choco upgrade yarn'; + } + + if (installationMethod === 'apk') { + return 'apk update && apk add -u yarn'; + } + + if (installationMethod === 'portage') { + return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn'; + } + + return null; + } + + function getUpdateInstaller(installationMethod) { + // Windows + if (installationMethod === 'msi') { + return (_constants || _load_constants()).YARN_INSTALLER_MSI; + } + + return null; + } + + function normalizeFlags(config, rawFlags) { + const flags = { + // install + har: !!rawFlags.har, + ignorePlatform: !!rawFlags.ignorePlatform, + ignoreEngines: !!rawFlags.ignoreEngines, + ignoreScripts: !!rawFlags.ignoreScripts, + ignoreOptional: !!rawFlags.ignoreOptional, + force: !!rawFlags.force, + flat: !!rawFlags.flat, + lockfile: rawFlags.lockfile !== false, + pureLockfile: !!rawFlags.pureLockfile, + updateChecksums: !!rawFlags.updateChecksums, + skipIntegrityCheck: !!rawFlags.skipIntegrityCheck, + frozenLockfile: !!rawFlags.frozenLockfile, + linkDuplicates: !!rawFlags.linkDuplicates, + checkFiles: !!rawFlags.checkFiles, + audit: !!rawFlags.audit, + + // add + peer: !!rawFlags.peer, + dev: !!rawFlags.dev, + optional: !!rawFlags.optional, + exact: !!rawFlags.exact, + tilde: !!rawFlags.tilde, + ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck, + + // outdated, update-interactive + includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps, + + // add, remove, update + workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false, + }; + + if (config.getOption('ignore-scripts')) { + flags.ignoreScripts = true; + } + + if (config.getOption('ignore-platform')) { + flags.ignorePlatform = true; + } + + if (config.getOption('ignore-engines')) { + flags.ignoreEngines = true; + } + + if (config.getOption('ignore-optional')) { + flags.ignoreOptional = true; + } + + if (config.getOption('force')) { + flags.force = true; + } + + return flags; + } + + class Install { + constructor(flags, config, reporter, lockfile) { + this.rootManifestRegistries = []; + this.rootPatternsToOrigin = (0, (_map || _load_map()).default)(); + this.lockfile = lockfile; + this.reporter = reporter; + this.config = config; + this.flags = normalizeFlags(config, flags); + this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode + this.resolutionMap = new ( + _resolutionMap || _load_resolutionMap() + ).default(config); // Selective resolutions for nested dependencies + this.resolver = new ( + _packageResolver || _load_packageResolver() + ).default(config, lockfile, this.resolutionMap); + this.integrityChecker = new ( + _integrityChecker || _load_integrityChecker() + ).default(config); + this.linker = new (_packageLinker || _load_packageLinker()).default( + config, + this.resolver, + ); + this.scripts = new ( + _packageInstallScripts || _load_packageInstallScripts() + ).default(config, this.resolver, this.flags.force); + } + + /** + * Create a list of dependency requests from the current directories manifests. + */ + + fetchRequestFromCwd( + excludePatterns = [], + ignoreUnusedPatterns = false, + ) { + var _this = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const patterns = []; + const deps = []; + let resolutionDeps = []; + const manifest = {}; + + const ignorePatterns = []; + const usedPatterns = []; + let workspaceLayout; + + // some commands should always run in the context of the entire workspace + const cwd = + _this.flags.includeWorkspaceDeps || + _this.flags.workspaceRootIsCwd + ? _this.config.lockfileFolder + : _this.config.cwd; + + // non-workspaces are always root, otherwise check for workspace root + const cwdIsRoot = + !_this.config.workspaceRootFolder || + _this.config.lockfileFolder === cwd; + + // exclude package names that are in install args + const excludeNames = []; + for ( + var _iterator = excludePatterns, + _isArray = Array.isArray(_iterator), + _i = 0, + _iterator = _isArray + ? _iterator + : _iterator[Symbol.iterator](); + ; + + ) { + var _ref; + + if (_isArray) { + if (_i >= _iterator.length) break; + _ref = _iterator[_i++]; + } else { + _i = _iterator.next(); + if (_i.done) break; + _ref = _i.value; + } + + const pattern = _ref; + + if ( + (0, (_index3 || _load_index3()).getExoticResolver)(pattern) + ) { + excludeNames.push( + (0, (_guessName || _load_guessName()).default)(pattern), + ); + } else { + // extract the name + const parts = (0, + (_normalizePattern || _load_normalizePattern()) + .normalizePattern)(pattern); + excludeNames.push(parts.name); + } + } + + const stripExcluded = function stripExcluded(manifest) { + for ( + var _iterator2 = excludeNames, + _isArray2 = Array.isArray(_iterator2), + _i2 = 0, + _iterator2 = _isArray2 + ? _iterator2 + : _iterator2[Symbol.iterator](); + ; + + ) { + var _ref2; + + if (_isArray2) { + if (_i2 >= _iterator2.length) break; + _ref2 = _iterator2[_i2++]; + } else { + _i2 = _iterator2.next(); + if (_i2.done) break; + _ref2 = _i2.value; + } + + const exclude = _ref2; + + if (manifest.dependencies && manifest.dependencies[exclude]) { + delete manifest.dependencies[exclude]; + } + if ( + manifest.devDependencies && + manifest.devDependencies[exclude] + ) { + delete manifest.devDependencies[exclude]; + } + if ( + manifest.optionalDependencies && + manifest.optionalDependencies[exclude] + ) { + delete manifest.optionalDependencies[exclude]; + } + } + }; + + for ( + var _iterator3 = Object.keys( + (_index2 || _load_index2()).registries, + ), + _isArray3 = Array.isArray(_iterator3), + _i3 = 0, + _iterator3 = _isArray3 + ? _iterator3 + : _iterator3[Symbol.iterator](); + ; + + ) { + var _ref3; + + if (_isArray3) { + if (_i3 >= _iterator3.length) break; + _ref3 = _iterator3[_i3++]; + } else { + _i3 = _iterator3.next(); + if (_i3.done) break; + _ref3 = _i3.value; + } + + const registry = _ref3; + + const filename = (_index2 || _load_index2()).registries[ + registry + ].filename; + + const loc = path.join(cwd, filename); + if (!(yield (_fs || _load_fs()).exists(loc))) { + continue; + } + + _this.rootManifestRegistries.push(registry); + + const projectManifestJson = yield _this.config.readJson(loc); + yield (0, (_index || _load_index()).default)( + projectManifestJson, + cwd, + _this.config, + cwdIsRoot, + ); + + Object.assign( + _this.resolutions, + projectManifestJson.resolutions, + ); + Object.assign(manifest, projectManifestJson); + + _this.resolutionMap.init(_this.resolutions); + for ( + var _iterator4 = Object.keys( + _this.resolutionMap.resolutionsByPackage, + ), + _isArray4 = Array.isArray(_iterator4), + _i4 = 0, + _iterator4 = _isArray4 + ? _iterator4 + : _iterator4[Symbol.iterator](); + ; + + ) { + var _ref4; + + if (_isArray4) { + if (_i4 >= _iterator4.length) break; + _ref4 = _iterator4[_i4++]; + } else { + _i4 = _iterator4.next(); + if (_i4.done) break; + _ref4 = _i4.value; + } + + const packageName = _ref4; + + const optional = + (_objectPath || _load_objectPath()).default.has( + manifest.optionalDependencies, + packageName, + ) && _this.flags.ignoreOptional; + for ( + var _iterator8 = + _this.resolutionMap.resolutionsByPackage[packageName], + _isArray8 = Array.isArray(_iterator8), + _i8 = 0, + _iterator8 = _isArray8 + ? _iterator8 + : _iterator8[Symbol.iterator](); + ; + + ) { + var _ref9; + + if (_isArray8) { + if (_i8 >= _iterator8.length) break; + _ref9 = _iterator8[_i8++]; + } else { + _i8 = _iterator8.next(); + if (_i8.done) break; + _ref9 = _i8.value; + } + + const _ref8 = _ref9; + const pattern = _ref8.pattern; + + resolutionDeps = [ + ...resolutionDeps, + { registry, pattern, optional, hint: 'resolution' }, + ]; + } + } + + const pushDeps = function pushDeps( + depType, + manifest, + { hint, optional }, + isUsed, + ) { + if (ignoreUnusedPatterns && !isUsed) { + return; + } + // We only take unused dependencies into consideration to get deterministic hoisting. + // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely + // leave these out. + if (_this.flags.flat && !isUsed) { + return; + } + const depMap = manifest[depType]; + for (const name in depMap) { + if (excludeNames.indexOf(name) >= 0) { + continue; + } + + let pattern = name; + if (!_this.lockfile.getLocked(pattern)) { + // when we use --save we save the dependency to the lockfile with just the name rather than the + // version combo + pattern += '@' + depMap[name]; + } + + // normalization made sure packages are mentioned only once + if (isUsed) { + usedPatterns.push(pattern); + } else { + ignorePatterns.push(pattern); + } + + _this.rootPatternsToOrigin[pattern] = depType; + patterns.push(pattern); + deps.push({ + pattern, + registry, + hint, + optional, + workspaceName: manifest.name, + workspaceLoc: manifest._loc, + }); + } + }; + + if (cwdIsRoot) { + pushDeps( + 'dependencies', + projectManifestJson, + { hint: null, optional: false }, + true, + ); + pushDeps( + 'devDependencies', + projectManifestJson, + { hint: 'dev', optional: false }, + !_this.config.production, + ); + pushDeps( + 'optionalDependencies', + projectManifestJson, + { hint: 'optional', optional: true }, + true, + ); + } + + if (_this.config.workspaceRootFolder) { + const workspaceLoc = cwdIsRoot + ? loc + : path.join(_this.config.lockfileFolder, filename); + const workspacesRoot = path.dirname(workspaceLoc); + + let workspaceManifestJson = projectManifestJson; + if (!cwdIsRoot) { + // the manifest we read before was a child workspace, so get the root + workspaceManifestJson = yield _this.config.readJson( + workspaceLoc, + ); + yield (0, (_index || _load_index()).default)( + workspaceManifestJson, + workspacesRoot, + _this.config, + true, + ); + } + + const workspaces = yield _this.config.resolveWorkspaces( + workspacesRoot, + workspaceManifestJson, + ); + workspaceLayout = new ( + _workspaceLayout || _load_workspaceLayout() + ).default(workspaces, _this.config); + + // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine + const workspaceDependencies = (0, + (_extends2 || _load_extends()).default)( + {}, + workspaceManifestJson.dependencies, + ); + for ( + var _iterator5 = Object.keys(workspaces), + _isArray5 = Array.isArray(_iterator5), + _i5 = 0, + _iterator5 = _isArray5 + ? _iterator5 + : _iterator5[Symbol.iterator](); + ; + + ) { + var _ref5; + + if (_isArray5) { + if (_i5 >= _iterator5.length) break; + _ref5 = _iterator5[_i5++]; + } else { + _i5 = _iterator5.next(); + if (_i5.done) break; + _ref5 = _i5.value; + } + + const workspaceName = _ref5; + + const workspaceManifest = + workspaces[workspaceName].manifest; + workspaceDependencies[workspaceName] = + workspaceManifest.version; + + // include dependencies from all workspaces + if (_this.flags.includeWorkspaceDeps) { + pushDeps( + 'dependencies', + workspaceManifest, + { hint: null, optional: false }, + true, + ); + pushDeps( + 'devDependencies', + workspaceManifest, + { hint: 'dev', optional: false }, + !_this.config.production, + ); + pushDeps( + 'optionalDependencies', + workspaceManifest, + { hint: 'optional', optional: true }, + true, + ); + } + } + const virtualDependencyManifest = { + _uid: '', + name: `workspace-aggregator-${uuid.v4()}`, + version: '1.0.0', + _registry: 'npm', + _loc: workspacesRoot, + dependencies: workspaceDependencies, + devDependencies: (0, + (_extends2 || _load_extends()).default)( + {}, + workspaceManifestJson.devDependencies, + ), + optionalDependencies: (0, + (_extends2 || _load_extends()).default)( + {}, + workspaceManifestJson.optionalDependencies, + ), + private: workspaceManifestJson.private, + workspaces: workspaceManifestJson.workspaces, + }; + workspaceLayout.virtualManifestName = + virtualDependencyManifest.name; + const virtualDep = {}; + virtualDep[virtualDependencyManifest.name] = + virtualDependencyManifest.version; + workspaces[virtualDependencyManifest.name] = { + loc: workspacesRoot, + manifest: virtualDependencyManifest, + }; + + // ensure dependencies that should be excluded are stripped from the correct manifest + stripExcluded( + cwdIsRoot + ? virtualDependencyManifest + : workspaces[projectManifestJson.name].manifest, + ); + + pushDeps( + 'workspaces', + { workspaces: virtualDep }, + { hint: 'workspaces', optional: false }, + true, + ); + + const implicitWorkspaceDependencies = (0, + (_extends2 || _load_extends()).default)( + {}, + workspaceDependencies, + ); + + for ( + var _iterator6 = (_constants || _load_constants()) + .OWNED_DEPENDENCY_TYPES, + _isArray6 = Array.isArray(_iterator6), + _i6 = 0, + _iterator6 = _isArray6 + ? _iterator6 + : _iterator6[Symbol.iterator](); + ; + + ) { + var _ref6; + + if (_isArray6) { + if (_i6 >= _iterator6.length) break; + _ref6 = _iterator6[_i6++]; + } else { + _i6 = _iterator6.next(); + if (_i6.done) break; + _ref6 = _i6.value; + } + + const type = _ref6; + + for ( + var _iterator7 = Object.keys( + projectManifestJson[type] || {}, + ), + _isArray7 = Array.isArray(_iterator7), + _i7 = 0, + _iterator7 = _isArray7 + ? _iterator7 + : _iterator7[Symbol.iterator](); + ; + + ) { + var _ref7; + + if (_isArray7) { + if (_i7 >= _iterator7.length) break; + _ref7 = _iterator7[_i7++]; + } else { + _i7 = _iterator7.next(); + if (_i7.done) break; + _ref7 = _i7.value; + } + + const dependencyName = _ref7; + + delete implicitWorkspaceDependencies[dependencyName]; + } + } + + pushDeps( + 'dependencies', + { dependencies: implicitWorkspaceDependencies }, + { hint: 'workspaces', optional: false }, + true, + ); + } + + break; + } + + // inherit root flat flag + if (manifest.flat) { + _this.flags.flat = true; + } + + return { + requests: [...resolutionDeps, ...deps], + patterns, + manifest, + usedPatterns, + ignorePatterns, + workspaceLayout, + }; + }, + )(); + } + + /** + * TODO description + */ + + prepareRequests(requests) { + return requests; + } + + preparePatterns(patterns) { + return patterns; + } + preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) { + return patterns; + } + + prepareManifests() { + var _this2 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const manifests = yield _this2.config.getRootManifests(); + return manifests; + }, + )(); + } + + bailout(patterns, workspaceLayout) { + var _this3 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + // We don't want to skip the audit - it could yield important errors + if (_this3.flags.audit) { + return false; + } + // PNP is so fast that the integrity check isn't pertinent + if (_this3.config.plugnplayEnabled) { + return false; + } + if (_this3.flags.skipIntegrityCheck || _this3.flags.force) { + return false; + } + const lockfileCache = _this3.lockfile.cache; + if (!lockfileCache) { + return false; + } + const lockfileClean = + _this3.lockfile.parseResultType === 'success'; + const match = yield _this3.integrityChecker.check( + patterns, + lockfileCache, + _this3.flags, + workspaceLayout, + ); + if ( + _this3.flags.frozenLockfile && + (!lockfileClean || match.missingPatterns.length > 0) + ) { + throw new (_errors || _load_errors()).MessageError( + _this3.reporter.lang('frozenLockfileError'), + ); + } + + const haveLockfile = yield (_fs || _load_fs()).exists( + path.join( + _this3.config.lockfileFolder, + (_constants || _load_constants()).LOCKFILE_FILENAME, + ), + ); + + const lockfileIntegrityPresent = !_this3.lockfile.hasEntriesExistWithoutIntegrity(); + const integrityBailout = + lockfileIntegrityPresent || !_this3.config.autoAddIntegrity; + + if ( + match.integrityMatches && + haveLockfile && + lockfileClean && + integrityBailout + ) { + _this3.reporter.success(_this3.reporter.lang('upToDate')); + return true; + } + + if (match.integrityFileMissing && haveLockfile) { + // Integrity file missing, force script installations + _this3.scripts.setForce(true); + return false; + } + + if (match.hardRefreshRequired) { + // e.g. node version doesn't match, force script installations + _this3.scripts.setForce(true); + return false; + } + + if (!patterns.length && !match.integrityFileMissing) { + _this3.reporter.success( + _this3.reporter.lang('nothingToInstall'), + ); + yield _this3.createEmptyManifestFolders(); + yield _this3.saveLockfileAndIntegrity( + patterns, + workspaceLayout, + ); + return true; + } + + return false; + }, + )(); + } + + /** + * Produce empty folders for all used root manifests. + */ + + createEmptyManifestFolders() { + var _this4 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + if (_this4.config.modulesFolder) { + // already created + return; + } + + for ( + var _iterator9 = _this4.rootManifestRegistries, + _isArray9 = Array.isArray(_iterator9), + _i9 = 0, + _iterator9 = _isArray9 + ? _iterator9 + : _iterator9[Symbol.iterator](); + ; + + ) { + var _ref10; + + if (_isArray9) { + if (_i9 >= _iterator9.length) break; + _ref10 = _iterator9[_i9++]; + } else { + _i9 = _iterator9.next(); + if (_i9.done) break; + _ref10 = _i9.value; + } + + const registryName = _ref10; + const folder = _this4.config.registries[registryName].folder; + + yield (_fs || _load_fs()).mkdirp( + path.join(_this4.config.lockfileFolder, folder), + ); + } + }, + )(); + } + + /** + * TODO description + */ + + markIgnored(patterns) { + for ( + var _iterator10 = patterns, + _isArray10 = Array.isArray(_iterator10), + _i10 = 0, + _iterator10 = _isArray10 + ? _iterator10 + : _iterator10[Symbol.iterator](); + ; + + ) { + var _ref11; + + if (_isArray10) { + if (_i10 >= _iterator10.length) break; + _ref11 = _iterator10[_i10++]; + } else { + _i10 = _iterator10.next(); + if (_i10.done) break; + _ref11 = _i10.value; + } + + const pattern = _ref11; + + const manifest = this.resolver.getStrictResolvedPattern(pattern); + const ref = manifest._reference; + invariant(ref, 'expected package reference'); + + // just mark the package as ignored. if the package is used by a required package, the hoister + // will take care of that. + ref.ignore = true; + } + } + + /** + * helper method that gets only recent manifests + * used by global.ls command + */ + getFlattenedDeps() { + var _this5 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + var _ref12 = yield _this5.fetchRequestFromCwd(); + + const depRequests = _ref12.requests, + rawPatterns = _ref12.patterns; + + yield _this5.resolver.init(depRequests, {}); + + const manifests = yield ( + _packageFetcher || _load_packageFetcher() + ).fetch(_this5.resolver.getManifests(), _this5.config); + _this5.resolver.updateManifests(manifests); + + return _this5.flatten(rawPatterns); + }, + )(); + } + + /** + * TODO description + */ + + init() { + var _this6 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + _this6.checkUpdate(); + + // warn if we have a shrinkwrap + if ( + yield (_fs || _load_fs()).exists( + path.join( + _this6.config.lockfileFolder, + (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME, + ), + ) + ) { + _this6.reporter.warn(_this6.reporter.lang('shrinkwrapWarning')); + } + + // warn if we have an npm lockfile + if ( + yield (_fs || _load_fs()).exists( + path.join( + _this6.config.lockfileFolder, + (_constants || _load_constants()).NPM_LOCK_FILENAME, + ), + ) + ) { + _this6.reporter.warn( + _this6.reporter.lang('npmLockfileWarning'), + ); + } + + if (_this6.config.plugnplayEnabled) { + _this6.reporter.info( + _this6.reporter.lang('plugnplaySuggestV2L1'), + ); + _this6.reporter.info( + _this6.reporter.lang('plugnplaySuggestV2L2'), + ); + } + + let flattenedTopLevelPatterns = []; + const steps = []; + + var _ref13 = yield _this6.fetchRequestFromCwd(); + + const depRequests = _ref13.requests, + rawPatterns = _ref13.patterns, + ignorePatterns = _ref13.ignorePatterns, + workspaceLayout = _ref13.workspaceLayout, + manifest = _ref13.manifest; + + let topLevelPatterns = []; + + const artifacts = yield _this6.integrityChecker.getArtifacts(); + if (artifacts) { + _this6.linker.setArtifacts(artifacts); + _this6.scripts.setArtifacts(artifacts); + } + + if ( + ( + _packageCompatibility || _load_packageCompatibility() + ).shouldCheck(manifest, _this6.flags) + ) { + steps.push( + (() => { + var _ref14 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*(curr, total) { + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('checkingManifest'), + emoji.get('mag'), + ); + yield _this6.checkCompatibility(); + }, + ); + + return function(_x, _x2) { + return _ref14.apply(this, arguments); + }; + })(), + ); + } + + const audit = new (_audit || _load_audit()).default( + _this6.config, + _this6.reporter, + { + groups: (_constants || _load_constants()) + .OWNED_DEPENDENCY_TYPES, + }, + ); + let auditFoundProblems = false; + + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'resolveStep', + (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('resolvingPackages'), + emoji.get('mag'), + ); + yield _this6.resolver.init( + _this6.prepareRequests(depRequests), + { + isFlat: _this6.flags.flat, + isFrozen: _this6.flags.frozenLockfile, + workspaceLayout, + }, + ); + topLevelPatterns = _this6.preparePatterns(rawPatterns); + flattenedTopLevelPatterns = yield _this6.flatten( + topLevelPatterns, + ); + return { + bailout: + !_this6.flags.audit && + (yield _this6.bailout( + topLevelPatterns, + workspaceLayout, + )), + }; + }, + ), + ); + }); + + if (_this6.flags.audit) { + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'auditStep', + (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('auditRunning'), + emoji.get('mag'), + ); + if (_this6.flags.offline) { + _this6.reporter.warn( + _this6.reporter.lang('auditOffline'), + ); + return { bailout: false }; + } + const preparedManifests = yield _this6.prepareManifests(); + // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object` + const mergedManifest = Object.assign( + {}, + ...Object.values(preparedManifests).map(function(m) { + return m.object; + }), + ); + const auditVulnerabilityCounts = yield audit.performAudit( + mergedManifest, + _this6.lockfile, + _this6.resolver, + _this6.linker, + topLevelPatterns, + ); + auditFoundProblems = + auditVulnerabilityCounts.info || + auditVulnerabilityCounts.low || + auditVulnerabilityCounts.moderate || + auditVulnerabilityCounts.high || + auditVulnerabilityCounts.critical; + return { + bailout: yield _this6.bailout( + topLevelPatterns, + workspaceLayout, + ), + }; + }, + ), + ); + }); + } + + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'fetchStep', + (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + _this6.markIgnored(ignorePatterns); + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('fetchingPackages'), + emoji.get('truck'), + ); + const manifests = yield ( + _packageFetcher || _load_packageFetcher() + ).fetch(_this6.resolver.getManifests(), _this6.config); + _this6.resolver.updateManifests(manifests); + yield ( + _packageCompatibility || _load_packageCompatibility() + ).check( + _this6.resolver.getManifests(), + _this6.config, + _this6.flags.ignoreEngines, + ); + }, + ), + ); + }); + + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'linkStep', + (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + // remove integrity hash to make this operation atomic + yield _this6.integrityChecker.removeIntegrityFile(); + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('linkingDependencies'), + emoji.get('link'), + ); + flattenedTopLevelPatterns = _this6.preparePatternsForLinking( + flattenedTopLevelPatterns, + manifest, + _this6.config.lockfileFolder === _this6.config.cwd, + ); + yield _this6.linker.init( + flattenedTopLevelPatterns, + workspaceLayout, + { + linkDuplicates: _this6.flags.linkDuplicates, + ignoreOptional: _this6.flags.ignoreOptional, + }, + ); + }, + ), + ); + }); + + if (_this6.config.plugnplayEnabled) { + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'pnpStep', + (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const pnpPath = `${_this6.config.lockfileFolder}/${ + (_constants || _load_constants()).PNP_FILENAME + }`; + + const code = yield (0, + (_generatePnpMap || _load_generatePnpMap()) + .generatePnpMap)( + _this6.config, + flattenedTopLevelPatterns, + { + resolver: _this6.resolver, + reporter: _this6.reporter, + targetPath: pnpPath, + workspaceLayout, + }, + ); + + try { + const file = yield (_fs || _load_fs()).readFile( + pnpPath, + ); + if (file === code) { + return; + } + } catch (error) {} + + yield (_fs || _load_fs()).writeFile(pnpPath, code); + yield (_fs || _load_fs()).chmod(pnpPath, 0o755); + }, + ), + ); + }); + } + + steps.push(function(curr, total) { + return (0, (_hooks || _load_hooks()).callThroughHook)( + 'buildStep', + (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + _this6.reporter.step( + curr, + total, + _this6.flags.force + ? _this6.reporter.lang('rebuildingPackages') + : _this6.reporter.lang('buildingFreshPackages'), + emoji.get('hammer'), + ); + + if (_this6.config.ignoreScripts) { + _this6.reporter.warn( + _this6.reporter.lang('ignoredScripts'), + ); + } else { + yield _this6.scripts.init(flattenedTopLevelPatterns); + } + }, + ), + ); + }); + + if (_this6.flags.har) { + steps.push( + (() => { + var _ref21 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*(curr, total) { + const formattedDate = new Date() + .toISOString() + .replace(/:/g, '-'); + const filename = `yarn-install_${formattedDate}.har`; + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('savingHar', filename), + emoji.get('black_circle_for_record'), + ); + yield _this6.config.requestManager.saveHar(filename); + }, + ); + + return function(_x3, _x4) { + return _ref21.apply(this, arguments); + }; + })(), + ); + } + + if (yield _this6.shouldClean()) { + steps.push( + (() => { + var _ref22 = (0, + (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*(curr, total) { + _this6.reporter.step( + curr, + total, + _this6.reporter.lang('cleaningModules'), + emoji.get('recycle'), + ); + yield (0, (_autoclean || _load_autoclean()).clean)( + _this6.config, + _this6.reporter, + ); + }, + ); + + return function(_x5, _x6) { + return _ref22.apply(this, arguments); + }; + })(), + ); + } + + let currentStep = 0; + for ( + var _iterator11 = steps, + _isArray11 = Array.isArray(_iterator11), + _i11 = 0, + _iterator11 = _isArray11 + ? _iterator11 + : _iterator11[Symbol.iterator](); + ; + + ) { + var _ref23; + + if (_isArray11) { + if (_i11 >= _iterator11.length) break; + _ref23 = _iterator11[_i11++]; + } else { + _i11 = _iterator11.next(); + if (_i11.done) break; + _ref23 = _i11.value; + } + + const step = _ref23; + + const stepResult = yield step(++currentStep, steps.length); + if (stepResult && stepResult.bailout) { + if (_this6.flags.audit) { + audit.summary(); + } + if (auditFoundProblems) { + _this6.reporter.warn( + _this6.reporter.lang('auditRunAuditForDetails'), + ); + } + _this6.maybeOutputUpdate(); + return flattenedTopLevelPatterns; + } + } + + // fin! + if (_this6.flags.audit) { + audit.summary(); + } + if (auditFoundProblems) { + _this6.reporter.warn( + _this6.reporter.lang('auditRunAuditForDetails'), + ); + } + yield _this6.saveLockfileAndIntegrity( + topLevelPatterns, + workspaceLayout, + ); + yield _this6.persistChanges(); + _this6.maybeOutputUpdate(); + _this6.config.requestManager.clearCache(); + return flattenedTopLevelPatterns; + }, + )(); + } + + checkCompatibility() { + var _this7 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + var _ref24 = yield _this7.fetchRequestFromCwd(); + + const manifest = _ref24.manifest; + + yield ( + _packageCompatibility || _load_packageCompatibility() + ).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines); + }, + )(); + } + + persistChanges() { + var _this8 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + // get all the different registry manifests in this folder + const manifests = yield _this8.config.getRootManifests(); + + if (yield _this8.applyChanges(manifests)) { + yield _this8.config.saveRootManifests(manifests); + } + }, + )(); + } + + applyChanges(manifests) { + let hasChanged = false; + + if (this.config.plugnplayPersist) { + const object = manifests.npm.object; + + if (typeof object.installConfig !== 'object') { + object.installConfig = {}; + } + + if ( + this.config.plugnplayEnabled && + object.installConfig.pnp !== true + ) { + object.installConfig.pnp = true; + hasChanged = true; + } else if ( + !this.config.plugnplayEnabled && + typeof object.installConfig.pnp !== 'undefined' + ) { + delete object.installConfig.pnp; + hasChanged = true; + } + + if (Object.keys(object.installConfig).length === 0) { + delete object.installConfig; + } + } + + return Promise.resolve(hasChanged); + } + + /** + * Check if we should run the cleaning step. + */ + + shouldClean() { + return (_fs || _load_fs()).exists( + path.join( + this.config.lockfileFolder, + (_constants || _load_constants()).CLEAN_FILENAME, + ), + ); + } + + /** + * TODO + */ + + flatten(patterns) { + var _this9 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + if (!_this9.flags.flat) { + return patterns; + } + + const flattenedPatterns = []; + + for ( + var _iterator12 = _this9.resolver.getAllDependencyNamesByLevelOrder( + patterns, + ), + _isArray12 = Array.isArray(_iterator12), + _i12 = 0, + _iterator12 = _isArray12 + ? _iterator12 + : _iterator12[Symbol.iterator](); + ; + + ) { + var _ref25; + + if (_isArray12) { + if (_i12 >= _iterator12.length) break; + _ref25 = _iterator12[_i12++]; + } else { + _i12 = _iterator12.next(); + if (_i12.done) break; + _ref25 = _i12.value; + } + + const name = _ref25; + + const infos = _this9.resolver + .getAllInfoForPackageName(name) + .filter(function(manifest) { + const ref = manifest._reference; + invariant(ref, 'expected package reference'); + return !ref.ignore; + }); + + if (infos.length === 0) { + continue; + } + + if (infos.length === 1) { + // single version of this package + // take out a single pattern as multiple patterns may have resolved to this package + flattenedPatterns.push( + _this9.resolver.patternsByPackage[name][0], + ); + continue; + } + + const options = infos.map(function(info) { + const ref = info._reference; + invariant(ref, 'expected reference'); + return { + // TODO `and is required by {PARENT}`, + name: _this9.reporter.lang( + 'manualVersionResolutionOption', + ref.patterns.join(', '), + info.version, + ), + + value: info.version, + }; + }); + const versions = infos.map(function(info) { + return info.version; + }); + let version; + + const resolutionVersion = _this9.resolutions[name]; + if ( + resolutionVersion && + versions.indexOf(resolutionVersion) >= 0 + ) { + // use json `resolution` version + version = resolutionVersion; + } else { + version = yield _this9.reporter.select( + _this9.reporter.lang('manualVersionResolution', name), + _this9.reporter.lang('answer'), + options, + ); + _this9.resolutions[name] = version; + } + + flattenedPatterns.push( + _this9.resolver.collapseAllVersionsOfPackage(name, version), + ); + } + + // save resolutions to their appropriate root manifest + if (Object.keys(_this9.resolutions).length) { + const manifests = yield _this9.config.getRootManifests(); + + for (const name in _this9.resolutions) { + const version = _this9.resolutions[name]; + + const patterns = _this9.resolver.patternsByPackage[name]; + if (!patterns) { + continue; + } + + let manifest; + for ( + var _iterator13 = patterns, + _isArray13 = Array.isArray(_iterator13), + _i13 = 0, + _iterator13 = _isArray13 + ? _iterator13 + : _iterator13[Symbol.iterator](); + ; + + ) { + var _ref26; + + if (_isArray13) { + if (_i13 >= _iterator13.length) break; + _ref26 = _iterator13[_i13++]; + } else { + _i13 = _iterator13.next(); + if (_i13.done) break; + _ref26 = _i13.value; + } + + const pattern = _ref26; + + manifest = _this9.resolver.getResolvedPattern(pattern); + if (manifest) { + break; + } + } + invariant(manifest, 'expected manifest'); + + const ref = manifest._reference; + invariant(ref, 'expected reference'); + + const object = manifests[ref.registry].object; + object.resolutions = object.resolutions || {}; + object.resolutions[name] = version; + } + + yield _this9.config.saveRootManifests(manifests); + } + + return flattenedPatterns; + }, + )(); + } + + /** + * Remove offline tarballs that are no longer required + */ + + pruneOfflineMirror(lockfile) { + var _this10 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const mirror = _this10.config.getOfflineMirrorPath(); + if (!mirror) { + return; + } + + const requiredTarballs = new Set(); + for (const dependency in lockfile) { + const resolved = lockfile[dependency].resolved; + if (resolved) { + const basename = path.basename(resolved.split('#')[0]); + if (dependency[0] === '@' && basename[0] !== '@') { + requiredTarballs.add( + `${dependency.split('/')[0]}-${basename}`, + ); + } + requiredTarballs.add(basename); + } + } + + const mirrorFiles = yield (_fs || _load_fs()).walk(mirror); + for ( + var _iterator14 = mirrorFiles, + _isArray14 = Array.isArray(_iterator14), + _i14 = 0, + _iterator14 = _isArray14 + ? _iterator14 + : _iterator14[Symbol.iterator](); + ; + + ) { + var _ref27; + + if (_isArray14) { + if (_i14 >= _iterator14.length) break; + _ref27 = _iterator14[_i14++]; + } else { + _i14 = _iterator14.next(); + if (_i14.done) break; + _ref27 = _i14.value; + } + + const file = _ref27; + + const isTarball = path.extname(file.basename) === '.tgz'; + // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages + const hasPrebuiltPackage = file.relative.startsWith( + 'prebuilt/', + ); + if ( + isTarball && + !hasPrebuiltPackage && + !requiredTarballs.has(file.basename) + ) { + yield (_fs || _load_fs()).unlink(file.absolute); + } + } + }, + )(); + } + + /** + * Save updated integrity and lockfiles. + */ + + saveLockfileAndIntegrity(patterns, workspaceLayout) { + var _this11 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const resolvedPatterns = {}; + Object.keys(_this11.resolver.patterns).forEach(function(pattern) { + if ( + !workspaceLayout || + !workspaceLayout.getManifestByPattern(pattern) + ) { + resolvedPatterns[pattern] = + _this11.resolver.patterns[pattern]; + } + }); + + // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile + patterns = patterns.filter(function(p) { + return ( + !workspaceLayout || !workspaceLayout.getManifestByPattern(p) + ); + }); + + const lockfileBasedOnResolver = _this11.lockfile.getLockfile( + resolvedPatterns, + ); + + if (_this11.config.pruneOfflineMirror) { + yield _this11.pruneOfflineMirror(lockfileBasedOnResolver); + } + + // write integrity hash + if (!_this11.config.plugnplayEnabled) { + yield _this11.integrityChecker.save( + patterns, + lockfileBasedOnResolver, + _this11.flags, + workspaceLayout, + _this11.scripts.getArtifacts(), + ); + } + + // --no-lockfile or --pure-lockfile or --frozen-lockfile + if ( + _this11.flags.lockfile === false || + _this11.flags.pureLockfile || + _this11.flags.frozenLockfile + ) { + return; + } + + const lockFileHasAllPatterns = patterns.every(function(p) { + return _this11.lockfile.getLocked(p); + }); + const lockfilePatternsMatch = Object.keys( + _this11.lockfile.cache || {}, + ).every(function(p) { + return lockfileBasedOnResolver[p]; + }); + const resolverPatternsAreSameAsInLockfile = Object.keys( + lockfileBasedOnResolver, + ).every(function(pattern) { + const manifest = _this11.lockfile.getLocked(pattern); + return ( + manifest && + manifest.resolved === + lockfileBasedOnResolver[pattern].resolved && + deepEqual( + manifest.prebuiltVariants, + lockfileBasedOnResolver[pattern].prebuiltVariants, + ) + ); + }); + const integrityPatternsAreSameAsInLockfile = Object.keys( + lockfileBasedOnResolver, + ).every(function(pattern) { + const existingIntegrityInfo = + lockfileBasedOnResolver[pattern].integrity; + if (!existingIntegrityInfo) { + // if this entry does not have an integrity, no need to re-write the lockfile because of it + return true; + } + const manifest = _this11.lockfile.getLocked(pattern); + if (manifest && manifest.integrity) { + const manifestIntegrity = ssri.stringify(manifest.integrity); + return manifestIntegrity === existingIntegrityInfo; + } + return false; + }); + + // remove command is followed by install with force, lockfile will be rewritten in any case then + if ( + !_this11.flags.force && + _this11.lockfile.parseResultType === 'success' && + lockFileHasAllPatterns && + lockfilePatternsMatch && + resolverPatternsAreSameAsInLockfile && + integrityPatternsAreSameAsInLockfile && + patterns.length + ) { + return; + } + + // build lockfile location + const loc = path.join( + _this11.config.lockfileFolder, + (_constants || _load_constants()).LOCKFILE_FILENAME, + ); + + // write lockfile + const lockSource = (0, + (_lockfile2 || _load_lockfile2()).stringify)( + lockfileBasedOnResolver, + false, + _this11.config.enableLockfileVersions, + ); + yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource); + + _this11._logSuccessSaveLockfile(); + }, + )(); + } + + _logSuccessSaveLockfile() { + this.reporter.success(this.reporter.lang('savedLockfile')); + } + + /** + * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd. + */ + hydrate(ignoreUnusedPatterns) { + var _this12 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + const request = yield _this12.fetchRequestFromCwd( + [], + ignoreUnusedPatterns, + ); + const depRequests = request.requests, + rawPatterns = request.patterns, + ignorePatterns = request.ignorePatterns, + workspaceLayout = request.workspaceLayout; + + yield _this12.resolver.init(depRequests, { + isFlat: _this12.flags.flat, + isFrozen: _this12.flags.frozenLockfile, + workspaceLayout, + }); + yield _this12.flatten(rawPatterns); + _this12.markIgnored(ignorePatterns); + + // fetch packages, should hit cache most of the time + const manifests = yield ( + _packageFetcher || _load_packageFetcher() + ).fetch(_this12.resolver.getManifests(), _this12.config); + _this12.resolver.updateManifests(manifests); + yield ( + _packageCompatibility || _load_packageCompatibility() + ).check( + _this12.resolver.getManifests(), + _this12.config, + _this12.flags.ignoreEngines, + ); + + // expand minimal manifests + for ( + var _iterator15 = _this12.resolver.getManifests(), + _isArray15 = Array.isArray(_iterator15), + _i15 = 0, + _iterator15 = _isArray15 + ? _iterator15 + : _iterator15[Symbol.iterator](); + ; + + ) { + var _ref28; + + if (_isArray15) { + if (_i15 >= _iterator15.length) break; + _ref28 = _iterator15[_i15++]; + } else { + _i15 = _iterator15.next(); + if (_i15.done) break; + _ref28 = _i15.value; + } + + const manifest = _ref28; + + const ref = manifest._reference; + invariant(ref, 'expected reference'); + const type = ref.remote.type; + // link specifier won't ever hit cache + + let loc = ''; + if (type === 'link') { + continue; + } else if (type === 'workspace') { + if (!ref.remote.reference) { + continue; + } + loc = ref.remote.reference; + } else { + loc = _this12.config.generateModuleCachePath(ref); + } + const newPkg = yield _this12.config.readManifest(loc); + yield _this12.resolver.updateManifest(ref, newPkg); + } + + return request; + }, + )(); + } + + /** + * Check for updates every day and output a nag message if there's a newer version. + */ + + checkUpdate() { + if (this.config.nonInteractive) { + // don't show upgrade dialog on CI or non-TTY terminals + return; + } + + // don't check if disabled + if (this.config.getOption('disable-self-update-check')) { + return; + } + + // only check for updates once a day + const lastUpdateCheck = + Number(this.config.getOption('lastUpdateCheck')) || 0; + if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) { + return; + } + + // don't bug for updates on tagged releases + if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) { + return; + } + + this._checkUpdate().catch(() => { + // swallow errors + }); + } + + _checkUpdate() { + var _this13 = this; + + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)( + function*() { + let latestVersion = yield _this13.config.requestManager.request({ + url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL, + }); + invariant(typeof latestVersion === 'string', 'expected string'); + latestVersion = latestVersion.trim(); + if (!semver.valid(latestVersion)) { + return; + } + + // ensure we only check for updates periodically + _this13.config.registries.yarn.saveHomeConfig({ + lastUpdateCheck: Date.now(), + }); + + if ( + semver.gt( + latestVersion, + (_yarnVersion || _load_yarnVersion()).version, + ) + ) { + const installationMethod = yield (0, + (_yarnVersion || _load_yarnVersion()).getInstallationMethod)(); + _this13.maybeOutputUpdate = function() { + _this13.reporter.warn( + _this13.reporter.lang( + 'yarnOutdated', + latestVersion, + (_yarnVersion || _load_yarnVersion()).version, + ), + ); + + const command = getUpdateCommand(installationMethod); + if (command) { + _this13.reporter.info( + _this13.reporter.lang('yarnOutdatedCommand'), + ); + _this13.reporter.command(command); + } else { + const installer = getUpdateInstaller(installationMethod); + if (installer) { + _this13.reporter.info( + _this13.reporter.lang( + 'yarnOutdatedInstaller', + installer, + ), + ); + } + } + }; + } + }, + )(); + } + + /** + * Method to override with a possible upgrade message. + */ + + maybeOutputUpdate() {} + } + + exports.Install = Install; + function hasWrapper(commander, args) { + return true; + } + + function setFlags(commander) { + commander.description( + 'Yarn install is used to install all dependencies for a project.', + ); + commander.usage('install [flags]'); + commander.option( + '-A, --audit', + 'Run vulnerability audit on installed packages', + ); + commander.option('-g, --global', 'DEPRECATED'); + commander.option( + '-S, --save', + 'DEPRECATED - save package to your `dependencies`', + ); + commander.option( + '-D, --save-dev', + 'DEPRECATED - save package to your `devDependencies`', + ); + commander.option( + '-P, --save-peer', + 'DEPRECATED - save package to your `peerDependencies`', + ); + commander.option( + '-O, --save-optional', + 'DEPRECATED - save package to your `optionalDependencies`', + ); + commander.option('-E, --save-exact', 'DEPRECATED'); + commander.option('-T, --save-tilde', 'DEPRECATED'); + } + + /***/ + }, + /* 35 */ + /***/ function(module, exports, __webpack_require__) { + var isObject = __webpack_require__(52); + module.exports = function(it) { + if (!isObject(it)) throw TypeError(it + ' is not an object!'); + return it; + }; + + /***/ + }, + /* 36 */ + /***/ function(module, __webpack_exports__, __webpack_require__) { + 'use strict'; + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'b', + function() { + return SubjectSubscriber; + }, + ); + /* harmony export (binding) */ __webpack_require__.d( + __webpack_exports__, + 'a', + function() { + return Subject; + }, + ); + /* unused harmony export AnonymousSubject */ + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__( + 1, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__( + 12, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__( + 7, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__( + 25, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__( + 189, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__( + 422, + ); + /* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__( + 321, + ); + /** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */ + + var SubjectSubscriber = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + SubjectSubscriber, + _super, + ); + function SubjectSubscriber(destination) { + var _this = _super.call(this, destination) || this; + _this.destination = destination; + return _this; + } + return SubjectSubscriber; + })(__WEBPACK_IMPORTED_MODULE_2__Subscriber__['a' /* Subscriber */]); + + var Subject = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + Subject, + _super, + ); + function Subject() { + var _this = _super.call(this) || this; + _this.observers = []; + _this.closed = false; + _this.isStopped = false; + _this.hasError = false; + _this.thrownError = null; + return _this; + } + Subject.prototype[ + __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__[ + 'a' /* rxSubscriber */ + ] + ] = function() { + return new SubjectSubscriber(this); + }; + Subject.prototype.lift = function(operator) { + var subject = new AnonymousSubject(this, this); + subject.operator = operator; + return subject; + }; + Subject.prototype.next = function(value) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__[ + 'a' /* ObjectUnsubscribedError */ + ](); + } + if (!this.isStopped) { + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].next(value); + } + } + }; + Subject.prototype.error = function(err) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__[ + 'a' /* ObjectUnsubscribedError */ + ](); + } + this.hasError = true; + this.thrownError = err; + this.isStopped = true; + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].error(err); + } + this.observers.length = 0; + }; + Subject.prototype.complete = function() { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__[ + 'a' /* ObjectUnsubscribedError */ + ](); + } + this.isStopped = true; + var observers = this.observers; + var len = observers.length; + var copy = observers.slice(); + for (var i = 0; i < len; i++) { + copy[i].complete(); + } + this.observers.length = 0; + }; + Subject.prototype.unsubscribe = function() { + this.isStopped = true; + this.closed = true; + this.observers = null; + }; + Subject.prototype._trySubscribe = function(subscriber) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__[ + 'a' /* ObjectUnsubscribedError */ + ](); + } else { + return _super.prototype._trySubscribe.call(this, subscriber); + } + }; + Subject.prototype._subscribe = function(subscriber) { + if (this.closed) { + throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__[ + 'a' /* ObjectUnsubscribedError */ + ](); + } else if (this.hasError) { + subscriber.error(this.thrownError); + return __WEBPACK_IMPORTED_MODULE_3__Subscription__[ + 'a' /* Subscription */ + ].EMPTY; + } else if (this.isStopped) { + subscriber.complete(); + return __WEBPACK_IMPORTED_MODULE_3__Subscription__[ + 'a' /* Subscription */ + ].EMPTY; + } else { + this.observers.push(subscriber); + return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__[ + 'a' /* SubjectSubscription */ + ](this, subscriber); + } + }; + Subject.prototype.asObservable = function() { + var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__[ + 'a' /* Observable */ + ](); + observable.source = this; + return observable; + }; + Subject.create = function(destination, source) { + return new AnonymousSubject(destination, source); + }; + return Subject; + })(__WEBPACK_IMPORTED_MODULE_1__Observable__['a' /* Observable */]); + + var AnonymousSubject = /*@__PURE__*/ (function(_super) { + __WEBPACK_IMPORTED_MODULE_0_tslib__['a' /* __extends */]( + AnonymousSubject, + _super, + ); + function AnonymousSubject(destination, source) { + var _this = _super.call(this) || this; + _this.destination = destination; + _this.source = source; + return _this; + } + AnonymousSubject.prototype.next = function(value) { + var destination = this.destination; + if (destination && destination.next) { + destination.next(value); + } + }; + AnonymousSubject.prototype.error = function(err) { + var destination = this.destination; + if (destination && destination.error) { + this.destination.error(err); + } + }; + AnonymousSubject.prototype.complete = function() { + var destination = this.destination; + if (destination && destination.complete) { + this.destination.complete(); + } + }; + AnonymousSubject.prototype._subscribe = function(subscriber) { + var source = this.source; + if (source) { + return this.source.subscribe(subscriber); + } else { + return __WEBPACK_IMPORTED_MODULE_3__Subscription__[ + 'a' /* Subscription */ + ].EMPTY; + } + }; + return AnonymousSubject; + })(Subject); + + //# sourceMappingURL=Subject.js.map + + /***/ + }, + /* 37 */ + /***/ function(module, exports, __webpack_require__) { + 'use strict'; + + Object.defineProperty(exports, '__esModule', { + value: true, + }); + exports.normalizePattern = normalizePattern; + + /** + * Explode and normalize a pattern into its name and range. + */ + + function normalizePattern(pattern) { + let hasVersion = false; + let range = 'latest'; + let name = pattern; + + // if we're a scope then remove the @ and add it back later + let isScoped = false; + if (name[0] === '@') { + isScoped = true; + name = name.slice(1); + } + + // take first part as the name + const parts = name.split('@'); + if (parts.length > 1) { + name = parts.shift(); + range = parts.join('@'); + + if (range) { + hasVersion = true; + } else { + range = '*'; + } + } + + // add back @ scope suffix + if (isScoped) { + name = `@${name}`; + } + + return { name, range, hasVersion }; + } + + /***/ + }, + /* 38 */ + /***/ function(module, exports, __webpack_require__) { + /* WEBPACK VAR INJECTION */ (function(module) { + var __WEBPACK_AMD_DEFINE_RESULT__; + /** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ + (function() { + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; + + /** Used as the semantic version number. */ + var VERSION = '4.17.10'; + + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; + + /** Error message constants. */ + var CORE_ERROR_TEXT = + 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; + + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; + + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; + + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; + + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; + + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; + + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; + + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; + + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; + + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; + + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e308, + NAN = 0 / 0; + + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG], + ]; + + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; + + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; + + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); + + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; + + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; + + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; + + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; + + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; + + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; + + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; + + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; + + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; + + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; + + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; + + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = + rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = + ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = + rsMathOpRange + + rsNonCharRange + + rsPunctuationRange + + rsSpaceRange; + + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = + '[^' + + rsAstralRange + + rsBreakRange + + rsDigits + + rsDingbatRange + + rsLowerRange + + rsUpperRange + + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; + + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = + '(?:' + + rsZWJ + + '(?:' + + [rsNonAstral, rsRegional, rsSurrPair].join('|') + + ')' + + rsOptVar + + reOptMod + + ')*', + rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', + rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = + '(?:' + + [rsDingbat, rsRegional, rsSurrPair].join('|') + + ')' + + rsSeq, + rsSymbol = + '(?:' + + [ + rsNonAstral + rsCombo + '?', + rsCombo, + rsRegional, + rsSurrPair, + rsAstral, + ].join('|') + + ')'; + + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); + + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); + + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp( + rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, + 'g', + ); + + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp( + [ + rsUpper + + '?' + + rsLower + + '+' + + rsOptContrLower + + '(?=' + + [rsBreak, rsUpper, '$'].join('|') + + ')', + rsMiscUpper + + '+' + + rsOptContrUpper + + '(?=' + + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji, + ].join('|'), + 'g', + ); + + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp( + '[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']', + ); + + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', + 'Buffer', + 'DataView', + 'Date', + 'Error', + 'Float32Array', + 'Float64Array', + 'Function', + 'Int8Array', + 'Int16Array', + 'Int32Array', + 'Map', + 'Math', + 'Object', + 'Promise', + 'RegExp', + 'Set', + 'String', + 'Symbol', + 'TypeError', + 'Uint8Array', + 'Uint8ClampedArray', + 'Uint16Array', + 'Uint32Array', + 'WeakMap', + '_', + 'clearTimeout', + 'isFinite', + 'parseInt', + 'setTimeout', + ]; + + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; + + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[ + float64Tag + ] = typedArrayTags[int8Tag] = typedArrayTags[ + int16Tag + ] = typedArrayTags[int32Tag] = typedArrayTags[ + uint8Tag + ] = typedArrayTags[uint8ClampedTag] = typedArrayTags[ + uint16Tag + ] = typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[ + arrayBufferTag + ] = typedArrayTags[boolTag] = typedArrayTags[ + dataViewTag + ] = typedArrayTags[dateTag] = typedArrayTags[ + errorTag + ] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[ + numberTag + ] = typedArrayTags[objectTag] = typedArrayTags[ + regexpTag + ] = typedArrayTags[setTag] = typedArrayTags[ + stringTag + ] = typedArrayTags[weakMapTag] = false; + + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[ + arrayBufferTag + ] = cloneableTags[dataViewTag] = cloneableTags[ + boolTag + ] = cloneableTags[dateTag] = cloneableTags[ + float32Tag + ] = cloneableTags[float64Tag] = cloneableTags[ + int8Tag + ] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[ + mapTag + ] = cloneableTags[numberTag] = cloneableTags[ + objectTag + ] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[ + stringTag + ] = cloneableTags[symbolTag] = cloneableTags[ + uint8Tag + ] = cloneableTags[uint8ClampedTag] = cloneableTags[ + uint16Tag + ] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[ + weakMapTag + ] = false; + + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + À: 'A', + Á: 'A', + Â: 'A', + Ã: 'A', + Ä: 'A', + Å: 'A', + à: 'a', + á: 'a', + â: 'a', + ã: 'a', + ä: 'a', + å: 'a', + Ç: 'C', + ç: 'c', + Ð: 'D', + ð: 'd', + È: 'E', + É: 'E', + Ê: 'E', + Ë: 'E', + è: 'e', + é: 'e', + ê: 'e', + ë: 'e', + Ì: 'I', + Í: 'I', + Î: 'I', + Ï: 'I', + ì: 'i', + í: 'i', + î: 'i', + ï: 'i', + Ñ: 'N', + ñ: 'n', + Ò: 'O', + Ó: 'O', + Ô: 'O', + Õ: 'O', + Ö: 'O', + Ø: 'O', + ò: 'o', + ó: 'o', + ô: 'o', + õ: 'o', + ö: 'o', + ø: 'o', + Ù: 'U', + Ú: 'U', + Û: 'U', + Ü: 'U', + ù: 'u', + ú: 'u', + û: 'u', + ü: 'u', + Ý: 'Y', + ý: 'y', + ÿ: 'y', + Æ: 'Ae', + æ: 'ae', + Þ: 'Th', + þ: 'th', + ß: 'ss', + // Latin Extended-A block. + Ā: 'A', + Ă: 'A', + Ą: 'A', + ā: 'a', + ă: 'a', + ą: 'a', + Ć: 'C', + Ĉ: 'C', + Ċ: 'C', + Č: 'C', + ć: 'c', + ĉ: 'c', + ċ: 'c', + č: 'c', + Ď: 'D', + Đ: 'D', + ď: 'd', + đ: 'd', + Ē: 'E', + Ĕ: 'E', + Ė: 'E', + Ę: 'E', + Ě: 'E', + ē: 'e', + ĕ: 'e', + ė: 'e', + ę: 'e', + ě: 'e', + Ĝ: 'G', + Ğ: 'G', + Ġ: 'G', + Ģ: 'G', + ĝ: 'g', + ğ: 'g', + ġ: 'g', + ģ: 'g', + Ĥ: 'H', + Ħ: 'H', + ĥ: 'h', + ħ: 'h', + Ĩ: 'I', + Ī: 'I', + Ĭ: 'I', + Į: 'I', + İ: 'I', + ĩ: 'i', + ī: 'i', + ĭ: 'i', + į: 'i', + ı: 'i', + Ĵ: 'J', + ĵ: 'j', + Ķ: 'K', + ķ: 'k', + ĸ: 'k', + Ĺ: 'L', + Ļ: 'L', + Ľ: 'L', + Ŀ: 'L', + Ł: 'L', + ĺ: 'l', + ļ: 'l', + ľ: 'l', + ŀ: 'l', + ł: 'l', + Ń: 'N', + Ņ: 'N', + Ň: 'N', + Ŋ: 'N', + ń: 'n', + ņ: 'n', + ň: 'n', + ŋ: 'n', + Ō: 'O', + Ŏ: 'O', + Ő: 'O', + ō: 'o', + ŏ: 'o', + ő: 'o', + Ŕ: 'R', + Ŗ: 'R', + Ř: 'R', + ŕ: 'r', + ŗ: 'r', + ř: 'r', + Ś: 'S', + Ŝ: 'S', + Ş: 'S', + Š: 'S', + ś: 's', + ŝ: 's', + ş: 's', + š: 's', + Ţ: 'T', + Ť: 'T', + Ŧ: 'T', + ţ: 't', + ť: 't', + ŧ: 't', + Ũ: 'U', + Ū: 'U', + Ŭ: 'U', + Ů: 'U', + Ű: 'U', + Ų: 'U', + ũ: 'u', + ū: 'u', + ŭ: 'u', + ů: 'u', + ű: 'u', + ų: 'u', + Ŵ: 'W', + ŵ: 'w', + Ŷ: 'Y', + ŷ: 'y', + Ÿ: 'Y', + Ź: 'Z', + Ż: 'Z', + Ž: 'Z', + ź: 'z', + ż: 'z', + ž: 'z', + IJ: 'IJ', + ij: 'ij', + Œ: 'Oe', + œ: 'oe', + ʼn: "'n", + ſ: 's', + }; + + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''', + }; + + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'", + }; + + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029', + }; + + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; + + /** Detect free variable `global` from Node.js. */ + var freeGlobal = + typeof global == 'object' && + global && + global.Object === Object && + global; + + /** Detect free variable `self`. */ + var freeSelf = + typeof self == 'object' && self && self.Object === Object && self; + + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); + + /** Detect free variable `exports`. */ + var freeExports = + typeof exports == 'object' && + exports && + !exports.nodeType && + exports; + + /** Detect free variable `module`. */ + var freeModule = + freeExports && + typeof module == 'object' && + module && + !module.nodeType && + module; + + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; + + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; + + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + // Use `util.types` for Node.js 10+. + var types = + freeModule && + freeModule.require && + freeModule.require('util').types; + + if (types) { + return types; + } + + // Legacy `process.binding('util')` for Node.js < 10. + return ( + freeProcess && + freeProcess.binding && + freeProcess.binding('util') + ); + } catch (e) {} + })(); + + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; + + /*--------------------------------------------------------------------------*/ + + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: + return func.call(thisArg); + case 1: + return func.call(thisArg, args[0]); + case 2: + return func.call(thisArg, args[0], args[1]); + case 3: + return func.call(thisArg, args[0], args[1], args[2]); + } + return func.apply(thisArg, args); + } + + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); + } + return accumulator; + } + + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; + + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } + } + return true; + } + + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } + + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { + return true; + } + } + return false; + } + + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); + + while (++index < length) { + result[index] = iteratee(array[index], index, array); + } + return result; + } + + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; + + while (++index < length) { + array[offset + index] = values[index]; + } + return array; + } + + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; + + if (initAccum && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; + } + + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } + + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; + } + } + return false; + } + + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); + + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } + + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } + + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; + } + }); + return result; + } + + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); + + while (fromRight ? index-- : ++index < length) { + if (predicate(array[index], index, array)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } + + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (comparator(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } + + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? baseSum(array, iteratee) / length : NAN; + } + + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce( + collection, + iteratee, + accumulator, + initAccum, + eachFunc, + ) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? ((initAccum = false), value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; + + array.sort(comparer); + while (length--) { + array[length] = array[length].value; + } + return array; + } + + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; + + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : result + current; + } + } + return result; + } + + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); + } + return result; + } + + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } + + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } + + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } + + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } + + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; + + while ( + ++index < length && + baseIndexOf(chrSymbols, strSymbols[index], 0) > -1 + ) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; + + while ( + index-- && + baseIndexOf(chrSymbols, strSymbols[index], 0) > -1 + ) {} + return index; + } + + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; + + while (length--) { + if (array[length] === placeholder) { + ++result; + } + } + return result; + } + + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); + + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); + + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } + + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } + + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } + + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } + + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; + + while (!(data = iterator.next()).done) { + result.push(data.value); + } + return result; + } + + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); + + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } + + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } + + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; + } + } + return result; + } + + /** + * Gets the value at `key`, unless `key` is "__proto__". + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function safeGet(object, key) { + return key == '__proto__' ? undefined : object[key]; + } + + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } + + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } + + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; + } + } + return index; + } + + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) ? unicodeSize(string) : asciiSize(string); + } + + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = (reUnicode.lastIndex = 0); + while (reUnicode.test(string)) { + ++result; + } + return result; + } + + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } + + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = function runInContext(context) { + context = + context == null + ? root + : _.defaults( + root.Object(), + context, + _.pick(root, contextProps), + ); + + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; + + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec( + (coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO) || + '', + ); + return uid ? 'Symbol(src)_1.' + uid : ''; + })(); + + /** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp( + '^' + + funcToString + .call(hasOwnProperty) + .replace(reRegExpChar, '\\$&') + .replace( + /hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, + '$1.*?', + ) + + '$', + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + })(); + + /** Mocked built-ins. */ + var ctxClearTimeout = + context.clearTimeout !== root.clearTimeout && + context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = + context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap(); + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. + * + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true + */ + function lodash(value) { + if ( + isObjectLike(value) && + !isArray(value) && + !(value instanceof LazyWrapper) + ) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } + } + return new LodashWrapper(value); + } + + /** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. + */ + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; + } + if (objectCreate) { + return objectCreate(proto); + } + object.prototype = proto; + var result = new object(); + object.prototype = undefined; + return result; + }; + })(); + + /** + * The function whose prototype chain sequence wrappers inherit from. + * + * @private + */ + function baseLodash() { + // No operation performed. + } + + /** + * The base constructor for creating `lodash` wrapper objects. + * + * @private + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. + */ + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; + } + + /** + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. + * + * @static + * @memberOf _ + * @type {Object} + */ + lodash.templateSettings = { + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + escape: reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + evaluate: reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + interpolate: reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + variable: '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + imports: { + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + _: lodash, + }, + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. + * + * @private + * @constructor + * @param {*} value The value to wrap. + */ + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; + } + + /** + * Creates a clone of the lazy wrapper object. + * + * @private + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. + */ + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; + } + + /** + * Reverses the direction of lazy iteration. + * + * @private + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. + */ + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; + } + return result; + } + + /** + * Extracts the unwrapped value from its lazy wrapper. + * + * @private + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. + */ + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : start - 1, + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); + + if ( + !isArr || + (!isRight && arrLength == length && takeCount == length) + ) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; + + outer: while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + result[resIndex++] = value; + } + return result; + } + + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a hash object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Hash(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the hash. + * + * @private + * @name clear + * @memberOf Hash + */ + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; + } + + /** + * Removes `key` and its value from the hash. + * + * @private + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the hash value for `key`. + * + * @private + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; + } + return hasOwnProperty.call(data, key) ? data[key] : undefined; + } + + /** + * Checks if a hash value for `key` exists. + * + * @private + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function hashHas(key) { + var data = this.__data__; + return nativeCreate + ? data[key] !== undefined + : hasOwnProperty.call(data, key); + } + + /** + * Sets the hash `key` to `value`. + * + * @private + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. + */ + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = + nativeCreate && value === undefined ? HASH_UNDEFINED : value; + return this; + } + + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an list cache object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the list cache. + * + * @private + * @name clear + * @memberOf ListCache + */ + function listCacheClear() { + this.__data__ = []; + this.size = 0; + } + + /** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; + } + + /** + * Gets the list cache value for `key`. + * + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; + } + + /** + * Checks if a list cache value for `key` exists. + * + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; + } + + /** + * Sets the list cache `key` to `value`. + * + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. + */ + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; + } + return this; + } + + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a map cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function MapCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the map. + * + * @private + * @name clear + * @memberOf MapCache + */ + function mapCacheClear() { + this.size = 0; + this.__data__ = { + hash: new Hash(), + map: new (Map || ListCache)(), + string: new Hash(), + }; + } + + /** + * Removes `key` and its value from the map. + * + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the map value for `key`. + * + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function mapCacheGet(key) { + return getMapData(this, key).get(key); + } + + /** + * Checks if a map value for `key` exists. + * + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function mapCacheHas(key) { + return getMapData(this, key).has(key); + } + + /** + * Sets the map `key` to `value`. + * + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. + */ + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; + } + + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * + * Creates an array cache object to store unique values. + * + * @private + * @constructor + * @param {Array} [values] The values to cache. + */ + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache(); + while (++index < length) { + this.add(values[index]); + } + } + + /** + * Adds `value` to the array cache. + * + * @private + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. + */ + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; + } + + /** + * Checks if `value` is in the array cache. + * + * @private + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. + */ + function setCacheHas(value) { + return this.__data__.has(value); + } + + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a stack cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Stack(entries) { + var data = (this.__data__ = new ListCache(entries)); + this.size = data.size; + } + + /** + * Removes all key-value entries from the stack. + * + * @private + * @name clear + * @memberOf Stack + */ + function stackClear() { + this.__data__ = new ListCache(); + this.size = 0; + } + + /** + * Removes `key` and its value from the stack. + * + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); + + this.size = data.size; + return result; + } + + /** + * Gets the stack value for `key`. + * + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function stackGet(key) { + return this.__data__.get(key); + } + + /** + * Checks if a stack value for `key` exists. + * + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function stackHas(key) { + return this.__data__.has(key); + } + + /** + * Sets the stack `key` to `value`. + * + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. + */ + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || pairs.length < LARGE_ARRAY_SIZE - 1) { + pairs.push([key, value]); + this.size = ++data.size; + return this; + } + data = this.__data__ = new MapCache(pairs); + } + data.set(key, value); + this.size = data.size; + return this; + } + + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of the enumerable property names of the array-like `value`. + * + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. + */ + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; + + for (var key in value) { + if ( + (inherited || hasOwnProperty.call(value, key)) && + !( + skipIndexes && + // Safari 9 has enumerable `arguments.length` in strict mode. + (key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && + (key == 'buffer' || + key == 'byteLength' || + key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length)) + ) + ) { + result.push(key); + } + } + return result; + } + + /** + * A specialized version of `_.sample` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. + */ + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; + } + + /** + * A specialized version of `_.sampleSize` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function arraySampleSize(array, n) { + return shuffleSelf( + copyArray(array), + baseClamp(n, 0, array.length), + ); + } + + /** + * A specialized version of `_.shuffle` for arrays. + * + * @private + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); + } + + /** + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignMergeValue(object, key, value) { + if ( + (value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object)) + ) { + baseAssignValue(object, key, value); + } + } + + /** + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignValue(object, key, value) { + var objValue = object[key]; + if ( + !(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object)) + ) { + baseAssignValue(object, key, value); + } + } + + /** + * Gets the index at which the `key` is found in `array` of key-value pairs. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } + } + return -1; + } + + /** + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); + } + + /** + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); + } + + /** + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + configurable: true, + enumerable: true, + value: value, + writable: true, + }); + } else { + object[key] = value; + } + } + + /** + * The base implementation of `_.at` without support for individual paths. + * + * @private + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. + */ + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; + + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; + } + + /** + * The base implementation of `_.clamp` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + */ + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; + } + if (lower !== undefined) { + number = number >= lower ? number : lower; + } + } + return number; + } + + /** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. + */ + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; + + if (customizer) { + result = object + ? customizer(value, key, object, stack) + : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = isFlat || isFunc ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack()); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + if (isSet(value)) { + value.forEach(function(subValue) { + result.add( + baseClone( + subValue, + bitmask, + customizer, + subValue, + value, + stack, + ), + ); + }); + + return result; + } + + if (isMap(value)) { + value.forEach(function(subValue, key) { + result.set( + key, + baseClone(subValue, bitmask, customizer, key, value, stack), + ); + }); + + return result; + } + + var keysFunc = isFull + ? isFlat + ? getAllKeysIn + : getAllKeys + : isFlat + ? keysIn + : keys; + + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue( + result, + key, + baseClone(subValue, bitmask, customizer, key, value, stack), + ); + }); + return result; + } + + /** + * The base implementation of `_.conforms` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. + */ + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; + } + + /** + * The base implementation of `_.conformsTo` which accepts `props` to check. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + */ + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; + } + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; + + if ( + (value === undefined && !(key in object)) || + !predicate(value) + ) { + return false; + } + } + return true; + } + + /** + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. + */ + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { + func.apply(undefined, args); + }, wait); + } + + /** + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + */ + function baseDifference(array, values, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; + + if (!length) { + return result; + } + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); + } + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; + } else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); + + value = comparator || value !== 0 ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } + } + result.push(value); + } else if (!includes(values, computed, comparator)) { + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.forEach` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEach = createBaseEach(baseForOwn); + + /** + * The base implementation of `_.forEachRight` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); + + /** + * The base implementation of `_.every` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; + } + + /** + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. + */ + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; + + while (++index < length) { + var value = array[index], + current = iteratee(value); + + if ( + current != null && + (computed === undefined + ? current === current && !isSymbol(current) + : comparator(current, computed)) + ) { + var computed = current, + result = value; + } + } + return result; + } + + /** + * The base implementation of `_.fill` without an iteratee call guard. + * + * @private + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + */ + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : length + start; + } + end = end === undefined || end > length ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; + } + + /** + * The base implementation of `_.filter` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; + } + + /** + * The base implementation of `_.flatten` with support for restricting flattening. + * + * @private + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. + */ + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; + } + } + return result; + } + + /** + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseFor = createBaseFor(); + + /** + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseForRight = createBaseFor(true); + + /** + * The base implementation of `_.forOwn` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); + } + + /** + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); + } + + /** + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. + * + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. + */ + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); + } + + /** + * The base implementation of `_.get` without support for default values. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. + */ + function baseGet(object, path) { + path = castPath(path, object); + + var index = 0, + length = path.length; + + while (object != null && index < length) { + object = object[toKey(path[index++])]; + } + return index && index == length ? object : undefined; + } + + /** + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. + */ + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) + ? result + : arrayPush(result, symbolsFunc(object)); + } + + /** + * The base implementation of `getTag` without fallbacks for buggy environments. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return symToStringTag && symToStringTag in Object(value) + ? getRawTag(value) + : objectToString(value); + } + + /** + * The base implementation of `_.gt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + */ + function baseGt(value, other) { + return value > other; + } + + /** + * The base implementation of `_.has` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); + } + + /** + * The base implementation of `_.hasIn` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHasIn(object, key) { + return object != null && key in Object(object); + } + + /** + * The base implementation of `_.inRange` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + */ + function baseInRange(number, start, end) { + return ( + number >= nativeMin(start, end) && + number < nativeMax(start, end) + ); + } + + /** + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of shared values. + */ + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; + + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); + } + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = + !comparator && + (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; + } + array = arrays[0]; + + var index = -1, + seen = caches[0]; + + outer: while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = comparator || value !== 0 ? value : 0; + if ( + !(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator)) + ) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if ( + !(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. + */ + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); + }); + return accumulator; + } + + /** + * The base implementation of `_.invoke` without support for individual + * method arguments. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + */ + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); + } + + /** + * The base implementation of `_.isArguments`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + */ + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; + } + + /** + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + */ + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + } + + /** + * The base implementation of `_.isDate` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + */ + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; + } + + /** + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + */ + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; + } + if ( + value == null || + other == null || + (!isObjectLike(value) && !isObjectLike(other)) + ) { + return value !== value && other !== other; + } + return baseIsEqualDeep( + value, + other, + bitmask, + customizer, + baseIsEqual, + stack, + ); + } + + /** + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseIsEqualDeep( + object, + other, + bitmask, + customizer, + equalFunc, + stack, + ) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; + } + if (isSameTag && !objIsObj) { + stack || (stack = new Stack()); + return objIsArr || isTypedArray(object) + ? equalArrays( + object, + other, + bitmask, + customizer, + equalFunc, + stack, + ) + : equalByTag( + object, + other, + objTag, + bitmask, + customizer, + equalFunc, + stack, + ); + } + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = + objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = + othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack()); + return equalFunc( + objUnwrapped, + othUnwrapped, + bitmask, + customizer, + stack, + ); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack()); + return equalObjects( + object, + other, + bitmask, + customizer, + equalFunc, + stack, + ); + } + + /** + * The base implementation of `_.isMap` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + */ + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; + } + + /** + * The base implementation of `_.isMatch` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + */ + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; + + if (object == null) { + return !length; + } + object = Object(object); + while (index--) { + var data = matchData[index]; + if ( + noCustomizer && data[2] + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } + } + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; + + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack(); + if (customizer) { + var result = customizer( + objValue, + srcValue, + key, + object, + source, + stack, + ); + } + if ( + !(result === undefined + ? baseIsEqual( + srcValue, + objValue, + COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, + customizer, + stack, + ) + : result) + ) { + return false; + } + } + } + return true; + } + + /** + * The base implementation of `_.isNative` without bad shim checks. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + */ + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); + } + + /** + * The base implementation of `_.isRegExp` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + */ + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; + } + + /** + * The base implementation of `_.isSet` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + */ + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; + } + + /** + * The base implementation of `_.isTypedArray` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + */ + function baseIsTypedArray(value) { + return ( + isObjectLike(value) && + isLength(value.length) && + !!typedArrayTags[baseGetTag(value)] + ); + } + + /** + * The base implementation of `_.iteratee`. + * + * @private + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. + */ + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; + } + if (value == null) { + return identity; + } + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); + } + return property(value); + } + + /** + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); + } + var isProto = isPrototype(object), + result = []; + + for (var key in object) { + if ( + !( + key == 'constructor' && + (isProto || !hasOwnProperty.call(object, key)) + ) + ) { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.lt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + */ + function baseLt(value, other) { + return value < other; + } + + /** + * The base implementation of `_.map` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) + ? Array(collection.length) + : []; + + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); + return result; + } + + /** + * The base implementation of `_.matches` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable( + matchData[0][0], + matchData[0][1], + ); + } + return function(object) { + return ( + object === source || baseIsMatch(object, source, matchData) + ); + }; + } + + /** + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. + * + * @private + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return objValue === undefined && objValue === srcValue + ? hasIn(object, path) + : baseIsEqual( + srcValue, + objValue, + COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, + ); + }; + } + + /** + * The base implementation of `_.merge` without support for multiple sources. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; + } + baseFor( + source, + function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack()); + baseMergeDeep( + object, + source, + key, + srcIndex, + baseMerge, + customizer, + stack, + ); + } else { + var newValue = customizer + ? customizer( + safeGet(object, key), + srcValue, + key + '', + object, + source, + stack, + ) + : undefined; + + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, + keysIn, + ); + } + + /** + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMergeDeep( + object, + source, + key, + srcIndex, + mergeFunc, + customizer, + stack, + ) { + var objValue = safeGet(object, key), + srcValue = safeGet(source, key), + stacked = stack.get(srcValue); + + if (stacked) { + assignMergeValue(object, key, stacked); + return; + } + var newValue = customizer + ? customizer( + objValue, + srcValue, + key + '', + object, + source, + stack, + ) + : undefined; + + var isCommon = newValue === undefined; + + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); + + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } else { + newValue = []; + } + } else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } else if ( + !isObject(objValue) || + (srcIndex && isFunction(objValue)) + ) { + newValue = initCloneObject(srcValue); + } + } else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); + } + + /** + * The base implementation of `_.nth` which doesn't coerce arguments. + * + * @private + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. + */ + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; + } + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; + } + + /** + * The base implementation of `_.orderBy` without param guards. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. + */ + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap( + iteratees.length ? iteratees : [identity], + baseUnary(getIteratee()), + ); + + var result = baseMap(collection, function( + value, + key, + collection, + ) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { criteria: criteria, index: ++index, value: value }; + }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); + } + + /** + * The base implementation of `_.pick` without support for individual + * property identifiers. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. + */ + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); + } + + /** + * The base implementation of `_.pickBy` without support for iteratee shorthands. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. + */ + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } + } + return result; + } + + /** + * A specialized version of `baseProperty` which supports deep paths. + * + * @private + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; + } + + /** + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + */ + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; + + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; + + while ( + (fromIndex = indexOf(seen, computed, fromIndex, comparator)) > + -1 + ) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } + } + return array; + } + + /** + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. + * + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. + */ + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; + + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } + } + return array; + } + + /** + * The base implementation of `_.random` without support for returning + * floating-point numbers. + * + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. + */ + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } + + /** + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. + * + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. + */ + function baseRange(start, end, step, fromRight) { + var index = -1, + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); + + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; + } + return result; + } + + /** + * The base implementation of `_.repeat` which doesn't coerce arguments. + * + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. + */ + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); + + return result; + } + + /** + * The base implementation of `_.rest` which doesn't validate or coerce arguments. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + */ + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } + + /** + * The base implementation of `_.sample`. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + */ + function baseSample(collection) { + return arraySample(values(collection)); + } + + /** + * The base implementation of `_.sampleSize` without param guards. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); + } + + /** + * The base implementation of `_.set`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; + } + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer + ? customizer(objValue, key, nested) + : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : isIndex(path[index + 1]) + ? [] + : {}; + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; + } + + /** + * The base implementation of `setData` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var baseSetData = !metaMap + ? identity + : function(func, data) { + metaMap.set(func, data); + return func; + }; + + /** + * The base implementation of `setToString` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var baseSetToString = !defineProperty + ? identity + : function(func, string) { + return defineProperty(func, 'toString', { + configurable: true, + enumerable: false, + value: constant(string), + writable: true, + }); + }; + + /** + * The base implementation of `_.shuffle`. + * + * @private + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function baseShuffle(collection) { + return shuffleSelf(values(collection)); + } + + /** + * The base implementation of `_.slice` without an iteratee call guard. + * + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : length + start; + } + end = end > length ? length : end; + if (end < 0) { + end += length; + } + length = start > end ? 0 : (end - start) >>> 0; + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; + } + + /** + * The base implementation of `_.some` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if ( + typeof value == 'number' && + value === value && + high <= HALF_MAX_ARRAY_LENGTH + ) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if ( + computed !== null && + !isSymbol(computed) && + (retHighest ? computed <= value : computed < value) + ) { + low = mid + 1; + } else { + high = mid; + } + } + return high; + } + return baseSortedIndexBy(array, value, identity, retHighest); + } + + /** + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = + othIsReflexive && + othIsDefined && + (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = + othIsReflexive && + othIsDefined && + !othIsNull && + (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? computed <= value : computed < value; + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } + + /** + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; + } + + /** + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. + * + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. + */ + function baseToNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + return +value; + } + + /** + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = value + ''; + return result == '0' && 1 / value == -INFINITY ? '-0' : result; + } + + /** + * The base implementation of `_.uniqBy` without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseUniq(array, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; + } else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); + } + isCommon = false; + includes = cacheHas; + seen = new SetCache(); + } else { + seen = iteratee ? [] : result; + } + outer: while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = comparator || value !== 0 ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.unset`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + */ + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; + } + + /** + * The base implementation of `_.update`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseUpdate(object, path, updater, customizer) { + return baseSet( + object, + path, + updater(baseGet(object, path)), + customizer, + ); + } + + /** + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the slice of `array`. + */ + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ( + (fromRight ? index-- : ++index < length) && + predicate(array[index], index, array) + ) {} + + return isDrop + ? baseSlice( + array, + fromRight ? 0 : index, + fromRight ? index + 1 : length, + ) + : baseSlice( + array, + fromRight ? index + 1 : 0, + fromRight ? length : index, + ); + } + + /** + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. + * + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. + */ + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce( + actions, + function(result, action) { + return action.func.apply( + action.thisArg, + arrayPush([result], action.args), + ); + }, + result, + ); + } + + /** + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. + */ + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; + } + var index = -1, + result = Array(length); + + while (++index < length) { + var array = arrays[index], + othIndex = -1; + + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference( + result[index] || array, + arrays[othIndex], + iteratee, + comparator, + ); + } + } + } + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } + + /** + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. + */ + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; + + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); + } + return result; + } + + /** + * Casts `value` to an empty array if it's not an array like object. + * + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. + */ + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; + } + + /** + * Casts `value` to `identity` if it's not a function. + * + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. + */ + function castFunction(value) { + return typeof value == 'function' ? value : identity; + } + + /** + * Casts `value` to a path array if it's not one. + * + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. + */ + function castPath(value, object) { + if (isArray(value)) { + return value; + } + return isKey(value, object) + ? [value] + : stringToPath(toString(value)); + } + + /** + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. + * + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. + * + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. + */ + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return !start && end >= length + ? array + : baseSlice(array, start, end); + } + + /** + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). + * + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. + */ + var clearTimeout = + ctxClearTimeout || + function(id) { + return root.clearTimeout(id); + }; + + /** + * Creates a clone of `buffer`. + * + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. + */ + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var length = buffer.length, + result = allocUnsafe + ? allocUnsafe(length) + : new buffer.constructor(length); + + buffer.copy(result); + return result; + } + + /** + * Creates a clone of `arrayBuffer`. + * + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; + } + + /** + * Creates a clone of `dataView`. + * + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. + */ + function cloneDataView(dataView, isDeep) { + var buffer = isDeep + ? cloneArrayBuffer(dataView.buffer) + : dataView.buffer; + return new dataView.constructor( + buffer, + dataView.byteOffset, + dataView.byteLength, + ); + } + + /** + * Creates a clone of `regexp`. + * + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ + function cloneRegExp(regexp) { + var result = new regexp.constructor( + regexp.source, + reFlags.exec(regexp), + ); + result.lastIndex = regexp.lastIndex; + return result; + } + + /** + * Creates a clone of the `symbol` object. + * + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } + + /** + * Creates a clone of `typedArray`. + * + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. + */ + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep + ? cloneArrayBuffer(typedArray.buffer) + : typedArray.buffer; + return new typedArray.constructor( + buffer, + typedArray.byteOffset, + typedArray.length, + ); + } + + /** + * Compares values to sort them in ascending order. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. + */ + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ( + (!othIsNull && + !othIsSymbol && + !valIsSymbol && + value > other) || + (valIsSymbol && + othIsDefined && + othIsReflexive && + !othIsNull && + !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive + ) { + return 1; + } + if ( + (!valIsNull && + !valIsSymbol && + !othIsSymbol && + value < other) || + (othIsSymbol && + valIsDefined && + valIsReflexive && + !valIsNull && + !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive + ) { + return -1; + } + } + return 0; + } + + /** + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. + * + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; + + while (++index < length) { + var result = compareAscending( + objCriteria[index], + othCriteria[index], + ); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; + } + + /** + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; + } + } + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; + } + + /** + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; + } + + /** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ + function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } + + /** + * Copies properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. + */ + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); + } + } + return object; + } + + /** + * Copies own symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); + } + + /** + * Copies own and inherited symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); + } + + /** + * Creates a function like `_.groupBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. + */ + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) + ? arrayAggregator + : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func( + collection, + setter, + getIteratee(iteratee, 2), + accumulator, + ); + }; + } + + /** + * Creates a function like `_.assign`. + * + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. + */ + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = + assigner.length > 3 && typeof customizer == 'function' + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); + } + + /** + * Creates a `baseEach` or `baseEachRight` function. + * + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while (fromRight ? index-- : ++index < length) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; + } + + /** + * Creates a base function for methods like `_.forIn` and `_.forOwn`. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var fn = + this && this !== root && this instanceof wrapper + ? Ctor + : func; + return fn.apply(isBind ? thisArg : this, arguments); + } + return wrapper; + } + + /** + * Creates a function like `_.lowerFirst`. + * + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. + */ + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); + + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols ? strSymbols[0] : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; + } + + /** + * Creates a function like `_.camelCase`. + * + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. + */ + function createCompounder(callback) { + return function(string) { + return arrayReduce( + words(deburr(string).replace(reApos, '')), + callback, + '', + ); + }; + } + + /** + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. + */ + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: + return new Ctor(); + case 1: + return new Ctor(args[0]); + case 2: + return new Ctor(args[0], args[1]); + case 3: + return new Ctor(args[0], args[1], args[2]); + case 4: + return new Ctor(args[0], args[1], args[2], args[3]); + case 5: + return new Ctor( + args[0], + args[1], + args[2], + args[3], + args[4], + ); + case 6: + return new Ctor( + args[0], + args[1], + args[2], + args[3], + args[4], + args[5], + ); + case 7: + return new Ctor( + args[0], + args[1], + args[2], + args[3], + args[4], + args[5], + args[6], + ); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } + + /** + * Creates a function that wraps `func` to enable currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = + length < 3 && + args[0] !== placeholder && + args[length - 1] !== placeholder + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, + bitmask, + createHybrid, + wrapper.placeholder, + undefined, + args, + holders, + undefined, + undefined, + arity - length, + ); + } + var fn = + this && this !== root && this instanceof wrapper + ? Ctor + : func; + return apply(fn, this, args); + } + return wrapper; + } + + /** + * Creates a `_.find` or `_.findLast` function. + * + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. + */ + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { + return iteratee(iterable[key], key, iterable); + }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 + ? iterable[iteratee ? collection[index] : index] + : undefined; + }; + } + + /** + * Creates a `_.flow` or `_.flowRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. + */ + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; + + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; + + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if ( + data && + isLaziable(data[0]) && + data[1] == + (WRAP_ARY_FLAG | + WRAP_CURRY_FLAG | + WRAP_PARTIAL_FLAG | + WRAP_REARG_FLAG) && + !data[4].length && + data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply( + wrapper, + data[3], + ); + } else { + wrapper = + func.length == 1 && isLaziable(func) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); + } + + /** + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createHybrid( + func, + bitmask, + thisArg, + partials, + holders, + partialsRight, + holdersRight, + argPos, + ary, + arity, + ) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight( + args, + partialsRight, + holdersRight, + isCurried, + ); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, + bitmask, + createHybrid, + wrapper.placeholder, + thisArg, + args, + newHolders, + argPos, + ary, + arity - length, + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); + } + return fn.apply(thisBinding, args); + } + return wrapper; + } + + /** + * Creates a function like `_.invertBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. + */ + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; + } + + /** + * Creates a function that performs a mathematical operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. + */ + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; + } + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; + } + + /** + * Creates a function like `_.over`. + * + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. + */ + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); + }); + } + + /** + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. + * + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. + */ + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); + + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; + } + var result = baseRepeat( + chars, + nativeCeil(length / stringSize(chars)), + ); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); + } + + /** + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. + */ + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = + this && this !== root && this instanceof wrapper + ? Ctor + : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); + } + return wrapper; + } + + /** + * Creates a `_.range` or `_.rangeRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. + */ + function createRange(fromRight) { + return function(start, end, step) { + if ( + step && + typeof step != 'number' && + isIterateeCall(start, end, step) + ) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = + step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; + } + + /** + * Creates a function that performs a relational operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. + */ + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; + } + + /** + * Creates a function that wraps `func` to continue currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createRecurry( + func, + bitmask, + wrapFunc, + placeholder, + thisArg, + partials, + holders, + argPos, + ary, + arity, + ) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG; + bitmask &= ~(isCurry + ? WRAP_PARTIAL_RIGHT_FLAG + : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, + bitmask, + thisArg, + newPartials, + newHolders, + newPartialsRight, + newHoldersRight, + argPos, + ary, + arity, + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); + } + + /** + * Creates a function like `_.round`. + * + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. + */ + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = + precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); + + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; + } + + /** + * Creates a set object of `values`. + * + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. + */ + var createSet = !( + Set && 1 / setToArray(new Set([, -0]))[1] == INFINITY + ) + ? noop + : function(values) { + return new Set(values); + }; + + /** + * Creates a `_.toPairs` or `_.toPairsIn` function. + * + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. + */ + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; + } + + /** + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createWrap( + func, + bitmask, + thisArg, + partials, + holders, + argPos, + ary, + arity, + ) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, + bitmask, + thisArg, + partials, + holders, + partialsRight, + holdersRight, + argPos, + ary, + arity, + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = + newData[9] === undefined + ? isBindKey + ? 0 + : func.length + : nativeMax(newData[9] - length, 0); + + if ( + !arity && + bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG) + ) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if ( + bitmask == WRAP_CURRY_FLAG || + bitmask == WRAP_CURRY_RIGHT_FLAG + ) { + result = createCurry(func, bitmask, arity); + } else if ( + (bitmask == WRAP_PARTIAL_FLAG || + bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && + !holders.length + ) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); + } + + /** + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. + */ + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if ( + objValue === undefined || + (eq(objValue, objectProto[key]) && + !hasOwnProperty.call(object, key)) + ) { + return srcValue; + } + return objValue; + } + + /** + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. + */ + function customDefaultsMerge( + objValue, + srcValue, + key, + object, + source, + stack, + ) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge( + objValue, + srcValue, + undefined, + customDefaultsMerge, + stack, + ); + stack['delete'](srcValue); + } + return objValue; + } + + /** + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. + * + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. + */ + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; + } + + /** + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. + * + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + */ + function equalArrays( + array, + other, + bitmask, + customizer, + equalFunc, + stack, + ) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if ( + arrLength != othLength && + !(isPartial && othLength > arrLength) + ) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; + } + var index = -1, + result = true, + seen = + bitmask & COMPARE_UNORDERED_FLAG ? new SetCache() : undefined; + + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer( + arrValue, + othValue, + index, + array, + other, + stack, + ); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if ( + !arraySome(other, function(othValue, othIndex) { + if ( + !cacheHas(seen, othIndex) && + (arrValue === othValue || + equalFunc( + arrValue, + othValue, + bitmask, + customizer, + stack, + )) + ) { + return seen.push(othIndex); + } + }) + ) { + result = false; + break; + } + } else if ( + !( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + ) + ) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. + * + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag( + object, + other, + tag, + bitmask, + customizer, + equalFunc, + stack, + ) { + switch (tag) { + case dataViewTag: + if ( + object.byteLength != other.byteLength || + object.byteOffset != other.byteOffset + ) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ( + object.byteLength != other.byteLength || + !equalFunc(new Uint8Array(object), new Uint8Array(other)) + ) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return ( + object.name == other.name && object.message == other.message + ); + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == other + ''; + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays( + convert(object), + convert(other), + bitmask, + customizer, + equalFunc, + stack, + ); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return ( + symbolValueOf.call(object) == symbolValueOf.call(other) + ); + } + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalObjects( + object, + other, + bitmask, + customizer, + equalFunc, + stack, + ) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; + } + var index = objLength; + while (index--) { + var key = objProps[index]; + if ( + !(isPartial ? key in other : hasOwnProperty.call(other, key)) + ) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); + + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if ( + !(compared === undefined + ? objValue === othValue || + equalFunc(objValue, othValue, bitmask, customizer, stack) + : compared) + ) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if ( + objCtor != othCtor && + 'constructor' in object && 'constructor' in other && + !( + typeof objCtor == 'function' && + objCtor instanceof objCtor && + typeof othCtor == 'function' && + othCtor instanceof othCtor + ) + ) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseRest` which flattens the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); + } + + /** + * Creates an array of own enumerable property names and symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); + } + + /** + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); + } + + /** + * Gets metadata for `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap + ? noop + : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the name of `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. + */ + function getFuncName(func) { + var result = func.name + '', + array = realNames[result], + length = hasOwnProperty.call(realNames, result) + ? array.length + : 0; + + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; + } + } + return result; + } + + /** + * Gets the argument placeholder value for `func`. + * + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. + */ + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') + ? lodash + : func; + return object.placeholder; + } + + /** + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. + * + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. + */ + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length + ? result(arguments[0], arguments[1]) + : result; + } + + /** + * Gets the data for `map`. + * + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. + */ + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } + + /** + * Gets the property names, values, and compare flags of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. + */ + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; + } + return result; + } + + /** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; + } + + /** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } + + /** + * Creates an array of the own enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbols = !nativeGetSymbols + ? stubArray + : function(object) { + if (object == null) { + return []; + } + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function( + symbol, + ) { + return propertyIsEnumerable.call(object, symbol); + }); + }; + + /** + * Creates an array of the own and inherited enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbolsIn = !nativeGetSymbols + ? stubArray + : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); + } + return result; + }; + + /** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ( + (DataView && + getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map()) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set()) != setTag) || + (WeakMap && getTag(new WeakMap()) != weakMapTag) + ) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: + return dataViewTag; + case mapCtorString: + return mapTag; + case promiseCtorString: + return promiseTag; + case setCtorString: + return setTag; + case weakMapCtorString: + return weakMapTag; + } + } + return result; + }; + } + + /** + * Gets the view, applying any `transforms` to the `start` and `end` positions. + * + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': + start += size; + break; + case 'dropRight': + end -= size; + break; + case 'take': + end = nativeMin(end, start + size); + break; + case 'takeRight': + start = nativeMax(start, end - size); + break; + } + } + return { start: start, end: end }; + } + + /** + * Extracts wrapper details from the `source` body comment. + * + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. + */ + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; + } + + /** + * Checks if `path` exists on `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + */ + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; + } + if (result || ++index != length) { + return result; + } + length = object == null ? 0 : object.length; + return ( + !!length && + isLength(length) && + isIndex(key, length) && + (isArray(object) || isArguments(object)) + ); + } + + /** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ + function initCloneArray(array) { + var length = array.length, + result = new array.constructor(length); + + // Add properties assigned by `RegExp#exec`. + if ( + length && + typeof array[0] == 'string' && + hasOwnProperty.call(array, 'index') + ) { + result.index = array.index; + result.input = array.input; + } + return result; + } + + /** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + return typeof object.constructor == 'function' && + !isPrototype(object) + ? baseCreate(getPrototype(object)) + : {}; + } + + /** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneByTag(object, tag, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: + case float64Tag: + case int8Tag: + case int16Tag: + case int32Tag: + case uint8Tag: + case uint8ClampedTag: + case uint16Tag: + case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return new Ctor(); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return new Ctor(); + + case symbolTag: + return cloneSymbol(object); + } + } + + /** + * Inserts wrapper `details` in a comment at the top of the `source` body. + * + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. + */ + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = + (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace( + reWrapComment, + '{\n/* [wrapped with ' + details + '] */\n', + ); + } + + /** + * Checks if `value` is a flattenable `arguments` object or array. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. + */ + function isFlattenable(value) { + return ( + isArray(value) || + isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]) + ); + } + + /** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + var type = typeof value; + length = length == null ? MAX_SAFE_INTEGER : length; + + return ( + !!length && + (type == 'number' || + (type != 'symbol' && reIsUint.test(value))) && + value > -1 && value % 1 == 0 && value < length + ); + } + + /** + * Checks if the given arguments are from an iteratee call. + * + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. + */ + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; + } + var type = typeof index; + if ( + type == 'number' + ? isArrayLike(object) && isIndex(index, object.length) + : type == 'string' && index in object + ) { + return eq(object[index], value); + } + return false; + } + + /** + * Checks if `value` is a property name and not a property path. + * + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + */ + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if ( + type == 'number' || + type == 'symbol' || + type == 'boolean' || + value == null || + isSymbol(value) + ) { + return true; + } + return ( + reIsPlainProp.test(value) || + !reIsDeepProp.test(value) || + (object != null && value in Object(object)) + ); + } + + /** + * Checks if `value` is suitable for use as unique object key. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + */ + function isKeyable(value) { + var type = typeof value; + return type == 'string' || + type == 'number' || + type == 'symbol' || + type == 'boolean' + ? value !== '__proto__' + : value === null; + } + + /** + * Checks if `func` has a lazy counterpart. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. + */ + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; + + if ( + typeof other != 'function' || + !(funcName in LazyWrapper.prototype) + ) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; + } + + /** + * Checks if `func` has its source masked. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ + function isMasked(func) { + return !!maskSrcKey && maskSrcKey in func; + } + + /** + * Checks if `func` is capable of being masked. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = + (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. + */ + function isStrictComparable(value) { + return value === value && !isObject(value); + } + + /** + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. + * + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return ( + object[key] === srcValue && + (srcValue !== undefined || key in Object(object)) + ); + }; + } + + /** + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. + * + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. + * + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. + * + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = + newBitmask < + (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + (srcBitmask == WRAP_ARY_FLAG && bitmask == WRAP_CURRY_FLAG) || + (srcBitmask == WRAP_ARY_FLAG && + bitmask == WRAP_REARG_FLAG && + data[7].length <= source[8]) || + (srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG) && + source[7].length <= source[8] && + bitmask == WRAP_CURRY_FLAG); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= + bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials + ? composeArgs(partials, value, source[4]) + : value; + data[4] = partials + ? replaceHolders(data[3], PLACEHOLDER) + : source[4]; + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials + ? composeArgsRight(partials, value, source[6]) + : value; + data[6] = partials + ? replaceHolders(data[5], PLACEHOLDER) + : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = + data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } + } + return result; + } + + /** + * Converts `value` to a string using `Object.prototype.toString`. + * + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. + */ + function overRest(func, start, transform) { + start = nativeMax( + start === undefined ? func.length - 1 : start, + 0, + ); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); + + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } + + /** + * Gets the parent value at `path` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. + */ + function parent(object, path) { + return path.length < 2 + ? object + : baseGet(object, baseSlice(path, 0, -1)); + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. + * + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) + ? oldArray[index] + : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. + * + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. + */ + var setTimeout = + ctxSetTimeout || + function(func, wait) { + return root.setTimeout(func, wait); + }; + + /** + * Sets the `toString` method of `func` to return `string`. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. + * + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. + */ + function setWrapToString(wrapper, reference, bitmask) { + var source = reference + ''; + return setToString( + wrapper, + insertWrapDetails( + source, + updateWrapDetails(getWrapDetails(source), bitmask), + ), + ); + } + + /** + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. + * + * @private + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new shortable function. + */ + function shortOut(func) { + var count = 0, + lastCalled = 0; + + return function() { + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; + } + return func.apply(undefined, arguments); + }; + } + + /** + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. + */ + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (string.charCodeAt(0) === 46 /* . */) { + result.push(''); + } + string.replace(rePropName, function( + match, + number, + quote, + subString, + ) { + result.push( + quote + ? subString.replace(reEscapeChar, '$1') + : number || match, + ); + }); + return result; + }); + + /** + * Converts `value` to a string key if it's not a string or symbol. + * + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. + */ + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = value + ''; + return result == '0' && 1 / value == -INFINITY ? '-0' : result; + } + + /** + * Converts `func` to its source code. + * + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. + */ + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return func + ''; + } catch (e) {} + } + return ''; + } + + /** + * Updates wrapper `details` based on `bitmask` flags. + * + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if (bitmask & pair[1] && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. + * + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. + */ + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper( + wrapper.__wrapped__, + wrapper.__chain__, + ); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the new array of chunks. + * @example + * + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] + * + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] + */ + function chunk(array, size, guard) { + if ( + guard ? isIterateeCall(array, size, guard) : size === undefined + ) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } + return result; + } + + /** + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * Creates a new array concatenating `array` with any additional arrays + * and/or values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. + * @example + * + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); + * + * console.log(other); + * // => [1, 2, 3, [4]] + * + * console.log(array); + * // => [1] + */ + function concat() { + var length = arguments.length; + if (!length) { + return []; + } + var args = Array(length - 1), + array = arguments[0], + index = length; + + while (index--) { + args[index - 1] = arguments[index]; + } + return arrayPush( + isArray(array) ? copyArray(array) : [array], + baseFlatten(args, 1), + ); + } + + /** + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor + * @example + * + * _.difference([2, 1], [2, 3]); + * // => [1] + */ + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference( + array, + baseFlatten(values, 1, isArrayLikeObject, true), + ) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] + * + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference( + array, + baseFlatten(values, 1, isArrayLikeObject, true), + getIteratee(iteratee, 2), + ) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] + */ + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference( + array, + baseFlatten(values, 1, isArrayLikeObject, true), + undefined, + comparator, + ) + : []; + }); + + /** + * Creates a slice of `array` with `n` elements dropped from the beginning. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.drop([1, 2, 3]); + * // => [2, 3] + * + * _.drop([1, 2, 3], 2); + * // => [3] + * + * _.drop([1, 2, 3], 5); + * // => [] + * + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = guard || n === undefined ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRight([1, 2, 3]); + * // => [1, 2] + * + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = guard || n === undefined ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] + * + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] + * + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropRightWhile(array, predicate) { + return array && array.length + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; + } + + /** + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropWhile(array, predicate) { + return array && array.length + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } + + /** + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. + * + * **Note:** This method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] + * + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] + */ + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if ( + start && + typeof start != 'number' && + isIterateeCall(array, value, start) + ) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } + + /** + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 + * + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 + */ + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } + + /** + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 + * + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 + */ + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = + fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex( + array, + getIteratee(predicate, 3), + index, + true, + ); + } + + /** + * Flattens `array` a single level deep. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] + */ + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; + } + + /** + * Recursively flattens `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] + */ + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; + } + + /** + * Recursively flatten `array` up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * var array = [1, [2, [3, [4]], 5]]; + * + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] + * + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] + */ + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); + } + + /** + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. + * @example + * + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } + */ + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; + } + + /** + * Gets the first element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. + * @example + * + * _.head([1, 2, 3]); + * // => 1 + * + * _.head([]); + * // => undefined + */ + function head(array) { + return array && array.length ? array[0] : undefined; + } + + /** + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 + * + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 + */ + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseIndexOf(array, value, index); + } + + /** + * Gets all but the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.initial([1, 2, 3]); + * // => [1, 2] + */ + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; + } + + /** + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersection([2, 1], [2, 3]); + * // => [2] + */ + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return mapped.length && mapped[0] === arrays[0] + ? baseIntersection(mapped) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] + * + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] + */ + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); + } + return mapped.length && mapped[0] === arrays[0] + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] + */ + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + comparator = + typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); + } + return mapped.length && mapped[0] === arrays[0] + ? baseIntersection(mapped, undefined, comparator) + : []; + }); + + /** + * Converts all elements in `array` into a string separated by `separator`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. + * @example + * + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' + */ + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); + } + + /** + * Gets the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. + * @example + * + * _.last([1, 2, 3]); + * // => 3 + */ + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; + } + + /** + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 + * + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = + index < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } + + /** + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. + * + * @static + * @memberOf _ + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * + * _.nth(array, 1); + * // => 'b' + * + * _.nth(array, -2); + * // => 'c'; + */ + function nth(array, n) { + return array && array.length + ? baseNth(array, toInteger(n)) + : undefined; + } + + /** + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] + */ + var pull = baseRest(pullAll); + + /** + * This method is like `_.pull` except that it accepts an array of values to remove. + * + * **Note:** Unlike `_.difference`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] + */ + function pullAll(array, values) { + return array && array.length && values && values.length + ? basePullAll(array, values) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). + * + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] + */ + function pullAllBy(array, values, iteratee) { + return array && array.length && values && values.length + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + */ + function pullAllWith(array, values, comparator) { + return array && array.length && values && values.length + ? basePullAll(array, values, undefined, comparator) + : array; + } + + /** + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. + * + * **Note:** Unlike `_.at`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); + * + * console.log(array); + * // => ['a', 'c'] + * + * console.log(pulled); + * // => ['b', 'd'] + */ + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt( + array, + arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending), + ); + + return result; + }); + + /** + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). + * + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); + * + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] + */ + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; + + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; + } + + /** + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if ( + end && + typeof end != 'number' && + isIterateeCall(array, start, end) + ) { + start = 0; + end = length; + } else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); + } + return baseSlice(array, start, end); + } + + /** + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedIndex([30, 50], 40); + * // => 1 + */ + function sortedIndex(array, value) { + return baseSortedIndex(array, value); + } + + /** + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 + */ + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); + } + + /** + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 + * + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 + */ + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy( + array, + value, + getIteratee(iteratee, 2), + true, + ); + } + + /** + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 + */ + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] + */ + function sortedUniq(array) { + return array && array.length ? baseSortedUniq(array) : []; + } + + /** + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] + */ + function sortedUniqBy(array, iteratee) { + return array && array.length + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; + } + + /** + * Gets all but the first element of `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.tail([1, 2, 3]); + * // => [2, 3] + */ + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; + } + + /** + * Creates a slice of `array` with `n` elements taken from the beginning. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.take([1, 2, 3]); + * // => [1] + * + * _.take([1, 2, 3], 2); + * // => [1, 2] + * + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] + */ + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = guard || n === undefined ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements taken from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] + */ + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = guard || n === undefined ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] + */ + function takeRightWhile(array, predicate) { + return array && array.length + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; + } + + /** + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] + */ + function takeWhile(array, predicate) { + return array && array.length + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } + + /** + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([2], [1, 2]); + * // => [2, 1] + */ + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); + }); + + /** + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq( + baseFlatten(arrays, 1, isArrayLikeObject, true), + getIteratee(iteratee, 2), + ); + }); + + /** + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = + typeof comparator == 'function' ? comparator : undefined; + return baseUniq( + baseFlatten(arrays, 1, isArrayLikeObject, true), + undefined, + comparator, + ); + }); + + /** + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniq([2, 1, 2]); + * // => [2, 1] + */ + function uniq(array) { + return array && array.length ? baseUniq(array) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + function uniqBy(array, iteratee) { + return array && array.length + ? baseUniq(array, getIteratee(iteratee, 2)) + : []; + } + + /** + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + */ + function uniqWith(array, comparator) { + comparator = + typeof comparator == 'function' ? comparator : undefined; + return array && array.length + ? baseUniq(array, undefined, comparator) + : []; + } + + /** + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. + * + * @static + * @memberOf _ + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + * + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] + */ + function unzip(array) { + if (!(array && array.length)) { + return []; + } + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); + } + + /** + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] + * + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] + */ + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; + } + var result = unzip(array); + if (iteratee == null) { + return result; + } + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); + } + + /** + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.pull`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor + * @example + * + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] + */ + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); + + /** + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without + * @example + * + * _.xor([2, 1], [2, 3]); + * // => [1, 3] + */ + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); + }); + + /** + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] + * + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseXor( + arrayFilter(arrays, isArrayLikeObject), + getIteratee(iteratee, 2), + ); + }); + + /** + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = + typeof comparator == 'function' ? comparator : undefined; + return baseXor( + arrayFilter(arrays, isArrayLikeObject), + undefined, + comparator, + ); + }); + + /** + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + */ + var zip = baseRest(unzip); + + /** + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. + * + * @static + * @memberOf _ + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObject(['a', 'b'], [1, 2]); + * // => { 'a': 1, 'b': 2 } + */ + function zipObject(props, values) { + return baseZipObject(props || [], values || [], assignValue); + } + + /** + * This method is like `_.zipObject` except that it supports property paths. + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); + * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + */ + function zipObjectDeep(props, values) { + return baseZipObject(props || [], values || [], baseSet); + } + + /** + * This method is like `_.zip` except that it accepts `iteratee` to specify + * how grouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @param {Function} [iteratee=_.identity] The function to combine + * grouped values. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { + * return a + b + c; + * }); + * // => [111, 222] + */ + var zipWith = baseRest(function(arrays) { + var length = arrays.length, + iteratee = length > 1 ? arrays[length - 1] : undefined; + + iteratee = + typeof iteratee == 'function' + ? (arrays.pop(), iteratee) + : undefined; + return unzipWith(arrays, iteratee); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` wrapper instance that wraps `value` with explicit method + * chain sequences enabled. The result of such sequences must be unwrapped + * with `_#value`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Seq + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; + * + * var youngest = _ + * .chain(users) + * .sortBy('age') + * .map(function(o) { + * return o.user + ' is ' + o.age; + * }) + * .head() + * .value(); + * // => 'pebbles is 1' + */ + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; + } + + /** + * This method invokes `interceptor` and returns `value`. The interceptor + * is invoked with one argument; (value). The purpose of this method is to + * "tap into" a method chain sequence in order to modify intermediate results. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns `value`. + * @example + * + * _([1, 2, 3]) + * .tap(function(array) { + * // Mutate input array. + * array.pop(); + * }) + * .reverse() + * .value(); + * // => [2, 1] + */ + function tap(value, interceptor) { + interceptor(value); + return value; + } + + /** + * This method is like `_.tap` except that it returns the result of `interceptor`. + * The purpose of this method is to "pass thru" values replacing intermediate + * results in a method chain sequence. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns the result of `interceptor`. + * @example + * + * _(' abc ') + * .chain() + * .trim() + * .thru(function(value) { + * return [value]; + * }) + * .value(); + * // => ['abc'] + */ + function thru(value, interceptor) { + return interceptor(value); + } + + /** + * This method is the wrapper version of `_.at`. + * + * @name at + * @memberOf _ + * @since 1.0.0 + * @category Seq + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _(object).at(['a[0].b.c', 'a[1]']).value(); + * // => [3, 4] + */ + var wrapperAt = flatRest(function(paths) { + var length = paths.length, + start = length ? paths[0] : 0, + value = this.__wrapped__, + interceptor = function(object) { + return baseAt(object, paths); + }; + + if ( + length > 1 || + this.__actions__.length || + !(value instanceof LazyWrapper) || + !isIndex(start) + ) { + return this.thru(interceptor); + } + value = value.slice(start, +start + (length ? 1 : 0)); + value.__actions__.push({ + func: thru, + args: [interceptor], + thisArg: undefined, + }); + return new LodashWrapper(value, this.__chain__).thru(function( + array, + ) { + if (length && !array.length) { + array.push(undefined); + } + return array; + }); + }); + + /** + * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. + * + * @name chain + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // A sequence without explicit chaining. + * _(users).head(); + * // => { 'user': 'barney', 'age': 36 } + * + * // A sequence with explicit chaining. + * _(users) + * .chain() + * .head() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } + */ + function wrapperChain() { + return chain(this); + } + + /** + * Executes the chain sequence and returns the wrapped result. + * + * @name commit + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2]; + * var wrapped = _(array).push(3); + * + * console.log(array); + * // => [1, 2] + * + * wrapped = wrapped.commit(); + * console.log(array); + * // => [1, 2, 3] + * + * wrapped.last(); + * // => 3 + * + * console.log(array); + * // => [1, 2, 3] + */ + function wrapperCommit() { + return new LodashWrapper(this.value(), this.__chain__); + } + + /** + * Gets the next value on a wrapped object following the + * [iterator protocol](https://mdn.io/iteration_protocols#iterator). + * + * @name next + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the next iterator value. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped.next(); + * // => { 'done': false, 'value': 1 } + * + * wrapped.next(); + * // => { 'done': false, 'value': 2 } + * + * wrapped.next(); + * // => { 'done': true, 'value': undefined } + */ + function wrapperNext() { + if (this.__values__ === undefined) { + this.__values__ = toArray(this.value()); + } + var done = this.__index__ >= this.__values__.length, + value = done ? undefined : this.__values__[this.__index__++]; + + return { done: done, value: value }; + } + + /** + * Enables the wrapper to be iterable. + * + * @name Symbol.iterator + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the wrapper object. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped[Symbol.iterator]() === wrapped; + * // => true + * + * Array.from(wrapped); + * // => [1, 2] + */ + function wrapperToIterator() { + return this; + } + + /** + * Creates a clone of the chain sequence planting `value` as the wrapped value. + * + * @name plant + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @param {*} value The value to plant. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2]).map(square); + * var other = wrapped.plant([3, 4]); + * + * other.value(); + * // => [9, 16] + * + * wrapped.value(); + * // => [1, 4] + */ + function wrapperPlant(value) { + var result, + parent = this; + + while (parent instanceof baseLodash) { + var clone = wrapperClone(parent); + clone.__index__ = 0; + clone.__values__ = undefined; + if (result) { + previous.__wrapped__ = clone; + } else { + result = clone; + } + var previous = clone; + parent = parent.__wrapped__; + } + previous.__wrapped__ = value; + return result; + } + + /** + * This method is the wrapper version of `_.reverse`. + * + * **Note:** This method mutates the wrapped array. + * + * @name reverse + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2, 3]; + * + * _(array).reverse().value() + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + var wrapped = value; + if (this.__actions__.length) { + wrapped = new LazyWrapper(this); + } + wrapped = wrapped.reverse(); + wrapped.__actions__.push({ + func: thru, + args: [reverse], + thisArg: undefined, + }); + return new LodashWrapper(wrapped, this.__chain__); + } + return this.thru(reverse); + } + + /** + * Executes the chain sequence to resolve the unwrapped value. + * + * @name value + * @memberOf _ + * @since 0.1.0 + * @alias toJSON, valueOf + * @category Seq + * @returns {*} Returns the resolved unwrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the number of times the key was returned by `iteratee`. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': 1, '6': 2 } + * + * // The `_.property` iteratee shorthand. + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + ++result[key]; + } else { + baseAssignValue(result, key, 1); + } + }); + + /** + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * Iteration is stopped once `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * **Note:** This method returns `true` for + * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because + * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of + * elements of empty collections. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.every(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.every(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.every(users, 'active'); + * // => false + */ + function every(collection, predicate, guard) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * **Note:** Unlike `_.remove`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.reject + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * _.filter(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.filter(users, { 'age': 36, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.filter(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.filter(users, 'active'); + * // => objects for ['barney'] + */ + function filter(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': true } + * ]; + * + * _.find(users, function(o) { return o.age < 40; }); + * // => object for 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.find(users, { 'age': 1, 'active': true }); + * // => object for 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.find(users, ['active', false]); + * // => object for 'fred' + * + * // The `_.property` iteratee shorthand. + * _.find(users, 'active'); + * // => object for 'barney' + */ + var find = createFind(findIndex); + + /** + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=collection.length-1] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { + * return n % 2 == 1; + * }); + * // => 3 + */ + var findLast = createFind(findLastIndex); + + /** + * Creates a flattened array of values by running each element in `collection` + * thru `iteratee` and flattening the mapped results. The iteratee is invoked + * with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [n, n]; + * } + * + * _.flatMap([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMap(collection, iteratee) { + return baseFlatten(map(collection, iteratee), 1); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDeep([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMapDeep(collection, iteratee) { + return baseFlatten(map(collection, iteratee), INFINITY); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDepth([1, 2], duplicate, 2); + * // => [[1, 1], [2, 2]] + */ + function flatMapDepth(collection, iteratee, depth) { + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(map(collection, iteratee), depth); + } + + /** + * Iterates over elements of `collection` and invokes `iteratee` for each element. + * The iteratee is invoked with three arguments: (value, index|key, collection). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * **Note:** As with other "Collections" methods, objects with a "length" + * property are iterated like arrays. To avoid this behavior use `_.forIn` + * or `_.forOwn` for object iteration. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias each + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEachRight + * @example + * + * _.forEach([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `1` then `2`. + * + * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forEach(collection, iteratee) { + var func = isArray(collection) ? arrayEach : baseEach; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @alias eachRight + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEach + * @example + * + * _.forEachRight([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `2` then `1`. + */ + function forEachRight(collection, iteratee) { + var func = isArray(collection) ? arrayEachRight : baseEachRight; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The order of grouped values + * is determined by the order they occur in `collection`. The corresponding + * value of each key is an array of elements responsible for generating the + * key. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': [4.2], '6': [6.1, 6.3] } + * + * // The `_.property` iteratee shorthand. + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + baseAssignValue(result, key, [value]); + } + }); + + /** + * Checks if `value` is in `collection`. If `collection` is a string, it's + * checked for a substring of `value`, otherwise + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * is used for equality comparisons. If `fromIndex` is negative, it's used as + * the offset from the end of `collection`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {boolean} Returns `true` if `value` is found, else `false`. + * @example + * + * _.includes([1, 2, 3], 1); + * // => true + * + * _.includes([1, 2, 3], 1, 2); + * // => false + * + * _.includes({ 'a': 1, 'b': 2 }, 1); + * // => true + * + * _.includes('abcd', 'bc'); + * // => true + */ + function includes(collection, value, fromIndex, guard) { + collection = isArrayLike(collection) + ? collection + : values(collection); + fromIndex = fromIndex && !guard ? toInteger(fromIndex) : 0; + + var length = collection.length; + if (fromIndex < 0) { + fromIndex = nativeMax(length + fromIndex, 0); + } + return isString(collection) + ? fromIndex <= length && + collection.indexOf(value, fromIndex) > -1 + : !!length && baseIndexOf(collection, value, fromIndex) > -1; + } + + /** + * Invokes the method at `path` of each element in `collection`, returning + * an array of the results of each invoked method. Any additional arguments + * are provided to each invoked method. If `path` is a function, it's invoked + * for, and `this` bound to, each element in `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array|Function|string} path The path of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke each method with. + * @returns {Array} Returns the array of results. + * @example + * + * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invokeMap([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invokeMap = baseRest(function(collection, path, args) { + var index = -1, + isFunc = typeof path == 'function', + result = isArrayLike(collection) + ? Array(collection.length) + : []; + + baseEach(collection, function(value) { + result[++index] = isFunc + ? apply(path, value, args) + : baseInvoke(value, path, args); + }); + return result; + }); + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the last element responsible for generating the key. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * var array = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; + * + * _.keyBy(array, function(o) { + * return String.fromCharCode(o.code); + * }); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.keyBy(array, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + */ + var keyBy = createAggregator(function(result, value, key) { + baseAssignValue(result, key, value); + }); + + /** + * Creates an array of values by running each element in `collection` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. + * + * The guarded methods are: + * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, + * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, + * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, + * `template`, `trim`, `trimEnd`, `trimStart`, and `words` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + * @example + * + * function square(n) { + * return n * n; + * } + * + * _.map([4, 8], square); + * // => [16, 64] + * + * _.map({ 'a': 4, 'b': 8 }, square); + * // => [16, 64] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // The `_.property` iteratee shorthand. + * _.map(users, 'user'); + * // => ['barney', 'fred'] + */ + function map(collection, iteratee) { + var func = isArray(collection) ? arrayMap : baseMap; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.sortBy` except that it allows specifying the sort + * orders of the iteratees to sort by. If `orders` is unspecified, all values + * are sorted in ascending order. Otherwise, specify an order of "desc" for + * descending or "asc" for ascending sort order of corresponding values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] + * The iteratees to sort by. + * @param {string[]} [orders] The sort orders of `iteratees`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 34 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 36 } + * ]; + * + * // Sort by `user` in ascending order and by `age` in descending order. + * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + */ + function orderBy(collection, iteratees, orders, guard) { + if (collection == null) { + return []; + } + if (!isArray(iteratees)) { + iteratees = iteratees == null ? [] : [iteratees]; + } + orders = guard ? undefined : orders; + if (!isArray(orders)) { + orders = orders == null ? [] : [orders]; + } + return baseOrderBy(collection, iteratees, orders); + } + + /** + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, the second of which + * contains elements `predicate` returns falsey for. The predicate is + * invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the array of grouped elements. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.partition(users, function(o) { return o.active; }); + * // => objects for [['fred'], ['barney', 'pebbles']] + * + * // The `_.matches` iteratee shorthand. + * _.partition(users, { 'age': 1, 'active': false }); + * // => objects for [['pebbles'], ['barney', 'fred']] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.partition(users, ['active', false]); + * // => objects for [['barney', 'pebbles'], ['fred']] + * + * // The `_.property` iteratee shorthand. + * _.partition(users, 'active'); + * // => objects for [['fred'], ['barney', 'pebbles']] + */ + var partition = createAggregator( + function(result, value, key) { + result[key ? 0 : 1].push(value); + }, + function() { + return [[], []]; + }, + ); + + /** + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` thru `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not given, the first element of `collection` is used as the initial + * value. The iteratee is invoked with four arguments: + * (accumulator, value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.reduce`, `_.reduceRight`, and `_.transform`. + * + * The guarded methods are: + * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, + * and `sortBy` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduceRight + * @example + * + * _.reduce([1, 2], function(sum, n) { + * return sum + n; + * }, 0); + * // => 3 + * + * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * return result; + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + */ + function reduce(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduce : baseReduce, + initAccum = arguments.length < 3; + + return func( + collection, + getIteratee(iteratee, 4), + accumulator, + initAccum, + baseEach, + ); + } + + /** + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduce + * @example + * + * var array = [[0, 1], [2, 3], [4, 5]]; + * + * _.reduceRight(array, function(flattened, other) { + * return flattened.concat(other); + * }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduceRight : baseReduce, + initAccum = arguments.length < 3; + + return func( + collection, + getIteratee(iteratee, 4), + accumulator, + initAccum, + baseEachRight, + ); + } + + /** + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.filter + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * _.reject(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.reject(users, { 'age': 40, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.reject(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.reject(users, 'active'); + * // => objects for ['barney'] + */ + function reject(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, negate(getIteratee(predicate, 3))); + } + + /** + * Gets a random element from `collection`. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + * @example + * + * _.sample([1, 2, 3, 4]); + * // => 2 + */ + function sample(collection) { + var func = isArray(collection) ? arraySample : baseSample; + return func(collection); + } + + /** + * Gets `n` random elements at unique keys from `collection` up to the + * size of `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @param {number} [n=1] The number of elements to sample. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the random elements. + * @example + * + * _.sampleSize([1, 2, 3], 2); + * // => [3, 1] + * + * _.sampleSize([1, 2, 3], 4); + * // => [2, 3, 1] + */ + function sampleSize(collection, n, guard) { + if ( + guard ? isIterateeCall(collection, n, guard) : n === undefined + ) { + n = 1; + } else { + n = toInteger(n); + } + var func = isArray(collection) ? arraySampleSize : baseSampleSize; + return func(collection, n); + } + + /** + * Creates an array of shuffled values, using a version of the + * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] + */ + function shuffle(collection) { + var func = isArray(collection) ? arrayShuffle : baseShuffle; + return func(collection); + } + + /** + * Gets the size of `collection` by returning its length for array-like + * values or the number of own enumerable string keyed properties for objects. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the collection size. + * @example + * + * _.size([1, 2, 3]); + * // => 3 + * + * _.size({ 'a': 1, 'b': 2 }); + * // => 2 + * + * _.size('pebbles'); + * // => 7 + */ + function size(collection) { + if (collection == null) { + return 0; + } + if (isArrayLike(collection)) { + return isString(collection) + ? stringSize(collection) + : collection.length; + } + var tag = getTag(collection); + if (tag == mapTag || tag == setTag) { + return collection.size; + } + return baseKeys(collection).length; + } + + /** + * Checks if `predicate` returns truthy for **any** element of `collection`. + * Iteration is stopped once `predicate` returns truthy. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + * @example + * + * _.some([null, 0, 'yes', false], Boolean); + * // => true + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.some(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.some(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.some(users, 'active'); + * // => true + */ + function some(collection, predicate, guard) { + var func = isArray(collection) ? arraySome : baseSome; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection thru each iteratee. This method + * performs a stable sort, that is, it preserves the original sort order of + * equal elements. The iteratees are invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {...(Function|Function[])} [iteratees=[_.identity]] + * The iteratees to sort by. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 34 } + * ]; + * + * _.sortBy(users, [function(o) { return o.user; }]); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * + * _.sortBy(users, ['user', 'age']); + * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + */ + var sortBy = baseRest(function(collection, iteratees) { + if (collection == null) { + return []; + } + var length = iteratees.length; + if ( + length > 1 && + isIterateeCall(collection, iteratees[0], iteratees[1]) + ) { + iteratees = []; + } else if ( + length > 2 && + isIterateeCall(iteratees[0], iteratees[1], iteratees[2]) + ) { + iteratees = [iteratees[0]]; + } + return baseOrderBy(collection, baseFlatten(iteratees, 1), []); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ + var now = + ctxNow || + function() { + return root.Date.now(); + }; + + /*------------------------------------------------------------------------*/ + + /** + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it's called `n` or more times. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var saves = ['profile', 'settings']; + * + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); + * + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => Logs 'done saving!' after the two async saves have completed. + */ + function after(n, func) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a function that invokes `func`, with up to `n` arguments, + * ignoring any additional arguments. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + n = guard ? undefined : n; + n = func && n == null ? func.length : n; + return createWrap( + func, + WRAP_ARY_FLAG, + undefined, + undefined, + undefined, + undefined, + n, + ); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it's called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * jQuery(element).on('click', _.before(5, addContactToList)); + * // => Allows adding up to 4 contacts to the list. + */ + function before(n, func) { + var result; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } + if (n <= 1) { + func = undefined; + } + return result; + }; + } + + /** + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and `partials` prepended to the arguments it receives. + * + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" + * property of bound functions. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * function greet(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * + * var object = { 'user': 'fred' }; + * + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // Bound with placeholders. + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' + */ + var bind = baseRest(function(func, thisArg, partials) { + var bitmask = WRAP_BIND_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bind)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(func, bitmask, thisArg, partials, holders); + }); + + /** + * Creates a function that invokes the method at `object[key]` with `partials` + * prepended to the arguments it receives. + * + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. See + * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Function + * @param {Object} object The object to invoke the method on. + * @param {string} key The key of the method. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; + * + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // Bound with placeholders. + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' + */ + var bindKey = baseRest(function(object, key, partials) { + var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bindKey)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(key, bitmask, object, partials, holders); + }); + + /** + * Creates a function that accepts arguments of `func` and either invokes + * `func` returning its result, if at least `arity` number of arguments have + * been provided, or returns a function that accepts the remaining `func` + * arguments, and so on. The arity of `func` may be specified if `func.length` + * is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(1)(_, 3)(2); + * // => [1, 2, 3] + */ + function curry(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap( + func, + WRAP_CURRY_FLAG, + undefined, + undefined, + undefined, + undefined, + undefined, + arity, + ); + result.placeholder = curry.placeholder; + return result; + } + + /** + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curryRight(abc); + * + * curried(3)(2)(1); + * // => [1, 2, 3] + * + * curried(2, 3)(1); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(3)(1, _)(2); + * // => [1, 2, 3] + */ + function curryRight(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap( + func, + WRAP_CURRY_RIGHT_FLAG, + undefined, + undefined, + undefined, + undefined, + undefined, + arity, + ); + result.placeholder = curryRight.placeholder; + return result; + } + + /** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ + function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing + ? nativeMax(toNumber(options.maxWait) || 0, wait) + : maxWait; + trailing = + 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + timeWaiting = wait - timeSinceLastCall; + + return maxing + ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) + : timeWaiting; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return ( + lastCallTime === undefined || + timeSinceLastCall >= wait || + timeSinceLastCall < 0 || + (maxing && timeSinceLastInvoke >= maxWait) + ); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; + } + + /** + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.defer(function(text) { + * console.log(text); + * }, 'deferred'); + * // => Logs 'deferred' after one millisecond. + */ + var defer = baseRest(function(func, args) { + return baseDelay(func, 1, args); + }); + + /** + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.delay(function(text) { + * console.log(text); + * }, 1000, 'later'); + * // => Logs 'later' after one second. + */ + var delay = baseRest(function(func, wait, args) { + return baseDelay(func, toNumber(wait) || 0, args); + }); + + /** + * Creates a function that invokes `func` with arguments reversed. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to flip arguments for. + * @returns {Function} Returns the new flipped function. + * @example + * + * var flipped = _.flip(function() { + * return _.toArray(arguments); + * }); + * + * flipped('a', 'b', 'c', 'd'); + * // => ['d', 'c', 'b', 'a'] + */ + function flip(func) { + return createWrap(func, WRAP_FLIP_FLAG); + } + + /** + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided, it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is used as the map cache key. The `func` + * is invoked with the `this` binding of the memoized function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the + * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) + * method interface of `clear`, `delete`, `get`, `has`, and `set`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoized function. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * var other = { 'c': 3, 'd': 4 }; + * + * var values = _.memoize(_.values); + * values(object); + * // => [1, 2] + * + * values(other); + * // => [3, 4] + * + * object.a = 2; + * values(object); + * // => [1, 2] + * + * // Modify the result cache. + * values.cache.set(object, ['a', 'b']); + * values(object); + * // => ['a', 'b'] + * + * // Replace `_.memoize.Cache`. + * _.memoize.Cache = WeakMap; + */ + function memoize(func, resolver) { + if ( + typeof func != 'function' || + (resolver != null && typeof resolver != 'function') + ) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var args = arguments, + key = resolver ? resolver.apply(this, args) : args[0], + cache = memoized.cache; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, args); + memoized.cache = cache.set(key, result) || cache; + return result; + }; + memoized.cache = new (memoize.Cache || MapCache)(); + return memoized; + } + + // Expose `MapCache`. + memoize.Cache = MapCache; + + /** + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new negated function. + * @example + * + * function isEven(n) { + * return n % 2 == 0; + * } + * + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] + */ + function negate(predicate) { + if (typeof predicate != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var args = arguments; + switch (args.length) { + case 0: + return !predicate.call(this); + case 1: + return !predicate.call(this, args[0]); + case 2: + return !predicate.call(this, args[0], args[1]); + case 3: + return !predicate.call(this, args[0], args[1], args[2]); + } + return !predicate.apply(this, args); + }; + } + + /** + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first invocation. The `func` is + * invoked with the `this` binding and arguments of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // => `createApplication` is invoked once + */ + function once(func) { + return before(2, func); + } + + /** + * Creates a function that invokes `func` with its arguments transformed. + * + * @static + * @since 4.0.0 + * @memberOf _ + * @category Function + * @param {Function} func The function to wrap. + * @param {...(Function|Function[])} [transforms=[_.identity]] + * The argument transforms. + * @returns {Function} Returns the new function. + * @example + * + * function doubled(n) { + * return n * 2; + * } + * + * function square(n) { + * return n * n; + * } + * + * var func = _.overArgs(function(x, y) { + * return [x, y]; + * }, [square, doubled]); + * + * func(9, 3); + * // => [81, 6] + * + * func(10, 5); + * // => [100, 10] + */ + var overArgs = castRest(function(func, transforms) { + transforms = + transforms.length == 1 && isArray(transforms[0]) + ? arrayMap(transforms[0], baseUnary(getIteratee())) + : arrayMap( + baseFlatten(transforms, 1), + baseUnary(getIteratee()), + ); + + var funcsLength = transforms.length; + return baseRest(function(args) { + var index = -1, + length = nativeMin(args.length, funcsLength); + + while (++index < length) { + args[index] = transforms[index].call(this, args[index]); + } + return apply(func, this, args); + }); + }); + + /** + * Creates a function that invokes `func` with `partials` prepended to the + * arguments it receives. This method is like `_.bind` except it does **not** + * alter the `this` binding. + * + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 0.2.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // Partially applied with placeholders. + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + */ + var partial = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partial)); + return createWrap( + func, + WRAP_PARTIAL_FLAG, + undefined, + partials, + holders, + ); + }); + + /** + * This method is like `_.partial` except that partially applied arguments + * are appended to the arguments it receives. + * + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + * + * // Partially applied with placeholders. + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' + */ + var partialRight = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partialRight)); + return createWrap( + func, + WRAP_PARTIAL_RIGHT_FLAG, + undefined, + partials, + holders, + ); + }); + + /** + * Creates a function that invokes `func` with arguments arranged according + * to the specified `indexes` where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes. + * @returns {Function} Returns the new function. + * @example + * + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, [2, 0, 1]); + * + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] + */ + var rearg = flatRest(function(func, indexes) { + return createWrap( + func, + WRAP_REARG_FLAG, + undefined, + undefined, + undefined, + indexes, + ); + }); + + /** + * Creates a function that invokes `func` with the `this` binding of the + * created function and arguments from `start` and beyond provided as + * an array. + * + * **Note:** This method is based on the + * [rest parameter](https://mdn.io/rest_parameters). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.rest(function(what, names) { + * return what + ' ' + _.initial(names).join(', ') + + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); + * }); + * + * say('hello', 'fred', 'barney', 'pebbles'); + * // => 'hello fred, barney, & pebbles' + */ + function rest(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start === undefined ? start : toInteger(start); + return baseRest(func, start); + } + + /** + * Creates a function that invokes `func` with the `this` binding of the + * create function and an array of arguments much like + * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). + * + * **Note:** This method is based on the + * [spread operator](https://mdn.io/spread_operator). + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Function + * @param {Function} func The function to spread arguments over. + * @param {number} [start=0] The start position of the spread. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.spread(function(who, what) { + * return who + ' says ' + what; + * }); + * + * say(['fred', 'hello']); + * // => 'fred says hello' + * + * var numbers = Promise.all([ + * Promise.resolve(40), + * Promise.resolve(36) + * ]); + * + * numbers.then(_.spread(function(x, y) { + * return x + y; + * })); + * // => a Promise of 76 + */ + function spread(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start == null ? 0 : nativeMax(toInteger(start), 0); + return baseRest(function(args) { + var array = args[start], + otherArgs = castSlice(args, 0, start); + + if (array) { + arrayPush(otherArgs, array); + } + return apply(func, this, otherArgs); + }); + } + + /** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = + 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + leading: leading, + maxWait: wait, + trailing: trailing, + }); + } + + /** + * Creates a function that accepts up to one argument, ignoring any + * additional arguments. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.unary(parseInt)); + * // => [6, 8, 10] + */ + function unary(func) { + return ary(func, 1); + } + + /** + * Creates a function that provides `value` to `wrapper` as its first + * argument. Any additional arguments provided to the function are appended + * to those provided to the `wrapper`. The wrapper is invoked with the `this` + * binding of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {*} value The value to wrap. + * @param {Function} [wrapper=identity] The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' + */ + function wrap(value, wrapper) { + return partial(castFunction(wrapper), value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Casts `value` as an array if it's not one. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Lang + * @param {*} value The value to inspect. + * @returns {Array} Returns the cast array. + * @example + * + * _.castArray(1); + * // => [1] + * + * _.castArray({ 'a': 1 }); + * // => [{ 'a': 1 }] + * + * _.castArray('abc'); + * // => ['abc'] + * + * _.castArray(null); + * // => [null] + * + * _.castArray(undefined); + * // => [undefined] + * + * _.castArray(); + * // => [] + * + * var array = [1, 2, 3]; + * console.log(_.castArray(array) === array); + * // => true + */ + function castArray() { + if (!arguments.length) { + return []; + } + var value = arguments[0]; + return isArray(value) ? value : [value]; + } + + /** + * Creates a shallow clone of `value`. + * + * **Note:** This method is loosely based on the + * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) + * and supports cloning arrays, array buffers, booleans, date objects, maps, + * numbers, `Object` objects, regexes, sets, strings, symbols, and typed + * arrays. The own enumerable properties of `arguments` objects are cloned + * as plain objects. An empty object is returned for uncloneable values such + * as error objects, functions, DOM nodes, and WeakMaps. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to clone. + * @returns {*} Returns the cloned value. + * @see _.cloneDeep + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var shallow = _.clone(objects); + * console.log(shallow[0] === objects[0]); + * // => true + */ + function clone(value) { + return baseClone(value, CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.clone` except that it accepts `customizer` which + * is invoked to produce the cloned value. If `customizer` returns `undefined`, + * cloning is handled by the method instead. The `customizer` is invoked with + * up to four arguments; (value [, index|key, object, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the cloned value. + * @see _.cloneDeepWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(false); + * } + * } + * + * var el = _.cloneWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 0 + */ + function cloneWith(value, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * This method is like `_.clone` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false + */ + function cloneDeep(value) { + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.cloneWith` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the deep cloned value. + * @see _.cloneWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(true); + * } + * } + * + * var el = _.cloneDeepWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 20 + */ + function cloneDeepWith(value, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + return baseClone( + value, + CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, + customizer, + ); + } + + /** + * Checks if `object` conforms to `source` by invoking the predicate + * properties of `source` with the corresponding property values of `object`. + * + * **Note:** This method is equivalent to `_.conforms` when `source` is + * partially applied. + * + * @static + * @memberOf _ + * @since 4.14.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); + * // => true + * + * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); + * // => false + */ + function conformsTo(object, source) { + return ( + source == null || baseConformsTo(object, source, keys(source)) + ); + } + + /** + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true + */ + function eq(value, other) { + return value === other || (value !== value && other !== other); + } + + /** + * Checks if `value` is greater than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + * @see _.lt + * @example + * + * _.gt(3, 1); + * // => true + * + * _.gt(3, 3); + * // => false + * + * _.gt(1, 3); + * // => false + */ + var gt = createRelationalOperation(baseGt); + + /** + * Checks if `value` is greater than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than or equal to + * `other`, else `false`. + * @see _.lte + * @example + * + * _.gte(3, 1); + * // => true + * + * _.gte(3, 3); + * // => true + * + * _.gte(1, 3); + * // => false + */ + var gte = createRelationalOperation(function(value, other) { + return value >= other; + }); + + /** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + var isArguments = baseIsArguments( + (function() { + return arguments; + })(), + ) + ? baseIsArguments + : function(value) { + return ( + isObjectLike(value) && + hasOwnProperty.call(value, 'callee') && + !propertyIsEnumerable.call(value, 'callee') + ); + }; + + /** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ + var isArray = Array.isArray; + + /** + * Checks if `value` is classified as an `ArrayBuffer` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + * @example + * + * _.isArrayBuffer(new ArrayBuffer(2)); + * // => true + * + * _.isArrayBuffer(new Array(2)); + * // => false + */ + var isArrayBuffer = nodeIsArrayBuffer + ? baseUnary(nodeIsArrayBuffer) + : baseIsArrayBuffer; + + /** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ + function isArrayLike(value) { + return ( + value != null && isLength(value.length) && !isFunction(value) + ); + } + + /** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ + function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); + } + + /** + * Checks if `value` is classified as a boolean primitive or object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. + * @example + * + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return ( + value === true || + value === false || + (isObjectLike(value) && baseGetTag(value) == boolTag) + ); + } + + /** + * Checks if `value` is a buffer. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @example + * + * _.isBuffer(new Buffer(2)); + * // => true + * + * _.isBuffer(new Uint8Array(2)); + * // => false + */ + var isBuffer = nativeIsBuffer || stubFalse; + + /** + * Checks if `value` is classified as a `Date` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + * + * _.isDate('Mon April 23 2012'); + * // => false + */ + var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + + /** + * Checks if `value` is likely a DOM element. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + * + * _.isElement(''); + * // => false + */ + function isElement(value) { + return ( + isObjectLike(value) && + value.nodeType === 1 && + !isPlainObject(value) + ); + } + + /** + * Checks if `value` is an empty object, collection, map, or set. + * + * Objects are considered empty if they have no own enumerable string keyed + * properties. + * + * Array-like values such as `arguments` objects, arrays, buffers, strings, or + * jQuery-like collections are considered empty if they have a `length` of `0`. + * Similarly, maps and sets are considered empty if they have a `size` of `0`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @example + * + * _.isEmpty(null); + * // => true + * + * _.isEmpty(true); + * // => true + * + * _.isEmpty(1); + * // => true + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({ 'a': 1 }); + * // => false + */ + function isEmpty(value) { + if (value == null) { + return true; + } + if ( + isArrayLike(value) && + (isArray(value) || + typeof value == 'string' || + typeof value.splice == 'function' || + isBuffer(value) || + isTypedArray(value) || + isArguments(value)) + ) { + return !value.length; + } + var tag = getTag(value); + if (tag == mapTag || tag == setTag) { + return !value.size; + } + if (isPrototype(value)) { + return !baseKeys(value).length; + } + for (var key in value) { + if (hasOwnProperty.call(value, key)) { + return false; + } + } + return true; + } + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent. + * + * **Note:** This method supports comparing arrays, array buffers, booleans, + * date objects, error objects, maps, numbers, `Object` objects, regexes, + * sets, strings, symbols, and typed arrays. `Object` objects are compared + * by their own, not inherited, enumerable properties. Functions and DOM + * nodes are compared by strict equality, i.e. `===`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.isEqual(object, other); + * // => true + * + * object === other; + * // => false + */ + function isEqual(value, other) { + return baseIsEqual(value, other); + } + + /** + * This method is like `_.isEqual` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with up to + * six arguments: (objValue, othValue [, index|key, object, other, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, othValue) { + * if (isGreeting(objValue) && isGreeting(othValue)) { + * return true; + * } + * } + * + * var array = ['hello', 'goodbye']; + * var other = ['hi', 'goodbye']; + * + * _.isEqualWith(array, other, customizer); + * // => true + */ + function isEqualWith(value, other, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + var result = customizer ? customizer(value, other) : undefined; + return result === undefined + ? baseIsEqual(value, other, undefined, customizer) + : !!result; + } + + /** + * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, + * `SyntaxError`, `TypeError`, or `URIError` object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @example + * + * _.isError(new Error); + * // => true + * + * _.isError(Error); + * // => false + */ + function isError(value) { + if (!isObjectLike(value)) { + return false; + } + var tag = baseGetTag(value); + return ( + tag == errorTag || + tag == domExcTag || + (typeof value.message == 'string' && + typeof value.name == 'string' && + !isPlainObject(value)) + ); + } + + /** + * Checks if `value` is a finite primitive number. + * + * **Note:** This method is based on + * [`Number.isFinite`](https://mdn.io/Number/isFinite). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @example + * + * _.isFinite(3); + * // => true + * + * _.isFinite(Number.MIN_VALUE); + * // => true + * + * _.isFinite(Infinity); + * // => false + * + * _.isFinite('3'); + * // => false + */ + function isFinite(value) { + return typeof value == 'number' && nativeIsFinite(value); + } + + /** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ + function isFunction(value) { + if (!isObject(value)) { + return false; + } + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 9 which returns 'object' for typed arrays and other constructors. + var tag = baseGetTag(value); + return ( + tag == funcTag || + tag == genTag || + tag == asyncTag || + tag == proxyTag + ); + } + + /** + * Checks if `value` is an integer. + * + * **Note:** This method is based on + * [`Number.isInteger`](https://mdn.io/Number/isInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an integer, else `false`. + * @example + * + * _.isInteger(3); + * // => true + * + * _.isInteger(Number.MIN_VALUE); + * // => false + * + * _.isInteger(Infinity); + * // => false + * + * _.isInteger('3'); + * // => false + */ + function isInteger(value) { + return typeof value == 'number' && value == toInteger(value); + } + + /** + * Checks if `value` is a valid array-like length. + * + * **Note:** This method is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ + function isLength(value) { + return ( + typeof value == 'number' && + value > -1 && + value % 1 == 0 && + value <= MAX_SAFE_INTEGER + ); + } + + /** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ + function isObject(value) { + var type = typeof value; + return value != null && (type == 'object' || type == 'function'); + } + + /** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ + function isObjectLike(value) { + return value != null && typeof value == 'object'; + } + + /** + * Checks if `value` is classified as a `Map` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + * @example + * + * _.isMap(new Map); + * // => true + * + * _.isMap(new WeakMap); + * // => false + */ + var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + + /** + * Performs a partial deep comparison between `object` and `source` to + * determine if `object` contains equivalent property values. + * + * **Note:** This method is equivalent to `_.matches` when `source` is + * partially applied. + * + * Partial comparisons will match empty array and empty object `source` + * values against any array or object value, respectively. See `_.isEqual` + * for a list of supported value comparisons. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.isMatch(object, { 'b': 2 }); + * // => true + * + * _.isMatch(object, { 'b': 1 }); + * // => false + */ + function isMatch(object, source) { + return ( + object === source || + baseIsMatch(object, source, getMatchData(source)) + ); + } + + /** + * This method is like `_.isMatch` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with five + * arguments: (objValue, srcValue, index|key, object, source). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, srcValue) { + * if (isGreeting(objValue) && isGreeting(srcValue)) { + * return true; + * } + * } + * + * var object = { 'greeting': 'hello' }; + * var source = { 'greeting': 'hi' }; + * + * _.isMatchWith(object, source, customizer); + * // => true + */ + function isMatchWith(object, source, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + return baseIsMatch( + object, + source, + getMatchData(source), + customizer, + ); + } + + /** + * Checks if `value` is `NaN`. + * + * **Note:** This method is based on + * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as + * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for + * `undefined` and other non-number values. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // An `NaN` primitive is the only value that is not equal to itself. + // Perform the `toStringTag` check first to avoid errors with some + // ActiveX objects in IE. + return isNumber(value) && value != +value; + } + + /** + * Checks if `value` is a pristine native function. + * + * **Note:** This method can't reliably detect native functions in the presence + * of the core-js package because core-js circumvents this kind of detection. + * Despite multiple requests, the core-js maintainer has made it clear: any + * attempt to fix the detection will be obstructed. As a result, we're left + * with little choice but to throw an error. Unfortunately, this also affects + * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), + * which rely on core-js. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ + function isNative(value) { + if (isMaskable(value)) { + throw new Error(CORE_ERROR_TEXT); + } + return baseIsNative(value); + } + + /** + * Checks if `value` is `null`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(void 0); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is `null` or `undefined`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is nullish, else `false`. + * @example + * + * _.isNil(null); + * // => true + * + * _.isNil(void 0); + * // => true + * + * _.isNil(NaN); + * // => false + */ + function isNil(value) { + return value == null; + } + + /** + * Checks if `value` is classified as a `Number` primitive or object. + * + * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are + * classified as numbers, use the `_.isFinite` method. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a number, else `false`. + * @example + * + * _.isNumber(3); + * // => true + * + * _.isNumber(Number.MIN_VALUE); + * // => true + * + * _.isNumber(Infinity); + * // => true + * + * _.isNumber('3'); + * // => false + */ + function isNumber(value) { + return ( + typeof value == 'number' || + (isObjectLike(value) && baseGetTag(value) == numberTag) + ); + } + + /** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * @static + * @memberOf _ + * @since 0.8.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ + function isPlainObject(value) { + if (!isObjectLike(value) || baseGetTag(value) != objectTag) { + return false; + } + var proto = getPrototype(value); + if (proto === null) { + return true; + } + var Ctor = + hasOwnProperty.call(proto, 'constructor') && proto.constructor; + return ( + typeof Ctor == 'function' && + Ctor instanceof Ctor && + funcToString.call(Ctor) == objectCtorString + ); + } + + /** + * Checks if `value` is classified as a `RegExp` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + * @example + * + * _.isRegExp(/abc/); + * // => true + * + * _.isRegExp('/abc/'); + * // => false + */ + var isRegExp = nodeIsRegExp + ? baseUnary(nodeIsRegExp) + : baseIsRegExp; + + /** + * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 + * double precision number which isn't the result of a rounded unsafe integer. + * + * **Note:** This method is based on + * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. + * @example + * + * _.isSafeInteger(3); + * // => true + * + * _.isSafeInteger(Number.MIN_VALUE); + * // => false + * + * _.isSafeInteger(Infinity); + * // => false + * + * _.isSafeInteger('3'); + * // => false + */ + function isSafeInteger(value) { + return ( + isInteger(value) && + value >= -MAX_SAFE_INTEGER && + value <= MAX_SAFE_INTEGER + ); + } + + /** + * Checks if `value` is classified as a `Set` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + * @example + * + * _.isSet(new Set); + * // => true + * + * _.isSet(new WeakSet); + * // => false + */ + var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + + /** + * Checks if `value` is classified as a `String` primitive or object. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a string, else `false`. + * @example + * + * _.isString('abc'); + * // => true + * + * _.isString(1); + * // => false + */ + function isString(value) { + return ( + typeof value == 'string' || + (!isArray(value) && + isObjectLike(value) && + baseGetTag(value) == stringTag) + ); + } + + /** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ + function isSymbol(value) { + return ( + typeof value == 'symbol' || + (isObjectLike(value) && baseGetTag(value) == symbolTag) + ); + } + + /** + * Checks if `value` is classified as a typed array. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + * @example + * + * _.isTypedArray(new Uint8Array); + * // => true + * + * _.isTypedArray([]); + * // => false + */ + var isTypedArray = nodeIsTypedArray + ? baseUnary(nodeIsTypedArray) + : baseIsTypedArray; + + /** + * Checks if `value` is `undefined`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + * + * _.isUndefined(null); + * // => false + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Checks if `value` is classified as a `WeakMap` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. + * @example + * + * _.isWeakMap(new WeakMap); + * // => true + * + * _.isWeakMap(new Map); + * // => false + */ + function isWeakMap(value) { + return isObjectLike(value) && getTag(value) == weakMapTag; + } + + /** + * Checks if `value` is classified as a `WeakSet` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. + * @example + * + * _.isWeakSet(new WeakSet); + * // => true + * + * _.isWeakSet(new Set); + * // => false + */ + function isWeakSet(value) { + return isObjectLike(value) && baseGetTag(value) == weakSetTag; + } + + /** + * Checks if `value` is less than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + * @see _.gt + * @example + * + * _.lt(1, 3); + * // => true + * + * _.lt(3, 3); + * // => false + * + * _.lt(3, 1); + * // => false + */ + var lt = createRelationalOperation(baseLt); + + /** + * Checks if `value` is less than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than or equal to + * `other`, else `false`. + * @see _.gte + * @example + * + * _.lte(1, 3); + * // => true + * + * _.lte(3, 3); + * // => true + * + * _.lte(3, 1); + * // => false + */ + var lte = createRelationalOperation(function(value, other) { + return value <= other; + }); + + /** + * Converts `value` to an array. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Array} Returns the converted array. + * @example + * + * _.toArray({ 'a': 1, 'b': 2 }); + * // => [1, 2] + * + * _.toArray('abc'); + * // => ['a', 'b', 'c'] + * + * _.toArray(1); + * // => [] + * + * _.toArray(null); + * // => [] + */ + function toArray(value) { + if (!value) { + return []; + } + if (isArrayLike(value)) { + return isString(value) + ? stringToArray(value) + : copyArray(value); + } + if (symIterator && value[symIterator]) { + return iteratorToArray(value[symIterator]()); + } + var tag = getTag(value), + func = + tag == mapTag + ? mapToArray + : tag == setTag + ? setToArray + : values; + + return func(value); + } + + /** + * Converts `value` to a finite number. + * + * @static + * @memberOf _ + * @since 4.12.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted number. + * @example + * + * _.toFinite(3.2); + * // => 3.2 + * + * _.toFinite(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toFinite(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toFinite('3.2'); + * // => 3.2 + */ + function toFinite(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = value < 0 ? -1 : 1; + return sign * MAX_INTEGER; + } + return value === value ? value : 0; + } + + /** + * Converts `value` to an integer. + * + * **Note:** This method is loosely based on + * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3.2); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3.2'); + * // => 3 + */ + function toInteger(value) { + var result = toFinite(value), + remainder = result % 1; + + return result === result + ? remainder + ? result - remainder + : result + : 0; + } + + /** + * Converts `value` to an integer suitable for use as the length of an + * array-like object. + * + * **Note:** This method is based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toLength(3.2); + * // => 3 + * + * _.toLength(Number.MIN_VALUE); + * // => 0 + * + * _.toLength(Infinity); + * // => 4294967295 + * + * _.toLength('3.2'); + * // => 3 + */ + function toLength(value) { + return value + ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) + : 0; + } + + /** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ + function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = + typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? other + '' : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return isBinary || reIsOctal.test(value) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : reIsBadHex.test(value) + ? NAN + : +value; + } + + /** + * Converts `value` to a plain object flattening inherited enumerable string + * keyed properties of `value` to own properties of the plain object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {Object} Returns the converted plain object. + * @example + * + * function Foo() { + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.assign({ 'a': 1 }, new Foo); + * // => { 'a': 1, 'b': 2 } + * + * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); + * // => { 'a': 1, 'b': 2, 'c': 3 } + */ + function toPlainObject(value) { + return copyObject(value, keysIn(value)); + } + + /** + * Converts `value` to a safe integer. A safe integer can be compared and + * represented correctly. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toSafeInteger(3.2); + * // => 3 + * + * _.toSafeInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toSafeInteger(Infinity); + * // => 9007199254740991 + * + * _.toSafeInteger('3.2'); + * // => 3 + */ + function toSafeInteger(value) { + return value + ? baseClamp( + toInteger(value), + -MAX_SAFE_INTEGER, + MAX_SAFE_INTEGER, + ) + : value === 0 + ? value + : 0; + } + + /** + * Converts `value` to a string. An empty string is returned for `null` + * and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ + function toString(value) { + return value == null ? '' : baseToString(value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Assigns own enumerable string keyed properties of source objects to the + * destination object. Source objects are applied from left to right. + * Subsequent sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object` and is loosely based on + * [`Object.assign`](https://mdn.io/Object/assign). + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assignIn + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assign({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'c': 3 } + */ + var assign = createAssigner(function(object, source) { + if (isPrototype(source) || isArrayLike(source)) { + copyObject(source, keys(source), object); + return; + } + for (var key in source) { + if (hasOwnProperty.call(source, key)) { + assignValue(object, key, source[key]); + } + } + }); + + /** + * This method is like `_.assign` except that it iterates over own and + * inherited source properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extend + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assign + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assignIn({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + */ + var assignIn = createAssigner(function(object, source) { + copyObject(source, keysIn(source), object); + }); + + /** + * This method is like `_.assignIn` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extendWith + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignInWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignInWith = createAssigner(function( + object, + source, + srcIndex, + customizer, + ) { + copyObject(source, keysIn(source), object, customizer); + }); + + /** + * This method is like `_.assign` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignInWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignWith = createAssigner(function( + object, + source, + srcIndex, + customizer, + ) { + copyObject(source, keys(source), object, customizer); + }); + + /** + * Creates an array of values corresponding to `paths` of `object`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Array} Returns the picked values. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _.at(object, ['a[0].b.c', 'a[1]']); + * // => [3, 4] + */ + var at = flatRest(baseAt); + + /** + * Creates an object that inherits from the `prototype` object. If a + * `properties` object is given, its own enumerable string keyed properties + * are assigned to the created object. + * + * @static + * @memberOf _ + * @since 2.3.0 + * @category Object + * @param {Object} prototype The object to inherit from. + * @param {Object} [properties] The properties to assign to the object. + * @returns {Object} Returns the new object. + * @example + * + * function Shape() { + * this.x = 0; + * this.y = 0; + * } + * + * function Circle() { + * Shape.call(this); + * } + * + * Circle.prototype = _.create(Shape.prototype, { + * 'constructor': Circle + * }); + * + * var circle = new Circle; + * circle instanceof Circle; + * // => true + * + * circle instanceof Shape; + * // => true + */ + function create(prototype, properties) { + var result = baseCreate(prototype); + return properties == null + ? result + : baseAssign(result, properties); + } + + /** + * Assigns own and inherited enumerable string keyed properties of source + * objects to the destination object for all destination properties that + * resolve to `undefined`. Source objects are applied from left to right. + * Once a property is set, additional values of the same property are ignored. + * + * **Note:** This method mutates `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaultsDeep + * @example + * + * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var defaults = baseRest(function(object, sources) { + object = Object(object); + + var index = -1; + var length = sources.length; + var guard = length > 2 ? sources[2] : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + length = 1; + } + + while (++index < length) { + var source = sources[index]; + var props = keysIn(source); + var propsIndex = -1; + var propsLength = props.length; + + while (++propsIndex < propsLength) { + var key = props[propsIndex]; + var value = object[key]; + + if ( + value === undefined || + (eq(value, objectProto[key]) && + !hasOwnProperty.call(object, key)) + ) { + object[key] = source[key]; + } + } + } + + return object; + }); + + /** + * This method is like `_.defaults` except that it recursively assigns + * default properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaults + * @example + * + * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); + * // => { 'a': { 'b': 2, 'c': 3 } } + */ + var defaultsDeep = baseRest(function(args) { + args.push(undefined, customDefaultsMerge); + return apply(mergeWith, undefined, args); + }); + + /** + * This method is like `_.find` except that it returns the key of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findKey(users, function(o) { return o.age < 40; }); + * // => 'barney' (iteration order is not guaranteed) + * + * // The `_.matches` iteratee shorthand. + * _.findKey(users, { 'age': 1, 'active': true }); + * // => 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findKey(users, 'active'); + * // => 'barney' + */ + function findKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); + } + + /** + * This method is like `_.findKey` except that it iterates over elements of + * a collection in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findLastKey(users, function(o) { return o.age < 40; }); + * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.findLastKey(users, { 'age': 36, 'active': true }); + * // => 'barney' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findLastKey(users, 'active'); + * // => 'pebbles' + */ + function findLastKey(object, predicate) { + return baseFindKey( + object, + getIteratee(predicate, 3), + baseForOwnRight, + ); + } + + /** + * Iterates over own and inherited enumerable string keyed properties of an + * object and invokes `iteratee` for each property. The iteratee is invoked + * with three arguments: (value, key, object). Iteratee functions may exit + * iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forInRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forIn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + */ + function forIn(object, iteratee) { + return object == null + ? object + : baseFor(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * This method is like `_.forIn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forIn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forInRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + */ + function forInRight(object, iteratee) { + return object == null + ? object + : baseForRight(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * Iterates over own enumerable string keyed properties of an object and + * invokes `iteratee` for each property. The iteratee is invoked with three + * arguments: (value, key, object). Iteratee functions may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwnRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forOwn(object, iteratee) { + return object && baseForOwn(object, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forOwn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwnRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + */ + function forOwnRight(object, iteratee) { + return ( + object && baseForOwnRight(object, getIteratee(iteratee, 3)) + ); + } + + /** + * Creates an array of function property names from own enumerable properties + * of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functionsIn + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functions(new Foo); + * // => ['a', 'b'] + */ + function functions(object) { + return object == null ? [] : baseFunctions(object, keys(object)); + } + + /** + * Creates an array of function property names from own and inherited + * enumerable properties of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functions + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functionsIn(new Foo); + * // => ['a', 'b', 'c'] + */ + function functionsIn(object) { + return object == null + ? [] + : baseFunctions(object, keysIn(object)); + } + + /** + * Gets the value at `path` of `object`. If the resolved value is + * `undefined`, the `defaultValue` is returned in its place. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.get(object, 'a[0].b.c'); + * // => 3 + * + * _.get(object, ['a', '0', 'b', 'c']); + * // => 3 + * + * _.get(object, 'a.b.c', 'default'); + * // => 'default' + */ + function get(object, path, defaultValue) { + var result = object == null ? undefined : baseGet(object, path); + return result === undefined ? defaultValue : result; + } + + /** + * Checks if `path` is a direct property of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = { 'a': { 'b': 2 } }; + * var other = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.has(object, 'a'); + * // => true + * + * _.has(object, 'a.b'); + * // => true + * + * _.has(object, ['a', 'b']); + * // => true + * + * _.has(other, 'a'); + * // => false + */ + function has(object, path) { + return object != null && hasPath(object, path, baseHas); + } + + /** + * Checks if `path` is a direct or inherited property of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.hasIn(object, 'a'); + * // => true + * + * _.hasIn(object, 'a.b'); + * // => true + * + * _.hasIn(object, ['a', 'b']); + * // => true + * + * _.hasIn(object, 'b'); + * // => false + */ + function hasIn(object, path) { + return object != null && hasPath(object, path, baseHasIn); + } + + /** + * Creates an object composed of the inverted keys and values of `object`. + * If `object` contains duplicate values, subsequent values overwrite + * property assignments of previous values. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Object + * @param {Object} object The object to invert. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invert(object); + * // => { '1': 'c', '2': 'b' } + */ + var invert = createInverter(function(result, value, key) { + if (value != null && typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + result[value] = key; + }, constant(identity)); + + /** + * This method is like `_.invert` except that the inverted object is generated + * from the results of running each element of `object` thru `iteratee`. The + * corresponding inverted value of each inverted key is an array of keys + * responsible for generating the inverted value. The iteratee is invoked + * with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Object + * @param {Object} object The object to invert. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invertBy(object); + * // => { '1': ['a', 'c'], '2': ['b'] } + * + * _.invertBy(object, function(value) { + * return 'group' + value; + * }); + * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + */ + var invertBy = createInverter(function(result, value, key) { + if (value != null && typeof value.toString != 'function') { + value = nativeObjectToString.call(value); + } + + if (hasOwnProperty.call(result, value)) { + result[value].push(key); + } else { + result[value] = [key]; + } + }, getIteratee); + + /** + * Invokes the method at `path` of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {...*} [args] The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + * @example + * + * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * + * _.invoke(object, 'a[0].b.c.slice', 1, 3); + * // => [2, 3] + */ + var invoke = baseRest(baseInvoke); + + /** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * for more details. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ + function keys(object) { + return isArrayLike(object) + ? arrayLikeKeys(object) + : baseKeys(object); + } + + /** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ + function keysIn(object) { + return isArrayLike(object) + ? arrayLikeKeys(object, true) + : baseKeysIn(object); + } + + /** + * The opposite of `_.mapValues`; this method creates an object with the + * same values as `object` and keys generated by running each own enumerable + * string keyed property of `object` thru `iteratee`. The iteratee is invoked + * with three arguments: (value, key, object). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapValues + * @example + * + * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { + * return key + value; + * }); + * // => { 'a1': 1, 'b2': 2 } + */ + function mapKeys(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, iteratee(value, key, object), value); + }); + return result; + } + + /** + * Creates an object with the same keys as `object` and values generated + * by running each own enumerable string keyed property of `object` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, key, object). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapKeys + * @example + * + * var users = { + * 'fred': { 'user': 'fred', 'age': 40 }, + * 'pebbles': { 'user': 'pebbles', 'age': 1 } + * }; + * + * _.mapValues(users, function(o) { return o.age; }); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * + * // The `_.property` iteratee shorthand. + * _.mapValues(users, 'age'); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + */ + function mapValues(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, key, iteratee(value, key, object)); + }); + return result; + } + + /** + * This method is like `_.assign` except that it recursively merges own and + * inherited enumerable string keyed properties of source objects into the + * destination object. Source properties that resolve to `undefined` are + * skipped if a destination value exists. Array and plain object properties + * are merged recursively. Other objects and value types are overridden by + * assignment. Source objects are applied from left to right. Subsequent + * sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @example + * + * var object = { + * 'a': [{ 'b': 2 }, { 'd': 4 }] + * }; + * + * var other = { + * 'a': [{ 'c': 3 }, { 'e': 5 }] + * }; + * + * _.merge(object, other); + * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + */ + var merge = createAssigner(function(object, source, srcIndex) { + baseMerge(object, source, srcIndex); + }); + + /** + * This method is like `_.merge` except that it accepts `customizer` which + * is invoked to produce the merged values of the destination and source + * properties. If `customizer` returns `undefined`, merging is handled by the + * method instead. The `customizer` is invoked with six arguments: + * (objValue, srcValue, key, object, source, stack). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} customizer The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * function customizer(objValue, srcValue) { + * if (_.isArray(objValue)) { + * return objValue.concat(srcValue); + * } + * } + * + * var object = { 'a': [1], 'b': [2] }; + * var other = { 'a': [3], 'b': [4] }; + * + * _.mergeWith(object, other, customizer); + * // => { 'a': [1, 3], 'b': [2, 4] } + */ + var mergeWith = createAssigner(function( + object, + source, + srcIndex, + customizer, + ) { + baseMerge(object, source, srcIndex, customizer); + }); + + /** + * The opposite of `_.pick`; this method creates an object composed of the + * own and inherited enumerable property paths of `object` that are not omitted. + * + * **Note:** This method is considerably slower than `_.pick`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to omit. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omit(object, ['a', 'c']); + * // => { 'b': '2' } + */ + var omit = flatRest(function(object, paths) { + var result = {}; + if (object == null) { + return result; + } + var isDeep = false; + paths = arrayMap(paths, function(path) { + path = castPath(path, object); + isDeep || (isDeep = path.length > 1); + return path; + }); + copyObject(object, getAllKeysIn(object), result); + if (isDeep) { + result = baseClone( + result, + CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, + customOmitClone, + ); + } + var length = paths.length; + while (length--) { + baseUnset(result, paths[length]); + } + return result; + }); + + /** + * The opposite of `_.pickBy`; this method creates an object composed of + * the own and inherited enumerable string keyed properties of `object` that + * `predicate` doesn't return truthy for. The predicate is invoked with two + * arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omitBy(object, _.isNumber); + * // => { 'b': '2' } + */ + function omitBy(object, predicate) { + return pickBy(object, negate(getIteratee(predicate))); + } + + /** + * Creates an object composed of the picked `object` properties. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pick(object, ['a', 'c']); + * // => { 'a': 1, 'c': 3 } + */ + var pick = flatRest(function(object, paths) { + return object == null ? {} : basePick(object, paths); + }); + + /** + * Creates an object composed of the `object` properties `predicate` returns + * truthy for. The predicate is invoked with two arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pickBy(object, _.isNumber); + * // => { 'a': 1, 'c': 3 } + */ + function pickBy(object, predicate) { + if (object == null) { + return {}; + } + var props = arrayMap(getAllKeysIn(object), function(prop) { + return [prop]; + }); + predicate = getIteratee(predicate); + return basePickBy(object, props, function(value, path) { + return predicate(value, path[0]); + }); + } + + /** + * This method is like `_.get` except that if the resolved value is a + * function it's invoked with the `this` binding of its parent object and + * its result is returned. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to resolve. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; + * + * _.result(object, 'a[0].b.c1'); + * // => 3 + * + * _.result(object, 'a[0].b.c2'); + * // => 4 + * + * _.result(object, 'a[0].b.c3', 'default'); + * // => 'default' + * + * _.result(object, 'a[0].b.c3', _.constant('default')); + * // => 'default' + */ + function result(object, path, defaultValue) { + path = castPath(path, object); + + var index = -1, + length = path.length; + + // Ensure the loop is entered when path is empty. + if (!length) { + length = 1; + object = undefined; + } + while (++index < length) { + var value = + object == null ? undefined : object[toKey(path[index])]; + if (value === undefined) { + index = length; + value = defaultValue; + } + object = isFunction(value) ? value.call(object) : value; + } + return object; + } + + /** + * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, + * it's created. Arrays are created for missing index properties while objects + * are created for all other missing properties. Use `_.setWith` to customize + * `path` creation. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.set(object, 'a[0].b.c', 4); + * console.log(object.a[0].b.c); + * // => 4 + * + * _.set(object, ['x', '0', 'y', 'z'], 5); + * console.log(object.x[0].y.z); + * // => 5 + */ + function set(object, path, value) { + return object == null ? object : baseSet(object, path, value); + } + + /** + * This method is like `_.set` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.setWith(object, '[0][1]', 'a', Object); + * // => { '0': { '1': 'a' } } + */ + function setWith(object, path, value, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + return object == null + ? object + : baseSet(object, path, value, customizer); + } + + /** + * Creates an array of own enumerable string keyed-value pairs for `object` + * which can be consumed by `_.fromPairs`. If `object` is a map or set, its + * entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entries + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairs(new Foo); + * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + */ + var toPairs = createToPairs(keys); + + /** + * Creates an array of own and inherited enumerable string keyed-value pairs + * for `object` which can be consumed by `_.fromPairs`. If `object` is a map + * or set, its entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entriesIn + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairsIn(new Foo); + * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) + */ + var toPairsIn = createToPairs(keysIn); + + /** + * An alternative to `_.reduce`; this method transforms `object` to a new + * `accumulator` object which is the result of running each of its own + * enumerable string keyed properties thru `iteratee`, with each invocation + * potentially mutating the `accumulator` object. If `accumulator` is not + * provided, a new object with the same `[[Prototype]]` will be used. The + * iteratee is invoked with four arguments: (accumulator, value, key, object). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The custom accumulator value. + * @returns {*} Returns the accumulated value. + * @example + * + * _.transform([2, 3, 4], function(result, n) { + * result.push(n *= n); + * return n % 2 == 0; + * }, []); + * // => [4, 9] + * + * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } + */ + function transform(object, iteratee, accumulator) { + var isArr = isArray(object), + isArrLike = isArr || isBuffer(object) || isTypedArray(object); + + iteratee = getIteratee(iteratee, 4); + if (accumulator == null) { + var Ctor = object && object.constructor; + if (isArrLike) { + accumulator = isArr ? new Ctor() : []; + } else if (isObject(object)) { + accumulator = isFunction(Ctor) + ? baseCreate(getPrototype(object)) + : {}; + } else { + accumulator = {}; + } + } + (isArrLike ? arrayEach : baseForOwn)(object, function( + value, + index, + object, + ) { + return iteratee(accumulator, value, index, object); + }); + return accumulator; + } + + /** + * Removes the property at `path` of `object`. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 7 } }] }; + * _.unset(object, 'a[0].b.c'); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + * + * _.unset(object, ['a', '0', 'b', 'c']); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + */ + function unset(object, path) { + return object == null ? true : baseUnset(object, path); + } + + /** + * This method is like `_.set` except that accepts `updater` to produce the + * value to set. Use `_.updateWith` to customize `path` creation. The `updater` + * is invoked with one argument: (value). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.update(object, 'a[0].b.c', function(n) { return n * n; }); + * console.log(object.a[0].b.c); + * // => 9 + * + * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); + * console.log(object.x[0].y.z); + * // => 0 + */ + function update(object, path, updater) { + return object == null + ? object + : baseUpdate(object, path, castFunction(updater)); + } + + /** + * This method is like `_.update` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.updateWith(object, '[0][1]', _.constant('a'), Object); + * // => { '0': { '1': 'a' } } + */ + function updateWith(object, path, updater, customizer) { + customizer = + typeof customizer == 'function' ? customizer : undefined; + return object == null + ? object + : baseUpdate(object, path, castFunction(updater), customizer); + } + + /** + * Creates an array of the own enumerable string keyed property values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.values(new Foo); + * // => [1, 2] (iteration order is not guaranteed) + * + * _.values('hi'); + * // => ['h', 'i'] + */ + function values(object) { + return object == null ? [] : baseValues(object, keys(object)); + } + + /** + * Creates an array of the own and inherited enumerable string keyed property + * values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.valuesIn(new Foo); + * // => [1, 2, 3] (iteration order is not guaranteed) + */ + function valuesIn(object) { + return object == null ? [] : baseValues(object, keysIn(object)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Clamps `number` within the inclusive `lower` and `upper` bounds. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Number + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + * @example + * + * _.clamp(-10, -5, 5); + * // => -5 + * + * _.clamp(10, -5, 5); + * // => 5 + */ + function clamp(number, lower, upper) { + if (upper === undefined) { + upper = lower; + lower = undefined; + } + if (upper !== undefined) { + upper = toNumber(upper); + upper = upper === upper ? upper : 0; + } + if (lower !== undefined) { + lower = toNumber(lower); + lower = lower === lower ? lower : 0; + } + return baseClamp(toNumber(number), lower, upper); + } + + /** + * Checks if `n` is between `start` and up to, but not including, `end`. If + * `end` is not specified, it's set to `start` with `start` then set to `0`. + * If `start` is greater than `end` the params are swapped to support + * negative ranges. + * + * @static + * @memberOf _ + * @since 3.3.0 + * @category Number + * @param {number} number The number to check. + * @param {number} [start=0] The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + * @see _.range, _.rangeRight + * @example + * + * _.inRange(3, 2, 4); + * // => true + * + * _.inRange(4, 8); + * // => true + * + * _.inRange(4, 2); + * // => false + * + * _.inRange(2, 2); + * // => false + * + * _.inRange(1.2, 2); + * // => true + * + * _.inRange(5.2, 4); + * // => false + * + * _.inRange(-3, -2, -6); + * // => true + */ + function inRange(number, start, end) { + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + number = toNumber(number); + return baseInRange(number, start, end); + } + + /** + * Produces a random number between the inclusive `lower` and `upper` bounds. + * If only one argument is provided a number between `0` and the given number + * is returned. If `floating` is `true`, or either `lower` or `upper` are + * floats, a floating-point number is returned instead of an integer. + * + * **Note:** JavaScript follows the IEEE-754 standard for resolving + * floating-point values which can produce unexpected results. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Number + * @param {number} [lower=0] The lower bound. + * @param {number} [upper=1] The upper bound. + * @param {boolean} [floating] Specify returning a floating-point number. + * @returns {number} Returns the random number. + * @example + * + * _.random(0, 5); + * // => an integer between 0 and 5 + * + * _.random(5); + * // => also an integer between 0 and 5 + * + * _.random(5, true); + * // => a floating-point number between 0 and 5 + * + * _.random(1.2, 5.2); + * // => a floating-point number between 1.2 and 5.2 + */ + function random(lower, upper, floating) { + if ( + floating && + typeof floating != 'boolean' && + isIterateeCall(lower, upper, floating) + ) { + upper = floating = undefined; + } + if (floating === undefined) { + if (typeof upper == 'boolean') { + floating = upper; + upper = undefined; + } else if (typeof lower == 'boolean') { + floating = lower; + lower = undefined; + } + } + if (lower === undefined && upper === undefined) { + lower = 0; + upper = 1; + } else { + lower = toFinite(lower); + if (upper === undefined) { + upper = lower; + lower = 0; + } else { + upper = toFinite(upper); + } + } + if (lower > upper) { + var temp = lower; + lower = upper; + upper = temp; + } + if (floating || lower % 1 || upper % 1) { + var rand = nativeRandom(); + return nativeMin( + lower + + rand * + (upper - + lower + + freeParseFloat('1e-' + ((rand + '').length - 1))), + upper, + ); + } + return baseRandom(lower, upper); + } + + /*------------------------------------------------------------------------*/ + + /** + * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the camel cased string. + * @example + * + * _.camelCase('Foo Bar'); + * // => 'fooBar' + * + * _.camelCase('--foo-bar--'); + * // => 'fooBar' + * + * _.camelCase('__FOO_BAR__'); + * // => 'fooBar' + */ + var camelCase = createCompounder(function(result, word, index) { + word = word.toLowerCase(); + return result + (index ? capitalize(word) : word); + }); + + /** + * Converts the first character of `string` to upper case and the remaining + * to lower case. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to capitalize. + * @returns {string} Returns the capitalized string. + * @example + * + * _.capitalize('FRED'); + * // => 'Fred' + */ + function capitalize(string) { + return upperFirst(toString(string).toLowerCase()); + } + + /** + * Deburrs `string` by converting + * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) + * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) + * letters to basic Latin letters and removing + * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to deburr. + * @returns {string} Returns the deburred string. + * @example + * + * _.deburr('déjà vu'); + * // => 'deja vu' + */ + function deburr(string) { + string = toString(string); + return ( + string && + string.replace(reLatin, deburrLetter).replace(reComboMark, '') + ); + } + + /** + * Checks if `string` ends with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=string.length] The position to search up to. + * @returns {boolean} Returns `true` if `string` ends with `target`, + * else `false`. + * @example + * + * _.endsWith('abc', 'c'); + * // => true + * + * _.endsWith('abc', 'b'); + * // => false + * + * _.endsWith('abc', 'b', 2); + * // => true + */ + function endsWith(string, target, position) { + string = toString(string); + target = baseToString(target); + + var length = string.length; + position = + position === undefined + ? length + : baseClamp(toInteger(position), 0, length); + + var end = position; + position -= target.length; + return position >= 0 && string.slice(position, end) == target; + } + + /** + * Converts the characters "&", "<", ">", '"', and "'" in `string` to their + * corresponding HTML entities. + * + * **Note:** No other characters are escaped. To escape additional + * characters use a third-party library like [_he_](https://mths.be/he). + * + * Though the ">" character is escaped for symmetry, characters like + * ">" and "/" don't need escaping in HTML and have no special meaning + * unless they're part of a tag or unquoted attribute value. See + * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) + * (under "semi-related fun fact") for more details. + * + * When working with HTML you should always + * [quote attribute values](http://wonko.com/post/html-escaping) to reduce + * XSS vectors. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escape('fred, barney, & pebbles'); + * // => 'fred, barney, & pebbles' + */ + function escape(string) { + string = toString(string); + return string && reHasUnescapedHtml.test(string) + ? string.replace(reUnescapedHtml, escapeHtmlChar) + : string; + } + + /** + * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", + * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escapeRegExp('[lodash](https://lodash.com/)'); + * // => '\[lodash\]\(https://lodash\.com/\)' + */ + function escapeRegExp(string) { + string = toString(string); + return string && reHasRegExpChar.test(string) + ? string.replace(reRegExpChar, '\\$&') + : string; + } + + /** + * Converts `string` to + * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the kebab cased string. + * @example + * + * _.kebabCase('Foo Bar'); + * // => 'foo-bar' + * + * _.kebabCase('fooBar'); + * // => 'foo-bar' + * + * _.kebabCase('__FOO_BAR__'); + * // => 'foo-bar' + */ + var kebabCase = createCompounder(function(result, word, index) { + return result + (index ? '-' : '') + word.toLowerCase(); + }); + + /** + * Converts `string`, as space separated words, to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the lower cased string. + * @example + * + * _.lowerCase('--Foo-Bar--'); + * // => 'foo bar' + * + * _.lowerCase('fooBar'); + * // => 'foo bar' + * + * _.lowerCase('__FOO_BAR__'); + * // => 'foo bar' + */ + var lowerCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + word.toLowerCase(); + }); + + /** + * Converts the first character of `string` to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.lowerFirst('Fred'); + * // => 'fred' + * + * _.lowerFirst('FRED'); + * // => 'fRED' + */ + var lowerFirst = createCaseFirst('toLowerCase'); + + /** + * Pads `string` on the left and right sides if it's shorter than `length`. + * Padding characters are truncated if they can't be evenly divided by `length`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ + function pad(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + if (!length || strLength >= length) { + return string; + } + var mid = (length - strLength) / 2; + return ( + createPadding(nativeFloor(mid), chars) + + string + + createPadding(nativeCeil(mid), chars) + ); + } + + /** + * Pads `string` on the right side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padEnd('abc', 6); + * // => 'abc ' + * + * _.padEnd('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padEnd('abc', 3); + * // => 'abc' + */ + function padEnd(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return length && strLength < length + ? string + createPadding(length - strLength, chars) + : string; + } + + /** + * Pads `string` on the left side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padStart('abc', 6); + * // => ' abc' + * + * _.padStart('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padStart('abc', 3); + * // => 'abc' + */ + function padStart(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return length && strLength < length + ? createPadding(length - strLength, chars) + string + : string; + } + + /** + * Converts `string` to an integer of the specified radix. If `radix` is + * `undefined` or `0`, a `radix` of `10` is used unless `value` is a + * hexadecimal, in which case a `radix` of `16` is used. + * + * **Note:** This method aligns with the + * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category String + * @param {string} string The string to convert. + * @param {number} [radix=10] The radix to interpret `value` by. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {number} Returns the converted integer. + * @example + * + * _.parseInt('08'); + * // => 8 + * + * _.map(['6', '08', '10'], _.parseInt); + * // => [6, 8, 10] + */ + function parseInt(string, radix, guard) { + if (guard || radix == null) { + radix = 0; + } else if (radix) { + radix = +radix; + } + return nativeParseInt( + toString(string).replace(reTrimStart, ''), + radix || 0, + ); + } + + /** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=1] The number of times to repeat the string. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ + function repeat(string, n, guard) { + if (guard ? isIterateeCall(string, n, guard) : n === undefined) { + n = 1; + } else { + n = toInteger(n); + } + return baseRepeat(toString(string), n); + } + + /** + * Replaces matches for `pattern` in `string` with `replacement`. + * + * **Note:** This method is based on + * [`String#replace`](https://mdn.io/String/replace). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to modify. + * @param {RegExp|string} pattern The pattern to replace. + * @param {Function|string} replacement The match replacement. + * @returns {string} Returns the modified string. + * @example + * + * _.replace('Hi Fred', 'Fred', 'Barney'); + * // => 'Hi Barney' + */ + function replace() { + var args = arguments, + string = toString(args[0]); + + return args.length < 3 + ? string + : string.replace(args[1], args[2]); + } + + /** + * Converts `string` to + * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the snake cased string. + * @example + * + * _.snakeCase('Foo Bar'); + * // => 'foo_bar' + * + * _.snakeCase('fooBar'); + * // => 'foo_bar' + * + * _.snakeCase('--FOO-BAR--'); + * // => 'foo_bar' + */ + var snakeCase = createCompounder(function(result, word, index) { + return result + (index ? '_' : '') + word.toLowerCase(); + }); + + /** + * Splits `string` by `separator`. + * + * **Note:** This method is based on + * [`String#split`](https://mdn.io/String/split). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to split. + * @param {RegExp|string} separator The separator pattern to split by. + * @param {number} [limit] The length to truncate results to. + * @returns {Array} Returns the string segments. + * @example + * + * _.split('a-b-c', '-', 2); + * // => ['a', 'b'] + */ + function split(string, separator, limit) { + if ( + limit && + typeof limit != 'number' && + isIterateeCall(string, separator, limit) + ) { + separator = limit = undefined; + } + limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; + if (!limit) { + return []; + } + string = toString(string); + if ( + string && + (typeof separator == 'string' || + (separator != null && !isRegExp(separator))) + ) { + separator = baseToString(separator); + if (!separator && hasUnicode(string)) { + return castSlice(stringToArray(string), 0, limit); + } + } + return string.split(separator, limit); + } + + /** + * Converts `string` to + * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * + * @static + * @memberOf _ + * @since 3.1.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the start cased string. + * @example + * + * _.startCase('--foo-bar--'); + * // => 'Foo Bar' + * + * _.startCase('fooBar'); + * // => 'Foo Bar' + * + * _.startCase('__FOO_BAR__'); + * // => 'FOO BAR' + */ + var startCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + upperFirst(word); + }); + + /** + * Checks if `string` starts with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=0] The position to search from. + * @returns {boolean} Returns `true` if `string` starts with `target`, + * else `false`. + * @example + * + * _.startsWith('abc', 'a'); + * // => true + * + * _.startsWith('abc', 'b'); + * // => false + * + * _.startsWith('abc', 'b', 1); + * // => true + */ + function startsWith(string, target, position) { + string = toString(string); + position = + position == null + ? 0 + : baseClamp(toInteger(position), 0, string.length); + + target = baseToString(target); + return string.slice(position, position + target.length) == target; + } + + /** + * Creates a compiled template function that can interpolate data properties + * in "interpolate" delimiters, HTML-escape interpolated data properties in + * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data + * properties may be accessed as free variables in the template. If a setting + * object is given, it takes precedence over `_.templateSettings` values. + * + * **Note:** In the development build `_.template` utilizes + * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) + * for easier debugging. + * + * For more information on precompiling templates see + * [lodash's custom builds documentation](https://lodash.com/custom-builds). + * + * For more information on Chrome extension sandboxes see + * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The template string. + * @param {Object} [options={}] The options object. + * @param {RegExp} [options.escape=_.templateSettings.escape] + * The HTML "escape" delimiter. + * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] + * The "evaluate" delimiter. + * @param {Object} [options.imports=_.templateSettings.imports] + * An object to import into the template as free variables. + * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] + * The "interpolate" delimiter. + * @param {string} [options.sourceURL='lodash.templateSources[n]'] + * The sourceURL of the compiled template. + * @param {string} [options.variable='obj'] + * The data object variable name. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the compiled template function. + * @example + * + * // Use the "interpolate" delimiter to create a compiled template. + * var compiled = _.template('hello <%= user %>!'); + * compiled({ 'user': 'fred' }); + * // => 'hello fred!' + * + * // Use the HTML "escape" delimiter to escape data property values. + * var compiled = _.template('<%- value %>'); + * compiled({ 'value': ' + + + `); +}; diff --git a/frontend/plugins/auth-backend/src/run.ts b/frontend/plugins/auth-backend/src/run.ts new file mode 100644 index 0000000..0a684c3 --- /dev/null +++ b/frontend/plugins/auth-backend/src/run.ts @@ -0,0 +1,33 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import yn from 'yn'; +import { getRootLogger } from '@backstage/backend-common'; +import { startStandaloneServer } from './service/standaloneServer'; + +const port = process.env.PLUGIN_PORT ? Number(process.env.PLUGIN_PORT) : 3003; +const enableCors = yn(process.env.PLUGIN_CORS, { default: false }); +const logger = getRootLogger(); + +startStandaloneServer({ port, enableCors, logger }).catch((err) => { + logger.error(err); + process.exit(1); +}); + +process.on('SIGINT', () => { + logger.info('CTRL+C pressed; exiting.'); + process.exit(0); +}); diff --git a/frontend/plugins/auth-backend/src/service/router.ts b/frontend/plugins/auth-backend/src/service/router.ts new file mode 100644 index 0000000..cdde95d --- /dev/null +++ b/frontend/plugins/auth-backend/src/service/router.ts @@ -0,0 +1,64 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import express from 'express'; +import Router from 'express-promise-router'; +import passport from 'passport'; +import { Logger } from 'winston'; +import { providers } from './../providers/config'; +import { makeProvider } from '../providers'; + +export interface RouterOptions { + logger: Logger; +} + +export async function createRouter( + options: RouterOptions, +): Promise { + const router = Router(); + const logger = options.logger.child({ plugin: 'auth' }); + const providerRouters: { [key: string]: express.Router } = {}; + + // configure all the providers + for (const providerConfig of providers) { + const { providerId, strategy, providerRouter } = makeProvider( + providerConfig, + ); + logger.info(`Configuring provider: ${providerId}`); + passport.use(strategy); + providerRouters[providerId] = providerRouter; + } + + passport.serializeUser((user, done) => { + done(null, user); + }); + + passport.deserializeUser((user, done) => { + done(null, user); + }); + + router.use(passport.initialize()); + router.use(passport.session()); + + for (const providerId in providerRouters) { + if (providerRouters.hasOwnProperty(providerId)) { + const providerRouter = providerRouters[providerId]; + router.use(`/${providerId}`, providerRouter); + } + } + + return router; +} diff --git a/frontend/plugins/auth-backend/src/service/standaloneApplication.ts b/frontend/plugins/auth-backend/src/service/standaloneApplication.ts new file mode 100644 index 0000000..5eea4fb --- /dev/null +++ b/frontend/plugins/auth-backend/src/service/standaloneApplication.ts @@ -0,0 +1,52 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { + errorHandler, + notFoundHandler, + requestLoggingHandler, +} from '@backstage/backend-common'; +import compression from 'compression'; +import cors from 'cors'; +import express from 'express'; +import helmet from 'helmet'; +import { Logger } from 'winston'; +import { createRouter } from './router'; + +export interface ApplicationOptions { + enableCors: boolean; + logger: Logger; +} + +export async function createStandaloneApplication( + options: ApplicationOptions, +): Promise { + const { enableCors, logger } = options; + const app = express(); + + app.use(helmet()); + if (enableCors) { + app.use(cors()); + } + app.use(compression()); + app.use(express.json()); + app.use(requestLoggingHandler()); + app.use('/', await createRouter({ logger })); + app.use(notFoundHandler()); + app.use(errorHandler()); + + return app; +} diff --git a/frontend/plugins/auth-backend/src/service/standaloneServer.ts b/frontend/plugins/auth-backend/src/service/standaloneServer.ts new file mode 100644 index 0000000..be1021d --- /dev/null +++ b/frontend/plugins/auth-backend/src/service/standaloneServer.ts @@ -0,0 +1,50 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { Server } from 'http'; +import { Logger } from 'winston'; +import { createStandaloneApplication } from './standaloneApplication'; + +export interface ServerOptions { + port: number; + enableCors: boolean; + logger: Logger; +} + +export async function startStandaloneServer( + options: ServerOptions, +): Promise { + const logger = options.logger.child({ service: 'auth-backend' }); + + logger.debug('Creating application...'); + const app = await createStandaloneApplication({ + enableCors: options.enableCors, + logger, + }); + + logger.debug('Starting application server...'); + return await new Promise((resolve, reject) => { + const server = app.listen(options.port, (err?: Error) => { + if (err) { + reject(err); + return; + } + + logger.info(`Listening on port ${options.port}`); + resolve(server); + }); + }); +} diff --git a/frontend/plugins/auth-backend/src/setupTests.ts b/frontend/plugins/auth-backend/src/setupTests.ts new file mode 100644 index 0000000..3fa7cb0 --- /dev/null +++ b/frontend/plugins/auth-backend/src/setupTests.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/auth-backend/tsconfig.json b/frontend/plugins/auth-backend/tsconfig.json new file mode 100644 index 0000000..015a967 --- /dev/null +++ b/frontend/plugins/auth-backend/tsconfig.json @@ -0,0 +1,15 @@ +{ + "include": ["src"], + "compilerOptions": { + "outDir": "dist", + "incremental": true, + "sourceMap": true, + "declaration": true, + "strict": true, + "target": "es2019", + "module": "commonjs", + "esModuleInterop": true, + "lib": ["es2019"], + "types": ["node", "jest"] + } +} diff --git a/frontend/plugins/catalog-backend/.eslintrc.js b/frontend/plugins/catalog-backend/.eslintrc.js new file mode 100644 index 0000000..16a033d --- /dev/null +++ b/frontend/plugins/catalog-backend/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint.backend')], +}; diff --git a/frontend/plugins/catalog-backend/README.md b/frontend/plugins/catalog-backend/README.md new file mode 100644 index 0000000..051bc50 --- /dev/null +++ b/frontend/plugins/catalog-backend/README.md @@ -0,0 +1,13 @@ +# Catalog Backend + +WORK IN PROGRESS + +This is the backend part of the default catalog plugin. + +It responds to requests from the frontend part, and fulfills them by delegating +to your existing catalog related services. + +## Links + +- (Frontend part of the plugin)[https://github.com/spotify/backstage/tree/master/plugins/catalog] +- (The Backstage homepage)[https://backstage.io] diff --git a/frontend/plugins/catalog-backend/fixtures/one_component.yaml b/frontend/plugins/catalog-backend/fixtures/one_component.yaml new file mode 100644 index 0000000..421f66f --- /dev/null +++ b/frontend/plugins/catalog-backend/fixtures/one_component.yaml @@ -0,0 +1,6 @@ +apiVersion: backstage.io/v1beta1 +kind: Component +metadata: + name: component3 +spec: + type: service diff --git a/frontend/plugins/catalog-backend/fixtures/two_components.yaml b/frontend/plugins/catalog-backend/fixtures/two_components.yaml new file mode 100644 index 0000000..d0e51ca --- /dev/null +++ b/frontend/plugins/catalog-backend/fixtures/two_components.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: backstage.io/v1beta1 +kind: Component +metadata: + name: component1 +spec: + type: service +--- +apiVersion: backstage.io/v1beta1 +kind: Component +metadata: + name: component2 +spec: + type: service diff --git a/frontend/plugins/catalog-backend/package.json b/frontend/plugins/catalog-backend/package.json new file mode 100644 index 0000000..50915bc --- /dev/null +++ b/frontend/plugins/catalog-backend/package.json @@ -0,0 +1,49 @@ +{ + "name": "@backstage/plugin-catalog-backend", + "version": "0.1.1-alpha.6", + "main": "dist", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "start": "tsc-watch --onFirstSuccess \"cross-env NODE_ENV=development nodemon dist/run.js\"", + "build": "tsc", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "clean": "backstage-cli clean" + }, + "dependencies": { + "@backstage/backend-common": "^0.1.1-alpha.6", + "compression": "^1.7.4", + "cors": "^2.8.5", + "express": "^4.17.1", + "express-promise-router": "^3.0.3", + "fs-extra": "^9.0.0", + "helmet": "^3.22.0", + "knex": "^0.21.1", + "lodash": "^4.17.15", + "morgan": "^1.10.0", + "sqlite3": "^4.2.0", + "uuid": "^8.0.0", + "winston": "^3.2.1", + "yaml": "^1.9.2", + "yn": "^4.0.0", + "yup": "^0.28.5" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@types/lodash": "^4.14.151", + "@types/uuid": "^7.0.3", + "@types/yup": "^0.28.2", + "jest-fetch-mock": "^3.0.3", + "tsc-watch": "^4.2.3" + }, + "files": [ + "dist" + ], + "nodemonConfig": { + "watch": "./dist" + } +} diff --git a/frontend/plugins/catalog-backend/src/catalog/DatabaseEntitiesCatalog.ts b/frontend/plugins/catalog-backend/src/catalog/DatabaseEntitiesCatalog.ts new file mode 100644 index 0000000..5c2c79d --- /dev/null +++ b/frontend/plugins/catalog-backend/src/catalog/DatabaseEntitiesCatalog.ts @@ -0,0 +1,33 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { Database } from '../database'; +import { DescriptorEnvelope } from '../ingestion/types'; +import { EntitiesCatalog } from './types'; + +export class DatabaseEntitiesCatalog implements EntitiesCatalog { + constructor(private readonly database: Database) {} + + async entities(): Promise { + const items = await this.database.entities(); + return items.map(i => i.entity); + } + + async entity(name: string): Promise { + const item = await this.database.entity(name); + return item.entity; + } +} diff --git a/frontend/plugins/catalog-backend/src/catalog/DatabaseLocationsCatalog.ts b/frontend/plugins/catalog-backend/src/catalog/DatabaseLocationsCatalog.ts new file mode 100644 index 0000000..e9f1512 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/catalog/DatabaseLocationsCatalog.ts @@ -0,0 +1,41 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { Database } from '../database'; +import { AddLocation, Location, LocationsCatalog } from './types'; + +export class DatabaseLocationsCatalog implements LocationsCatalog { + constructor(private readonly database: Database) {} + + async addLocation(location: AddLocation): Promise { + const added = await this.database.addLocation(location); + return added; + } + + async removeLocation(id: string): Promise { + await this.database.removeLocation(id); + } + + async locations(): Promise { + const items = await this.database.locations(); + return items; + } + + async location(id: string): Promise { + const item = await this.location(id); + return item; + } +} diff --git a/frontend/plugins/catalog-backend/src/catalog/StaticEntitiesCatalog.ts b/frontend/plugins/catalog-backend/src/catalog/StaticEntitiesCatalog.ts new file mode 100644 index 0000000..d74487a --- /dev/null +++ b/frontend/plugins/catalog-backend/src/catalog/StaticEntitiesCatalog.ts @@ -0,0 +1,39 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { NotFoundError } from '@backstage/backend-common'; +import { DescriptorEnvelope } from '../ingestion'; +import { EntitiesCatalog } from './types'; + +export class StaticEntitiesCatalog implements EntitiesCatalog { + private _entities: DescriptorEnvelope[]; + + constructor(entities: DescriptorEnvelope[]) { + this._entities = entities; + } + + async entities(): Promise { + return this._entities.slice(); + } + + async entity(name: string): Promise { + const item = this._entities.find(e => e.metadata?.name === name); + if (!item) { + throw new NotFoundError(`Found no entity with name ${name}`); + } + return item; + } +} diff --git a/frontend/plugins/catalog-backend/src/catalog/index.ts b/frontend/plugins/catalog-backend/src/catalog/index.ts new file mode 100644 index 0000000..58ae531 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/catalog/index.ts @@ -0,0 +1,20 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './DatabaseEntitiesCatalog'; +export * from './DatabaseLocationsCatalog'; +export * from './StaticEntitiesCatalog'; +export * from './types'; diff --git a/frontend/plugins/catalog-backend/src/catalog/types.ts b/frontend/plugins/catalog-backend/src/catalog/types.ts new file mode 100644 index 0000000..bb50a00 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/catalog/types.ts @@ -0,0 +1,56 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import * as yup from 'yup'; +import { DescriptorEnvelope } from '../ingestion'; + +// +// Items +// + +export type EntitiesCatalog = { + entities(): Promise; + entity(id: string): Promise; +}; + +// +// Locations +// + +export type Location = { + id: string; + type: string; + target: string; +}; + +export type AddLocation = { + type: string; + target: string; +}; + +export const addLocationSchema: yup.Schema = yup + .object({ + type: yup.string().required(), + target: yup.string().required(), + }) + .noUnknown(); + +export type LocationsCatalog = { + addLocation(location: AddLocation): Promise; + removeLocation(id: string): Promise; + locations(): Promise; + location(id: string): Promise; +}; diff --git a/frontend/plugins/catalog-backend/src/database/Database.test.ts b/frontend/plugins/catalog-backend/src/database/Database.test.ts new file mode 100644 index 0000000..4599684 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/Database.test.ts @@ -0,0 +1,78 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import knex from 'knex'; +import path from 'path'; +import { Database } from './Database'; +import { AddDatabaseLocation, DbLocationsRow } from './types'; + +describe('Database', () => { + const database = knex({ + client: 'sqlite3', + connection: ':memory:', + useNullAsDefault: true, + }); + database.client.pool.on('createSuccess', (_eventId: any, resource: any) => { + resource.run('PRAGMA foreign_keys = ON', () => {}); + }); + + beforeEach(async () => { + await database.migrate.latest({ + directory: path.resolve(__dirname, 'migrations'), + loadExtensions: ['.ts'], + }); + }); + + it('manages locations', async () => { + const db = new Database(database); + const input: AddDatabaseLocation = { type: 'a', target: 'b' }; + const output: DbLocationsRow = { + id: expect.anything(), + type: 'a', + target: 'b', + }; + + await db.addLocation(input); + + const locations = await db.locations(); + expect(locations).toEqual([output]); + const location = await db.location(locations[0].id); + expect(location).toEqual(output); + + await db.removeLocation(locations[0].id); + + await expect(db.locations()).resolves.toEqual([]); + await expect(db.location(locations[0].id)).rejects.toThrow( + /Found no location/, + ); + }); + + it('instead of adding second location with the same target, returns existing one', async () => { + // Prepare + const catalog = new Database(database); + const input: AddDatabaseLocation = { type: 'a', target: 'b' }; + const output1: DbLocationsRow = await catalog.addLocation(input); + + // Try to insert the same location + const output2: DbLocationsRow = await catalog.addLocation(input); + const locations = await catalog.locations(); + + // Output is the same + expect(output2).toEqual(output1); + // Locations contain only one record + expect(locations).toEqual([output1]); + }); +}); diff --git a/frontend/plugins/catalog-backend/src/database/Database.ts b/frontend/plugins/catalog-backend/src/database/Database.ts new file mode 100644 index 0000000..71530c3 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/Database.ts @@ -0,0 +1,203 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { InputError, NotFoundError } from '@backstage/backend-common'; +import Knex from 'knex'; +import { v4 as uuidv4 } from 'uuid'; +import { DescriptorEnvelope } from '../ingestion'; +import { + AddDatabaseLocation, + DatabaseLocationUpdateLogEvent, + DatabaseLocationUpdateLogStatus, + DbEntitiesRow, + DbEntityRequest, + DbEntityResponse, + DbLocationsRow, +} from './types'; + +function serializeMetadata( + metadata: DescriptorEnvelope['metadata'], +): DbEntitiesRow['metadata'] { + if (!metadata) { + return null; + } + + const output = { ...metadata }; + // TODO: delete output.uid; + // TODO: delete output.generation; + + return JSON.stringify(output); +} + +function serializeSpec( + spec: DescriptorEnvelope['spec'], +): DbEntitiesRow['spec'] { + if (!spec) { + return null; + } + + return JSON.stringify(spec); +} + +function entityRequestToDb(request: DbEntityRequest): DbEntitiesRow { + return { + id: '', + location_id: request.locationId || null, + api_version: request.entity.apiVersion, + kind: request.entity.kind, + name: request.entity.metadata?.name || null, + namespace: request.entity.metadata?.namespace || null, + metadata: serializeMetadata(request.entity.metadata), + spec: serializeSpec(request.entity.spec), + }; +} + +function entityDbToResponse(row: DbEntitiesRow): DbEntityResponse { + const entity: DescriptorEnvelope = { + apiVersion: row.api_version, + kind: row.kind, + metadata: { + // TODO: uid: row.id, + // TODO: generation: row.generation, + }, + }; + + if (row.metadata) { + const metadata = JSON.parse(row.metadata) as DescriptorEnvelope['metadata']; + entity.metadata = { ...entity.metadata, ...metadata }; + } + + if (row.spec) { + const spec = JSON.parse(row.spec); + entity.spec = spec; + } + + return { + locationId: row.location_id || undefined, + entity, + }; +} + +export class Database { + constructor(private readonly database: Knex) {} + + async addOrUpdateEntity(request: DbEntityRequest): Promise { + if (!request.entity.metadata?.name) { + throw new InputError(`Entities without names are not yet supported`); + } + + const newRow = entityRequestToDb(request); + + await this.database.transaction(async tx => { + // TODO(freben): Currently, several locations can compete for the same entity + // TODO(freben): If locationId is unset in the input, it won't be overwritten - should we instead replace with null? + const count = await tx('entities') + .where({ name: request.entity.metadata?.name }) + .update({ + ...newRow, + id: undefined, + }); + if (!count) { + await tx('entities').insert({ + ...newRow, + id: uuidv4(), + }); + } + }); + } + + async entities(): Promise { + const items = await this.database('entities') + .orderBy('name') + .select(); + return items.map(entityDbToResponse); + } + + async entity(name: string): Promise { + const items = await this.database('entities') + .where({ name }) + .select(); + if (!items.length) { + throw new NotFoundError(`Found no entity with name ${name}`); + } + return entityDbToResponse(items[0]); + } + + async addLocation(location: AddDatabaseLocation): Promise { + return await this.database.transaction(async tx => { + const existingLocation = await tx('locations') + .where({ + target: location.target, + }) + .select(); + + if (existingLocation?.[0]) { + return existingLocation[0]; + } + + const id = uuidv4(); + const { type, target } = location; + await tx('locations').insert({ + id, + type, + target, + }); + + return (await tx('locations').where({ id }).select())![0]; + }); + } + + async removeLocation(id: string): Promise { + const result = await this.database('locations') + .where({ id }) + .del(); + + if (!result) { + throw new NotFoundError(`Found no location with ID ${id}`); + } + } + + async location(id: string): Promise { + const items = await this.database('locations') + .where({ id }) + .select(); + if (!items.length) { + throw new NotFoundError(`Found no location with ID ${id}`); + } + return items[0]; + } + + async locations(): Promise { + return this.database('locations').select(); + } + + async addLocationUpdateLogEvent( + locationId: string, + status: DatabaseLocationUpdateLogStatus, + entityName?: string, + message?: string, + ): Promise { + return this.database( + 'location_update_log', + ).insert({ + id: uuidv4(), + status: status, + location_id: locationId, + entity_name: entityName, + message, + }); + } +} diff --git a/frontend/plugins/catalog-backend/src/database/DatabaseManager.test.ts b/frontend/plugins/catalog-backend/src/database/DatabaseManager.test.ts new file mode 100644 index 0000000..1043733 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/DatabaseManager.test.ts @@ -0,0 +1,232 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { PassThrough } from 'stream'; +import winston from 'winston'; +import { + ComponentDescriptor, + DescriptorParser, + LocationReader, + ParserError, +} from '../ingestion'; +import { Database } from './Database'; +import { DatabaseManager } from './DatabaseManager'; +import { DatabaseLocationUpdateLogStatus, DbLocationsRow } from './types'; + +describe('DatabaseManager', () => { + const logger = winston.createLogger({ + transports: [new winston.transports.Stream({ stream: new PassThrough() })], + }); + + describe('refreshLocations', () => { + it('works with no locations added', async () => { + const db = ({ + addOrUpdateEntity: jest.fn(), + locations: jest.fn().mockResolvedValue([]), + } as unknown) as Database; + const reader: LocationReader = { + read: jest.fn(), + }; + const parser: DescriptorParser = { + parse: jest.fn(), + }; + + await expect( + DatabaseManager.refreshLocations(db, reader, parser, logger), + ).resolves.toBeUndefined(); + expect(reader.read).not.toHaveBeenCalled(); + expect(parser.parse).not.toHaveBeenCalled(); + }); + + it('can update a single location', async () => { + const db = ({ + addOrUpdateEntity: jest.fn(), + locations: jest.fn(() => + Promise.resolve([ + { + id: '123', + type: 'some', + target: 'thing', + } as DbLocationsRow, + ]), + ), + addLocationUpdateLogEvent: jest.fn(), + } as unknown) as Database; + + const desc: ComponentDescriptor = { + apiVersion: 'backstage.io/v1beta1', + kind: 'Component', + metadata: { name: 'c1' }, + spec: { type: 'service' }, + }; + const reader: LocationReader = { + read: jest.fn(() => Promise.resolve([{ type: 'data', data: desc }])), + }; + const parser: DescriptorParser = { + parse: jest.fn(() => Promise.resolve(desc)), + }; + + await expect( + DatabaseManager.refreshLocations(db, reader, parser, logger), + ).resolves.toBeUndefined(); + expect(reader.read).toHaveBeenCalledTimes(1); + expect(reader.read).toHaveBeenNthCalledWith(1, 'some', 'thing'); + expect(db.addOrUpdateEntity).toHaveBeenCalledTimes(1); + expect(db.addOrUpdateEntity).toHaveBeenNthCalledWith(1, { + locationId: '123', + entity: expect.objectContaining({ + metadata: expect.objectContaining({ name: 'c1' }), + }), + }); + }); + + it('logs successful updates', async () => { + const db = ({ + addOrUpdateEntity: jest.fn(), + locations: jest.fn(() => + Promise.resolve([ + { + id: '123', + type: 'some', + target: 'thing', + } as DbLocationsRow, + ]), + ), + addLocationUpdateLogEvent: jest.fn(), + } as unknown) as Database; + + const desc: ComponentDescriptor = { + apiVersion: 'backstage.io/v1beta1', + kind: 'Component', + metadata: { name: 'c1' }, + spec: { type: 'service' }, + }; + const reader: LocationReader = { + read: jest.fn(() => Promise.resolve([{ type: 'data', data: desc }])), + }; + const parser: DescriptorParser = { + parse: jest.fn(() => Promise.resolve(desc)), + }; + + await expect( + DatabaseManager.refreshLocations(db, reader, parser, logger), + ).resolves.toBeUndefined(); + + expect(db.addLocationUpdateLogEvent).toHaveBeenNthCalledWith( + 1, + '123', + DatabaseLocationUpdateLogStatus.SUCCESS, + 'c1', + ); + + expect(db.addLocationUpdateLogEvent).toHaveBeenNthCalledWith( + 2, + '123', + DatabaseLocationUpdateLogStatus.SUCCESS, + undefined, + ); + }); + + it('logs unsuccessful updates when parser fails', async () => { + const db = ({ + addOrUpdateEntity: jest.fn(), + locations: jest.fn(() => + Promise.resolve([ + { + id: '123', + type: 'some', + target: 'thing', + } as DbLocationsRow, + ]), + ), + addLocationUpdateLogEvent: jest.fn(), + } as unknown) as Database; + + const desc: ComponentDescriptor = { + apiVersion: 'backstage.io/v1beta1', + kind: 'Component', + metadata: { name: 'c1' }, + spec: { type: 'service' }, + }; + const reader: LocationReader = { + read: jest.fn(() => Promise.resolve([{ type: 'data', data: desc }])), + }; + const parser: DescriptorParser = { + parse: jest.fn(() => + Promise.reject(new ParserError('parser error message', 'c1')), + ), + }; + + await expect( + DatabaseManager.refreshLocations(db, reader, parser, logger), + ).resolves.toBeUndefined(); + + expect(db.addLocationUpdateLogEvent).toHaveBeenNthCalledWith( + 1, + '123', + DatabaseLocationUpdateLogStatus.FAIL, + 'c1', + 'parser error message', + ); + + expect(db.addLocationUpdateLogEvent).toHaveBeenNthCalledWith( + 2, + '123', + DatabaseLocationUpdateLogStatus.SUCCESS, + undefined, + ); + }); + + it('logs unsuccessful updates when reader fails', async () => { + const db = ({ + addOrUpdateEntity: jest.fn(), + locations: jest.fn(() => + Promise.resolve([ + { + id: '123', + type: 'some', + target: 'thing', + } as DbLocationsRow, + ]), + ), + addLocationUpdateLogEvent: jest.fn(), + } as unknown) as Database; + + const reader: LocationReader = { + read: jest.fn(() => + Promise.reject([{ type: 'error', error: new Error('test message') }]), + ), + }; + const parser: DescriptorParser = { + parse: jest.fn(() => + Promise.reject(new ParserError('parser error message', 'c1')), + ), + }; + + await expect( + DatabaseManager.refreshLocations(db, reader, parser, logger), + ).resolves.toBeUndefined(); + + expect(db.addLocationUpdateLogEvent).toHaveBeenNthCalledWith( + 1, + '123', + DatabaseLocationUpdateLogStatus.FAIL, + undefined, + undefined, + ); + }); + }); +}); diff --git a/frontend/plugins/catalog-backend/src/database/DatabaseManager.ts b/frontend/plugins/catalog-backend/src/database/DatabaseManager.ts new file mode 100644 index 0000000..29b0bad --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/DatabaseManager.ts @@ -0,0 +1,108 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import Knex from 'knex'; +import path from 'path'; +import { Logger } from 'winston'; +import { DescriptorParser, LocationReader, ParserError } from '../ingestion'; +import { Database } from './Database'; +import { DatabaseLocationUpdateLogStatus, DbEntityRequest } from './types'; + +export class DatabaseManager { + public static async createDatabase(database: Knex): Promise { + await database.migrate.latest({ + directory: path.resolve(__dirname, 'migrations'), + loadExtensions: ['.js'], + }); + return new Database(database); + } + + private static async logUpdateSuccess( + database: Database, + locationId: string, + entityName?: string, + ) { + return database.addLocationUpdateLogEvent( + locationId, + DatabaseLocationUpdateLogStatus.SUCCESS, + entityName, + ); + } + + private static async logUpdateFailure( + database: Database, + locationId: string, + error?: Error, + entityName?: string, + ) { + return database.addLocationUpdateLogEvent( + locationId, + DatabaseLocationUpdateLogStatus.FAIL, + entityName, + error?.message, + ); + } + + public static async refreshLocations( + database: Database, + reader: LocationReader, + parser: DescriptorParser, + logger: Logger, + ): Promise { + const locations = await database.locations(); + for (const location of locations) { + try { + logger.debug( + `Refreshing location ${location.id} type "${location.type}" target "${location.target}"`, + ); + + const readerOutput = await reader.read(location.type, location.target); + + for (const readerItem of readerOutput) { + if (readerItem.type === 'error') { + logger.debug(readerItem.error); + continue; + } + try { + const entity = await parser.parse(readerItem.data); + const dbc: DbEntityRequest = { locationId: location.id, entity }; + await database.addOrUpdateEntity(dbc); + await DatabaseManager.logUpdateSuccess( + database, + location.id, + entity.metadata!.name, + ); + } catch (error) { + let entityName; + if (error instanceof ParserError) { + entityName = error.entityName; + } + await DatabaseManager.logUpdateFailure( + database, + location.id, + error, + entityName, + ); + } + } + await DatabaseManager.logUpdateSuccess(database, location.id); + } catch (error) { + logger.debug(`Failed to refresh location ${location.id}, ${error}`); + await DatabaseManager.logUpdateFailure(database, location.id, error); + } + } + } +} diff --git a/frontend/plugins/catalog-backend/src/database/index.ts b/frontend/plugins/catalog-backend/src/database/index.ts new file mode 100644 index 0000000..616808f --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/index.ts @@ -0,0 +1,19 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './Database'; +export * from './DatabaseManager'; +export * from './types'; diff --git a/frontend/plugins/catalog-backend/src/database/migrations/20200511113813_init.ts b/frontend/plugins/catalog-backend/src/database/migrations/20200511113813_init.ts new file mode 100644 index 0000000..e31834d --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/migrations/20200511113813_init.ts @@ -0,0 +1,78 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import * as Knex from 'knex'; + +export async function up(knex: Knex): Promise { + return ( + knex.schema + // + // locations + // + .createTable('locations', table => { + table.comment( + 'Registered locations that shall be contiuously scanned for catalog item updates', + ); + table.uuid('id').primary().comment('Auto-generated ID of the location'); + table.string('type').notNullable().comment('The type of location'); + table + .string('target') + .notNullable() + .comment('The actual target of the location'); + }) + // + // entities + // + .createTable('entities', table => { + table.comment('All entities currently stored in the catalog'); + table.uuid('id').primary().comment('Auto-generated ID of the entity'); + table + .uuid('location_id') + .references('id') + .inTable('locations') + .nullable() + .comment('The location that originated the entity'); + table + .string('api_version') + .notNullable() + .comment('The apiVersion field of the entity'); + table + .string('kind') + .notNullable() + .comment('The kind field of the entity'); + table + .string('name') + .nullable() + .comment('The metadata.name field of the entity'); + table + .string('namespace') + .nullable() + .comment('The metadata.namespace field of the entity'); + table + .string('metadata') + .nullable() + .comment('The entire metadata JSON blob of the entity'); + table + .string('spec') + .nullable() + .comment('The entire spec JSON blob of the entity'); + }) + ); +} + +export async function down(knex: Knex): Promise { + return knex.schema.dropTable('entities').dropTable('locations'); +} diff --git a/frontend/plugins/catalog-backend/src/database/migrations/20200520140700_location_update_log_table.ts b/frontend/plugins/catalog-backend/src/database/migrations/20200520140700_location_update_log_table.ts new file mode 100644 index 0000000..594641e --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/migrations/20200520140700_location_update_log_table.ts @@ -0,0 +1,36 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import * as Knex from 'knex'; + +export async function up(knex: Knex): Promise { + return knex.schema.createTable('location_update_log', table => { + table.uuid('id').primary(); + table.enum('status', ['success', 'fail']).notNullable(); + table.dateTime('created_at').defaultTo(knex.fn.now()).notNullable(); + table.string('message'); + table + .uuid('location_id') + .references('id') + .inTable('locations') + .onUpdate('CASCADE') + .onDelete('CASCADE'); + table.string('entity_name').notNullable(); + }); +} + +export async function down(knex: Knex): Promise { + return knex.schema.dropTableIfExists('location_update_log'); +} diff --git a/frontend/plugins/catalog-backend/src/database/types.ts b/frontend/plugins/catalog-backend/src/database/types.ts new file mode 100644 index 0000000..0a199fa --- /dev/null +++ b/frontend/plugins/catalog-backend/src/database/types.ts @@ -0,0 +1,71 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import * as yup from 'yup'; +import { DescriptorEnvelope } from '../ingestion'; + +export type DbEntitiesRow = { + id: string; + location_id: string | null; + api_version: string; + kind: string; + name: string | null; + namespace: string | null; + metadata: string | null; + spec: string | null; +}; + +export type DbEntityRequest = { + locationId?: string; + entity: DescriptorEnvelope; +}; + +export type DbEntityResponse = { + locationId?: string; + entity: DescriptorEnvelope; +}; + +export type DbLocationsRow = { + id: string; + type: string; + target: string; +}; + +export type AddDatabaseLocation = { + type: string; + target: string; +}; + +export const addDatabaseLocationSchema: yup.Schema = yup + .object({ + type: yup.string().required(), + target: yup.string().required(), + }) + .noUnknown(); + +export enum DatabaseLocationUpdateLogStatus { + FAIL = 'fail', + SUCCESS = 'success', +} + +export type DatabaseLocationUpdateLogEvent = { + id: string; + status: DatabaseLocationUpdateLogStatus; + location_id: string; + entity_name: string; + created_at?: string; + message?: string; +}; diff --git a/frontend/plugins/catalog-backend/src/index.ts b/frontend/plugins/catalog-backend/src/index.ts new file mode 100644 index 0000000..89fd4d3 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/index.ts @@ -0,0 +1,21 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './catalog'; +export * from './database'; +export * from './ingestion'; +export * from './service/router'; +export * from './util'; diff --git a/frontend/plugins/catalog-backend/src/ingestion/DescriptorParsers.ts b/frontend/plugins/catalog-backend/src/ingestion/DescriptorParsers.ts new file mode 100644 index 0000000..86283df --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/DescriptorParsers.ts @@ -0,0 +1,53 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { makeValidator } from '../validation'; +import { ComponentDescriptorV1beta1Parser } from './descriptors/ComponentDescriptorV1beta1Parser'; +import { DescriptorEnvelopeParser } from './descriptors/DescriptorEnvelopeParser'; +import { + DescriptorEnvelope, + DescriptorParser, + KindParser, + ParserError, +} from './types'; + +export class DescriptorParsers implements DescriptorParser { + static create(): DescriptorParser { + const validators = makeValidator(); + return new DescriptorParsers(new DescriptorEnvelopeParser(validators), [ + new ComponentDescriptorV1beta1Parser(), + ]); + } + + constructor( + private readonly envelopeParser: DescriptorEnvelopeParser, + private readonly kindParsers: KindParser[], + ) {} + + async parse(descriptor: object): Promise { + const envelope = await this.envelopeParser.parse(descriptor); + for (const parser of this.kindParsers) { + const parsed = await parser.tryParse(envelope); + if (parsed) { + return parsed; + } + } + throw new ParserError( + `Unsupported object ${envelope.apiVersion}, ${envelope.kind}`, + envelope.metadata?.name, + ); + } +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/LocationReaders.ts b/frontend/plugins/catalog-backend/src/ingestion/LocationReaders.ts new file mode 100644 index 0000000..676c318 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/LocationReaders.ts @@ -0,0 +1,38 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { FileLocationSource } from './sources/FileLocationSource'; +import { LocationSource } from './sources/types'; +import { LocationReader, ReaderOutput } from './types'; + +export class LocationReaders implements LocationReader { + static create(): LocationReader { + return new LocationReaders({ + file: new FileLocationSource(), + }); + } + + constructor(private readonly sources: Record) {} + + async read(type: string, target: string): Promise { + const source = this.sources[type]; + if (!source) { + throw new Error(`Unknown location type ${type}`); + } + + return source.read(target); + } +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/descriptors/ComponentDescriptorV1beta1Parser.ts b/frontend/plugins/catalog-backend/src/ingestion/descriptors/ComponentDescriptorV1beta1Parser.ts new file mode 100644 index 0000000..8d756ac --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/descriptors/ComponentDescriptorV1beta1Parser.ts @@ -0,0 +1,64 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import * as yup from 'yup'; +import { DescriptorEnvelope, ParserError } from '../types'; +import { KindParser } from './types'; + +export interface ComponentDescriptorV1beta1 extends DescriptorEnvelope { + spec: { + type: string; + }; +} + +export class ComponentDescriptorV1beta1Parser implements KindParser { + private schema: yup.Schema; + + constructor() { + this.schema = yup.object>({ + metadata: yup + .object({ + name: yup.string().required(), + }) + .required(), + spec: yup + .object({ + type: yup.string().required(), + }) + .required(), + }); + } + + async tryParse( + envelope: DescriptorEnvelope, + ): Promise { + if ( + envelope.apiVersion !== 'backstage.io/v1beta1' || + envelope.kind !== 'Component' + ) { + return undefined; + } + + try { + return await this.schema.validate(envelope, { strict: true }); + } catch (e) { + throw new ParserError( + `Malformed component, ${e}`, + envelope.metadata?.name, + ); + } + } +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.test.ts b/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.test.ts new file mode 100644 index 0000000..7c96fb7 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.test.ts @@ -0,0 +1,172 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import yaml from 'yaml'; +import { makeValidator } from '../../validation'; +import { DescriptorEnvelopeParser } from './DescriptorEnvelopeParser'; + +describe('DescriptorEnvelopeParser', () => { + let data: any; + let parser: DescriptorEnvelopeParser; + + beforeEach(() => { + data = yaml.parse(` + apiVersion: backstage.io/v1beta1 + kind: Component + metadata: + uid: e01199ab-08cc-44c2-8e19-5c29ded82521 + etag: lsndfkjsndfkjnsdfkjnsd== + generation: 13 + name: my-component-yay + namespace: the-namespace + labels: + backstage.io/custom: ValueStuff + annotations: + example.com/bindings: are-secret + spec: + custom: stuff + `); + parser = new DescriptorEnvelopeParser(makeValidator()); + }); + + it('works for the happy path', async () => { + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects missing apiVersion', async () => { + delete data.apiVersion; + await expect(parser.parse(data)).rejects.toThrow(/apiVersion/); + }); + + it('rejects wrong root type', async () => { + await expect(parser.parse(7)).rejects.toThrow(/object/); + }); + + it('rejects bad apiVersion', async () => { + data.apiVersion = 'a#b'; + await expect(parser.parse(data)).rejects.toThrow(/apiVersion/); + }); + + it('rejects missing kind', async () => { + delete data.kind; + await expect(parser.parse(data)).rejects.toThrow(/kind/); + }); + + it('rejects bad kind', async () => { + data.kind = 'a#b'; + await expect(parser.parse(data)).rejects.toThrow(/kind/); + }); + + it('accepts missing metadata', async () => { + delete data.medatata; + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects non-object metadata', async () => { + data.metadata = 7; + await expect(parser.parse(data)).rejects.toThrow(/metadata/); + }); + + it('accepts missing uid', async () => { + delete data.metadata.uid; + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects bad uid', async () => { + data.metadata.uid = 7; + await expect(parser.parse(data)).rejects.toThrow(/uid/); + }); + + it('accepts missing etag', async () => { + delete data.metadata.etag; + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects bad etag', async () => { + data.metadata.etag = 7; + await expect(parser.parse(data)).rejects.toThrow(/etag/); + }); + + it('accepts missing generation', async () => { + delete data.metadata.generation; + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects bad generation', async () => { + data.metadata.generation = 'a'; + await expect(parser.parse(data)).rejects.toThrow(/generation/); + }); + + it('accepts missing spec', async () => { + delete data.spec; + await expect(parser.parse(data)).resolves.toBe(data); + }); + + it('rejects non-object spec', async () => { + data.spec = 7; + await expect(parser.parse(data)).rejects.toThrow(/spec/); + }); + + it('rejects bad name', async () => { + data.metadata.name = 7; + await expect(parser.parse(data)).rejects.toThrow(/name/); + }); + + it('rejects bad namespace', async () => { + data.metadata.namespace = 7; + await expect(parser.parse(data)).rejects.toThrow(/namespace/); + }); + + it('rejects bad label key', async () => { + data.metadata.labels['a#b'] = 'value'; + await expect(parser.parse(data)).rejects.toThrow(/label.*key/i); + }); + + it('rejects bad label value', async () => { + data.metadata.labels.a = 'a#b'; + await expect(parser.parse(data)).rejects.toThrow(/label.*value/i); + }); + + it('rejects bad annotation key', async () => { + data.metadata.annotations['a#b'] = 'value'; + await expect(parser.parse(data)).rejects.toThrow(/annotation.*key/i); + }); + + it('rejects bad annotation value', async () => { + data.metadata.annotations.a = []; + await expect(parser.parse(data)).rejects.toThrow(/annotation.*value/i); + }); + + it('rejects unknown root keys', async () => { + data.spec2 = {}; + await expect(parser.parse(data)).rejects.toThrow(/spec2/i); + }); + + it('rejects reserved keys in the spec root', async () => { + data.spec.apiVersion = 'a/b'; + await expect(parser.parse(data)).rejects.toThrow(/spec.*apiVersion/i); + }); + + it('rejects reserved keys in labels', async () => { + data.metadata.labels.apiVersion = 'a'; + await expect(parser.parse(data)).rejects.toThrow(/label.*apiVersion/i); + }); + + it('rejects reserved keys in annotations', async () => { + data.metadata.annotations.apiVersion = 'a'; + await expect(parser.parse(data)).rejects.toThrow(/annotation.*apiVersion/i); + }); +}); diff --git a/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.ts b/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.ts new file mode 100644 index 0000000..ccf5fc3 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/descriptors/DescriptorEnvelopeParser.ts @@ -0,0 +1,206 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import * as yup from 'yup'; +import { Validators } from '../../validation'; +import { DescriptorEnvelope } from '../types'; + +/** + * Parses some raw structured data as a descriptor envelope + */ +export class DescriptorEnvelopeParser { + private schema: yup.Schema; + + constructor(validators: Validators) { + const apiVersionSchema = yup + .string() + .required() + .test( + 'apiVersion', + 'The apiVersion is not formatted according to schema', + validators.isValidApiVersion, + ); + + const kindSchema = yup + .string() + .required() + .test( + 'kind', + 'The kind is not formatted according to schema', + validators.isValidKind, + ); + + const uidSchema = yup + .string() + .notRequired() + .test( + 'metadata.uid', + 'The uid is not formatted according to schema', + value => value === undefined || value.length > 0, + ); + + const etagSchema = yup + .string() + .notRequired() + .test( + 'metadata.etag', + 'The etag value is not according to schema', + value => value === undefined || value.length > 0, + ); + + const generationSchema = yup + .number() + .notRequired() + .test( + 'metadata.generation', + 'The generation value is not according to schema', + value => value === undefined || value > 0, + ); + + const nameSchema = yup + .string() + .notRequired() + .test( + 'metadata.name', + 'The name is not formatted according to schema', + value => value === undefined || validators.isValidEntityName(value), + ); + + const namespaceSchema = yup + .string() + .notRequired() + .test( + 'metadata.namespace', + 'The namespace is malformed', + value => value === undefined || validators.isValidNamespace(value), + ); + + const labelsSchema = yup + .object() + .notRequired() + .test({ + name: 'metadata.labels.keys', + message: 'Label keys not formatted according to schema', + test(value: object) { + return ( + value === undefined || + Object.keys(value).every(validators.isValidLabelKey) + ); + }, + }) + .test({ + name: 'metadata.labels.values', + message: 'Label values not formatted according to schema', + test(value: object) { + return ( + value === undefined || + Object.values(value).every(validators.isValidLabelValue) + ); + }, + }); + + const annotationsSchema = yup + .object() + .notRequired() + .test({ + name: 'metadata.annotations.keys', + message: 'Annotation keys not formatted according to schema', + test(value: object) { + return ( + value === undefined || + Object.keys(value).every(validators.isValidAnnotationKey) + ); + }, + }) + .test({ + name: 'metadata.annotations.values', + message: 'Annotation values not formatted according to schema', + test(value: object) { + return ( + value === undefined || + Object.values(value).every(validators.isValidAnnotationValue) + ); + }, + }); + + const metadataSchema = yup + .object({ + uid: uidSchema, + etag: etagSchema, + generation: generationSchema, + name: nameSchema, + namespace: namespaceSchema, + labels: labelsSchema, + annotations: annotationsSchema, + }) + .notRequired(); + + const specSchema = yup.object({}).notRequired(); + + this.schema = yup + .object({ + apiVersion: apiVersionSchema, + kind: kindSchema, + metadata: metadataSchema, + spec: specSchema, + }) + .noUnknown(); + } + + async parse(data: any): Promise { + let result: DescriptorEnvelope; + try { + result = await this.schema.validate(data, { strict: true }); + } catch (e) { + throw new Error(`Malformed envelope, ${e}`); + } + + // These are keys with specific semantic meaning in a document, that we do + // not want to appear in the root of the spec, or as labels or as + // annotations, because they will lead to confusion. + const reservedKeys = [ + 'apiVersion', + 'kind', + 'uid', + 'etag', + 'generation', + 'name', + 'namespace', + 'labels', + 'annotations', + 'spec', + ]; + for (const key of reservedKeys) { + if (result.spec?.hasOwnProperty(key)) { + throw new Error( + `The spec may not contain the key ${key}, because it has reserved meaning`, + ); + } + if (result.metadata?.labels?.hasOwnProperty(key)) { + throw new Error( + `A label may not have the key ${key}, because it has reserved meaning`, + ); + } + if (result.metadata?.annotations?.hasOwnProperty(key)) { + throw new Error( + `An annotation may not have the key ${key}, because it has reserved meaning`, + ); + } + } + + return result; + } +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/descriptors/types.ts b/frontend/plugins/catalog-backend/src/ingestion/descriptors/types.ts new file mode 100644 index 0000000..92b5fda --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/descriptors/types.ts @@ -0,0 +1,38 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { DescriptorEnvelope } from '../types'; + +/** + * Parses and validates a single envelope into its materialized kind. + * + * These parsers may assume that the envelope is already validated and well + * formed. + */ +export type KindParser = { + /** + * Try to parse an envelope into a materialized kind. + * + * @param envelope A valid descriptor envelope + * @returns A materialized type, or undefined if the given version/kind is + * not meant to be handled by this parser + * @throws An Error if the type was handled and found to not be properly + * formatted + */ + tryParse( + envelope: DescriptorEnvelope, + ): Promise; +}; diff --git a/frontend/plugins/catalog-backend/src/ingestion/index.ts b/frontend/plugins/catalog-backend/src/ingestion/index.ts new file mode 100644 index 0000000..ca6f2dd --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/index.ts @@ -0,0 +1,19 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './DescriptorParsers'; +export * from './LocationReaders'; +export * from './types'; diff --git a/frontend/plugins/catalog-backend/src/ingestion/sources/FileLocationSource.ts b/frontend/plugins/catalog-backend/src/ingestion/sources/FileLocationSource.ts new file mode 100644 index 0000000..67d889e --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/sources/FileLocationSource.ts @@ -0,0 +1,37 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import fs from 'fs-extra'; +import { ReaderOutput } from '../types'; +import { LocationSource } from './types'; +import { readDescriptorYaml } from './util'; + +export class FileLocationSource implements LocationSource { + async read(target: string): Promise { + let rawYaml; + try { + rawYaml = await fs.readFile(target, 'utf8'); + } catch (e) { + throw new Error(`Unable to read "${target}", ${e}`); + } + + try { + return readDescriptorYaml(rawYaml); + } catch (e) { + throw new Error(`Malformed descriptor at "${target}", ${e}`); + } + } +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/sources/types.ts b/frontend/plugins/catalog-backend/src/ingestion/sources/types.ts new file mode 100644 index 0000000..c078693 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/sources/types.ts @@ -0,0 +1,28 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { ReaderOutput } from '../types'; + +export type LocationSource = { + /** + * Reads the contents of a single location. + * + * @param target The location target to read + * @returns The parsed contents, as an array of unverified descriptors + * @throws An error if the location target could not be read + */ + read(target: string): Promise; +}; diff --git a/frontend/plugins/catalog-backend/src/ingestion/sources/util.ts b/frontend/plugins/catalog-backend/src/ingestion/sources/util.ts new file mode 100644 index 0000000..cccbeb9 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/sources/util.ts @@ -0,0 +1,55 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import yaml from 'yaml'; +import { ReaderOutput } from '../types'; + +export function readDescriptorYaml(data: string): ReaderOutput[] { + let documents; + try { + documents = yaml.parseAllDocuments(data); + } catch (e) { + throw new Error(`Could not parse YAML data, ${e}`); + } + + const result: ReaderOutput[] = []; + + for (const document of documents) { + if (document.contents) { + if (document.errors?.length) { + result.push({ + type: 'error', + error: new Error(`Malformed YAML document, ${document.errors[0]}`), + }); + } else { + const json = document.toJSON(); + if (typeof json !== 'object' || Array.isArray(json)) { + result.push({ + type: 'error', + error: new Error(`Malformed descriptor, expected object at root`), + }); + } else { + result.push({ + type: 'data', + data: json, + }); + } + } + } + } + + return result; +} diff --git a/frontend/plugins/catalog-backend/src/ingestion/types.ts b/frontend/plugins/catalog-backend/src/ingestion/types.ts new file mode 100644 index 0000000..5281773 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/ingestion/types.ts @@ -0,0 +1,180 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { ComponentDescriptorV1beta1 } from './descriptors/ComponentDescriptorV1beta1Parser'; + +export type ComponentDescriptor = ComponentDescriptorV1beta1; + +/** + * The format envelope that's common to all versions/kinds. + * + * @see https://kubernetes.io/docs/concepts/overview/working-with-objects/kubernetes-objects/ + */ +export type DescriptorEnvelope = { + /** + * The version of specification format for this particular entity that + * this is written against. + */ + apiVersion: string; + + /** + * The high level entity type being described. + */ + kind: string; + + /** + * Optional metadata related to the entity. + * + * @see https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.18/#objectmeta-v1-meta + */ + metadata?: { + /** + * A globally unique ID for the entity. + * + * This field can not be set by the user at creation time, and the server + * will reject an attempt to do so. The field will be populated in read + * operations. The field can (optionally) be specified when performing + * update or delete operations, but the server is free to reject requests + * that do so in such a way that it breaks semantics. + */ + uid?: string; + + /** + * An opaque string that changes for each update operation to any part of + * the entity, including metadata. + * + * This field can not be set by the user at creation time, and the server + * will reject an attempt to do so. The field will be populated in read + * operations. The field can (optionally) be specified when performing + * update or delete operations, and the server will then reject the + * operation if it does not match the current stored value. + */ + etag?: string; + + /** + * A positive nonzero number that indicates the current generation of data + * for this entity; the value is incremented each time the spec changes. + * + * This field can not be set by the user at creation time, and the server + * will reject an attempt to do so. The field will be populated in read + * operations. + */ + generation?: number; + + /** + * The name of the entity. + * + * Must be uniqe within the catalog at any given point in time, for any + * given namespace, for any given kind. + */ + name?: string; + + /** + * The namespace that the entity belongs to. + */ + namespace?: string; + + /** + * Key/value pairs of identifying information attached to the entity. + */ + labels?: object; + + /** + * Key/value pairs of non-identifying auxiliary information attached to the + * entity. + */ + annotations?: object; + }; + + /** + * The specification data describing the entity itself. + */ + spec?: object; +}; + +/** + * Parses and validates descriptors. + * + * The output must be validated and well formed. + */ +export type DescriptorParser = { + /** + * Parses and validates a single raw descriptor. + * + * @param descriptor A raw descriptor object + * @returns A structure describing the parsed and validated descriptor + * @throws An Error if the descriptor was malformed + */ + parse(descriptor: object): Promise; +}; + +/** + * Parses and validates a single envelope into its materialized kind. + * + * These parsers may assume that the envelope is already validated and well + * formed. + */ +export type KindParser = { + /** + * Try to parse an envelope into a materialized kind. + * + * @param envelope A valid descriptor envelope + * @returns A materialized type, or undefined if the given version/kind is + * not meant to be handled by this parser + * @throws An Error if the type was handled and found to not be properly + * formatted + */ + tryParse( + envelope: DescriptorEnvelope, + ): Promise; +}; + +export class ParserError extends Error { + constructor(message?: string, private _entityName?: string | undefined) { + super(message); + } + get entityName() { + return this._entityName; + } +} + +export type ReaderOutput = + | { type: 'error'; error: Error } + | { type: 'data'; data: object }; + +export type LocationReader = { + /** + * Reads the contents of a single location. + * + * @param type The type of location to read + * @param target The location target (type-specific) + * @returns The parsed contents, as an array of unverified descriptors or + * errors where the individual documents could not be parsed. + * @throws An error if the location as a whole could not be read + */ + read(type: string, target: string): Promise; +}; + +export type LocationSource = { + /** + * Reads the contents of a single location. + * + * @param target The location target to read + * @returns The parsed contents, as an array of unverified descriptors + * @throws An error if the location target could not be read + */ + read(target: string): Promise; +}; diff --git a/frontend/plugins/catalog-backend/src/run.ts b/frontend/plugins/catalog-backend/src/run.ts new file mode 100644 index 0000000..f484516 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/run.ts @@ -0,0 +1,33 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { getRootLogger } from '@backstage/backend-common'; +import yn from 'yn'; +import { startStandaloneServer } from './service/standaloneServer'; + +const port = process.env.PLUGIN_PORT ? Number(process.env.PLUGIN_PORT) : 3003; +const enableCors = yn(process.env.PLUGIN_CORS, { default: false }); +const logger = getRootLogger(); + +startStandaloneServer({ port, enableCors, logger }).catch(err => { + logger.error(err); + process.exit(1); +}); + +process.on('SIGINT', () => { + logger.info('CTRL+C pressed; exiting.'); + process.exit(0); +}); diff --git a/frontend/plugins/catalog-backend/src/service/router.ts b/frontend/plugins/catalog-backend/src/service/router.ts new file mode 100644 index 0000000..5bcf58b --- /dev/null +++ b/frontend/plugins/catalog-backend/src/service/router.ts @@ -0,0 +1,78 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import express from 'express'; +import Router from 'express-promise-router'; +import { Logger } from 'winston'; +import { + addLocationSchema, + EntitiesCatalog, + LocationsCatalog, +} from '../catalog'; +import { validateRequestBody } from './util'; + +export interface RouterOptions { + entitiesCatalog?: EntitiesCatalog; + locationsCatalog?: LocationsCatalog; + logger: Logger; +} + +export async function createRouter( + options: RouterOptions, +): Promise { + const { entitiesCatalog, locationsCatalog } = options; + const router = Router(); + + if (entitiesCatalog) { + // Entities + router + .get('/entities', async (_req, res) => { + const entities = await entitiesCatalog.entities(); + res.status(200).send(entities); + }) + .get('/entities/:id', async (req, res) => { + const { id } = req.params; + const entity = await entitiesCatalog.entity(id); + res.status(200).send(entity); + }); + } + + // Locations + if (locationsCatalog) { + router + .post('/locations', async (req, res) => { + const input = await validateRequestBody(req, addLocationSchema); + const output = await locationsCatalog.addLocation(input); + res.status(201).send(output); + }) + .get('/locations', async (_req, res) => { + const output = await locationsCatalog.locations(); + res.status(200).send(output); + }) + .get('/locations/:id', async (req, res) => { + const { id } = req.params; + const output = await locationsCatalog.location(id); + res.status(200).send(output); + }) + .delete('/locations/:id', async (req, res) => { + const { id } = req.params; + await locationsCatalog.removeLocation(id); + res.status(200).send(); + }); + } + + return router; +} diff --git a/frontend/plugins/catalog-backend/src/service/standaloneApplication.ts b/frontend/plugins/catalog-backend/src/service/standaloneApplication.ts new file mode 100644 index 0000000..126806c --- /dev/null +++ b/frontend/plugins/catalog-backend/src/service/standaloneApplication.ts @@ -0,0 +1,58 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { + errorHandler, + notFoundHandler, + requestLoggingHandler, +} from '@backstage/backend-common'; +import compression from 'compression'; +import cors from 'cors'; +import express from 'express'; +import helmet from 'helmet'; +import { Logger } from 'winston'; +import { EntitiesCatalog, LocationsCatalog } from '../catalog'; +import { createRouter } from './router'; + +export interface ApplicationOptions { + enableCors: boolean; + entitiesCatalog: EntitiesCatalog; + locationsCatalog?: LocationsCatalog; + logger: Logger; +} + +export async function createStandaloneApplication( + options: ApplicationOptions, +): Promise { + const { enableCors, entitiesCatalog, locationsCatalog, logger } = options; + const app = express(); + + app.use(helmet()); + if (enableCors) { + app.use(cors()); + } + app.use(compression()); + app.use(express.json()); + app.use(requestLoggingHandler()); + app.use( + '/', + await createRouter({ entitiesCatalog, locationsCatalog, logger }), + ); + app.use(notFoundHandler()); + app.use(errorHandler()); + + return app; +} diff --git a/frontend/plugins/catalog-backend/src/service/standaloneServer.ts b/frontend/plugins/catalog-backend/src/service/standaloneServer.ts new file mode 100644 index 0000000..2fd4afc --- /dev/null +++ b/frontend/plugins/catalog-backend/src/service/standaloneServer.ts @@ -0,0 +1,67 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { Server } from 'http'; +import { Logger } from 'winston'; +import { StaticEntitiesCatalog } from '../catalog'; +import { createStandaloneApplication } from './standaloneApplication'; + +export interface ServerOptions { + port: number; + enableCors: boolean; + logger: Logger; +} + +export async function startStandaloneServer( + options: ServerOptions, +): Promise { + const logger = options.logger.child({ service: 'catalog-backend' }); + + const entitiesCatalog = new StaticEntitiesCatalog([ + { + apiVersion: 'backstage.io/v1beta1', + kind: 'Component', + metadata: { name: 'c1' }, + spec: { type: 'service' }, + }, + { + apiVersion: 'backstage.io/v1beta1', + kind: 'Component', + metadata: { name: 'c2' }, + spec: { type: 'service' }, + }, + ]); + + logger.debug('Creating application...'); + const app = await createStandaloneApplication({ + enableCors: options.enableCors, + entitiesCatalog, + logger, + }); + + logger.debug('Starting application server...'); + return await new Promise((resolve, reject) => { + const server = app.listen(options.port, (err?: Error) => { + if (err) { + reject(err); + return; + } + + logger.info(`Listening on port ${options.port}`); + resolve(server); + }); + }); +} diff --git a/frontend/plugins/catalog-backend/src/service/util.ts b/frontend/plugins/catalog-backend/src/service/util.ts new file mode 100644 index 0000000..4c37154 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/service/util.ts @@ -0,0 +1,44 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { InputError } from '@backstage/backend-common'; +import { Request } from 'express'; +import yup from 'yup'; + +export async function validateRequestBody( + req: Request, + schema: yup.Schema, +): Promise { + const contentType = req.header('content-type'); + if (!contentType) { + throw new InputError('Content-Type missing'); + } else if (!contentType.match(/^application\/json($|;)/)) { + throw new InputError('Illegal Content-Type'); + } + + const body = req.body; + if (!body) { + throw new InputError('Missing request body'); + } + + try { + await schema.validate(body, { strict: true }); + } catch (e) { + throw new InputError(`Malformed request: ${e}`); + } + + return body as T; +} diff --git a/frontend/plugins/catalog-backend/src/setupTests.ts b/frontend/plugins/catalog-backend/src/setupTests.ts new file mode 100644 index 0000000..3fa7cb0 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/setupTests.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/catalog-backend/src/util/index.ts b/frontend/plugins/catalog-backend/src/util/index.ts new file mode 100644 index 0000000..6f0505d --- /dev/null +++ b/frontend/plugins/catalog-backend/src/util/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './runPeriodically'; diff --git a/frontend/plugins/catalog-backend/src/util/runPeriodically.ts b/frontend/plugins/catalog-backend/src/util/runPeriodically.ts new file mode 100644 index 0000000..2f65d0e --- /dev/null +++ b/frontend/plugins/catalog-backend/src/util/runPeriodically.ts @@ -0,0 +1,54 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +/** + * Runs a function repeatedly, with a fixed wait between invocations. + * + * Supports async functions, and silently ignores exceptions and rejections. + * + * @param fn The function to run. May return a Promise. + * @param delayMs The delay between a completed function invocation and the + * next. + * @returns A function that, when called, stops the invocation loop. + */ +export function runPeriodically(fn: () => any, delayMs: number): () => void { + let cancel: () => void; + let cancelled = false; + const cancellationPromise = new Promise(resolve => { + cancel = () => { + resolve(); + cancelled = true; + }; + }); + + const startRefresh = async () => { + while (!cancelled) { + try { + await fn(); + } catch { + // ignore intentionally + } + + await Promise.race([ + new Promise(resolve => setTimeout(resolve, delayMs)), + cancellationPromise, + ]); + } + }; + startRefresh(); + + return cancel!; +} diff --git a/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.test.ts b/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.test.ts new file mode 100644 index 0000000..200e90b --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.test.ts @@ -0,0 +1,178 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { CommonValidatorFunctions } from './CommonValidatorFunctions'; + +describe('CommonValidatorFunctions', () => { + describe('isValidPrefixAndOrSuffix', () => { + it('only accepts strings', () => { + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + null, + '/', + () => true, + () => true, + ), + ).toBe(false); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 7, + '/', + () => true, + () => true, + ), + ).toBe(false); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + () => 'hello', + '/', + () => true, + () => true, + ), + ).toBe(false); + }); + + it('only accepts one or two parts', () => { + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a', + '/', + () => true, + () => true, + ), + ).toBe(true); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a/b', + '/', + () => true, + () => true, + ), + ).toBe(true); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a/b/c', + '/', + () => true, + () => true, + ), + ).toBe(false); + }); + + it('checks the prefix and suffix', () => { + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a/b', + '/', + () => true, + () => true, + ), + ).toBe(true); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a/b', + '/', + () => false, + () => true, + ), + ).toBe(false); + expect( + CommonValidatorFunctions.isValidPrefixAndOrSuffix( + 'a/b', + '/', + () => true, + () => false, + ), + ).toBe(false); + }); + }); + + it.each([ + [null, true], + [undefined, false], + [1, true], + ['a', true], + [() => 'a', false], + [Symbol('a'), false], + [[], true], + [[1], true], + [[undefined], false], + [{}, true], + [{ a: 1 }, true], + [{ a: undefined }, false], + ] as [any, boolean][])(`isJsonSafe %p ? %p`, (value, result) => { + expect(CommonValidatorFunctions.isJsonSafe(value)).toBe(result); + }); + + it.each([ + [null, false], + [7, false], + ['', false], + ['a', true], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', false], + ['adam.bertil.caesar', true], + ['adam.ber-til.caesar', true], + ['adam.-bertil.caesar', false], + ['adam.bertil-.caesar', false], + ['adam/bertil.caesar', false], + [`a.${'b'.repeat(63)}.c`, true], + [`a.${'b'.repeat(64)}.c`, false], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(61)}`, + true, + ], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(62)}`, + false, + ], + ])(`isValidDnsSubdomain %p ? %p`, (value, result) => { + expect(CommonValidatorFunctions.isValidDnsSubdomain(value)).toBe(result); + }); + + it.each([ + [null, false], + [7, false], + ['', false], + ['a', true], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', false], + [`${'a'.repeat(63)}`, true], + [`${'a'.repeat(64)}`, false], + ])(`isValidDnsLabel %p ? %p`, (value, result) => { + expect(CommonValidatorFunctions.isValidDnsLabel(value)).toBe(result); + }); + + it.each([ + ['', ''], + ['a', 'a'], + ['a-b', 'ab'], + ['-a-b', 'ab'], + ['a_b', 'ab'], + [`${'a'.repeat(6000)}`, `${'a'.repeat(6000)}`], + ['_:;>!"#€', ''], + ])(`normalizeToLowercaseAlphanum %p ? %p`, (value, result) => { + expect(CommonValidatorFunctions.normalizeToLowercaseAlphanum(value)).toBe( + result, + ); + }); +}); diff --git a/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.ts b/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.ts new file mode 100644 index 0000000..96a91ac --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/CommonValidatorFunctions.ts @@ -0,0 +1,108 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import lodash from 'lodash'; + +/** + * Contains various helper validation and normalization functions that can be + * composed to form a Validator. + */ +export class CommonValidatorFunctions { + /** + * Checks that the value is on the form or , and validates + * those parts separately. + * + * @param value The value to check + * @param separator The separator between parts + * @param isValidPrefix Checks that the part before the separator is valid, if present + * @param isValidSuffix Checks that the part after the separator (or the entire value if there is no separator) is valid + */ + static isValidPrefixAndOrSuffix( + value: any, + separator: string, + isValidPrefix: (value: string) => boolean, + isValidSuffix: (value: string) => boolean, + ): boolean { + if (typeof value !== 'string') { + return false; + } + + const parts = value.split(separator); + if (parts.length === 1) { + return isValidSuffix(parts[0]); + } else if (parts.length === 2) { + return isValidPrefix(parts[0]) && isValidSuffix(parts[1]); + } + + return false; + } + + /** + * Checks that the value can be safely transferred as JSON. + * + * @param value The value to check + */ + static isJsonSafe(value: any): boolean { + try { + return lodash.isEqual(value, JSON.parse(JSON.stringify(value))); + } catch { + return false; + } + } + + /** + * Checks that the value is a valid DNS subdomain name. + * + * @param value The value to check + * @see https://tools.ietf.org/html/rfc1123 + */ + static isValidDnsSubdomain(value: any): boolean { + return ( + typeof value === 'string' && + value.length >= 1 && + value.length <= 253 && + value.split('.').every(CommonValidatorFunctions.isValidDnsLabel) + ); + } + + /** + * Checks that the value is a valid DNS label. + * + * @param value The value to check + * @see https://tools.ietf.org/html/rfc1123 + */ + static isValidDnsLabel(value: any): boolean { + return ( + typeof value === 'string' && + value.length >= 1 && + value.length <= 63 && + /^[a-z0-9]+(\-[a-z0-9]+)*$/.test(value) + ); + } + + /** + * Normalizes by keeping only a-z, A-Z, and 0-9; and converts to lowercase. + * + * @param value The value to normalize + */ + static normalizeToLowercaseAlphanum(value: string): string { + return value + .split('') + .filter(x => /[a-zA-Z0-9]/.test(x)) + .join('') + .toLowerCase(); + } +} diff --git a/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.test.ts b/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.test.ts new file mode 100644 index 0000000..d067308 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.test.ts @@ -0,0 +1,209 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { KubernetesValidatorFunctions } from './KubernetesValidatorFunctions'; + +describe('KubernetesValidatorFunctions', () => { + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', true], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a-b', false], + ['a_b', false], + ['a.b', false], + ['a/a', true], + ['a/aAb5C', true], + ['a-b.c/v1', true], + ['a--b.c/v1', false], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 61, + )}/v1`, + true, + ], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 62, + )}/v1`, + false, + ], + [`a/${'a'.repeat(63)}`, true], + [`a/${'a'.repeat(64)}`, false], + ])(`isValidApiVersion %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidApiVersion(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', true], + ['9AZ', false], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a-b', false], + ])(`isValidKind %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidKind(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', true], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a/b', false], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', true], + ['a.b', true], + ])(`isValidObjectName %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidObjectName(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', false], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a/b', false], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', false], + ['a.b', false], + ])(`isValidNamespace %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidNamespace(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', true], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a/b', true], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', true], + ['a.b', true], + ['a/a', true], + ['a-b.c/a', true], + ['a--b.c/a', false], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 61, + )}/a`, + true, + ], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 62, + )}/a`, + false, + ], + [`a/${'a'.repeat(63)}`, true], + [`a/${'a'.repeat(64)}`, false], + ])(`isValidLabelKey %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidLabelKey(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', true], + ['a', true], + ['AZ09', true], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a/b', false], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', true], + ['a.b', true], + ])(`isValidLabelValue %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidLabelValue(value)).toBe(matches); + }); + + it.each([ + [7, false], + [null, false], + ['', false], + ['a', true], + ['AZ09', true], + ['a'.repeat(63), true], + ['a'.repeat(64), false], + ['a/b', true], + ['a-b', true], + ['-a-b', false], + ['a-b-', false], + ['a--b', false], + ['a_b', true], + ['a.b', true], + ['a/a', true], + ['a-b.c/a', true], + ['a--b.c/a', false], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 61, + )}/a`, + true, + ], + [ + `${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat(63)}.${'a'.repeat( + 62, + )}/a`, + false, + ], + [`a/${'a'.repeat(63)}`, true], + [`a/${'a'.repeat(64)}`, false], + ])(`isValidAnnotationKey %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidAnnotationKey(value)).toBe( + matches, + ); + }); + + it.each([ + [7, false], + [null, false], + ['', true], + ['a', true], + ['/'.repeat(6000), true], + ])(`isValidAnnotationValue %p ? %p`, (value, matches) => { + expect(KubernetesValidatorFunctions.isValidAnnotationValue(value)).toBe( + matches, + ); + }); +}); diff --git a/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.ts b/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.ts new file mode 100644 index 0000000..fa938f5 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/KubernetesValidatorFunctions.ts @@ -0,0 +1,86 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { CommonValidatorFunctions } from './CommonValidatorFunctions'; + +/** + * Contains validation functions that match the Kubernetes spec, usable to + * build a catalog that is compatible with those rule sets. + * + * @see https://kubernetes.io/docs/concepts/overview/working-with-objects/names/ + * @see https://kubernetes.io/docs/concepts/overview/working-with-objects/labels/#syntax-and-character-set + * @see https://kubernetes.io/docs/concepts/overview/working-with-objects/annotations/#syntax-and-character-set + */ +export class KubernetesValidatorFunctions { + static isValidApiVersion(value: any): boolean { + return CommonValidatorFunctions.isValidPrefixAndOrSuffix( + value, + '/', + CommonValidatorFunctions.isValidDnsSubdomain, + n => n.length >= 1 && n.length <= 63 && /^[a-z0-9A-Z]+$/.test(n), + ); + } + + static isValidKind(value: any): boolean { + return ( + typeof value === 'string' && + value.length >= 1 && + value.length <= 63 && + /^[a-zA-Z][a-z0-9A-Z]*$/.test(value) + ); + } + + static isValidObjectName(value: any): boolean { + return ( + typeof value === 'string' && + value.length >= 1 && + value.length <= 63 && + /^[a-z0-9A-Z]+([-_.][a-z0-9A-Z]+)*$/.test(value) + ); + } + + static isValidNamespace(value: any): boolean { + return CommonValidatorFunctions.isValidDnsLabel(value); + } + + static isValidLabelKey(value: any): boolean { + return CommonValidatorFunctions.isValidPrefixAndOrSuffix( + value, + '/', + CommonValidatorFunctions.isValidDnsSubdomain, + KubernetesValidatorFunctions.isValidObjectName, + ); + } + + static isValidLabelValue(value: any): boolean { + return ( + value === '' || KubernetesValidatorFunctions.isValidObjectName(value) + ); + } + + static isValidAnnotationKey(value: any): boolean { + return CommonValidatorFunctions.isValidPrefixAndOrSuffix( + value, + '/', + CommonValidatorFunctions.isValidDnsSubdomain, + KubernetesValidatorFunctions.isValidObjectName, + ); + } + + static isValidAnnotationValue(value: any): boolean { + return typeof value === 'string'; + } +} diff --git a/frontend/plugins/catalog-backend/src/validation/index.ts b/frontend/plugins/catalog-backend/src/validation/index.ts new file mode 100644 index 0000000..be607e4 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/index.ts @@ -0,0 +1,20 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './CommonValidatorFunctions'; +export * from './KubernetesValidatorFunctions'; +export * from './makeValidator'; +export * from './types'; diff --git a/frontend/plugins/catalog-backend/src/validation/makeValidator.ts b/frontend/plugins/catalog-backend/src/validation/makeValidator.ts new file mode 100644 index 0000000..7ca0136 --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/makeValidator.ts @@ -0,0 +1,38 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { CommonValidatorFunctions } from './CommonValidatorFunctions'; +import { KubernetesValidatorFunctions } from './KubernetesValidatorFunctions'; +import { Validators } from './types'; + +const defaultValidators: Validators = { + isValidApiVersion: KubernetesValidatorFunctions.isValidApiVersion, + isValidKind: KubernetesValidatorFunctions.isValidKind, + isValidEntityName: KubernetesValidatorFunctions.isValidObjectName, + isValidNamespace: KubernetesValidatorFunctions.isValidNamespace, + normalizeEntityName: CommonValidatorFunctions.normalizeToLowercaseAlphanum, + isValidLabelKey: KubernetesValidatorFunctions.isValidLabelKey, + isValidLabelValue: KubernetesValidatorFunctions.isValidLabelValue, + isValidAnnotationKey: KubernetesValidatorFunctions.isValidAnnotationKey, + isValidAnnotationValue: KubernetesValidatorFunctions.isValidAnnotationValue, +}; + +export function makeValidator(overrides: Partial = {}): Validators { + return { + ...defaultValidators, + ...overrides, + }; +} diff --git a/frontend/plugins/catalog-backend/src/validation/types.ts b/frontend/plugins/catalog-backend/src/validation/types.ts new file mode 100644 index 0000000..81209bf --- /dev/null +++ b/frontend/plugins/catalog-backend/src/validation/types.ts @@ -0,0 +1,27 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export type Validators = { + isValidApiVersion(value: any): boolean; + isValidKind(value: any): boolean; + isValidEntityName(value: any): boolean; + isValidNamespace(value: any): boolean; + normalizeEntityName(value: string): string; + isValidLabelKey(value: any): boolean; + isValidLabelValue(value: any): boolean; + isValidAnnotationKey(value: any): boolean; + isValidAnnotationValue(value: any): boolean; +}; diff --git a/frontend/plugins/catalog-backend/tsconfig.json b/frontend/plugins/catalog-backend/tsconfig.json new file mode 100644 index 0000000..015a967 --- /dev/null +++ b/frontend/plugins/catalog-backend/tsconfig.json @@ -0,0 +1,15 @@ +{ + "include": ["src"], + "compilerOptions": { + "outDir": "dist", + "incremental": true, + "sourceMap": true, + "declaration": true, + "strict": true, + "target": "es2019", + "module": "commonjs", + "esModuleInterop": true, + "lib": ["es2019"], + "types": ["node", "jest"] + } +} diff --git a/frontend/plugins/catalog/.eslintrc.js b/frontend/plugins/catalog/.eslintrc.js new file mode 100644 index 0000000..13573ef --- /dev/null +++ b/frontend/plugins/catalog/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], +}; diff --git a/frontend/plugins/catalog/README.md b/frontend/plugins/catalog/README.md new file mode 100644 index 0000000..52bbd0d --- /dev/null +++ b/frontend/plugins/catalog/README.md @@ -0,0 +1,13 @@ +# Catalog Frontend + +WORK IN PROGRESS + +This is the frontend part of the default catalog plugin. + +It will implement the core API for handling your catalog of software, and +supply the base views to show and manage them. + +## Links + +- (Backend part of the plugin)[https://github.com/spotify/backstage/tree/master/plugins/catalog-backend] +- (The Backstage homepage)[https://backstage.io] diff --git a/frontend/plugins/catalog/dev/index.tsx b/frontend/plugins/catalog/dev/index.tsx new file mode 100644 index 0000000..812a558 --- /dev/null +++ b/frontend/plugins/catalog/dev/index.tsx @@ -0,0 +1,20 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin } from '../src/plugin'; + +createDevApp().registerPlugin(plugin).render(); diff --git a/frontend/plugins/catalog/package.json b/frontend/plugins/catalog/package.json new file mode 100644 index 0000000..cd8548b --- /dev/null +++ b/frontend/plugins/catalog/package.json @@ -0,0 +1,45 @@ +{ + "name": "@backstage/plugin-catalog", + "version": "0.1.1-alpha.6", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "build": "backstage-cli plugin:build", + "start": "backstage-cli plugin:serve", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "diff": "backstage-cli plugin:diff", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "clean": "backstage-cli clean" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "@backstage/plugin-sentry": "^0.1.1-alpha.6", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@backstage/test-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.test.tsx b/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.test.tsx new file mode 100644 index 0000000..d018d59 --- /dev/null +++ b/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.test.tsx @@ -0,0 +1,39 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { render } from '@testing-library/react'; +import CatalogPage from './CatalogPage'; +import { ThemeProvider } from '@material-ui/core'; +import { lightTheme } from '@backstage/theme'; +import { ComponentFactory } from '../../data/component'; + +const testComponentFactory: ComponentFactory = { + getAllComponents: jest.fn(() => Promise.resolve([{ name: 'test' }])), + getComponentByName: jest.fn(() => Promise.resolve({ name: 'test' })), + removeComponentByName: jest.fn(() => Promise.resolve(true)), +}; + +describe('CatalogPage', () => { + it('should render', async () => { + const rendered = render( + + + , + ); + expect(await rendered.findByText('Your components')).toBeInTheDocument(); + }); +}); diff --git a/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.tsx b/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.tsx new file mode 100644 index 0000000..7889c5e --- /dev/null +++ b/frontend/plugins/catalog/src/components/CatalogPage/CatalogPage.tsx @@ -0,0 +1,42 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { Content, Header, Page, pageTheme } from '@backstage/core'; +import { useAsync } from 'react-use'; +import { ComponentFactory } from '../../data/component'; +import CatalogTable from '../CatalogTable/CatalogTable'; + +type CatalogPageProps = { + componentFactory: ComponentFactory; +}; +const CatalogPage: FC = ({ componentFactory }) => { + const { value, error, loading } = useAsync(componentFactory.getAllComponents); + return ( + +
+ + + + + ); +}; + +export default CatalogPage; diff --git a/frontend/plugins/catalog/src/components/CatalogPage/index.ts b/frontend/plugins/catalog/src/components/CatalogPage/index.ts new file mode 100644 index 0000000..61182e3 --- /dev/null +++ b/frontend/plugins/catalog/src/components/CatalogPage/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { default } from './CatalogPage'; diff --git a/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.test.tsx b/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.test.tsx new file mode 100644 index 0000000..0ab95f4 --- /dev/null +++ b/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.test.tsx @@ -0,0 +1,56 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import * as React from 'react'; +import { render } from '@testing-library/react'; +import CatalogTable from './CatalogTable'; +import { Component } from '../../data/component'; + +const components: Component[] = [ + { name: 'component1' }, + { name: 'component2' }, + { name: 'component3' }, +]; + +describe('CatalogTable component', () => { + it('should render loading when loading prop it set to true', async () => { + const rendered = render(); + const progress = await rendered.findByTestId('progress'); + expect(progress).toBeInTheDOM(); + }); + + it('should render error message when error is passed in props', async () => { + const rendered = render( + , + ); + const errorMessage = await rendered.findByText( + 'Error encountered while fetching components.', + ); + expect(errorMessage).toBeInTheDOM(); + }); + + it('should display component names when loading has finished and no error occurred', async () => { + const rendered = render( + , + ); + expect(await rendered.findByText('component1')).toBeInTheDOM(); + expect(await rendered.findByText('component2')).toBeInTheDOM(); + expect(await rendered.findByText('component3')).toBeInTheDOM(); + }); +}); diff --git a/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.tsx b/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.tsx new file mode 100644 index 0000000..ea23281 --- /dev/null +++ b/frontend/plugins/catalog/src/components/CatalogTable/CatalogTable.tsx @@ -0,0 +1,63 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { Component } from '../../data/component'; +import { InfoCard, Progress, Table, TableColumn } from '@backstage/core'; +import { Typography, Link } from '@material-ui/core'; + +const columns: TableColumn[] = [ + { + title: 'Name', + field: 'name', + highlight: true, + render: (componentData: any) => ( + {componentData.name} + ), + }, +]; + +type CatalogTableProps = { + components: Component[]; + loading: boolean; + error?: any; +}; +const CatalogTable: FC = ({ + components, + loading, + error, +}) => { + if (loading) { + return ; + } + if (error) { + return ( + + + Error encountered while fetching components. + + + ); + } + return ( + + ); +}; +export default CatalogTable; diff --git a/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.test.tsx b/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.test.tsx new file mode 100644 index 0000000..cd9bb95 --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.test.tsx @@ -0,0 +1,34 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import ComponentContextMenu from './ComponentContextMenu'; +import { render } from '@testing-library/react'; +import * as React from 'react'; +import { act } from 'react-dom/test-utils'; + +describe('ComponentContextMenu', () => { + it('should call onUnregisterComponent on button click', async () => { + await act(async () => { + const mockCallback = jest.fn(); + const menu = await render( + , + ); + const button = await menu.findByTestId('menu-button'); + button.click(); + const unregister = await menu.findByText('Unregister component'); + expect(unregister).toBeInTheDOM(); + }); + }); +}); diff --git a/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.tsx b/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.tsx new file mode 100644 index 0000000..674d979 --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentContextMenu/ComponentContextMenu.tsx @@ -0,0 +1,90 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC, useEffect, useRef, useState } from 'react'; +import { + IconButton, + ListItemIcon, + Menu, + MenuItem, + Typography, +} from '@material-ui/core'; +import Cancel from '@material-ui/icons/Cancel'; +import MoreVert from '@material-ui/icons/MoreVert'; +import SwapHoriz from '@material-ui/icons/SwapHoriz'; +import { makeStyles } from '@material-ui/core/styles'; + +const useStyles = makeStyles({ + menu: { + marginTop: 52, + }, +}); + +type ComponentContextMenuProps = { + onUnregisterComponent: () => void; +}; + +const ComponentContextMenu: FC = ({ + onUnregisterComponent, +}) => { + const [menuOpen, setMenuOpen] = useState(false); + const menuAnchor = useRef(null); + const classes = useStyles(); + + useEffect(() => { + const globalCloseHandler = (event: any) => { + const menu = menuAnchor.current; + if (menu !== null && !menu.contains(event.target)) { + setMenuOpen(false); + } + }; + + window.addEventListener('click', globalCloseHandler); + return () => window.removeEventListener('click', globalCloseHandler); + }, [menuOpen]); + + return ( +
+ setMenuOpen(!menuOpen)} + data-testid="menu-button" + > + + + + + + + + Unregister component + + + + + + More repository + + +
+ ); +}; +export default ComponentContextMenu; diff --git a/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.test.tsx b/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.test.tsx new file mode 100644 index 0000000..e190ee6 --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.test.tsx @@ -0,0 +1,37 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React from 'react'; +import ComponentMetadataCard from './ComponentMetadataCard'; +import { Component } from '../../data/component'; +import { render } from '@testing-library/react'; + +describe('ComponentMetadataCard component', () => { + it('should display component name if provided', async () => { + const testComponent: Component = { + name: 'test', + }; + const rendered = await render( + , + ); + expect(await rendered.findByText('test')).toBeInTheDOM(); + }); + it('should display loader when loading is set to true', async () => { + const rendered = await render( + , + ); + expect(await rendered.findByRole('progressbar')).toBeInTheDOM(); + }); +}); diff --git a/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.tsx b/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.tsx new file mode 100644 index 0000000..7059709 --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentMetadataCard/ComponentMetadataCard.tsx @@ -0,0 +1,44 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { Component } from '../../data/component'; +import { Progress, InfoCard, StructuredMetadataTable } from '@backstage/core'; + +type ComponentMetadataCardProps = { + loading: boolean; + component: Component | undefined; +}; +const ComponentMetadataCard: FC = ({ + loading, + component, +}) => { + if (loading) { + return ( + + + + ); + } + if (!component) { + return null; + } + return ( + + + + ); +}; +export default ComponentMetadataCard; diff --git a/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.test.tsx b/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.test.tsx new file mode 100644 index 0000000..369b80d --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.test.tsx @@ -0,0 +1,70 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import ComponentPage from './ComponentPage'; +import { render } from '@testing-library/react'; +import * as React from 'react'; +import { wrapInTheme } from '@backstage/test-utils'; +import { act } from 'react-dom/test-utils'; +import { ApiProvider, ApiRegistry, errorApiRef } from '@backstage/core'; + +const getTestProps = (componentName: string) => { + return { + match: { + params: { + name: componentName, + }, + }, + history: { + push: jest.fn(), + }, + componentFactory: { + getAllComponents: jest.fn(() => Promise.resolve([{ name: 'test' }])), + getComponentByName: jest.fn(() => Promise.resolve({ name: 'test' })), + removeComponentByName: jest.fn(() => Promise.resolve(true)), + }, + }; +}; + +const errorApi = { post: () => {} }; + +describe('ComponentPage', () => { + it('should redirect to component table page when name is not provided', async () => { + const props = getTestProps(''); + await render( + wrapInTheme( + + + , + ), + ); + expect(props.history.push).toHaveBeenCalledWith('/catalog'); + }); + it('should use factory to fetch component by name and display it', async () => { + await act(async () => { + const props = getTestProps('test'); + await render( + wrapInTheme( + + + , + ), + ); + expect(props.componentFactory.getComponentByName).toHaveBeenCalledWith( + 'test', + ); + }); + }); +}); diff --git a/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.tsx b/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.tsx new file mode 100644 index 0000000..0cf7017 --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentPage/ComponentPage.tsx @@ -0,0 +1,117 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC, useEffect, useState } from 'react'; +import { useAsync } from 'react-use'; +import { ComponentFactory } from '../../data/component'; +import ComponentMetadataCard from '../ComponentMetadataCard/ComponentMetadataCard'; +import { + Content, + Header, + pageTheme, + Page, + useApi, + ErrorApi, + errorApiRef, +} from '@backstage/core'; +import ComponentContextMenu from '../ComponentContextMenu/ComponentContextMenu'; +import ComponentRemovalDialog from '../ComponentRemovalDialog/ComponentRemovalDialog'; +import { SentryIssuesWidget } from '@backstage/plugin-sentry'; +import { Grid } from '@material-ui/core'; + +const REDIRECT_DELAY = 1000; + +type ComponentPageProps = { + componentFactory: ComponentFactory; + match: { + params: { + name: string; + }; + }; + history: { + push: (url: string) => void; + }; +}; + +const ComponentPage: FC = ({ + match, + history, + componentFactory, +}) => { + const [confirmationDialogOpen, setConfirmationDialogOpen] = useState(false); + const [removingPending, setRemovingPending] = useState(false); + const showRemovalDialog = () => setConfirmationDialogOpen(true); + const hideRemovalDialog = () => setConfirmationDialogOpen(false); + const componentName = match.params.name; + const errorApi = useApi(errorApiRef); + + if (componentName === '') { + history.push('/catalog'); + return null; + } + + const catalogRequest = useAsync(() => + componentFactory.getComponentByName(match.params.name), + ); + + useEffect(() => { + if (catalogRequest.error) { + errorApi.post(new Error('Component not found!')); + setTimeout(() => { + history.push('/catalog'); + }, REDIRECT_DELAY); + } + }, [catalogRequest.error]); + + const removeComponent = async () => { + setConfirmationDialogOpen(false); + setRemovingPending(true); + await componentFactory.removeComponentByName(componentName); + history.push('/catalog'); + }; + + return ( + +
+ +
+ {confirmationDialogOpen && catalogRequest.value && ( + + )} + + + + + + + + + + +
+ ); +}; +export default ComponentPage; diff --git a/frontend/plugins/catalog/src/components/ComponentRemovalDialog/ComponentRemovalDialog.tsx b/frontend/plugins/catalog/src/components/ComponentRemovalDialog/ComponentRemovalDialog.tsx new file mode 100644 index 0000000..b5a863c --- /dev/null +++ b/frontend/plugins/catalog/src/components/ComponentRemovalDialog/ComponentRemovalDialog.tsx @@ -0,0 +1,65 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { + Button, + Dialog, + DialogActions, + DialogContent, + DialogContentText, + DialogTitle, + useMediaQuery, + useTheme, +} from '@material-ui/core'; +import { Component } from '../../data/component'; + +type ComponentRemovalDialogProps = { + onConfirm: () => any; + onCancel: () => any; + onClose: () => any; + component: Component; +}; +const ComponentRemovalDialog: FC = ({ + onConfirm, + onCancel, + onClose, + component, +}) => { + const theme = useTheme(); + const fullScreen = useMediaQuery(theme.breakpoints.down('sm')); + return ( + + + Are you sure you want to unregister this component? + + + + This action will unregister {component.name}. To undo, just + re-register the component in Backstage. + + + + + + + + ); +}; +export default ComponentRemovalDialog; diff --git a/frontend/plugins/catalog/src/data/component.ts b/frontend/plugins/catalog/src/data/component.ts new file mode 100644 index 0000000..ec6e236 --- /dev/null +++ b/frontend/plugins/catalog/src/data/component.ts @@ -0,0 +1,24 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export type Component = { + name: string; +}; + +export interface ComponentFactory { + getAllComponents(): Promise; + getComponentByName(name: string): Promise; + removeComponentByName(name: string): Promise; +} diff --git a/frontend/plugins/catalog/src/data/mock-factory-data.json b/frontend/plugins/catalog/src/data/mock-factory-data.json new file mode 100644 index 0000000..8fc61a8 --- /dev/null +++ b/frontend/plugins/catalog/src/data/mock-factory-data.json @@ -0,0 +1,35 @@ +[ + { + "name": "example.com" + }, + { + "name": "subdomain.example.com" + }, + { + "name": "subdomain2.example.com" + }, + { + "name": "User data pipeline 1" + }, + { + "name": "User data pipeline 2" + }, + { + "name": "User data pipeline 3" + }, + { + "name": "Aggregation CRON job" + }, + { + "name": "Authentication service" + }, + { + "name": "Payments service" + }, + { + "name": "Backstage supervisor" + }, + { + "name": "Identity service" + } +] diff --git a/frontend/plugins/catalog/src/data/mock-factory.ts b/frontend/plugins/catalog/src/data/mock-factory.ts new file mode 100644 index 0000000..bf39fa4 --- /dev/null +++ b/frontend/plugins/catalog/src/data/mock-factory.ts @@ -0,0 +1,48 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { Component, ComponentFactory } from './component'; +import mock from './mock-factory-data.json'; + +const ARTIFICIAL_TIMEOUT = 800; +let inMemoryStore = [...mock]; +export const MockComponentFactory: ComponentFactory = { + getAllComponents(): Promise { + return new Promise((resolve) => + setTimeout(() => resolve(inMemoryStore), ARTIFICIAL_TIMEOUT), + ); + }, + getComponentByName(name: string): Promise { + return new Promise((resolve, reject) => + setTimeout(() => { + const mockComponent = inMemoryStore.find( + (component) => component.name === name, + ); + if (mockComponent) return resolve(mockComponent); + return reject({ code: 'Component not found!' }); + }, ARTIFICIAL_TIMEOUT), + ); + }, + removeComponentByName(name: string): Promise { + return new Promise((resolve) => + setTimeout(() => { + inMemoryStore = inMemoryStore.filter( + (component) => component.name !== name, + ); + resolve(true); + }, ARTIFICIAL_TIMEOUT), + ); + }, +}; diff --git a/frontend/plugins/catalog/src/data/with-mock-store.tsx b/frontend/plugins/catalog/src/data/with-mock-store.tsx new file mode 100644 index 0000000..2e5425d --- /dev/null +++ b/frontend/plugins/catalog/src/data/with-mock-store.tsx @@ -0,0 +1,26 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import * as React from 'react'; +import { ComponentFactory } from './component'; +import { MockComponentFactory } from './mock-factory'; + +const componentFactory: ComponentFactory = MockComponentFactory; + +export const withMockStore = (Component: React.ElementType) => { + return (props: any) => ( + + ); +}; diff --git a/frontend/plugins/catalog/src/index.ts b/frontend/plugins/catalog/src/index.ts new file mode 100644 index 0000000..3a0a0fe --- /dev/null +++ b/frontend/plugins/catalog/src/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { plugin } from './plugin'; diff --git a/frontend/plugins/catalog/src/plugin.test.ts b/frontend/plugins/catalog/src/plugin.test.ts new file mode 100644 index 0000000..427efc3 --- /dev/null +++ b/frontend/plugins/catalog/src/plugin.test.ts @@ -0,0 +1,23 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { plugin } from './plugin'; + +describe('catalog', () => { + it('should export plugin', () => { + expect(plugin).toBeDefined(); + }); +}); diff --git a/frontend/plugins/catalog/src/plugin.ts b/frontend/plugins/catalog/src/plugin.ts new file mode 100644 index 0000000..456a6d2 --- /dev/null +++ b/frontend/plugins/catalog/src/plugin.ts @@ -0,0 +1,28 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createPlugin } from '@backstage/core'; +import CatalogPage from './components/CatalogPage'; +import ComponentPage from './components/ComponentPage/ComponentPage'; +import { withMockStore } from './data/with-mock-store'; + +export const plugin = createPlugin({ + id: 'catalog', + register({ router }) { + router.registerRoute('/catalog', withMockStore(CatalogPage)); + router.registerRoute('/catalog/:name/', withMockStore(ComponentPage)); + }, +}); diff --git a/frontend/plugins/catalog/src/setupTests.ts b/frontend/plugins/catalog/src/setupTests.ts new file mode 100644 index 0000000..e34bc46 --- /dev/null +++ b/frontend/plugins/catalog/src/setupTests.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import '@testing-library/jest-dom'; +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/circleci/.eslintrc.js b/frontend/plugins/circleci/.eslintrc.js new file mode 100644 index 0000000..13573ef --- /dev/null +++ b/frontend/plugins/circleci/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], +}; diff --git a/frontend/plugins/circleci/README.md b/frontend/plugins/circleci/README.md new file mode 100644 index 0000000..2dcc137 --- /dev/null +++ b/frontend/plugins/circleci/README.md @@ -0,0 +1,52 @@ +# CircleCI Plugin + +Website: [https://circleci.com/](https://circleci.com/) + + + + + + +## Setup + +0. If you have standalone app (you didn't clone this repo), then do + +```bash +yarn add @backstage/plugin-circleci +``` + +1. Add plugin API to your Backstage instance: + +```js +// packages/app/src/api.ts +import { ApiHolder } from '@backstage/core'; +import { CircleCIApi, circleCIApiRef } from '@backstage/plugin-circleci'; + +const builder = ApiRegistry.builder(); +builder.add(circleCIApiRef, new CircleCIApi(/* optional custom url for your own CircleCI instance */)); + +export default builder.build() as ApiHolder; +``` + +2. Add plugin itself: + +```js +// packages/app/src/plugins.ts +export { plugin as Circleci } from '@backstage/plugin-circleci'; +``` + +3. Run app with `yarn start` and navigate to `/circleci/settings` +4. Enter project settings and **project** token, acquired according to [https://circleci.com/docs/2.0/managing-api-tokens/](https://circleci.com/docs/2.0/managing-api-tokens/) + +## Features + +- List top 50 builds for a project +- Dive into one build to see logs +- Polling (logs only) +- Retry builds +- Works for both project and personal tokens +- Pagination for builds + +## Limitations + +- CircleCI has pretty strict rate limits per token, be careful with opened tabs diff --git a/frontend/plugins/circleci/dev/index.tsx b/frontend/plugins/circleci/dev/index.tsx new file mode 100644 index 0000000..ed7dd5d --- /dev/null +++ b/frontend/plugins/circleci/dev/index.tsx @@ -0,0 +1,28 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin } from '../src/plugin'; +import { circleCIApiRef, CircleCIApi } from '../src/api'; + +createDevApp() + .registerPlugin(plugin) + .registerApiFactory({ + deps: {}, + factory: () => new CircleCIApi(), + implements: circleCIApiRef, + }) + .render(); diff --git a/frontend/plugins/circleci/package.json b/frontend/plugins/circleci/package.json new file mode 100644 index 0000000..bbcac8e --- /dev/null +++ b/frontend/plugins/circleci/package.json @@ -0,0 +1,58 @@ +{ + "name": "@backstage/plugin-circleci", + "version": "0.1.1-alpha.6", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "proxy": { + "/circleci/api": { + "target": "https://circleci.com/api/v1.1", + "changeOrigin": true, + "pathRewrite": { + "^/circleci/api/": "/" + } + } + }, + "scripts": { + "build": "backstage-cli plugin:build", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "clean": "backstage-cli clean", + "diff": "backstage-cli plugin:diff", + "start": "backstage-cli plugin:serve", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "@types/react-lazylog": "^4.5.0", + "circleci-api": "^4.0.0", + "moment": "^2.25.3", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-lazylog": "^4.5.2", + "react-router": "^5.1.2", + "react-router-dom": "^5.1.2", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/circleci/src/api/index.ts b/frontend/plugins/circleci/src/api/index.ts new file mode 100644 index 0000000..f683f79 --- /dev/null +++ b/frontend/plugins/circleci/src/api/index.ts @@ -0,0 +1,76 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { + CircleCIOptions, + getMe, + getBuildSummaries, + getFullBuild, + postBuildActions, + BuildAction, + BuildWithSteps, + BuildStepAction, + BuildSummary, + GitType, +} from 'circleci-api'; +import { ApiRef } from '@backstage/core'; + +export { BuildWithSteps, BuildStepAction, BuildSummary, GitType }; + +export const circleCIApiRef = new ApiRef({ + id: 'plugin.circleci.service', + description: 'Used by the CircleCI plugin to make requests', +}); + +export class CircleCIApi { + apiUrl: string; + constructor(apiUrl: string = '/circleci/api') { + this.apiUrl = apiUrl; + } + + async retry(buildNumber: number, options: CircleCIOptions) { + return postBuildActions(options.token, buildNumber, BuildAction.RETRY, { + circleHost: this.apiUrl, + ...options.vcs, + }); + } + + async getBuilds( + { limit = 10, offset = 0 }: { limit: number; offset: number }, + options: CircleCIOptions, + ) { + return getBuildSummaries(options.token, { + options: { + limit, + offset, + }, + vcs: {}, + circleHost: this.apiUrl, + ...options, + }); + } + + async getUser(options: CircleCIOptions) { + return getMe(options.token, { circleHost: this.apiUrl, ...options }); + } + + async getBuild(buildNumber: number, options: CircleCIOptions) { + return getFullBuild(options.token, buildNumber, { + circleHost: this.apiUrl, + ...options.vcs, + }); + } +} diff --git a/frontend/plugins/circleci/src/assets/screenshot-1.png b/frontend/plugins/circleci/src/assets/screenshot-1.png new file mode 100644 index 0000000..2e3f1f4 Binary files /dev/null and b/frontend/plugins/circleci/src/assets/screenshot-1.png differ diff --git a/frontend/plugins/circleci/src/assets/screenshot-2.png b/frontend/plugins/circleci/src/assets/screenshot-2.png new file mode 100644 index 0000000..4e97cbc Binary files /dev/null and b/frontend/plugins/circleci/src/assets/screenshot-2.png differ diff --git a/frontend/plugins/circleci/src/assets/screenshot-3.png b/frontend/plugins/circleci/src/assets/screenshot-3.png new file mode 100644 index 0000000..ac20d58 Binary files /dev/null and b/frontend/plugins/circleci/src/assets/screenshot-3.png differ diff --git a/frontend/plugins/circleci/src/assets/screenshot-4.png b/frontend/plugins/circleci/src/assets/screenshot-4.png new file mode 100644 index 0000000..2d4ab5f Binary files /dev/null and b/frontend/plugins/circleci/src/assets/screenshot-4.png differ diff --git a/frontend/plugins/circleci/src/components/App.tsx b/frontend/plugins/circleci/src/components/App.tsx new file mode 100644 index 0000000..1649c01 --- /dev/null +++ b/frontend/plugins/circleci/src/components/App.tsx @@ -0,0 +1,60 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React from 'react'; +import { Switch, Route, MemoryRouter } from 'react-router'; +import { BuildsPage, Builds } from '../pages/BuildsPage'; +import { DetailedViewPage, BuildWithSteps } from '../pages/BuildWithStepsPage'; +import { AppStateProvider } from '../state'; +import { Settings } from './Settings'; + +export const App = () => { + return ( + + <> + + + + + + + + ); +}; + +// TODO: allow pass in settings as props +// When some shared settings workflow +// will be established +export const CircleCIWidget = () => ( + + + <> + + + + + + + + +); diff --git a/frontend/plugins/circleci/src/components/Layout/Layout.tsx b/frontend/plugins/circleci/src/components/Layout/Layout.tsx new file mode 100644 index 0000000..a614d38 --- /dev/null +++ b/frontend/plugins/circleci/src/components/Layout/Layout.tsx @@ -0,0 +1,37 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React from 'react'; +import { Header, Page, pageTheme, HeaderLabel } from '@backstage/core'; +import { Box } from '@material-ui/core'; + +export const Layout: React.FC = ({ children }) => { + return ( + +
+ Circle CI + + } + > + + +
+ {children} +
+ ); +}; diff --git a/frontend/plugins/circleci/src/components/Layout/index.ts b/frontend/plugins/circleci/src/components/Layout/index.ts new file mode 100644 index 0000000..236fc98 --- /dev/null +++ b/frontend/plugins/circleci/src/components/Layout/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export * from './Layout'; diff --git a/frontend/plugins/circleci/src/components/PluginHeader/PluginHeader.tsx b/frontend/plugins/circleci/src/components/PluginHeader/PluginHeader.tsx new file mode 100644 index 0000000..4bab4b5 --- /dev/null +++ b/frontend/plugins/circleci/src/components/PluginHeader/PluginHeader.tsx @@ -0,0 +1,55 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { Link as RouterLink, useLocation } from 'react-router-dom'; +import { ContentHeader, SupportButton } from '@backstage/core'; +import { Button, IconButton, Box, Typography } from '@material-ui/core'; +import ArrowBack from '@material-ui/icons/ArrowBack'; +import SettingsIcon from '@material-ui/icons/Settings'; +import { useSettings } from '../../state'; + +export type Props = { title?: string }; +export const PluginHeader: FC = ({ title = 'Circle CI' }) => { + const [, { showSettings }] = useSettings(); + const location = useLocation(); + const notRoot = !location.pathname.match(/\/circleci\/?$/); + const isSettingsPage = location.pathname.match(/\/circleci\/settings\/?/); + return ( + ( + + {notRoot && ( + + + + )} + {title} + + )} + > + {!isSettingsPage && ( + + )} + + This plugin allows you to view and interact with your builds within the + Circle CI environment. + + + ); +}; diff --git a/frontend/plugins/circleci/src/components/PluginHeader/index.ts b/frontend/plugins/circleci/src/components/PluginHeader/index.ts new file mode 100644 index 0000000..4de972f --- /dev/null +++ b/frontend/plugins/circleci/src/components/PluginHeader/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export * from './PluginHeader'; diff --git a/frontend/plugins/circleci/src/components/Settings/Settings.tsx b/frontend/plugins/circleci/src/components/Settings/Settings.tsx new file mode 100644 index 0000000..e853bb4 --- /dev/null +++ b/frontend/plugins/circleci/src/components/Settings/Settings.tsx @@ -0,0 +1,129 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { useState, useEffect } from 'react'; +import { + Button, + TextField, + List, + ListItem, + Snackbar, + Box, + Dialog, + DialogTitle, +} from '@material-ui/core'; +import { Alert } from '@material-ui/lab'; +import { useSettings } from '../../state'; + +const Settings = () => { + const [ + { + repo: repoFromStore, + owner: ownerFromStore, + token: tokenFromStore, + showSettings, + }, + { saveSettings, hideSettings }, + ] = useSettings(); + + const [token, setToken] = useState(() => tokenFromStore); + const [owner, setOwner] = useState(() => ownerFromStore); + const [repo, setRepo] = useState(() => repoFromStore); + + useEffect(() => { + if (tokenFromStore !== token) { + setToken(tokenFromStore); + } + if (ownerFromStore !== owner) { + setOwner(ownerFromStore); + } + if (repoFromStore !== repo) { + setRepo(repoFromStore); + } + }, [ownerFromStore, repoFromStore, tokenFromStore]); + + const [saved, setSaved] = useState(false); + + return ( + <> + setSaved(false)} + > + Credentials saved. + + + + Project Credentials + {/* {authed ? : } */} + + + + + setToken(e.target.value)} + /> + + + setOwner(e.target.value)} + /> + + + setRepo(e.target.value)} + /> + + + + + + + + + + + ); +}; + +export default Settings; diff --git a/frontend/plugins/circleci/src/components/Settings/index.ts b/frontend/plugins/circleci/src/components/Settings/index.ts new file mode 100644 index 0000000..c04ded6 --- /dev/null +++ b/frontend/plugins/circleci/src/components/Settings/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { default as Settings } from './Settings'; diff --git a/frontend/plugins/circleci/src/index.ts b/frontend/plugins/circleci/src/index.ts new file mode 100644 index 0000000..fd0360b --- /dev/null +++ b/frontend/plugins/circleci/src/index.ts @@ -0,0 +1,21 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { plugin } from './plugin'; +export * from './api'; +export * from './proxy'; +export * from './navTargets'; +export { CircleCIWidget } from './components/App'; diff --git a/frontend/plugins/circleci/src/navTargets.tsx b/frontend/plugins/circleci/src/navTargets.tsx new file mode 100644 index 0000000..ce45532 --- /dev/null +++ b/frontend/plugins/circleci/src/navTargets.tsx @@ -0,0 +1,38 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { createNavTarget } from '@backstage/core'; +import { SvgIcon, SvgIconProps } from '@material-ui/core'; + +const CircleCIIcon: FC = (props) => ( + + + +); + +export const navTargetCircleCI = createNavTarget({ + icon: CircleCIIcon, + path: '/circleci', + title: 'CircleCI', +}); diff --git a/frontend/plugins/circleci/src/pages/BuildWithStepsPage/BuildWithStepsPage.tsx b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/BuildWithStepsPage.tsx new file mode 100644 index 0000000..8493913 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/BuildWithStepsPage.tsx @@ -0,0 +1,166 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC, useEffect } from 'react'; +import { useParams } from 'react-router-dom'; +import { Content, InfoCard, Progress } from '@backstage/core'; +import { BuildWithSteps, BuildStepAction } from '../../api'; +import { Grid, Box, Link, IconButton } from '@material-ui/core'; +import { makeStyles } from '@material-ui/core/styles'; +import { PluginHeader } from '../../components/PluginHeader'; +import { ActionOutput } from './lib/ActionOutput/ActionOutput'; +import { Layout } from '../../components/Layout'; +import LaunchIcon from '@material-ui/icons/Launch'; +import { useSettings } from '../../state/useSettings'; +import { useBuildWithSteps } from '../../state/useBuildWithSteps'; + +const IconLink = IconButton as typeof Link; +const BuildName: FC<{ build?: BuildWithSteps }> = ({ build }) => ( + + #{build?.build_num} - {build?.subject} + + + + +); +const useStyles = makeStyles((theme) => ({ + neutral: {}, + failed: { + position: 'relative', + '&:after': { + pointerEvents: 'none', + content: '""', + position: 'absolute', + top: 0, + right: 0, + left: 0, + bottom: 0, + boxShadow: `inset 4px 0px 0px ${theme.palette.error.main}`, + }, + }, + running: { + position: 'relative', + '&:after': { + pointerEvents: 'none', + content: '""', + position: 'absolute', + top: 0, + right: 0, + left: 0, + bottom: 0, + boxShadow: `inset 4px 0px 0px ${theme.palette.info.main}`, + }, + }, + cardContent: { + backgroundColor: theme.palette.background.default, + }, + success: { + position: 'relative', + '&:after': { + pointerEvents: 'none', + content: '""', + position: 'absolute', + top: 0, + right: 0, + left: 0, + bottom: 0, + boxShadow: `inset 4px 0px 0px ${theme.palette.success.main}`, + }, + }, +})); + +const pickClassName = ( + classes: ReturnType, + build: BuildWithSteps = {} as BuildWithSteps, +) => { + if (build.failed) return classes.failed; + if (['running', 'queued'].includes(build.status!)) return classes.running; + if (build.status === 'success') return classes.success; + + return classes.neutral; +}; + +const Page = () => ( + + + + + +); + +const BuildWithStepsView: FC<{}> = () => { + const { buildId = '' } = useParams(); + const classes = useStyles(); + const [settings] = useSettings(); + const [{ loading, value }, { startPolling, stopPolling }] = useBuildWithSteps( + parseInt(buildId, 10), + ); + + useEffect(() => { + startPolling(); + return () => stopPolling(); + }, [buildId, settings]); + + return ( + <> + + + + + } + cardClassName={classes.cardContent} + > + {loading ? : } + + + + + ); +}; + +const BuildsList: FC<{ build?: BuildWithSteps }> = ({ build }) => ( + + {build && + build.steps && + build.steps.map( + ({ name, actions }: { name: string; actions: BuildStepAction[] }) => ( + + ), + )} + +); + +const ActionsList: FC<{ actions: BuildStepAction[]; name: string }> = ({ + actions, +}) => { + const classes = useStyles(); + return ( + <> + {actions.map((action: BuildStepAction) => ( + + ))} + + ); +}; + +export default Page; +export { BuildWithStepsView as BuildWithSteps }; diff --git a/frontend/plugins/circleci/src/pages/BuildWithStepsPage/index.ts b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/index.ts new file mode 100644 index 0000000..fddff70 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/index.ts @@ -0,0 +1,19 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { + default as DetailedViewPage, + BuildWithSteps, +} from './BuildWithStepsPage'; diff --git a/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/ActionOutput.tsx b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/ActionOutput.tsx new file mode 100644 index 0000000..e8e1bfe --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/ActionOutput.tsx @@ -0,0 +1,98 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { useEffect, useState, FC, Suspense } from 'react'; +import { + ExpansionPanel, + ExpansionPanelSummary, + Typography, + ExpansionPanelDetails, + LinearProgress, +} from '@material-ui/core'; +import moment from 'moment'; +import ExpandMoreIcon from '@material-ui/icons/ExpandMore'; +import { makeStyles } from '@material-ui/core/styles'; +import { BuildStepAction } from 'circleci-api'; + +const LazyLog = React.lazy(() => import('react-lazylog/build/LazyLog')); +moment.relativeTimeThreshold('ss', 0); +const useStyles = makeStyles({ + expansionPanelDetails: { + padding: 0, + }, + button: { + order: -1, + marginRight: 0, + marginLeft: '-20px', + }, +}); + +export const ActionOutput: FC<{ + url: string; + name: string; + className?: string; + action: BuildStepAction; +}> = ({ url, name, className, action }) => { + const classes = useStyles(); + + const [messages, setMessages] = useState([]); + useEffect(() => { + fetch(url) + .then((res) => res.json()) + .then((actionOutput) => { + if (typeof actionOutput !== 'undefined') { + setMessages( + actionOutput.map(({ message }: { message: string }) => message), + ); + } + }); + }, [url]); + + const timeElapsed = moment + .duration( + moment(action.end_time || moment()).diff(moment(action.start_time)), + ) + .humanize(); + return ( + + } + aria-controls={`panel-${name}-content`} + id={`panel-${name}-header`} + IconButtonProps={{ + className: classes.button, + }} + > + + {name} ({timeElapsed}) + + + + {messages.length === 0 ? ( + 'Nothing here...' + ) : ( + }> +
+ +
+
+ )} +
+
+ ); +}; diff --git a/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/index.ts b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/index.ts new file mode 100644 index 0000000..7cf74c7 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildWithStepsPage/lib/ActionOutput/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { ActionOutput } from './ActionOutput'; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/BuildsPage.tsx b/frontend/plugins/circleci/src/pages/BuildsPage/BuildsPage.tsx new file mode 100644 index 0000000..7b124c0 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/BuildsPage.tsx @@ -0,0 +1,43 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { Content } from '@backstage/core'; +import { Grid } from '@material-ui/core'; +import { Builds as BuildsComp } from './lib/Builds'; +import { Layout } from '../../components/Layout'; +import { PluginHeader } from '../../components/PluginHeader'; + +const BuildsPage: FC<{}> = () => ( + + + + + +); + +const Builds = () => ( + <> + + + + + + + +); + +export default BuildsPage; +export { Builds }; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/index.ts b/frontend/plugins/circleci/src/pages/BuildsPage/index.ts new file mode 100644 index 0000000..72b46d6 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { default as BuildsPage, Builds } from './BuildsPage'; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/Builds.tsx b/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/Builds.tsx new file mode 100644 index 0000000..bed96bb --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/Builds.tsx @@ -0,0 +1,38 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { CITable } from '../CITable'; +import { useBuilds } from '../../../../state'; + +export const Builds: FC<{}> = () => { + const [ + { total, loading, value, projectName, page, pageSize }, + { setPage, retry, setPageSize }, + ] = useBuilds(); + return ( + + ); +}; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/index.ts b/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/index.ts new file mode 100644 index 0000000..e91a949 --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/lib/Builds/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { Builds } from './Builds'; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/CITable.tsx b/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/CITable.tsx new file mode 100644 index 0000000..b349dcf --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/CITable.tsx @@ -0,0 +1,167 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { Link, Typography, Box, IconButton } from '@material-ui/core'; +import RetryIcon from '@material-ui/icons/Replay'; +import GitHubIcon from '@material-ui/icons/GitHub'; +import { Link as RouterLink } from 'react-router-dom'; +import { + StatusError, + StatusWarning, + StatusOK, + StatusPending, + StatusRunning, + Table, + TableColumn, +} from '@backstage/core'; + +export type CITableBuildInfo = { + id: string; + buildName: string; + buildUrl?: string; + source: { + branchName: string; + commit: { + hash: string; + url: string; + }; + }; + status: string; + tests?: { + total: number; + passed: number; + skipped: number; + failed: number; + testUrl: string; // fixme better name + }; + onRestartClick: () => void; +}; + +// retried, canceled, infrastructure_fail, timedout, not_run, running, failed, queued, scheduled, not_running, no_tests, fixed, success +const getStatusComponent = (status: string | undefined = '') => { + switch (status.toLowerCase()) { + case 'queued': + case 'scheduled': + return ; + case 'running': + return ; + case 'failed': + return ; + case 'success': + return ; + case 'canceled': + default: + return ; + } +}; + +const generatedColumns: TableColumn[] = [ + { + title: 'ID', + field: 'id', + type: 'numeric', + width: '80px', + }, + { + title: 'Build', + field: 'buildName', + highlight: true, + render: (row: Partial) => ( + + {row.buildName} + + ), + }, + { + title: 'Source', + render: (row: Partial) => ( + <> +

{row.source?.branchName}

+

{row.source?.commit.hash}

+ + ), + }, + { + title: 'Status', + render: (row: Partial) => ( + + {getStatusComponent(row.status)} + + {row.status} + + ), + }, + { + title: 'Actions', + render: (row: Partial) => ( + + + + ), + width: '10%', + }, +]; + +type Props = { + loading: boolean; + retry: () => void; + builds: CITableBuildInfo[]; + projectName: string; + page: number; + onChangePage: (page: number) => void; + total: number; + pageSize: number; + onChangePageSize: (pageSize: number) => void; +}; +export const CITable: FC = ({ + projectName, + loading, + pageSize, + page, + retry, + builds, + onChangePage, + onChangePageSize, + total, +}) => { + return ( +
, + tooltip: 'Refresh Data', + isFreeAction: true, + onClick: () => retry(), + }, + ]} + data={builds} + onChangePage={onChangePage} + onChangeRowsPerPage={onChangePageSize} + title={ + + + + {projectName} + + } + columns={generatedColumns} + /> + ); +}; diff --git a/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/index.ts b/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/index.ts new file mode 100644 index 0000000..358939e --- /dev/null +++ b/frontend/plugins/circleci/src/pages/BuildsPage/lib/CITable/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export { CITable } from './CITable'; +export type { CITableBuildInfo } from './CITable'; diff --git a/frontend/plugins/circleci/src/plugin.test.ts b/frontend/plugins/circleci/src/plugin.test.ts new file mode 100644 index 0000000..821a503 --- /dev/null +++ b/frontend/plugins/circleci/src/plugin.test.ts @@ -0,0 +1,23 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { plugin } from './plugin'; + +describe('circleci', () => { + it('should export plugin', () => { + expect(plugin).toBeDefined(); + }); +}); diff --git a/frontend/plugins/circleci/src/plugin.ts b/frontend/plugins/circleci/src/plugin.ts new file mode 100644 index 0000000..1eceb60 --- /dev/null +++ b/frontend/plugins/circleci/src/plugin.ts @@ -0,0 +1,25 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { createPlugin } from '@backstage/core'; +import { App } from './components/App'; +import { navTargetCircleCI } from './navTargets'; + +export const plugin = createPlugin({ + id: 'circleci', + register({ router }) { + router.addRoute(navTargetCircleCI, App, { exact: false }); + }, +}); diff --git a/frontend/plugins/circleci/src/proxy.ts b/frontend/plugins/circleci/src/proxy.ts new file mode 100644 index 0000000..8a5ae46 --- /dev/null +++ b/frontend/plugins/circleci/src/proxy.ts @@ -0,0 +1,25 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export const proxySettings = { + '/circleci/api': { + target: 'https://circleci.com/api/v1.1', + changeOrigin: true, + logLevel: 'debug', + pathRewrite: { + '^/circleci/api/': '/', + }, + }, +}; diff --git a/frontend/plugins/circleci/src/setupTests.ts b/frontend/plugins/circleci/src/setupTests.ts new file mode 100644 index 0000000..1a907ab --- /dev/null +++ b/frontend/plugins/circleci/src/setupTests.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import '@testing-library/jest-dom/extend-expect'; +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/circleci/src/state/AppState.tsx b/frontend/plugins/circleci/src/state/AppState.tsx new file mode 100644 index 0000000..49d55b6 --- /dev/null +++ b/frontend/plugins/circleci/src/state/AppState.tsx @@ -0,0 +1,56 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC, useReducer, Dispatch, Reducer } from 'react'; +import { circleCIApiRef } from '../api'; +import type { State, Action, SettingsState } from './types'; +export type { SettingsState }; + +export const AppContext = React.createContext<[State, Dispatch]>( + [] as any, +); +export const STORAGE_KEY = `${circleCIApiRef.id}.settings`; + +const initialState: State = { + owner: '', + repo: '', + token: '', + showSettings: false, +}; + +const reducer: Reducer = (state, action) => { + switch (action.type) { + case 'setCredentials': + return { + ...state, + ...action.payload, + }; + case 'showSettings': + return { ...state, showSettings: true }; + case 'hideSettings': + return { ...state, showSettings: false }; + default: + return state; + } +}; + +export const AppStateProvider: FC = ({ children }) => { + const [state, dispatch] = useReducer(reducer, initialState); + return ( + + <>{children} + + ); +}; diff --git a/frontend/plugins/circleci/src/state/index.ts b/frontend/plugins/circleci/src/state/index.ts new file mode 100644 index 0000000..2321103 --- /dev/null +++ b/frontend/plugins/circleci/src/state/index.ts @@ -0,0 +1,19 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +export * from './AppState'; +export * from './useSettings'; +export * from './useBuilds'; +export * from './useBuildWithSteps'; diff --git a/frontend/plugins/circleci/src/state/types.ts b/frontend/plugins/circleci/src/state/types.ts new file mode 100644 index 0000000..41b3577 --- /dev/null +++ b/frontend/plugins/circleci/src/state/types.ts @@ -0,0 +1,36 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export type Settings = { owner: string; repo: string; token: string }; +export type SettingsState = Settings & { + showSettings: boolean; +}; + +export type State = SettingsState; + +type SettingsAction = + | { + type: 'setCredentials'; + payload: { + repo: string; + owner: string; + token: string; + }; + } + | { type: 'showSettings' } + | { type: 'hideSettings' }; + +export type Action = SettingsAction; diff --git a/frontend/plugins/circleci/src/state/useAsyncPolling.ts b/frontend/plugins/circleci/src/state/useAsyncPolling.ts new file mode 100644 index 0000000..2f8de0c --- /dev/null +++ b/frontend/plugins/circleci/src/state/useAsyncPolling.ts @@ -0,0 +1,37 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { useRef } from 'react'; + +export const useAsyncPolling = ( + pollingFn: () => Promise, + interval: number, +) => { + const isPolling = useRef(false); + const startPolling = async () => { + if (isPolling.current === true) return; + isPolling.current = true; + + while (isPolling.current === true) { + await pollingFn(); + await new Promise((resolve) => setTimeout(resolve, interval)); + } + }; + + const stopPolling = () => { + isPolling.current = false; + }; + return { startPolling, stopPolling }; +}; diff --git a/frontend/plugins/circleci/src/state/useBuildWithSteps.ts b/frontend/plugins/circleci/src/state/useBuildWithSteps.ts new file mode 100644 index 0000000..7aba770 --- /dev/null +++ b/frontend/plugins/circleci/src/state/useBuildWithSteps.ts @@ -0,0 +1,84 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { errorApiRef, useApi } from '@backstage/core'; +import { useCallback } from 'react'; +import { useAsyncRetry } from 'react-use'; +import { circleCIApiRef, GitType } from '../api/index'; +import { useAsyncPolling } from './useAsyncPolling'; +import { useSettings } from './useSettings'; + +const INTERVAL_AMOUNT = 1500; +export function useBuildWithSteps(buildId: number) { + const [{ token, repo, owner }] = useSettings(); + const api = useApi(circleCIApiRef); + const errorApi = useApi(errorApiRef); + + const getBuildWithSteps = useCallback(async () => { + if (owner === '' || repo === '' || token === '') { + return Promise.reject('No credentials provided'); + } + + try { + const options = { + token: token, + vcs: { + owner: owner, + repo: repo, + type: GitType.GITHUB, + }, + }; + const build = await api.getBuild(buildId, options); + return Promise.resolve(build); + } catch (e) { + errorApi.post(e); + return Promise.reject(e); + } + }, [token, owner, repo, buildId]); + + const restartBuild = async () => { + try { + await api.retry(buildId, { + token: token, + vcs: { + owner: owner, + repo: repo, + type: GitType.GITHUB, + }, + }); + } catch (e) { + errorApi.post(e); + } + }; + + const { loading, value, retry } = useAsyncRetry(() => getBuildWithSteps(), [ + getBuildWithSteps, + ]); + + const { startPolling, stopPolling } = useAsyncPolling( + getBuildWithSteps, + INTERVAL_AMOUNT, + ); + + return [ + { loading, value, retry }, + { + restartBuild, + getBuildWithSteps, + startPolling, + stopPolling, + }, + ] as const; +} diff --git a/frontend/plugins/circleci/src/state/useBuilds.ts b/frontend/plugins/circleci/src/state/useBuilds.ts new file mode 100644 index 0000000..f90311b --- /dev/null +++ b/frontend/plugins/circleci/src/state/useBuilds.ts @@ -0,0 +1,153 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { errorApiRef, useApi } from '@backstage/core'; +import { BuildSummary, GitType } from 'circleci-api'; +import { useCallback, useEffect, useState } from 'react'; +import { useAsyncRetry } from 'react-use'; +import { circleCIApiRef } from '../api/index'; +import type { CITableBuildInfo } from '../pages/BuildsPage/lib/CITable'; +import { useSettings } from './useSettings'; + +const makeReadableStatus = (status: string | undefined) => { + if (!status) return ''; + return ({ + retried: 'Retried', + canceled: 'Canceled', + infrastructure_fail: 'Infra fail', + timedout: 'Timedout', + not_run: 'Not run', + running: 'Running', + failed: 'Failed', + queued: 'Queued', + scheduled: 'Scheduled', + not_running: 'Not running', + no_tests: 'No tests', + fixed: 'Fixed', + success: 'Success', + } as Record)[status]; +}; + +export const transform = ( + buildsData: BuildSummary[], + restartBuild: { (buildId: number): Promise }, +): CITableBuildInfo[] => { + return buildsData.map(buildData => { + const tableBuildInfo: CITableBuildInfo = { + id: String(buildData.build_num), + buildName: buildData.subject + ? buildData.subject + + (buildData.retry_of ? ` (retry of #${buildData.retry_of})` : '') + : '', + onRestartClick: () => + typeof buildData.build_num !== 'undefined' && + restartBuild(buildData.build_num), + source: { + branchName: String(buildData.branch), + commit: { + hash: String(buildData.vcs_revision), + url: 'todo', + }, + }, + status: makeReadableStatus(buildData.status), + buildUrl: buildData.build_url, + }; + return tableBuildInfo; + }); +}; + +export function useBuilds() { + const [{ repo, owner, token }] = useSettings(); + + const api = useApi(circleCIApiRef); + const errorApi = useApi(errorApiRef); + + const [total, setTotal] = useState(0); + const [page, setPage] = useState(0); + const [pageSize, setPageSize] = useState(5); + + const getBuilds = useCallback( + async ({ limit, offset }: { limit: number; offset: number }) => { + if (owner === '' || repo === '' || token === '') { + return Promise.reject('No credentials provided'); + } + + try { + return await api.getBuilds( + { limit, offset }, + { + token: token, + vcs: { + owner: owner, + repo: repo, + type: GitType.GITHUB, + }, + }, + ); + } catch (e) { + errorApi.post(e); + return Promise.reject(e); + } + }, + [repo, token, owner], + ); + + const restartBuild = async (buildId: number) => { + try { + await api.retry(buildId, { + token: token, + vcs: { + owner: owner, + repo: repo, + type: GitType.GITHUB, + }, + }); + } catch (e) { + errorApi.post(e); + } + }; + + useEffect(() => { + getBuilds({ limit: 1, offset: 0 }).then(b => setTotal(b?.[0].build_num!)); + }, [repo]); + + const { loading, value, retry } = useAsyncRetry( + () => + getBuilds({ + offset: page * pageSize, + limit: pageSize, + }).then(builds => transform(builds ?? [], restartBuild)), + [page, pageSize, getBuilds], + ); + + const projectName = `${owner}/${repo}`; + return [ + { + page, + pageSize, + loading, + value, + projectName, + total, + }, + { + getBuilds, + setPage, + setPageSize, + restartBuild, + retry, + }, + ] as const; +} diff --git a/frontend/plugins/circleci/src/state/useSettings.ts b/frontend/plugins/circleci/src/state/useSettings.ts new file mode 100644 index 0000000..5482abe --- /dev/null +++ b/frontend/plugins/circleci/src/state/useSettings.ts @@ -0,0 +1,66 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import { errorApiRef, useApi } from '@backstage/core'; +import { useContext, useEffect } from 'react'; +import { AppContext, STORAGE_KEY } from './AppState'; +import { Settings } from './types'; + +export function useSettings() { + const [settings, dispatch] = useContext(AppContext); + + const errorApi = useApi(errorApiRef); + + const rehydrate = () => { + try { + const stateFromStorage = JSON.parse(sessionStorage.getItem(STORAGE_KEY)!); + if ( + stateFromStorage && + Object.keys(stateFromStorage).some( + (k) => (settings as any)[k] !== stateFromStorage[k], + ) + ) + dispatch({ + type: 'setCredentials', + payload: stateFromStorage, + }); + } catch (error) { + errorApi.post(error); + } + }; + + useEffect(() => { + rehydrate(); + }, []); + + const persist = (state: Settings) => { + sessionStorage.setItem(STORAGE_KEY, JSON.stringify(state)); + }; + + return [ + settings, + { + saveSettings: (state: Settings) => { + persist(state); + dispatch({ + type: 'setCredentials', + payload: state, + }); + }, + showSettings: () => dispatch({ type: 'showSettings' }), + hideSettings: () => dispatch({ type: 'hideSettings' }), + }, + ] as const; +} diff --git a/frontend/plugins/explore/.eslintrc.js b/frontend/plugins/explore/.eslintrc.js new file mode 100644 index 0000000..13573ef --- /dev/null +++ b/frontend/plugins/explore/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], +}; diff --git a/frontend/plugins/explore/README.md b/frontend/plugins/explore/README.md new file mode 100644 index 0000000..12a4e58 --- /dev/null +++ b/frontend/plugins/explore/README.md @@ -0,0 +1,6 @@ +# Title +Welcome to the explore plugin! + +## Sub-section 1 + +## Sub-section 2 diff --git a/frontend/plugins/explore/dev/index.tsx b/frontend/plugins/explore/dev/index.tsx new file mode 100644 index 0000000..812a558 --- /dev/null +++ b/frontend/plugins/explore/dev/index.tsx @@ -0,0 +1,20 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin } from '../src/plugin'; + +createDevApp().registerPlugin(plugin).render(); diff --git a/frontend/plugins/explore/package.json b/frontend/plugins/explore/package.json new file mode 100644 index 0000000..36e43a9 --- /dev/null +++ b/frontend/plugins/explore/package.json @@ -0,0 +1,45 @@ +{ + "name": "@backstage/plugin-explore", + "version": "0.1.1-alpha.6", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "build": "backstage-cli plugin:build", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "diff": "backstage-cli plugin:diff", + "clean": "backstage-cli clean", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "start": "backstage-cli plugin:serve" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "classnames": "^2.2.6", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@backstage/test-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/explore/src/components/ExploreCard.test.js b/frontend/plugins/explore/src/components/ExploreCard.test.js new file mode 100644 index 0000000..fde36b5 --- /dev/null +++ b/frontend/plugins/explore/src/components/ExploreCard.test.js @@ -0,0 +1,93 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { render } from '@testing-library/react'; +import { wrapInThemedTestApp } from '@backstage/test-utils'; + +import ExploreCard from './ExploreCard'; + +const minProps = { + card: { + title: 'Title', + description: 'Something something', + url: 'http://spotify.com/', + image: 'https://developer.spotify.com/assets/WebAPI_intro.png', + tags: ['tag1', 'tag2'], + }, +}; + +describe('', () => { + it('renders without exploding', () => { + const { getByText } = render( + wrapInThemedTestApp(), + ); + expect(getByText('Explore')).toBeInTheDocument(); + }); + + it('renders props correctly', () => { + const { getByText } = render( + wrapInThemedTestApp(), + ); + expect(getByText(minProps.card.title)).toBeInTheDocument(); + expect(getByText(minProps.card.description)).toBeInTheDocument(); + }); + + it('should link out', () => { + const rendered = render(wrapInThemedTestApp()); + const anchor = rendered.container.querySelector('a'); + expect(anchor.href).toBe(minProps.card.url); + }); + + it('renders default description when missing', () => { + const propsWithoutDescription = { + card: { + card: { + title: 'Title', + url: 'http://spotify.com/', + image: 'https://developer.spotify.com/assets/WebAPI_intro.png', + }, + }, + }; + const { getByText } = render( + wrapInThemedTestApp(), + ); + expect(getByText('Description missing')).toBeInTheDocument(); + }); + + it('renders lifecycle correctly', () => { + const propsWithLifecycle = { + card: { + title: 'Title', + url: 'http://spotify.com/', + image: 'https://developer.spotify.com/assets/WebAPI_intro.png', + lifecycle: 'GA', + }, + }; + const { queryByText } = render( + wrapInThemedTestApp(), + ); + expect(queryByText('GA')).not.toBeInTheDocument(); + }); + + it('renders tags correctly', () => { + const { getByText } = render( + wrapInThemedTestApp(), + ); + expect(getByText(minProps.card.tags[0])).toBeInTheDocument(); + expect(getByText(minProps.card.tags[1])).toBeInTheDocument(); + }); +}); diff --git a/frontend/plugins/explore/src/components/ExploreCard.tsx b/frontend/plugins/explore/src/components/ExploreCard.tsx new file mode 100644 index 0000000..af6eca6 --- /dev/null +++ b/frontend/plugins/explore/src/components/ExploreCard.tsx @@ -0,0 +1,134 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import classNames from 'classnames'; +import { + Button, + Card, + CardActions, + CardContent, + CardMedia, + Chip, + Typography, + makeStyles, +} from '@material-ui/core'; +import { BackstageTheme } from '@backstage/theme'; + +const useStyles = makeStyles((theme) => ({ + card: { + display: 'flex', + flexDirection: 'column', + }, + cardActions: { + flexGrow: 1, + alignItems: 'flex-end', + }, + media: { + height: 128, + }, + mediaContain: { + backgroundSize: 'contain', + }, + lifecycle: { + lineHeight: '0.8em', + color: 'white', + }, + ga: { + backgroundColor: theme.palette.status.ok, + }, + alpha: { + backgroundColor: theme.palette.status.error, + }, + beta: { + backgroundColor: theme.palette.status.warning, + }, + domains: { + position: 'relative', + top: theme.spacing(2), + }, + spaceBetween: { + justifyContent: 'space-between', + }, +})); + +export type CardData = { + title: string; + description: string; + url: string; + image: string; + tags?: string[]; + lifecycle?: string; + newsTag?: string; +}; + +type Props = { + card: CardData; + objectFit?: 'cover' | 'contain'; +}; + +const ExploreCard: FC = ({ card, objectFit }) => { + const classes = useStyles(); + + const { title, description, url, image, lifecycle, newsTag, tags } = card; + + return ( + + + + + {title}{' '} + {lifecycle && lifecycle.toLowerCase() !== 'ga' && ( + + )} + + + {description || 'Description missing'} + + {tags && ( +
+ {tags.map((item, idx) => ( + + ))} +
+ )} +
+ + + +
+ ); +}; + +export default ExploreCard; diff --git a/frontend/plugins/explore/src/components/ExplorePluginPage.tsx b/frontend/plugins/explore/src/components/ExplorePluginPage.tsx new file mode 100644 index 0000000..efd1afa --- /dev/null +++ b/frontend/plugins/explore/src/components/ExplorePluginPage.tsx @@ -0,0 +1,101 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { makeStyles, Typography } from '@material-ui/core'; +import { + Content, + ContentHeader, + Header, + Page, + pageTheme, + SupportButton, +} from '@backstage/core'; +import ExploreCard, { CardData } from './ExploreCard'; +import { BackstageTheme } from '@backstage/theme'; + +const useStyles = makeStyles(theme => ({ + container: { + display: 'grid', + gridTemplateColumns: 'repeat(auto-fill, 296px)', + gridGap: theme.spacing(3), + marginBottom: theme.spacing(6), + }, +})); + +const toolsCards = [ + { + title: 'CircleCI', + description: + 'Provides builds overview, detailed build info and retriggering functionality for CircleCI.', + url: '/circleci', + image: 'https://miro.medium.com/max/1200/1*hkTBp22vLAqlIHkrkZHPnw.png', + tags: ['circleci', 'ci', 'dev'], + }, + { + title: 'Lighthouse', + description: + "Google's Lighthouse tool is a great resource for benchmarking and improving the accessibility, performance, SEO, and best practices of your website.", + url: '/lighthouse', + image: + 'https://raw.githubusercontent.com/GoogleChrome/lighthouse/8b3d7f052b2e64dd857e741d7395647f487697e7/assets/lighthouse-logo.png', + tags: ['web', 'seo', 'accessibility', 'performance'], + }, + { + title: 'Tech Radar', + description: + 'Tech Radar is a list of technologies, complemented by an assessment result, called ring assignment.', + url: '/tech-radar', + image: + 'https://storage.googleapis.com/wf-blogs-engineering-media/2018/09/fe13bb32-wf-tech-radar-hero-1024x597.png', + tags: ['standards', 'landscape'], + }, + { + title: 'GraphiQL', + description: + 'Integrates GraphiQL as a tool to browse GraphiQL endpoints inside Backstage.', + url: '/graphiql', + image: + 'https://camo.githubusercontent.com/517398c3fbe0687d3d4dcbe05da82970b882e75a/68747470733a2f2f64337676366c703535716a6171632e636c6f756466726f6e742e6e65742f6974656d732f33413061324e314c3346324f304c3377326e316a2f477261706869514c382e706e673f582d436c6f75644170702d56697369746f722d49643d3433363432', + tags: ['graphql', 'dev'], + }, +]; + +const ExplorePluginPage: FC<{}> = () => { + const classes = useStyles(); + return ( + +
+ + + + Explore tools available in Backstage + + +
+ {toolsCards.map((card: CardData, ix: any) => ( + + ))} +
+
+ + ); +}; + +export default ExplorePluginPage; diff --git a/frontend/plugins/explore/src/index.ts b/frontend/plugins/explore/src/index.ts new file mode 100644 index 0000000..3a0a0fe --- /dev/null +++ b/frontend/plugins/explore/src/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { plugin } from './plugin'; diff --git a/frontend/plugins/explore/src/plugin.test.ts b/frontend/plugins/explore/src/plugin.test.ts new file mode 100644 index 0000000..d6503c0 --- /dev/null +++ b/frontend/plugins/explore/src/plugin.test.ts @@ -0,0 +1,23 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { plugin } from './plugin'; + +describe('explore', () => { + it('should export plugin', () => { + expect(plugin).toBeDefined(); + }); +}); diff --git a/frontend/plugins/explore/src/plugin.ts b/frontend/plugins/explore/src/plugin.ts new file mode 100644 index 0000000..66e48a9 --- /dev/null +++ b/frontend/plugins/explore/src/plugin.ts @@ -0,0 +1,25 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createPlugin } from '@backstage/core'; +import ExplorePluginPage from './components/ExplorePluginPage'; + +export const plugin = createPlugin({ + id: 'explore', + register({ router }) { + router.registerRoute('/explore', ExplorePluginPage); + }, +}); diff --git a/frontend/plugins/explore/src/setupTests.ts b/frontend/plugins/explore/src/setupTests.ts new file mode 100644 index 0000000..e34bc46 --- /dev/null +++ b/frontend/plugins/explore/src/setupTests.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import '@testing-library/jest-dom'; +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/graphiql/.eslintrc.js b/frontend/plugins/graphiql/.eslintrc.js new file mode 100644 index 0000000..6a513fb --- /dev/null +++ b/frontend/plugins/graphiql/.eslintrc.js @@ -0,0 +1,7 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], + rules: { + // Prefer to use rendered.getBy*, which will throw an error + 'jest/expect-expect': 0, + }, +}; diff --git a/frontend/plugins/graphiql/README.md b/frontend/plugins/graphiql/README.md new file mode 100644 index 0000000..d2f8caf --- /dev/null +++ b/frontend/plugins/graphiql/README.md @@ -0,0 +1,64 @@ +# @backstage/plugin-graphiql + +This plugin integrates [GraphiQL](https://github.com/graphql/graphiql) as a tool to browse GraphiQL endpoints inside Backstage. + +The purpose of the plugin is to provide a convenient way for developers to try out GraphQL queries in their own environment. +By exposing GraphiQL as a plugin instead of a standalone app, it's possible to provide a preconfigured environment for engineers, and also tie into authentication providers already inside Backstage. + +## Getting Started + +### Installing the plugin + +Start out by installing the plugin in your Backstage app: + +```bash +yarn add @backstage/plugin-graphiql +``` + +Then add an entry to your App's `plugins.ts` to import the plugin. + +The plugin registers a `/graphiql` route, which you can link to from the Sidebar if desired. + +### Adding GraphQL endpoints + +For the plugin to function, you need to supply GraphQL endpoints through the GraphQLBrowse API, which is done by implementing the `GraphQLBrowseApi` exported by this plugin. + +If all you need is a static list of endpoints, the plugin exports a `GraphQLEndpoints` class that implements the `GraphQLBrowseApi` for you. Here's and example of how you could expose two GraphQL endpoints in your App: + +```tsx +import { + graphQlBrowseApiRef, + GraphQLEndpoints, +} from '@backstage/plugin-graphiql'; + +// Implement the Graph QL browse API using a static list of endpoints +const graphQlBrowseApi = GraphQLEndpoints.from([ + // Use the .create function if all you need is a static URL and headers. + GraphQLEndpoints.create({ + id: 'gitlab', + title: 'GitLab', + url: 'https://gitlab.com/api/graphql', + // Optional extra headers + headers: { Extra: 'Header' }, + }), + { + id: 'hooli-search', + title: 'Hooli Search', + // Custom fetch function, this one is equivalent to using GraphQLEndpoints.create() + // with url set to https://internal.hooli.com/search + fetcher: async (params: any) => { + return fetch('https://internal.hooli.com/search', { + method: 'POST', + headers: { 'Content-Type': 'application/json' }, + body: JSON.stringify(params), + }).then(res => res.json()); + }, + }, +]); + +// ApiRegistry builder created somewhere in your App +const builder = ApiRegistry.builder(); + +// Add the instance to the API registry +builder.add(graphQlBrowseApiRef, graphQlBrowseApi); +``` diff --git a/frontend/plugins/graphiql/dev/index.tsx b/frontend/plugins/graphiql/dev/index.tsx new file mode 100644 index 0000000..32d18b4 --- /dev/null +++ b/frontend/plugins/graphiql/dev/index.tsx @@ -0,0 +1,40 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin, GraphQLEndpoints, graphQlBrowseApiRef } from '../src'; + +createDevApp() + .registerPlugin(plugin) + .registerApiFactory({ + implements: graphQlBrowseApiRef, + deps: {}, + factory() { + return GraphQLEndpoints.from([ + GraphQLEndpoints.create({ + id: 'gitlab', + title: 'GitLab', + url: 'https://gitlab.com/api/graphql', + }), + GraphQLEndpoints.create({ + id: 'countries', + title: 'Countries', + url: 'https://countries.trevorblades.com/', + }), + ]); + }, + }) + .render(); diff --git a/frontend/plugins/graphiql/package.json b/frontend/plugins/graphiql/package.json new file mode 100644 index 0000000..9f229c8 --- /dev/null +++ b/frontend/plugins/graphiql/package.json @@ -0,0 +1,61 @@ +{ + "name": "@backstage/plugin-graphiql", + "description": "Backstage plugin for browsing GraphQL APIs", + "version": "0.1.1-alpha.6", + "private": false, + "publishConfig": { + "access": "public" + }, + "homepage": "https://github.com/spotify/backstage/tree/master/plugins/graphiql#readme", + "repository": { + "type": "git", + "url": "https://github.com/spotify/backstage", + "directory": "plugins/graphiql" + }, + "keywords": [ + "backstage" + ], + "license": "Apache-2.0", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "scripts": { + "build": "backstage-cli plugin:build", + "start": "backstage-cli plugin:serve", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "diff": "backstage-cli plugin:diff", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "clean": "backstage-cli clean" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "graphiql": "^1.0.0-alpha.8", + "graphql": "15.0.0", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@backstage/test-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/codemirror": "^0.0.93", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3", + "react-router-dom": "^5.2.0" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.test.tsx b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.test.tsx new file mode 100644 index 0000000..1726c18 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.test.tsx @@ -0,0 +1,57 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { render } from '@testing-library/react'; +import { GraphiQLBrowser } from './GraphiQLBrowser'; +import { ThemeProvider } from '@material-ui/core'; +import { lightTheme } from '@backstage/theme'; + +jest.mock('graphiql', () => () => ''); + +describe('GraphiQLBrowser', () => { + it('should render error text if there are no endpoints', () => { + const rendered = render( + + + , + ); + rendered.getByText('No endpoints available'); + }); + + it('should render endpoint tabs', () => { + const rendered = render( + + + , + ); + rendered.getByText('Endpoint A'); + rendered.getByText('Endpoint B'); + }); +}); diff --git a/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.tsx b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.tsx new file mode 100644 index 0000000..b41fc04 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/GraphiQLBrowser.tsx @@ -0,0 +1,81 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC, useState, Suspense } from 'react'; +import { Tabs, Tab, makeStyles, Typography, Divider } from '@material-ui/core'; +import 'graphiql/graphiql.css'; +import { StorageBucket } from '../../lib/storage'; +import { GraphQLEndpoint } from '../../lib/api'; +import { Progress } from '@backstage/core'; +import { BackstageTheme } from '@backstage/theme'; + +const GraphiQL = React.lazy(() => import('graphiql')); + +const useStyles = makeStyles((theme) => ({ + root: { + height: '100%', + display: 'flex', + flexFlow: 'column nowrap', + }, + tabs: { + background: theme.palette.background.paper, + }, + graphiQlWrapper: { + flex: 1, + '@global': { + '.graphiql-container': { + boxSizing: 'initial', + }, + }, + }, +})); + +type GraphiQLBrowserProps = { + endpoints: GraphQLEndpoint[]; +}; + +export const GraphiQLBrowser: FC = ({ endpoints }) => { + const classes = useStyles(); + const [tabIndex, setTabIndex] = useState(0); + + if (!endpoints.length) { + return No endpoints available; + } + + const { id, fetcher } = endpoints[tabIndex]; + const storage = StorageBucket.forLocalStorage(`plugin/graphiql/data/${id}`); + + return ( +
+ }> + setTabIndex(value)} + indicatorColor="primary" + > + {endpoints.map(({ title }, index) => ( + + ))} + + +
+ +
+
+
+ ); +}; diff --git a/frontend/plugins/graphiql/src/components/GraphiQLBrowser/index.ts b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/index.ts new file mode 100644 index 0000000..cb9a4a9 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLBrowser/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './GraphiQLBrowser'; diff --git a/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.test.tsx b/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.test.tsx new file mode 100644 index 0000000..fb40149 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.test.tsx @@ -0,0 +1,88 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { GraphiQLPage } from './GraphiQLPage'; +import { ThemeProvider } from '@material-ui/core'; +import { lightTheme } from '@backstage/theme'; +import { ApiProvider, ApiRegistry } from '@backstage/core'; +import { renderWithEffects } from '@backstage/test-utils'; +import { GraphQLBrowseApi, graphQlBrowseApiRef } from '../../lib/api'; + +jest.mock('../GraphiQLBrowser', () => ({ + GraphiQLBrowser: () => '', +})); + +describe('GraphiQLPage', () => { + it('should show progress', async () => { + const loadingApi: GraphQLBrowseApi = { + async getEndpoints() { + await new Promise(() => {}); + return []; + }, + }; + + const rendered = await renderWithEffects( + + + + + , + , + ); + + rendered.getByText('GraphiQL'); + rendered.getByTestId('progress'); + }); + + it('should show error', async () => { + const loadingApi: GraphQLBrowseApi = { + async getEndpoints() { + throw new Error('NOPE'); + }, + }; + + const rendered = await renderWithEffects( + + + + + , + ); + + rendered.getByText('GraphiQL'); + rendered.getByText('Failed to load GraphQL endpoints, Error: NOPE'); + }); + + it('should show GraphiQLBrowser', async () => { + const loadingApi: GraphQLBrowseApi = { + async getEndpoints() { + return []; + }, + }; + + const rendered = await renderWithEffects( + + + + + , + ); + + rendered.getByText('GraphiQL'); + rendered.getByText(''); + }); +}); diff --git a/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.tsx b/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.tsx new file mode 100644 index 0000000..a16fdf3 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLPage/GraphiQLPage.tsx @@ -0,0 +1,71 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { + Content, + Header, + HeaderLabel, + Page, + Progress, + pageTheme, + useApi, +} from '@backstage/core'; +import { useAsync } from 'react-use'; +import 'graphiql/graphiql.css'; +import { graphQlBrowseApiRef } from '../../lib/api'; +import { GraphiQLBrowser } from '../GraphiQLBrowser'; +import { Typography } from '@material-ui/core'; + +export const GraphiQLPage: FC<{}> = () => { + const graphQlBrowseApi = useApi(graphQlBrowseApiRef); + const endpoints = useAsync(() => graphQlBrowseApi.getEndpoints()); + + let content: JSX.Element; + + if (endpoints.loading) { + content = ( + + + + ); + } else if (endpoints.error) { + content = ( + + + {/* TODO: provide a proper error component */} + Failed to load GraphQL endpoints, {String(endpoints.error)} + + + ); + } else { + content = ( + + + + ); + } + + return ( + +
+ + +
+ {content} +
+ ); +}; diff --git a/frontend/plugins/graphiql/src/components/GraphiQLPage/index.ts b/frontend/plugins/graphiql/src/components/GraphiQLPage/index.ts new file mode 100644 index 0000000..ed11f03 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/GraphiQLPage/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './GraphiQLPage'; diff --git a/frontend/plugins/graphiql/src/components/index.ts b/frontend/plugins/graphiql/src/components/index.ts new file mode 100644 index 0000000..c0d2228 --- /dev/null +++ b/frontend/plugins/graphiql/src/components/index.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './GraphiQLPage'; +export * from './GraphiQLBrowser'; diff --git a/frontend/plugins/graphiql/src/index.ts b/frontend/plugins/graphiql/src/index.ts new file mode 100644 index 0000000..5590a0d --- /dev/null +++ b/frontend/plugins/graphiql/src/index.ts @@ -0,0 +1,19 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { plugin } from './plugin'; +export * from './lib/api'; +export * from './navTargets'; diff --git a/frontend/plugins/graphiql/src/lib/api/GraphQLEndpoints.ts b/frontend/plugins/graphiql/src/lib/api/GraphQLEndpoints.ts new file mode 100644 index 0000000..c407d92 --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/api/GraphQLEndpoints.ts @@ -0,0 +1,63 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { GraphQLBrowseApi, GraphQLEndpoint } from './types'; + +// Helper for generic http endpoints +export type EndpointConfig = { + id: string; + title: string; + // Endpoint URL + url: string; + // only supports POST right now + method?: 'POST'; + // Defaults to setting Content-Type to application/json + headers?: { [name in string]: string }; +}; + +export class GraphQLEndpoints implements GraphQLBrowseApi { + // Create a support + static create(config: EndpointConfig): GraphQLEndpoint { + const { id, title, url, method = 'POST' } = config; + return { + id, + title, + fetcher: async (params: any) => { + const body = JSON.stringify(params); + const headers = { + 'Content-Type': 'application/json', + ...config.headers, + }; + const res = await fetch(url, { + method, + headers, + body, + }); + return res.json(); + }, + }; + } + + static from(endpoints: GraphQLEndpoint[]) { + return new GraphQLEndpoints(endpoints); + } + + private constructor(private readonly endpoints: GraphQLEndpoint[]) {} + + async getEndpoints() { + return this.endpoints; + } +} diff --git a/frontend/plugins/graphiql/src/lib/api/index.ts b/frontend/plugins/graphiql/src/lib/api/index.ts new file mode 100644 index 0000000..bcc7966 --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/api/index.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './GraphQLEndpoints'; +export * from './types'; diff --git a/frontend/plugins/graphiql/src/lib/api/types.ts b/frontend/plugins/graphiql/src/lib/api/types.ts new file mode 100644 index 0000000..6c41e2a --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/api/types.ts @@ -0,0 +1,39 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { ApiRef } from '@backstage/core'; + +export type GraphQLEndpoint = { + // Will be used as unique key for storing history and query data + id: string; + + // Displayed to the user to identify the source. + title: string; + + // Method used send a GraphQL query. + // The body parameter is equivalent to the POST body to be JSON-serialized, and the + // return value should be the equivalent of a parsed JSON response from that POST. + fetcher: (body: any) => Promise; +}; + +export type GraphQLBrowseApi = { + getEndpoints(): Promise; +}; + +export const graphQlBrowseApiRef = new ApiRef({ + id: 'plugin.graphiql.browse', + description: 'Used to supply GraphQL endpoints for browsing', +}); diff --git a/frontend/plugins/graphiql/src/lib/storage/StorageBucket.test.ts b/frontend/plugins/graphiql/src/lib/storage/StorageBucket.test.ts new file mode 100644 index 0000000..d18d038 --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/storage/StorageBucket.test.ts @@ -0,0 +1,143 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { StorageBucket } from './StorageBucket'; + +describe('StorageBucket', () => { + it('should forbid access to unknown keys', () => { + const bucket = StorageBucket.forStorage(localStorage, 'hello'); + + expect(() => { + bucket['dunno-this-one'] = 'nope'; + }).toThrow('Direct property access is not allowed for StorageBuckets'); + expect(() => { + return bucket['dunno-this-one']; + }).toThrow('Direct property access is not allowed for StorageBuckets'); + }); + + it('should not implement all methods', () => { + const bucket = StorageBucket.forLocalStorage('hello'); + + expect(() => bucket.length).toThrow('Method not implemented.'); + expect(() => bucket.key()).toThrow('Method not implemented.'); + }); + + describe('with mocked underlying storage', () => { + const mockStorage = { + getItem: jest.fn(), + setItem: jest.fn(), + removeItem: jest.fn(), + }; + const bucket = StorageBucket.forStorage( + (mockStorage as unknown) as Storage, + 'my-bucket', + ); + + afterEach(() => { + jest.resetAllMocks(); + }); + + it('should set a first item', () => { + bucket.setItem('x', 'a'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(1); + expect(mockStorage.setItem).toHaveBeenLastCalledWith( + 'my-bucket', + JSON.stringify({ x: 'a' }), + ); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + + it('should set a second item', () => { + mockStorage.getItem.mockReturnValueOnce(JSON.stringify({ y: 'b' })); + bucket.setItem('x', 'a'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(1); + expect(mockStorage.setItem).toHaveBeenLastCalledWith( + 'my-bucket', + JSON.stringify({ y: 'b', x: 'a' }), + ); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + + it('should clear the bucket', () => { + bucket.clear(); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(0); + expect(mockStorage.setItem).toHaveBeenCalledTimes(0); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(1); + expect(mockStorage.removeItem).toHaveBeenLastCalledWith('my-bucket'); + }); + + it('should get an item', () => { + mockStorage.getItem.mockReturnValueOnce(JSON.stringify({ x: 'X' })); + expect(bucket.getItem('x')).toBe('X'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(0); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + + it('should remove an item', () => { + mockStorage.getItem.mockReturnValueOnce( + JSON.stringify({ x: 'X', y: 'Y' }), + ); + bucket.removeItem('x'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(1); + expect(mockStorage.setItem).toHaveBeenLastCalledWith( + 'my-bucket', + JSON.stringify({ y: 'Y' }), + ); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + + it('should not bother to write when deleting a missing key', () => { + mockStorage.getItem.mockReturnValueOnce(JSON.stringify({ y: 'Y' })); + bucket.removeItem('x'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(0); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + + it('should ignore bad data', () => { + mockStorage.getItem.mockReturnValue('derp'); + + expect(bucket.getItem('x')).toBe(null); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(1); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(0); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + + bucket.removeItem('x'); + + expect(mockStorage.getItem).toHaveBeenCalledTimes(2); + expect(mockStorage.getItem).toHaveBeenLastCalledWith('my-bucket'); + expect(mockStorage.setItem).toHaveBeenCalledTimes(0); + expect(mockStorage.removeItem).toHaveBeenCalledTimes(0); + }); + }); +}); diff --git a/frontend/plugins/graphiql/src/lib/storage/StorageBucket.ts b/frontend/plugins/graphiql/src/lib/storage/StorageBucket.ts new file mode 100644 index 0000000..9d275e5 --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/storage/StorageBucket.ts @@ -0,0 +1,102 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +type BucketData = { [key in string]: string }; + +export class StorageBucket implements Storage { + private static noPropAccessProxyHandler: ProxyHandler = { + get(target, prop) { + if (prop in target) { + return target[prop as any]; + } + throw new Error( + 'Direct property access is not allowed for StorageBuckets', + ); + }, + set() { + throw new Error( + 'Direct property access is not allowed for StorageBuckets', + ); + }, + }; + + static forStorage(storage: Storage, bucket: string) { + const storageBucket = new StorageBucket(storage, bucket); + return new Proxy(storageBucket, StorageBucket.noPropAccessProxyHandler); + } + + static forLocalStorage(bucket: string): StorageBucket { + return StorageBucket.forStorage(localStorage, bucket); + } + + private constructor( + private readonly storage: Storage, + private readonly bucket: string, + ) {} + + [name: string]: any; + + get length(): number { + throw new Error('Method not implemented.'); + } + + clear(): void { + this.storage.removeItem(this.bucket); + } + + getItem(key: string): string | null { + return this.read()?.[key] ?? null; + } + + key(): never { + throw new Error('Method not implemented.'); + } + + removeItem(key: string): void { + const data = this.read(); + if (!data) { + return; + } + + if (key in data) { + delete data[key]; + this.write(data); + } + } + + setItem(key: string, value: string): void { + const data = this.read() ?? {}; + data[key] = value; + this.write(data); + } + + private read(): BucketData | undefined { + const bucketValue = this.storage.getItem(this.bucket); + if (!bucketValue) { + return undefined; + } + + try { + return JSON.parse(bucketValue); + } catch { + return undefined; + } + } + + private write(data: BucketData) { + this.storage.setItem(this.bucket, JSON.stringify(data)); + } +} diff --git a/frontend/plugins/graphiql/src/lib/storage/index.ts b/frontend/plugins/graphiql/src/lib/storage/index.ts new file mode 100644 index 0000000..a760761 --- /dev/null +++ b/frontend/plugins/graphiql/src/lib/storage/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './StorageBucket'; diff --git a/frontend/plugins/graphiql/src/navTargets.tsx b/frontend/plugins/graphiql/src/navTargets.tsx new file mode 100644 index 0000000..2351780 --- /dev/null +++ b/frontend/plugins/graphiql/src/navTargets.tsx @@ -0,0 +1,92 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { createNavTarget } from '@backstage/core'; +import { SvgIcon, SvgIconProps } from '@material-ui/core'; + +const GraphiQLIcon: FC = (props) => ( + + + + + + + + + + + + + + + + + + + +); + +export const navTargetGraphiQL = createNavTarget({ + icon: GraphiQLIcon, + path: '/graphiql', + title: 'GraphiQL', +}); diff --git a/frontend/plugins/graphiql/src/plugin.test.ts b/frontend/plugins/graphiql/src/plugin.test.ts new file mode 100644 index 0000000..0841d3e --- /dev/null +++ b/frontend/plugins/graphiql/src/plugin.test.ts @@ -0,0 +1,23 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { plugin } from './plugin'; + +describe('graphiql', () => { + it('should export plugin', () => { + expect(plugin).toBeDefined(); + }); +}); diff --git a/frontend/plugins/graphiql/src/plugin.ts b/frontend/plugins/graphiql/src/plugin.ts new file mode 100644 index 0000000..9c73324 --- /dev/null +++ b/frontend/plugins/graphiql/src/plugin.ts @@ -0,0 +1,26 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createPlugin } from '@backstage/core'; +import { GraphiQLPage } from './components'; +import { navTargetGraphiQL } from './navTargets'; + +export const plugin = createPlugin({ + id: 'graphiql', + register({ router }) { + router.addRoute(navTargetGraphiQL, GraphiQLPage); + }, +}); diff --git a/frontend/plugins/graphiql/src/setupTests.ts b/frontend/plugins/graphiql/src/setupTests.ts new file mode 100644 index 0000000..e34bc46 --- /dev/null +++ b/frontend/plugins/graphiql/src/setupTests.ts @@ -0,0 +1,18 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import '@testing-library/jest-dom'; +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/home-page/.eslintrc.js b/frontend/plugins/home-page/.eslintrc.js new file mode 100644 index 0000000..13573ef --- /dev/null +++ b/frontend/plugins/home-page/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], +}; diff --git a/frontend/plugins/home-page/README.md b/frontend/plugins/home-page/README.md new file mode 100644 index 0000000..ecac8aa --- /dev/null +++ b/frontend/plugins/home-page/README.md @@ -0,0 +1 @@ +Welcome to your home-page plugin! diff --git a/frontend/plugins/home-page/dev/index.tsx b/frontend/plugins/home-page/dev/index.tsx new file mode 100644 index 0000000..812a558 --- /dev/null +++ b/frontend/plugins/home-page/dev/index.tsx @@ -0,0 +1,20 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin } from '../src/plugin'; + +createDevApp().registerPlugin(plugin).render(); diff --git a/frontend/plugins/home-page/package.json b/frontend/plugins/home-page/package.json new file mode 100644 index 0000000..fa12368 --- /dev/null +++ b/frontend/plugins/home-page/package.json @@ -0,0 +1,44 @@ +{ + "name": "@backstage/plugin-home-page", + "version": "0.1.1-alpha.6", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "build": "backstage-cli plugin:build", + "start": "backstage-cli plugin:serve", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "diff": "backstage-cli plugin:diff", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "clean": "backstage-cli clean" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3", + "react-router-dom": "^5.2.0" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/home-page/src/components/HomePage/HomePage.test.tsx b/frontend/plugins/home-page/src/components/HomePage/HomePage.test.tsx new file mode 100644 index 0000000..e7df794 --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomePage/HomePage.test.tsx @@ -0,0 +1,32 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { render } from '@testing-library/react'; +import HomePage from './HomePage'; +import { ThemeProvider } from '@material-ui/core'; +import { lightTheme } from '@backstage/theme'; + +describe('HomePage', () => { + it('should render', () => { + const rendered = render( + + + , + ); + expect(rendered.baseElement).toBeInTheDocument(); + }); +}); diff --git a/frontend/plugins/home-page/src/components/HomePage/HomePage.tsx b/frontend/plugins/home-page/src/components/HomePage/HomePage.tsx new file mode 100644 index 0000000..60b2718 --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomePage/HomePage.tsx @@ -0,0 +1,91 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { Typography, Link, Grid } from '@material-ui/core'; +import HomePageTimer from '../HomepageTimer'; +import { Content, InfoCard, Header, Page, pageTheme } from '@backstage/core'; +import SquadTechHealth from './SquadTechHealth'; +import Table from '@material-ui/core/Table'; +import TableBody from '@material-ui/core/TableBody'; +import TableCell from '@material-ui/core/TableCell'; +import TableContainer from '@material-ui/core/TableContainer'; +import TableHead from '@material-ui/core/TableHead'; +import TableRow from '@material-ui/core/TableRow'; + +const STATIC_DATA = [ + { id: 'backstage', kind: 'service' }, + { id: 'backstage-microsite', kind: 'website' }, +]; + +const HomePage: FC<{}> = () => { + const data = STATIC_DATA.map(({ id, kind }) => { + return { + id, + entity: ( + + {id} + + ), + kind: {kind}, + }; + }); + + const profile = { givenName: 'Suzy' }; + + return ( + +
+ +
+ + + + Things you own + + +
+ + + ID + Kind + + + + {data.map((d) => ( + + {d.entity} + {d.kind} + + ))} + +
+ + + + + + + + + + ); +}; + +export default HomePage; diff --git a/frontend/plugins/home-page/src/components/HomePage/SquadTechHealth.tsx b/frontend/plugins/home-page/src/components/HomePage/SquadTechHealth.tsx new file mode 100644 index 0000000..c4e55c4 --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomePage/SquadTechHealth.tsx @@ -0,0 +1,52 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { Grid, Typography } from '@material-ui/core'; + +import { HorizontalScrollGrid, ProgressCard } from '@backstage/core'; + +const SquadTechHealth: FC<{}> = () => { + return ( + <> + Team Metrics + + + + + + + + + + ); +}; + +export default SquadTechHealth; diff --git a/frontend/plugins/home-page/src/components/HomePage/index.ts b/frontend/plugins/home-page/src/components/HomePage/index.ts new file mode 100644 index 0000000..c5a0dcd --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomePage/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { default } from './HomePage'; diff --git a/frontend/plugins/home-page/src/components/HomepageTimer/HomepageTimer.tsx b/frontend/plugins/home-page/src/components/HomepageTimer/HomepageTimer.tsx new file mode 100644 index 0000000..770f98e --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomepageTimer/HomepageTimer.tsx @@ -0,0 +1,74 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { FC } from 'react'; +import { HeaderLabel } from '@backstage/core'; + +const timeFormat = { hour: '2-digit', minute: '2-digit' }; +const utcOptions = { timeZone: 'UTC', ...timeFormat }; +const nycOptions = { timeZone: 'America/New_York', ...timeFormat }; +const tyoOptions = { timeZone: 'Asia/Tokyo', ...timeFormat }; +const stoOptions = { timeZone: 'Europe/Stockholm', ...timeFormat }; + +const defaultTimes = { + timeNY: '', + timeUTC: '', + timeTYO: '', + timeSTO: '', +}; + +function getTimes() { + const d = new Date(); + const lang = window.navigator.language; + + // Using the browser native toLocaleTimeString instead of huge moment-tz + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/toLocaleTimeString + const timeNY = d.toLocaleTimeString(lang, nycOptions); + const timeUTC = d.toLocaleTimeString(lang, utcOptions); + const timeTYO = d.toLocaleTimeString(lang, tyoOptions); + const timeSTO = d.toLocaleTimeString(lang, stoOptions); + + return { timeNY, timeUTC, timeTYO, timeSTO }; +} + +const HomePageTimer: FC<{}> = () => { + const [{ timeNY, timeUTC, timeTYO, timeSTO }, setTimes] = React.useState( + defaultTimes, + ); + + React.useEffect(() => { + setTimes(getTimes()); + + const intervalId = setInterval(() => { + setTimes(getTimes()); + }, 1000); + + return () => { + clearInterval(intervalId); + }; + }, []); + + return ( + <> + + + + + + ); +}; + +export default HomePageTimer; diff --git a/frontend/plugins/home-page/src/components/HomepageTimer/index.ts b/frontend/plugins/home-page/src/components/HomepageTimer/index.ts new file mode 100644 index 0000000..be260e5 --- /dev/null +++ b/frontend/plugins/home-page/src/components/HomepageTimer/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { default } from './HomepageTimer'; diff --git a/frontend/plugins/home-page/src/index.ts b/frontend/plugins/home-page/src/index.ts new file mode 100644 index 0000000..3a0a0fe --- /dev/null +++ b/frontend/plugins/home-page/src/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export { plugin } from './plugin'; diff --git a/frontend/plugins/home-page/src/plugin.test.ts b/frontend/plugins/home-page/src/plugin.test.ts new file mode 100644 index 0000000..aea6b90 --- /dev/null +++ b/frontend/plugins/home-page/src/plugin.test.ts @@ -0,0 +1,23 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { plugin } from './plugin'; + +describe('home-page', () => { + it('should export plugin', () => { + expect(plugin).toBeDefined(); + }); +}); diff --git a/frontend/plugins/home-page/src/plugin.ts b/frontend/plugins/home-page/src/plugin.ts new file mode 100644 index 0000000..182d43b --- /dev/null +++ b/frontend/plugins/home-page/src/plugin.ts @@ -0,0 +1,25 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createPlugin } from '@backstage/core'; +import HomePage from './components/HomePage'; + +export const plugin = createPlugin({ + id: 'home-page', + register({ router }) { + router.registerRoute('/home', HomePage); + }, +}); diff --git a/frontend/plugins/home-page/src/setupTests.ts b/frontend/plugins/home-page/src/setupTests.ts new file mode 100644 index 0000000..825bcd4 --- /dev/null +++ b/frontend/plugins/home-page/src/setupTests.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import '@testing-library/jest-dom'; diff --git a/frontend/plugins/identity-backend/.eslintrc.js b/frontend/plugins/identity-backend/.eslintrc.js new file mode 100644 index 0000000..16a033d --- /dev/null +++ b/frontend/plugins/identity-backend/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint.backend')], +}; diff --git a/frontend/plugins/identity-backend/README.md b/frontend/plugins/identity-backend/README.md new file mode 100644 index 0000000..7d97bb5 --- /dev/null +++ b/frontend/plugins/identity-backend/README.md @@ -0,0 +1,11 @@ +# Identity Backend + +WORK IN PROGRESS + +This is the backend part of the identity plugin. + +It responds to identity requests from the frontend. + +## Links + +- (The Backstage homepage)[https://backstage.io] diff --git a/frontend/plugins/identity-backend/package.json b/frontend/plugins/identity-backend/package.json new file mode 100644 index 0000000..30512ee --- /dev/null +++ b/frontend/plugins/identity-backend/package.json @@ -0,0 +1,40 @@ +{ + "name": "@backstage/plugin-identity-backend", + "version": "0.1.1-alpha.6", + "main": "dist", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "start": "tsc-watch --onFirstSuccess \"cross-env NODE_ENV=development nodemon dist/run.js\"", + "build": "tsc", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "clean": "backstage-cli clean" + }, + "dependencies": { + "@backstage/backend-common": "^0.1.1-alpha.6", + "compression": "^1.7.4", + "cors": "^2.8.5", + "express": "^4.17.1", + "express-promise-router": "^3.0.3", + "fs-extra": "^9.0.0", + "helmet": "^3.22.0", + "morgan": "^1.10.0", + "winston": "^3.2.1", + "yn": "^4.0.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "jest-fetch-mock": "^3.0.3", + "tsc-watch": "^4.2.3" + }, + "files": [ + "dist" + ], + "nodemonConfig": { + "watch": "./dist" + } +} diff --git a/frontend/plugins/identity-backend/src/index.test.ts b/frontend/plugins/identity-backend/src/index.test.ts new file mode 100644 index 0000000..b3e2f19 --- /dev/null +++ b/frontend/plugins/identity-backend/src/index.test.ts @@ -0,0 +1,21 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +describe('test', () => { + it('unbreaks the test runner', () => { + expect(true).toBeTruthy(); + }); +}); diff --git a/frontend/plugins/identity-backend/src/index.ts b/frontend/plugins/identity-backend/src/index.ts new file mode 100644 index 0000000..7612c39 --- /dev/null +++ b/frontend/plugins/identity-backend/src/index.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +export * from './service/router'; diff --git a/frontend/plugins/identity-backend/src/run.ts b/frontend/plugins/identity-backend/src/run.ts new file mode 100644 index 0000000..0a684c3 --- /dev/null +++ b/frontend/plugins/identity-backend/src/run.ts @@ -0,0 +1,33 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import yn from 'yn'; +import { getRootLogger } from '@backstage/backend-common'; +import { startStandaloneServer } from './service/standaloneServer'; + +const port = process.env.PLUGIN_PORT ? Number(process.env.PLUGIN_PORT) : 3003; +const enableCors = yn(process.env.PLUGIN_CORS, { default: false }); +const logger = getRootLogger(); + +startStandaloneServer({ port, enableCors, logger }).catch((err) => { + logger.error(err); + process.exit(1); +}); + +process.on('SIGINT', () => { + logger.info('CTRL+C pressed; exiting.'); + process.exit(0); +}); diff --git a/frontend/plugins/identity-backend/src/service/router.ts b/frontend/plugins/identity-backend/src/service/router.ts new file mode 100644 index 0000000..52e73db --- /dev/null +++ b/frontend/plugins/identity-backend/src/service/router.ts @@ -0,0 +1,37 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import express from 'express'; +import Router from 'express-promise-router'; +import { Logger } from 'winston'; + +export interface RouterOptions { + logger: Logger; +} + +export async function createRouter( + options: RouterOptions, +): Promise { + const router = Router(); + const logger = options.logger; + + router.use('/ping', (_, res) => { + logger.info('heartbeat for identity service'); + res.send('pong'); + }); + + return router; +} diff --git a/frontend/plugins/identity-backend/src/service/standaloneApplication.ts b/frontend/plugins/identity-backend/src/service/standaloneApplication.ts new file mode 100644 index 0000000..5eea4fb --- /dev/null +++ b/frontend/plugins/identity-backend/src/service/standaloneApplication.ts @@ -0,0 +1,52 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { + errorHandler, + notFoundHandler, + requestLoggingHandler, +} from '@backstage/backend-common'; +import compression from 'compression'; +import cors from 'cors'; +import express from 'express'; +import helmet from 'helmet'; +import { Logger } from 'winston'; +import { createRouter } from './router'; + +export interface ApplicationOptions { + enableCors: boolean; + logger: Logger; +} + +export async function createStandaloneApplication( + options: ApplicationOptions, +): Promise { + const { enableCors, logger } = options; + const app = express(); + + app.use(helmet()); + if (enableCors) { + app.use(cors()); + } + app.use(compression()); + app.use(express.json()); + app.use(requestLoggingHandler()); + app.use('/', await createRouter({ logger })); + app.use(notFoundHandler()); + app.use(errorHandler()); + + return app; +} diff --git a/frontend/plugins/identity-backend/src/service/standaloneServer.ts b/frontend/plugins/identity-backend/src/service/standaloneServer.ts new file mode 100644 index 0000000..42231b4 --- /dev/null +++ b/frontend/plugins/identity-backend/src/service/standaloneServer.ts @@ -0,0 +1,50 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { Server } from 'http'; +import { Logger } from 'winston'; +import { createStandaloneApplication } from './standaloneApplication'; + +export interface ServerOptions { + port: number; + enableCors: boolean; + logger: Logger; +} + +export async function startStandaloneServer( + options: ServerOptions, +): Promise { + const logger = options.logger.child({ service: 'identity-backend' }); + + logger.debug('Creating application...'); + const app = await createStandaloneApplication({ + enableCors: options.enableCors, + logger, + }); + + logger.debug('Starting application server...'); + return await new Promise((resolve, reject) => { + const server = app.listen(options.port, (err?: Error) => { + if (err) { + reject(err); + return; + } + + logger.info(`Listening on port ${options.port}`); + resolve(server); + }); + }); +} diff --git a/frontend/plugins/identity-backend/src/setupTests.ts b/frontend/plugins/identity-backend/src/setupTests.ts new file mode 100644 index 0000000..3fa7cb0 --- /dev/null +++ b/frontend/plugins/identity-backend/src/setupTests.ts @@ -0,0 +1,17 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +require('jest-fetch-mock').enableMocks(); diff --git a/frontend/plugins/identity-backend/tsconfig.json b/frontend/plugins/identity-backend/tsconfig.json new file mode 100644 index 0000000..015a967 --- /dev/null +++ b/frontend/plugins/identity-backend/tsconfig.json @@ -0,0 +1,15 @@ +{ + "include": ["src"], + "compilerOptions": { + "outDir": "dist", + "incremental": true, + "sourceMap": true, + "declaration": true, + "strict": true, + "target": "es2019", + "module": "commonjs", + "esModuleInterop": true, + "lib": ["es2019"], + "types": ["node", "jest"] + } +} diff --git a/frontend/plugins/lighthouse/.eslintrc.js b/frontend/plugins/lighthouse/.eslintrc.js new file mode 100644 index 0000000..13573ef --- /dev/null +++ b/frontend/plugins/lighthouse/.eslintrc.js @@ -0,0 +1,3 @@ +module.exports = { + extends: [require.resolve('@backstage/cli/config/eslint')], +}; diff --git a/frontend/plugins/lighthouse/README.md b/frontend/plugins/lighthouse/README.md new file mode 100644 index 0000000..337e0f9 --- /dev/null +++ b/frontend/plugins/lighthouse/README.md @@ -0,0 +1,51 @@ +# @backstage/plugin-lighthouse + +A frontend for [lighthouse-audit-service](https://github.com/spotify/lighthouse-audit-service), this plugin allows you to trigger Lighthouse audits on websites and track them over time. + +## Getting Started + +### Use cases + +Google's [Lighthouse](https://developers.google.com/web/tools/lighthouse) auditing tool for websites +is a great open-source resource for benchmarking and improving the accessibility, performance, SEO, and best practices of your site. +At Spotify, we keep track of Lighthouse audit scores over time to look at trends and overall areas for investment. + +This plugin allows you to generate on-demand Lighthouse audits for websites, and to track the trends for the +top-level categories of Lighthouse at a glance. + +In the future, we hope to add support for scheduling audits (which we do internally), as well as allowing +custom runs of Lighthouse to be ingested (for auditing sites that require authentication or some session state). + +### Installation + +To get started, you will need a running instance of [lighthouse-audit-service](https://github.com/spotify/lighthouse-audit-service). +_It's likely you will need to enable CORS when running lighthouse-audit-service. Initialize the app +with the environment variable `LAS_CORS` set to `true`._ + +When you have an instance running that Backstage can hook into, make sure to export the plugin in +your app's [`plugins.ts`](https://github.com/spotify/backstage/blob/master/packages/app/src/plugins.ts) +to enable the plugin: + +```js +import { default as LighthousePlugin } from '@backstage/plugin-lighthouse'; +export LighthousePlugin; +``` + +Then, you need to use the `lighthouseApiRef` exported from the plugin to initialize the Rest API in +your [`apis.ts`](https://github.com/spotify/backstage/blob/master/packages/app/src/apis.ts). + +```js +import { ApiHolder, ApiRegistry } from '@backstage/core'; +import { + lighthouseApiRef, + LighthouseRestApi, +} from '@backstage/plugin-lighthouse'; + +const builder = ApiRegistry.builder(); + +export const lighthouseApi = + new LighthouseRestApi(/* your service url here! */); +builder.add(lighthouseApiRef, lighthouseApi); + +export default builder.build() as ApiHolder; +``` diff --git a/frontend/plugins/lighthouse/dev/index.tsx b/frontend/plugins/lighthouse/dev/index.tsx new file mode 100644 index 0000000..6496fb6 --- /dev/null +++ b/frontend/plugins/lighthouse/dev/index.tsx @@ -0,0 +1,28 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { createDevApp } from '@backstage/dev-utils'; +import { plugin } from '../src/plugin'; +import { lighthouseApiRef, LighthouseRestApi } from '../src'; + +createDevApp() + .registerPlugin(plugin) + .registerApiFactory({ + implements: lighthouseApiRef, + deps: {}, + factory: () => new LighthouseRestApi('http://localhost:3003'), + }) + .render(); diff --git a/frontend/plugins/lighthouse/package.json b/frontend/plugins/lighthouse/package.json new file mode 100644 index 0000000..d8e2b53 --- /dev/null +++ b/frontend/plugins/lighthouse/package.json @@ -0,0 +1,46 @@ +{ + "name": "@backstage/plugin-lighthouse", + "version": "0.1.1-alpha.6", + "main": "dist/index.esm.js", + "main:src": "src/index.ts", + "types": "src/index.ts", + "license": "Apache-2.0", + "private": true, + "scripts": { + "build": "backstage-cli plugin:build", + "lint": "backstage-cli lint", + "test": "backstage-cli test", + "diff": "backstage-cli plugin:diff", + "clean": "backstage-cli clean", + "prepack": "backstage-cli prepack", + "postpack": "backstage-cli postpack", + "start": "backstage-cli plugin:serve" + }, + "dependencies": { + "@backstage/core": "^0.1.1-alpha.6", + "@backstage/theme": "^0.1.1-alpha.6", + "@material-ui/core": "^4.9.1", + "@material-ui/icons": "^4.9.1", + "@material-ui/lab": "4.0.0-alpha.45", + "react": "^16.13.1", + "react-dom": "^16.13.1", + "react-markdown": "^4.3.1", + "react-router-dom": "^5.2.0", + "react-use": "^14.2.0" + }, + "devDependencies": { + "@backstage/cli": "^0.1.1-alpha.6", + "@backstage/dev-utils": "^0.1.1-alpha.6", + "@backstage/test-utils": "^0.1.1-alpha.6", + "@testing-library/jest-dom": "^5.7.0", + "@testing-library/react": "^9.3.2", + "@testing-library/user-event": "^10.2.4", + "@types/jest": "^25.2.2", + "@types/node": "^12.0.0", + "@types/testing-library__jest-dom": "^5.0.4", + "jest-fetch-mock": "^3.0.3" + }, + "files": [ + "dist/**/*.{js,d.ts}" + ] +} diff --git a/frontend/plugins/lighthouse/src/__fixtures__/create-audit-response.json b/frontend/plugins/lighthouse/src/__fixtures__/create-audit-response.json new file mode 100644 index 0000000..d3b9323 --- /dev/null +++ b/frontend/plugins/lighthouse/src/__fixtures__/create-audit-response.json @@ -0,0 +1,6 @@ +{ + "id": "80d92fff-52ec-4ef5-848f-9cec8b383e41", + "url": "https://anchor.fm", + "timeCreated": "2020-03-31T15:34:02.199-04:00", + "status": "RUNNING" +} diff --git a/frontend/plugins/lighthouse/src/__fixtures__/website-list-response.json b/frontend/plugins/lighthouse/src/__fixtures__/website-list-response.json new file mode 100644 index 0000000..e46f464 --- /dev/null +++ b/frontend/plugins/lighthouse/src/__fixtures__/website-list-response.json @@ -0,0 +1,579 @@ +{ + "items": [ + { + "url": "https://anchor.fm", + "audits": [ + { + "id": "80d92fff-52ec-4ef5-848f-9cec8b383e41", + "url": "https://anchor.fm", + "timeCreated": "2020-03-31T15:34:02.199-04:00", + "status": "RUNNING" + } + ], + "lastAudit": { + "id": "80d92fff-52ec-4ef5-848f-9cec8b383e41", + "url": "https://anchor.fm", + "timeCreated": "2020-03-31T15:34:02.199-04:00", + "status": "RUNNING" + } + }, + { + "url": "https://artists.spotify.com/", + "audits": [ + { + "id": "d6389155-6a3c-43d4-8032-f9ae98f663a4", + "url": "https://artists.spotify.com/", + "timeCreated": "2020-03-31T15:31:10.769-04:00", + "timeCompleted": "2020-03-31T15:31:17.311-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.56 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.91 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.62 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.83 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.93 + } + } + } + ], + "lastAudit": { + "id": "d6389155-6a3c-43d4-8032-f9ae98f663a4", + "url": "https://artists.spotify.com/", + "timeCreated": "2020-03-31T15:31:10.769-04:00", + "timeCompleted": "2020-03-31T15:31:17.311-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.56 }, + "seo": { "id": "seo", "title": "SEO", "score": 0.91 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.62 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.83 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.93 + } + } + } + }, + { + "url": "https://spotify.com", + "audits": [ + { + "id": "f471916c-80bc-4a22-93de-f3347835e785", + "url": "https://spotify.com", + "timeCreated": "2020-03-31T15:29:25.68-04:00", + "timeCompleted": "2020-03-31T15:29:33.085-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.9 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.43 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + }, + { + "id": "047f506b-15f8-4eb1-b177-d8e3d0377b85", + "url": "https://spotify.com", + "timeCreated": "2020-03-27T12:58:34.605-04:00", + "timeCompleted": "2020-03-27T12:58:43.842-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.44 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + }, + { + "id": "2e7810fd-fe42-4620-8787-b047b7f6c57a", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:09:59.146-04:00", + "timeCompleted": "2020-03-26T14:10:05.356-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.47 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + }, + { + "id": "0f094aa2-12c6-479e-bb52-fad2b089d5c1", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:02:03.023-04:00", + "timeCompleted": "2020-03-26T14:02:33.336-04:00", + "status": "FAILED" + }, + { + "id": "628d7eb6-e26a-4d1a-9690-adc3c6af1baa", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:00:43.878-04:00", + "timeCompleted": "2020-03-26T14:01:14.203-04:00", + "status": "FAILED" + }, + { + "id": "71b8e012-88fc-49d8-9d88-3b03ef9ec34e", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T13:59:51.243-04:00", + "timeCompleted": "2020-03-26T13:59:51.595-04:00", + "status": "FAILED" + } + ], + "lastAudit": { + "id": "f471916c-80bc-4a22-93de-f3347835e785", + "url": "https://spotify.com", + "timeCreated": "2020-03-31T15:29:25.68-04:00", + "timeCompleted": "2020-03-31T15:29:33.085-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.33 }, + "seo": { "id": "seo", "title": "SEO", "score": 0.9 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.43 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + } + }, + { + "url": "https://www.soundtrap.com/", + "audits": [ + { + "id": "3fba085f-651e-4e09-a368-70998d6594d4", + "url": "https://www.soundtrap.com/", + "timeCreated": "2020-03-31T15:19:48.711-04:00", + "timeCompleted": "2020-03-31T15:19:59.422-04:00", + "status": "FAILED" + } + ], + "lastAudit": { + "id": "3fba085f-651e-4e09-a368-70998d6594d4", + "url": "https://www.soundtrap.com/", + "timeCreated": "2020-03-31T15:19:48.711-04:00", + "timeCompleted": "2020-03-31T15:19:59.422-04:00", + "status": "FAILED" + } + }, + { + "url": "https://backstage.io", + "audits": [ + { + "id": "51211f04-848a-4c54-a891-ce747502958c", + "url": "https://backstage.io", + "timeCreated": "2020-03-30T18:23:24.734-04:00", + "timeCompleted": "2020-03-30T18:23:30.533-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.56 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.98 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.81 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + }, + { + "id": "8a6b32f8-930e-4750-a699-7046a51e7b8e", + "url": "https://backstage.io", + "timeCreated": "2020-03-30T09:34:28.25-04:00", + "timeCompleted": "2020-03-30T09:34:33.275-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.54 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.99 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.81 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + }, + { + "id": "259bf4c9-57ad-479d-8072-06da8956fdf4", + "url": "https://backstage.io", + "timeCreated": "2020-03-27T16:10:13.512-04:00", + "timeCompleted": "2020-03-27T16:10:17.998-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.54 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.99 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.81 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + }, + { + "id": "0c2ce744-019a-42f2-8c61-9b49478a2ecd", + "url": "https://backstage.io", + "timeCreated": "2020-03-27T13:01:21.399-04:00", + "timeCompleted": "2020-03-27T13:01:25.761-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.56 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.99 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.81 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + } + ], + "lastAudit": { + "id": "51211f04-848a-4c54-a891-ce747502958c", + "url": "https://backstage.io", + "timeCreated": "2020-03-30T18:23:24.734-04:00", + "timeCompleted": "2020-03-30T18:23:30.533-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.56 }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.98 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.81 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + } + }, + { + "url": "https://adstudio.spotify.com", + "audits": [ + { + "id": "5c89fad2-96ed-4728-856c-f9fbcfb8244e", + "url": "https://adstudio.spotify.com", + "timeCreated": "2020-03-27T15:29:00.859-04:00", + "timeCompleted": "2020-03-27T15:29:11.014-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.73 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.56 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.84 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + }, + { + "id": "7b68a014-5e23-462c-952c-dae575d9e10c", + "url": "https://adstudio.spotify.com", + "timeCreated": "2020-03-27T15:28:37.319-04:00", + "timeCompleted": "2020-03-27T15:28:47.727-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.73 + }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.55 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.84 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + }, + { + "id": "275ae2d4-4409-45ae-b1dd-91121478cc3c", + "url": "https://adstudio.spotify.com", + "timeCreated": "2020-03-27T12:24:19.422-04:00", + "timeCompleted": "2020-03-27T12:24:30.299-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.74 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.98 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.51 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.84 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + } + ], + "lastAudit": { + "id": "5c89fad2-96ed-4728-856c-f9fbcfb8244e", + "url": "https://adstudio.spotify.com", + "timeCreated": "2020-03-27T15:29:00.859-04:00", + "timeCompleted": "2020-03-27T15:29:11.014-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.73 }, + "seo": { "id": "seo", "title": "SEO", "score": 1 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.56 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.84 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 1 + } + } + } + }, + { + "url": "https://spotify.com/us", + "audits": [ + { + "id": "cac7f052-361f-49ff-9112-c780dd720416", + "url": "https://spotify.com/us", + "timeCreated": "2020-03-27T12:17:41.711-04:00", + "timeCompleted": "2020-03-27T12:17:48.85-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.46 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + } + ], + "lastAudit": { + "id": "cac7f052-361f-49ff-9112-c780dd720416", + "url": "https://spotify.com/us", + "timeCreated": "2020-03-27T12:17:41.711-04:00", + "timeCompleted": "2020-03-27T12:17:48.85-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.33 }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.46 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + } + } + ], + "total": 7, + "limit": 10, + "offset": 0 +} diff --git a/frontend/plugins/lighthouse/src/__fixtures__/website-response.json b/frontend/plugins/lighthouse/src/__fixtures__/website-response.json new file mode 100644 index 0000000..36c0423 --- /dev/null +++ b/frontend/plugins/lighthouse/src/__fixtures__/website-response.json @@ -0,0 +1,118 @@ +{ + "url": "https://spotify.com", + "audits": [ + { + "id": "f471916c-80bc-4a22-93de-f3347835e785", + "url": "https://spotify.com", + "timeCreated": "2020-03-31T15:29:25.68-04:00", + "status": "RUNNING" + }, + { + "id": "047f506b-15f8-4eb1-b177-d8e3d0377b85", + "url": "https://spotify.com", + "timeCreated": "2020-03-27T12:58:34.605-04:00", + "timeCompleted": "2020-03-27T12:58:43.842-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.44 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + }, + { + "id": "2e7810fd-fe42-4620-8787-b047b7f6c57a", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:09:59.146-04:00", + "timeCompleted": "2020-03-26T14:10:05.356-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { + "id": "pwa", + "title": "Progressive Web App", + "score": 0.33 + }, + "seo": { "id": "seo", "title": "SEO", "score": 0.92 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.47 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + }, + { + "id": "0f094aa2-12c6-479e-bb52-fad2b089d5c1", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:02:03.023-04:00", + "timeCompleted": "2020-03-26T14:02:33.336-04:00", + "status": "FAILED" + }, + { + "id": "628d7eb6-e26a-4d1a-9690-adc3c6af1baa", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T14:00:43.878-04:00", + "timeCompleted": "2020-03-26T14:01:14.203-04:00", + "status": "FAILED" + }, + { + "id": "71b8e012-88fc-49d8-9d88-3b03ef9ec34e", + "url": "https://spotify.com", + "timeCreated": "2020-03-26T13:59:51.243-04:00", + "timeCompleted": "2020-03-26T13:59:51.595-04:00", + "status": "FAILED" + } + ], + "lastAudit": { + "id": "f471916c-80bc-4a22-93de-f3347835e785", + "url": "https://spotify.com", + "timeCreated": "2020-03-31T15:29:25.68-04:00", + "timeCompleted": "2020-03-31T15:29:33.085-04:00", + "status": "COMPLETED", + "categories": { + "pwa": { "id": "pwa", "title": "Progressive Web App", "score": 0.33 }, + "seo": { "id": "seo", "title": "SEO", "score": 0.9 }, + "performance": { + "id": "performance", + "title": "Performance", + "score": 0.43 + }, + "accessibility": { + "id": "accessibility", + "title": "Accessibility", + "score": 0.82 + }, + "best-practices": { + "id": "best-practices", + "title": "Best Practices", + "score": 0.86 + } + } + } +} diff --git a/frontend/plugins/lighthouse/src/api.ts b/frontend/plugins/lighthouse/src/api.ts new file mode 100644 index 0000000..0fb2139 --- /dev/null +++ b/frontend/plugins/lighthouse/src/api.ts @@ -0,0 +1,148 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import { ApiRef } from '@backstage/core'; + +export type LighthouseCategoryId = + | 'pwa' + | 'seo' + | 'performance' + | 'accessibility' + | 'best-practices'; + +export interface LighthouseCategoryAbbr { + id: LighthouseCategoryId; + score: number; + title: string; +} + +export interface LASListRequest { + offset?: number; + limit?: number; +} + +export interface LASListResponse { + items: Item[]; + total: number; + offset: number; + limit: number; +} + +interface AuditBase { + id: string; + url: string; + timeCreated: string; +} + +export interface AuditRunning extends AuditBase { + status: 'RUNNING'; +} + +export interface AuditFailed extends AuditBase { + status: 'FAILED'; + timeCompleted: string; +} + +export interface AuditCompleted extends AuditBase { + status: 'COMPLETED'; + timeCompleted: string; + report: Object; + categories: Record; +} + +export type Audit = AuditRunning | AuditFailed | AuditCompleted; + +export interface Website { + url: string; + audits: Audit[]; + lastAudit: Audit; +} + +export type WebsiteListResponse = LASListResponse; + +export interface TriggerAuditPayload { + url: string; + options: { + lighthouseConfig: { + settings: { + emulatedFormFactor: string; + }; + }; + }; +} + +export class FetchError extends Error { + get name(): string { + return this.constructor.name; + } + + static async forResponse(resp: Response): Promise { + return new FetchError( + `Request failed with status code ${ + resp.status + }.\nReason: ${await resp.text()}`, + ); + } +} + +export type LighthouseApi = { + url: string; + getWebsiteList: (listOptions: LASListRequest) => Promise; + getWebsiteForAuditId: (auditId: string) => Promise; + triggerAudit: (payload: TriggerAuditPayload) => Promise; +}; + +export const lighthouseApiRef = new ApiRef({ + id: 'plugin.lighthouse.service', + description: 'Used by the Lighthouse plugin to make requests', +}); + +export class LighthouseRestApi implements LighthouseApi { + constructor(public url: string) {} + + private async fetch(input: string, init?: RequestInit): Promise { + const resp = await fetch(`${this.url}${input}`, init); + if (!resp.ok) throw await FetchError.forResponse(resp); + return await resp.json(); + } + + async getWebsiteList({ limit, offset }: LASListRequest = {}): Promise< + WebsiteListResponse + > { + const params = new URLSearchParams(); + if (typeof limit === 'number') params.append('limit', limit.toString()); + if (typeof offset === 'number') params.append('offset', offset.toString()); + return await this.fetch( + `/v1/websites?${params.toString()}`, + ); + } + + async getWebsiteForAuditId(auditId: string): Promise { + return await this.fetch( + `/v1/audits/${encodeURIComponent(auditId)}/website`, + ); + } + + async triggerAudit(payload: TriggerAuditPayload): Promise { + return await this.fetch('/v1/audits', { + method: 'POST', + body: JSON.stringify(payload), + headers: { + 'Content-Type': 'application/json', + }, + }); + } +} diff --git a/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.test.tsx b/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.test.tsx new file mode 100644 index 0000000..cebab93 --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.test.tsx @@ -0,0 +1,129 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React from 'react'; +import { render } from '@testing-library/react'; +import { wrapInThemedTestApp } from '@backstage/test-utils'; +import { ApiRegistry, ApiProvider } from '@backstage/core'; + +import AuditListTable from './AuditListTable'; +import { + WebsiteListResponse, + lighthouseApiRef, + LighthouseRestApi, +} from '../../api'; +import { formatTime } from '../../utils'; +import mockFetch from 'jest-fetch-mock'; + +import * as data from '../../__fixtures__/website-list-response.json'; + +const websiteListResponse = data as WebsiteListResponse; + +describe('AuditListTable', () => { + let apis: ApiRegistry; + + beforeEach(() => { + apis = ApiRegistry.from([ + [lighthouseApiRef, new LighthouseRestApi('http://lighthouse')], + ]); + mockFetch.mockResponse(JSON.stringify(websiteListResponse)); + }); + + const auditList = (websiteList: WebsiteListResponse) => { + return ( + + + + ); + }; + it('renders the link to each website', () => { + const rendered = render( + wrapInThemedTestApp(auditList(websiteListResponse)), + ); + const link = rendered.queryByText('https://anchor.fm'); + const website = websiteListResponse.items.find( + (w) => w.url === 'https://anchor.fm', + ); + if (!website) + throw new Error('https://anchor.fm must be present in fixture'); + expect(link).toBeInTheDocument(); + expect(link).toHaveAttribute( + 'href', + `/lighthouse/audit/${website.lastAudit.id}`, + ); + }); + + it('renders the dates that are available for a given row', () => { + const rendered = render( + wrapInThemedTestApp(auditList(websiteListResponse)), + ); + const website = websiteListResponse.items.find( + (w) => w.url === 'https://anchor.fm', + ); + if (!website) + throw new Error('https://anchor.fm must be present in fixture'); + expect( + rendered.queryByText(formatTime(website.lastAudit.timeCreated)), + ).toBeInTheDocument(); + }); + + it('renders the status for a given row', async () => { + const rendered = render( + wrapInThemedTestApp(auditList(websiteListResponse)), + ); + + const completed = await rendered.findAllByText('COMPLETED'); + expect(completed).toHaveLength( + websiteListResponse.items.filter( + (w) => w.lastAudit.status === 'COMPLETED', + ).length, + ); + + const failed = await rendered.findAllByText('FAILED'); + expect(failed).toHaveLength( + websiteListResponse.items.filter((w) => w.lastAudit.status === 'FAILED') + .length, + ); + + const running = await rendered.findAllByText('FAILED'); + expect(running).toHaveLength( + websiteListResponse.items.filter((w) => w.lastAudit.status === 'RUNNING') + .length, + ); + }); + + describe('sparklines', () => { + it('correctly maps the data from the website payload', () => { + const rendered = render( + wrapInThemedTestApp(auditList(websiteListResponse)), + ); + const backstageSEO = rendered.getByTitle( + 'trendline for SEO category of https://backstage.io', + ); + expect(backstageSEO).toBeInTheDocument(); + }); + + it('does not break when no data is available', () => { + const rendered = render( + wrapInThemedTestApp(auditList(websiteListResponse)), + ); + const anchorSEO = rendered.queryByTitle( + 'trendline for SEO category of https://anchor.fm', + ); + expect(anchorSEO).not.toBeInTheDocument(); + }); + }); +}); diff --git a/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.tsx b/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.tsx new file mode 100644 index 0000000..20dd1f3 --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditList/AuditListTable.tsx @@ -0,0 +1,124 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC, useState } from 'react'; +import { Table, TableColumn, TrendLine, useApi } from '@backstage/core'; +import { Website, lighthouseApiRef } from '../../api'; +import { useInterval } from 'react-use'; +import { + formatTime, + CATEGORIES, + CATEGORY_LABELS, + buildSparklinesDataForItem, +} from '../../utils'; +import { Link } from '@material-ui/core'; +import AuditStatusIcon from '../AuditStatusIcon'; + +const columns: TableColumn[] = [ + { + title: 'Website URL', + field: 'websiteUrl', + }, + ...CATEGORIES.map((category) => ({ + title: CATEGORY_LABELS[category], + field: category, + })), + { + title: 'Last Report', + field: 'lastReport', + cellStyle: { + whiteSpace: 'nowrap', + }, + }, + { + title: 'Last Audit Triggered', + field: 'lastAuditTriggered', + cellStyle: { + minWidth: 120, + }, + }, +]; + +export const AuditListTable: FC<{ items: Website[] }> = ({ items }) => { + const [websiteState, setWebsiteState] = useState(items); + const lighthouseApi = useApi(lighthouseApiRef); + + const runRefresh = (websites: Website[]) => { + websites.forEach(async (website) => { + const response = await lighthouseApi.getWebsiteForAuditId( + website.lastAudit.id, + ); + const auditStatus = response.lastAudit.status; + if (auditStatus === 'COMPLETED' || auditStatus === 'FAILED') { + const newWebsiteData = websiteState.slice(0); + newWebsiteData[ + newWebsiteData.findIndex((w) => w.url === response.url) + ] = response; + setWebsiteState(newWebsiteData); + } + }); + }; + + const runningWebsiteAudits = websiteState + ? websiteState.filter((website) => website.lastAudit.status === 'RUNNING') + : []; + + useInterval( + () => runRefresh(runningWebsiteAudits), + runningWebsiteAudits.length > 0 ? 5000 : null, + ); + + const data = websiteState.map((website) => { + const trendlineData = buildSparklinesDataForItem(website); + const trendlines: any = {}; + CATEGORIES.forEach((category) => { + trendlines[category] = ( + + ); + }); + + return { + websiteUrl: ( + + {website.url} + + ), + ...trendlines, + lastReport: ( + <> + {' '} + {website.lastAudit.status.toUpperCase()} + + ), + lastAuditTriggered: formatTime(website.lastAudit.timeCreated), + }; + }); + + return ( + + ); +}; + +export default AuditListTable; diff --git a/frontend/plugins/lighthouse/src/components/AuditList/index.test.tsx b/frontend/plugins/lighthouse/src/components/AuditList/index.test.tsx new file mode 100644 index 0000000..9bd6e98 --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditList/index.test.tsx @@ -0,0 +1,185 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +jest.mock('react-router-dom', () => { + const actual = jest.requireActual('react-router-dom'); + const mocks = { + replace: jest.fn(), + push: jest.fn(), + }; + return { + ...actual, + useHistory: jest.fn(() => mocks), + }; +}); + +import React from 'react'; +import { MemoryRouter } from 'react-router-dom'; +import mockFetch from 'jest-fetch-mock'; +import { render, fireEvent } from '@testing-library/react'; +import { ApiRegistry, ApiProvider } from '@backstage/core'; +import { wrapInThemedTestApp, wrapInTheme } from '@backstage/test-utils'; + +import { + lighthouseApiRef, + LighthouseRestApi, + WebsiteListResponse, +} from '../../api'; +import AuditList from '.'; + +import * as data from '../../__fixtures__/website-list-response.json'; + +const { useHistory } = jest.requireMock('react-router-dom'); +const websiteListResponse = data as WebsiteListResponse; + +describe('AuditList', () => { + let apis: ApiRegistry; + + beforeEach(() => { + apis = ApiRegistry.from([ + [lighthouseApiRef, new LighthouseRestApi('http://lighthouse')], + ]); + mockFetch.mockResponse(JSON.stringify(websiteListResponse)); + }); + + it('should render the table', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + const element = await rendered.findByText('https://anchor.fm'); + expect(element).toBeInTheDocument(); + }); + + it('renders a link to create a new audit', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + const element = await rendered.findByText('Create Audit'); + expect(element).toBeInTheDocument(); + expect(element.parentElement).toHaveAttribute( + 'href', + '/lighthouse/create-audit', + ); + }); + + describe('pagination', () => { + it('requests the correct limit and offset from the api based on the query', () => { + mockFetch.mockClear(); + render( + wrapInTheme( + + + + + , + ), + ); + expect(mockFetch).toHaveBeenLastCalledWith( + 'http://lighthouse/v1/websites?limit=10&offset=10', + undefined, + ); + }); + + describe('when only one page is needed', () => { + it('hides pagination elements', () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + expect(rendered.queryByLabelText(/Go to page/)).not.toBeInTheDocument(); + }); + }); + + describe('when multiple pages are needed', () => { + beforeEach(() => { + const response = { ...websiteListResponse }; + response.limit = 5; + response.offset = 5; + response.total = 7; + mockFetch.mockResponseOnce(JSON.stringify(response)); + }); + + it('shows pagination elements', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + expect( + await rendered.findByLabelText(/Go to page/), + ).toBeInTheDocument(); + }); + + it('changes the page on click', async () => { + const rendered = render( + wrapInTheme( + + + + + , + ), + ); + const element = await rendered.findByLabelText(/Go to page 1/); + fireEvent.click(element); + expect(useHistory().replace).toHaveBeenCalledWith(`/lighthouse?page=1`); + }); + }); + }); + + describe('when waiting on the request', () => { + it('should render the loader', async () => { + mockFetch.mockResponseOnce(() => new Promise(() => {})); + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + const element = await rendered.findByTestId('progress'); + expect(element).toBeInTheDocument(); + }); + }); + + describe('when the audits fail', () => { + it('should render an error', async () => { + mockFetch.mockRejectOnce(new Error('failed to fetch')); + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + const element = await rendered.findByTestId('error-message'); + expect(element).toBeInTheDocument(); + }); + }); +}); diff --git a/frontend/plugins/lighthouse/src/components/AuditList/index.tsx b/frontend/plugins/lighthouse/src/components/AuditList/index.tsx new file mode 100644 index 0000000..85be31c --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditList/index.tsx @@ -0,0 +1,130 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +import React, { useState, useMemo, FC, ReactNode } from 'react'; +import { useLocalStorage, useAsync } from 'react-use'; +import { useHistory } from 'react-router-dom'; +import { Grid, Button } from '@material-ui/core'; +import Alert from '@material-ui/lab/Alert'; +import Pagination from '@material-ui/lab/Pagination'; +import { + InfoCard, + Header, + Page, + Content, + ContentHeader, + HeaderLabel, + Progress, + pageTheme, + useApi, +} from '@backstage/core'; + +import { lighthouseApiRef, WebsiteListResponse } from '../../api'; +import { useQuery } from '../../utils'; +import LighthouseSupportButton from '../SupportButton'; +import LighthouseIntro, { LIGHTHOUSE_INTRO_LOCAL_STORAGE } from '../Intro'; +import AuditListTable from './AuditListTable'; + +export const LIMIT = 10; + +const AuditList: FC<{}> = () => { + const [dismissedStored] = useLocalStorage(LIGHTHOUSE_INTRO_LOCAL_STORAGE); + const [dismissed, setDismissed] = useState(dismissedStored); + + const query = useQuery(); + const page = query.get('page') + ? parseInt(query.get('page') as string, 10) || 1 + : 1; + + const lighthouseApi = useApi(lighthouseApiRef); + const { value, loading, error } = useAsync( + async () => + await lighthouseApi.getWebsiteList({ + limit: LIMIT, + offset: (page - 1) * LIMIT, + }), + [page], + ); + + const pageCount: number = useMemo(() => { + if (value?.total && value?.limit) + return Math.ceil(value?.total / value?.limit); + return 0; + }, [value]); + + const history = useHistory(); + + let content: ReactNode = null; + if (value) { + content = ( + <> + + {pageCount > 1 && ( + { + history.replace(`/lighthouse?page=${newPage}`); + }} + /> + )} + + ); + } else if (loading) { + content = ; + } else if (error) { + content = ( + + {error.message} + + ); + } + + return ( + +
+ + +
+ + setDismissed(true)} /> + + + {dismissed && } + + + + {content} + + + +
+ ); +}; + +export default AuditList; diff --git a/frontend/plugins/lighthouse/src/components/AuditStatusIcon/index.tsx b/frontend/plugins/lighthouse/src/components/AuditStatusIcon/index.tsx new file mode 100644 index 0000000..bce917d --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditStatusIcon/index.tsx @@ -0,0 +1,27 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { FC } from 'react'; +import { StatusPending, StatusError, StatusOK } from '@backstage/core'; + +import { Audit } from '../../api'; + +const AuditStatusIcon: FC<{ audit: Audit }> = ({ audit }) => { + if (audit.status === 'FAILED') return ; + if (audit.status === 'COMPLETED') return ; + return ; +}; + +export default AuditStatusIcon; diff --git a/frontend/plugins/lighthouse/src/components/AuditView/index.test.tsx b/frontend/plugins/lighthouse/src/components/AuditView/index.test.tsx new file mode 100644 index 0000000..330b885 --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditView/index.test.tsx @@ -0,0 +1,226 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +/* eslint-disable jest/no-disabled-tests */ + +jest.mock('react-router-dom', () => { + const actual = jest.requireActual('react-router-dom'); + return { + ...actual, + useParams: jest.fn(() => ({})), + }; +}); + +import React from 'react'; +import mockFetch from 'jest-fetch-mock'; +import { render } from '@testing-library/react'; +import { wrapInThemedTestApp } from '@backstage/test-utils'; +import { ApiRegistry, ApiProvider } from '@backstage/core'; + +import AuditView from '.'; +import { lighthouseApiRef, LighthouseRestApi, Audit, Website } from '../../api'; +import { formatTime } from '../../utils'; +import * as data from '../../__fixtures__/website-response.json'; + +const { useParams }: { useParams: jest.Mock } = jest.requireMock( + 'react-router-dom', +); +const websiteResponse = data as Website; + +describe('AuditView', () => { + let apis: ApiRegistry; + let id: string; + + beforeEach(() => { + mockFetch.mockResponse(JSON.stringify(websiteResponse)); + apis = ApiRegistry.from([ + [lighthouseApiRef, new LighthouseRestApi('https://lighthouse')], + ]); + id = websiteResponse.audits.find((a) => a.status === 'COMPLETED') + ?.id as string; + useParams.mockReturnValue({ id }); + }); + + it('renders the iframe for the selected audit', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + const iframe = await rendered.findByTitle( + 'Lighthouse audit for https://spotify.com', + ); + expect(iframe).toBeInTheDocument(); + expect(iframe).toHaveAttribute('src', `https://lighthouse/v1/audits/${id}`); + }); + + it('renders a link to create a new audit for this website', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + const button = await rendered.findByText('Create Audit'); + expect(button).toBeInTheDocument(); + expect(button.parentElement).toHaveAttribute( + 'href', + `/lighthouse/create-audit?url=${encodeURIComponent( + 'https://spotify.com', + )}`, + ); + }); + + describe('sidebar', () => { + it('renders a list of all audits for the website', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + await rendered.findByTestId('audit-sidebar'); + + websiteResponse.audits.forEach((a) => { + expect( + rendered.queryByText(formatTime(a.timeCreated)), + ).toBeInTheDocument(); + }); + }); + + it('sets the current audit as active', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + await rendered.findByTestId('audit-sidebar'); + + const audit = websiteResponse.audits.find((a) => a.id === id) as Audit; + const auditElement = rendered.getByText(formatTime(audit.timeCreated)); + expect(auditElement.parentElement?.parentElement?.className).toContain( + 'selected', + ); + + const notSelectedAudit = websiteResponse.audits.find( + (a) => a.id !== id, + ) as Audit; + const notSelectedAuditElement = rendered.getByText( + formatTime(notSelectedAudit.timeCreated), + ); + expect( + notSelectedAuditElement.parentElement?.parentElement?.className, + ).not.toContain('selected'); + }); + + it('navigates to the next report when an audit is clicked', async () => { + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + await rendered.findByTestId('audit-sidebar'); + + websiteResponse.audits.forEach((a) => { + expect( + rendered.getByText(formatTime(a.timeCreated)).parentElement + ?.parentElement, + ).toHaveAttribute('href', `/lighthouse/audit/${a.id}`); + }); + }); + }); + + describe('when the request for the website by id is pending', () => { + it('it shows the loading', async () => { + mockFetch.mockImplementationOnce(() => new Promise(() => {})); + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + expect(await rendered.findByTestId('progress')).toBeInTheDocument(); + }); + }); + + describe('when the request for the website by id fails', () => { + it('it shows an error', async () => { + mockFetch.mockRejectOnce(new Error('failed to fetch')); + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + expect(await rendered.findByText('failed to fetch')).toBeInTheDocument(); + }); + }); + + describe.skip('when a loading audit is accessed', () => { + it('shows a loading view', async () => { + id = websiteResponse.audits.find((a) => a.status === 'RUNNING') + ?.id as string; + useParams.mockReturnValueOnce({ id }); + + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + await rendered.findByTestId('audit-sidebar'); + + expect(rendered.queryByTestId('progress')).toBeInTheDocument(); + }); + }); + + describe.skip('when a failed audit is accessed', () => { + it('shows an error message', async () => { + id = websiteResponse.audits.find((a) => a.status === 'FAILED') + ?.id as string; + useParams.mockReturnValueOnce({ id }); + + const rendered = render( + wrapInThemedTestApp( + + + , + ), + ); + + await rendered.findByTestId('audit-sidebar'); + + expect(rendered.queryByText(/This audit failed/)).toBeInTheDocument(); + }); + }); +}); diff --git a/frontend/plugins/lighthouse/src/components/AuditView/index.tsx b/frontend/plugins/lighthouse/src/components/AuditView/index.tsx new file mode 100644 index 0000000..889c6c5 --- /dev/null +++ b/frontend/plugins/lighthouse/src/components/AuditView/index.tsx @@ -0,0 +1,191 @@ +/* + * Copyright 2020 Spotify AB + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +import React, { useState, useEffect, ReactNode, FC } from 'react'; +import { Link, useParams } from 'react-router-dom'; +import { useAsync } from 'react-use'; +import { + makeStyles, + Button, + Grid, + List, + ListItem, + ListItemIcon, + ListItemText, +} from '@material-ui/core'; +import Alert from '@material-ui/lab/Alert'; +import { + useApi, + pageTheme, + InfoCard, + Header, + Page, + Content, + ContentHeader, + HeaderLabel, + Progress, +} from '@backstage/core'; + +import { lighthouseApiRef, Website, Audit } from '../../api'; +import AuditStatusIcon from '../AuditStatusIcon'; +import LighthouseSupportButton from '../SupportButton'; +import { formatTime } from '../../utils'; + +const useStyles = makeStyles({ + contentGrid: { + height: '100%', + }, + iframe: { + border: '0', + width: '100%', + height: '100%', + }, + errorOutput: { whiteSpace: 'pre' }, +}); + +interface AuditLinkListProps { + audits?: Audit[]; + selectedId: string; +} +const AuditLinkList: FC = ({ + audits = [], + selectedId, +}: AuditLinkListProps) => ( + + {audits.map((audit) => ( + + + + + + + ))} + +); + +const AuditView: FC<{ audit?: Audit }> = ({ audit }: { audit?: Audit }) => { + const classes = useStyles(); + const params = useParams<{ id: string }>(); + const { url: lighthouseUrl } = useApi(lighthouseApiRef); + + if (audit?.status === 'RUNNING') return ; + if (audit?.status === 'FAILED') + return ( + + This audit failed when attempting to run after several retries. Check + that your instance of lighthouse-audit-service can successfully connect + to your website and try again. + + ); + + return ( + +