|
| 1 | +# MolHighlighter |
| 2 | + |
| 3 | +[](https://www.rdkit.org/) |
| 4 | + |
| 5 | +Fancy colored substructure highlights with labels |
| 6 | + |
| 7 | +<p float="left"> |
| 8 | + <img alt="Paired highlight of IUPAC name" height="200" src="assets/iupac_highlight.png"/> |
| 9 | + <img alt="Paired highlight of SMILES string" height="200" src="assets/smiles_highlight.png"/> |
| 10 | +</p> |
| 11 | + |
| 12 | +## 🐍 Installation |
| 13 | + |
| 14 | +```python |
| 15 | +pip install git+https://github.com/cbouy/molhighlighter.git |
| 16 | +``` |
| 17 | + |
| 18 | +## 📜 Usage |
| 19 | + |
| 20 | +### Simple substructure highlight |
| 21 | + |
| 22 | +```python |
| 23 | +from rdkit import Chem |
| 24 | +from molhighlighter import MH, Highlight |
| 25 | + |
| 26 | +mol = Chem.MolFromSmiles("C1=CC(=CC=C1N=NC2=CC=C(C=C2)Br)O") |
| 27 | + |
| 28 | +highlights = [ |
| 29 | + Highlight.from_smarts(mol, "c1ccccc1Br", "#93e467", fill_ring=True), |
| 30 | + Highlight.from_smarts(mol, "N=N", "#e36262"), |
| 31 | + Highlight.from_smarts(mol, "c1ccccc1O", "#62d4e3", True), |
| 32 | +] |
| 33 | +MH(mol, highlights).display() |
| 34 | +``` |
| 35 | + |
| 36 | +### Substructure highlight paired with label highlighting |
| 37 | + |
| 38 | +```python |
| 39 | +from rdkit import Chem |
| 40 | +from molhighlighter import LMH, LabelledHighlight |
| 41 | + |
| 42 | +mol = Chem.MolFromSmiles("C1=CC(=CC=C1N=NC2=CC=C(C=C2)Br)O") |
| 43 | +name = "4-[(4-bromophenyl)diazenyl]phenol" |
| 44 | + |
| 45 | +highlights = [ |
| 46 | + Highlight.from_smarts(mol, "c1ccccc1Br", "#93e467", fill_ring=True), |
| 47 | + Highlight.from_smarts(mol, "N=N", "#e36262"), |
| 48 | + Highlight.from_smarts(mol, "c1ccccc1O", "#62d4e3", True), |
| 49 | +] |
| 50 | +LMH(name, mol, highlights).display() |
| 51 | +``` |
| 52 | + |
| 53 | +See the [demo notebook](demo.ipynb) for more info |
| 54 | + |
| 55 | +## ⚖ License |
| 56 | + |
| 57 | +Unless otherwise noted, all files in this directory and all subdirectories are distributed under the Apache License, Version 2.0: |
| 58 | +```text |
| 59 | + Copyright 2022 Cédric BOUYSSET |
| 60 | +
|
| 61 | + Licensed under the Apache License, Version 2.0 (the "License"); |
| 62 | + you may not use this file except in compliance with the License. |
| 63 | + You may obtain a copy of the License at |
| 64 | +
|
| 65 | + http://www.apache.org/licenses/LICENSE-2.0 |
| 66 | +
|
| 67 | + Unless required by applicable law or agreed to in writing, software |
| 68 | + distributed under the License is distributed on an "AS IS" BASIS, |
| 69 | + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| 70 | + See the License for the specific language governing permissions and |
| 71 | + limitations under the License. |
| 72 | +``` |
0 commit comments